6 Commits

Author SHA1 Message Date
shahondin1624
b339c10ca0 feat: use Worte/Weise labels and render metadata at page bottom (Closes #5)
Add metadata_labels ("abbreviated"/"german") and metadata_position
("top"/"bottom") options to LayoutConfig. German labels use "Worte:" and
"Weise:" instead of "T:" and "M:", with "Worte und Weise:" when lyricist
and composer are the same person. Metadata at bottom position renders
after notes with word-wrapping. MeasurementEngine accounts for two-line
metadata in German label mode.

Co-Authored-By: Claude Opus 4.6 <noreply@anthropic.com>
2026-03-17 09:46:06 +01:00
shahondin1624
8dca7d7131 feat: support inline images within song pages (Closes #2)
Add {image: path} directive to embed images at any position within a song's
sections. SongLine gains an optional imagePath field; when set, the line
represents an inline image rather than chord/lyric content. The renderer
scales and centers images within the content width. MeasurementEngine
reserves 40mm height per inline image for layout calculations.

Co-Authored-By: Claude Opus 4.6 <noreply@anthropic.com>
2026-03-17 09:45:26 +01:00
shahondin1624
8c92c7d78b feat: support rich multi-paragraph notes with formatting (Closes #7)
Add {start_of_notes}/{end_of_notes} (and short forms {son}/{eon}) block
directives to ChordProParser for multi-paragraph note content. Blank lines
within the block separate paragraphs. The renderer now word-wraps note
paragraphs to fit within the content width. MeasurementEngine estimates
wrapped line count for more accurate height calculations.

Co-Authored-By: Claude Opus 4.6 <noreply@anthropic.com>
2026-03-17 09:38:25 +01:00
shahondin1624
0139327034 feat: highlight the current book's column in the TOC (Closes #6)
Add TocConfig with highlightColumn field to BookConfig. TocRenderer now
applies a light gray background shading to the designated column header
and data cells, making it easy to visually distinguish the current book's
page numbers from reference book columns.

Co-Authored-By: Claude Opus 4.6 <noreply@anthropic.com>
2026-03-17 09:35:47 +01:00
shahondin1624
ba035159f7 feat: display reference book page numbers in song page footer (Closes #3)
Render a two-row footer at the bottom of each song page showing reference
book abbreviations as column headers with corresponding page numbers below.
A thin separator line is drawn above the footer. MeasurementEngine now
reserves vertical space for the reference footer when reference books are
configured and the song has references.

Co-Authored-By: Claude Opus 4.6 <noreply@anthropic.com>
2026-03-17 09:32:52 +01:00
shahondin1624
8e4728c55a feat: add support for foreword/preface pages (Closes #1)
Add ForewordConfig to BookConfig, Foreword model type, ForewordParser for
text files (quote/paragraphs/signatures), ForewordPage in PageContent,
pipeline integration to insert foreword after TOC, and PDF rendering with
styled quote, horizontal rule separator, word-wrapped paragraphs, and
right-aligned signatures.

Also adds Gradle wrapper and adjusts build toolchain for JDK 25 compat.

Co-Authored-By: Claude Opus 4.6 <noreply@anthropic.com>
2026-03-17 09:27:00 +01:00
368 changed files with 6499 additions and 15982 deletions

37
.gitignore vendored
View File

@@ -1,29 +1,22 @@
# LaTeX build artifacts
*.aux
*.log
*.out
*.toc
*.fls
*.fdb_latexmk
*.synctex.gz
*.synctex(busy)
*.sxd
*.sxc
# Gradle
.gradle/
build/
buildSrc/build/
# Output directory
output/
# OS files
.DS_Store
Thumbs.db
# Editor files
# IDE
.idea/
*.iml
.vscode/
*~
*.swp
# OS
.DS_Store
Thumbs.db
# Output
output/
# Kotlin
*.class
# Claude
.claude/
__pycache__/

118
CLAUDE.md
View File

@@ -2,83 +2,79 @@
This file provides guidance to Claude Code (claude.ai/code) when working with code in this repository.
## Build Commands
## Build & Test Commands
```bash
# Build the songbook PDF (two-pass for TOC)
make
# Build everything
gradle build
# Remove auxiliary files
make clean
# Run all tests
gradle test
# Remove everything including PDF
make distclean
# Run tests for a specific module
gradle :parser:test
gradle :layout:test
gradle :renderer-pdf:test
gradle :app:test
# Run a single test class
gradle :parser:test --tests ChordProParserTest
# Run a single test method
gradle :parser:test --tests "ChordProParserTest.parse complete song"
# Build and run CLI
gradle :cli:run --args="build -d /path/to/project"
gradle :cli:run --args="validate -d /path/to/project"
# Launch GUI
gradle :gui:run
```
Requires LuaLaTeX (TeX Live) and the `leadsheets` package.
Requires Java 21 (configured in `gradle.properties`). Kotlin 2.1.10, Gradle 9.3.1.
## Project Structure
## Architecture
**Pipeline:** Parse → Measure → Paginate → Render
`SongbookPipeline` (in `app`) orchestrates the full flow:
1. `ConfigParser` reads `songbook.yaml``BookConfig`
2. `ChordProParser` reads `.chopro` files → `Song` objects
3. `Validator` checks config and songs
4. `MeasurementEngine` calculates each song's height in mm using `FontMetrics`
5. `TocGenerator` estimates TOC page count and creates entries
6. `PaginationEngine` arranges songs into pages (greedy spread packing)
7. `PdfBookRenderer` generates the PDF via OpenPDF
**Module dependency graph:**
```
songbook.tex # Main document (title page, TOC, song inputs)
songbook-style.sty # Style package (geometry, fonts, leadsheets config)
songs/ # One .tex file per song
fonts/ # Font files (UnifrakturMaguntia for titles)
images/ # Filler images (empty for now)
Makefile # Build rules (lualatex, two passes)
output/ # Generated PDF (gitignored)
model ← parser
model ← layout
model ← renderer-pdf
parser, layout, renderer-pdf ← app
app ← cli (Clikt)
app, parser ← gui (Compose Desktop)
```
## How It Works
`model` is the foundation with no dependencies — all data classes, the `FontMetrics` interface, and the `BookRenderer` interface live here. The `FontMetrics` abstraction decouples layout from rendering: `PdfFontMetrics` is the real implementation (in renderer-pdf), `StubFontMetrics` is used in layout tests.
Pure LaTeX songbook using the `leadsheets` package with LuaLaTeX. The style matches the Carmina Leonis songbook format:
- Song titles in Fraktur/blackletter font (UnifrakturMaguntia)
- Chords above lyrics in regular weight, black
- No verse labels (verses separated by blank lines)
- Metadata (Worte/Weise) at bottom of each song page
- Reference book cross-references (MO, PfLB) in footer
- Each song starts on a new page
- A5 twoside format with page numbers at bottom-outer
**Pagination constraint:** Songs spanning 2 pages must start on a left (even) page. The `PaginationEngine` inserts filler images or blank pages to enforce this.
## Key Types
- `Song` → sections → `SongLine``LineSegment(chord?, text)` — chord is placed above the text segment
- `PageContent` — sealed class: `SongPage`, `FillerImage`, `BlankPage`
- `SectionType` — enum: `VERSE`, `CHORUS`, `BRIDGE`, `REPEAT`
- `BuildResult` — returned by `SongbookPipeline.build()` with success/errors/counts
## Song Format
Each song uses the `leadsheets` `song` environment:
ChordPro-compatible `.chopro` files: directives in `{braces}`, chords in `[brackets]` inline with lyrics, comments with `#`. See `songs/` for examples.
```latex
\begin{song}{
title = Song Title,
lyrics = Lyricist,
composer = Composer,
key = G,
mundorgel = 42,
pfadfinderliederbuch = 118,
note = {Optional note text.},
}
## Test Patterns
\begin{verse}
\chord{G}Lyrics with \chord{D}chords above. \\
Next \chord{C}line here.
\end{verse}
Tests use `kotlin.test` annotations with Kotest assertions (`shouldBe`, `shouldHaveSize`, etc.) on JUnit 5. Layout tests use `StubFontMetrics` to avoid PDF font dependencies. App integration tests create temp directories with song files and config.
\begin{verse}
Second verse without chords (or with).
\end{verse}
## Package
\end{song}
```
**Important constraints:**
- Use `\\` for line breaks within verses (not blank lines)
- Never place two `\chord{}` commands without a space between them — split compound words with a hyphen: `\chord{D}Abend- \chord{A}zeit.`
- Custom properties: `alias`, `note`, `mundorgel`, `pfadfinderliederbuch`
- Verse types: `verse` (no label), `verse*` (for custom-labeled sections like Kanon, Ref.)
- `musicsymbols` library skipped (requires `musix11` font not installed)
## Style Details (songbook-style.sty)
- Page geometry: A5, margins (top 15mm, bottom 20mm, inner 20mm, outer 12mm)
- Body font: TeX Gyre Heros (Helvetica clone)
- Title font: UnifrakturMaguntia (Fraktur/blackletter, from `fonts/` directory)
- Chord format: small, regular weight, black
- Song title template: Fraktur title only (metadata rendered at bottom via `after-song` hook)
- Reference style based on Carmina Leonis (Pfadfinder scout songbook)
All code under `de.pfadfinder.songbook.*` — subpackages match module names (`.model`, `.parser`, `.layout`, `.renderer.pdf`, `.app`, `.cli`, `.gui`).

View File

@@ -1,23 +0,0 @@
MAIN = songbook
ENGINE = lualatex
OUTDIR = output
FLAGS = --output-directory=$(OUTDIR) --interaction=nonstopmode
.PHONY: all clean distclean
all: $(OUTDIR)/$(MAIN).pdf
$(OUTDIR):
mkdir -p $(OUTDIR)
$(OUTDIR)/$(MAIN).pdf: $(MAIN).tex songbook-style.sty songs/*.tex | $(OUTDIR)
TEXINPUTS=.:$(shell pwd):$(shell pwd)/$(OUTDIR): $(ENGINE) $(FLAGS) $(MAIN).tex
TEXINPUTS=.:$(shell pwd):$(shell pwd)/$(OUTDIR): $(ENGINE) $(FLAGS) $(MAIN).tex
clean:
rm -f $(OUTDIR)/*.aux $(OUTDIR)/*.log $(OUTDIR)/*.out \
$(OUTDIR)/*.toc $(OUTDIR)/*.fls $(OUTDIR)/*.fdb_latexmk \
$(OUTDIR)/*.sxd $(OUTDIR)/*.sxc $(OUTDIR)/*.songtoc
distclean: clean
rm -f $(OUTDIR)/$(MAIN).pdf

View File

@@ -1,298 +0,0 @@
% Auto-generated list of all songs (alphabetical order)
% Generated by import-songs.py
\input{songs/abends-gehn-die-liebespaare}
\input{songs/abends-treten-elche}
\input{songs/abends-wenn-das-tageslicht}
\input{songs/ade-nun-zur-guten-nacht}
\input{songs/alle-strassen}
\input{songs/alle-die-mit-uns-auf-kaperfahrt}
\input{songs/allzeit-bereit-bundeslied-der-cpd}
\input{songs/almost-heaven}
\input{songs/als-wir-nach-frankreich}
\input{songs/als-wir-noch-knaben-waren}
\input{songs/am-alten-hafen-piratenhafen}
\input{songs/am-brunnen-vor-dem-tore}
\input{songs/am-ural}
\input{songs/am-westermanns-loenstief}
\input{songs/an-de-eck}
\input{songs/an-land}
\input{songs/andre-die-das-land}
\input{songs/auf-vielen-strassen}
\input{songs/balkanlied}
\input{songs/ballade-von-bergen}
\input{songs/ballade-von-der-gemeinsamen-zeit-vorspiel-d-a-d-g}
\input{songs/banner}
\input{songs/bella-ciao}
\input{songs/big-bomb-dolly-aus-dover}
\input{songs/bin-ja-nur-ein-armer-zigeuner}
\input{songs/birkenring}
\input{songs/bis-in-die-roten-morgenstunden}
\input{songs/brennt-die-sonne}
\input{songs/bruder-nun-wird-es-abend}
\input{songs/burschen-burschen}
\input{songs/buendische-vaganten}
\input{songs/buergerlied}
\input{songs/come-by-the-hills}
\input{songs/das-gotenlied}
\input{songs/das-leben}
\input{songs/das-lilienbanner}
\input{songs/das-schiff-im-nebel}
\input{songs/dat-du-min-leewsten-buest}
\input{songs/dein-ist-dein-leben-vorspiel-e-c-g-d}
\input{songs/der-da-vorn-so-laut}
\input{songs/der-geist-der-fahrt}
\input{songs/der-geist-ist-mued}
\input{songs/der-holzschuhmann}
\input{songs/der-kirchenmausrock}
\input{songs/der-kleine-troll}
\input{songs/der-lang-genug}
\input{songs/der-mond-ist-aufgegangen}
\input{songs/der-papagei-ein-vogel-ist}
\input{songs/der-pfahl}
\input{songs/der-rabe}
\input{songs/der-tag-begann}
\input{songs/der-tod-reit-auf}
\input{songs/der-wagen}
\input{songs/der-zug-faehrt-auf}
\input{songs/die-affen-rasen}
\input{songs/die-ballade-vom-roten-haar}
\input{songs/die-blauen-dragoner}
\input{songs/die-daemmerung-faellt}
\input{songs/die-eisenfaust}
\input{songs/die-freie-republik}
\input{songs/die-gedanken}
\input{songs/die-glocken}
\input{songs/die-grauen-nebel}
\input{songs/die-herren-waren-bei-laune}
\input{songs/die-klampfen-erklingen}
\input{songs/die-lappen-hoch}
\input{songs/die-mazurka}
\input{songs/die-nacht-ist-nicht-allein-zum-schlafen-da}
\input{songs/die-roten-fahnen}
\input{songs/die-sandbank}
\input{songs/die-schluchten-des-balkan}
\input{songs/die-sonne-geht}
\input{songs/die-strasse-gleitet}
\input{songs/die-trommel-her}
\input{songs/die-weber}
\input{songs/die-zunft-der-strassenbrueder}
\input{songs/dort-an-dem-ueferchen}
\input{songs/drei-rote-pfiffe}
\input{songs/drei-tropfen-blut-chume-geselle}
\input{songs/du-machst-kleinholz}
\input{songs/durch-die-morgenroten-scheiben}
\input{songs/daemmert-von-fern}
\input{songs/edelweisspiraten}
\input{songs/eh-die-sonne}
\input{songs/ein-hase-sass-im-tiefen-tal}
\input{songs/ein-hotdog-unten-am-hafen}
\input{songs/ein-kleiner-matrose}
\input{songs/ein-landsknecht}
\input{songs/ein-neuer-tag-beginnt}
\input{songs/ein-stolzes-schiff}
\input{songs/eines-morgens-partisanenlied}
\input{songs/eines-morgens-ging}
\input{songs/einst-macht-ich}
\input{songs/endlich-trocknet-der-landstrasse}
\input{songs/endlos-lang}
\input{songs/endlos-sind-jene-strassen}
\input{songs/ensemble-on-est-mieux-intro-e-a-c-h7}
\input{songs/erklingen-leise-lieder}
\input{songs/es-dunkelt-schon}
\input{songs/es-gibt-nur-wasser}
\input{songs/es-ist-an-der-zeit}
\input{songs/es-ist-ein-schnitter}
\input{songs/es-liegen-drei-glaenzende-kugeln}
\input{songs/es-liegt-etwas-auf-den-strassen}
\input{songs/es-soll-sich-der-mensch}
\input{songs/es-tropft-von-helm-und-saebel}
\input{songs/es-war-an-einem-sommertag}
\input{songs/es-war-ein-koenig}
\input{songs/es-war-in-einer-regennacht}
\input{songs/es-wollt-ein-maegdlein}
\input{songs/falado}
\input{songs/fields-of-athenry}
\input{songs/finnlandlied}
\input{songs/fordre-niemand}
\input{songs/fresenhof}
\input{songs/freunde-das-leben-seid-ihr}
\input{songs/frueher-da-war-ich}
\input{songs/fruehling-dringt-in-den-norden}
\input{songs/geburtstagslied}
\input{songs/gehe-nicht-o-gregor}
\input{songs/gelbe-blaetter-fallen-im-wind}
\input{songs/gestern-brueder}
\input{songs/gospodar-dein-grossgut}
\input{songs/griechischer-fruehling}
\input{songs/grosser-gott-wir-loben-dich}
\input{songs/graefin-anne}
\input{songs/gut-wieder-hier-zu-sein}
\input{songs/gute-nacht-kameraden}
\input{songs/hans-spielmann}
\input{songs/hell-strahlt-die-sonne}
\input{songs/heulender-motor}
\input{songs/heute-hier}
\input{songs/hier-waechst-kein-ahorn}
\input{songs/hoch-lebe-der-mann-mit-dem-hut}
\input{songs/hochzeit}
\input{songs/hohe-tannen}
\input{songs/how-many-roads-blowin-in-the-wind}
\input{songs/hymn-intro-e-esus4-e-esus4-e}
\input{songs/hoerst-du-den-wind-bundeslied-der-esm}
\input{songs/ich-kann-dich-sehen}
\input{songs/ich-komme-schon}
\input{songs/ich-komme-dir-zu-sagen-versprechenslied}
\input{songs/ich-moecht-mit-einem-zirkus-ziehn}
\input{songs/ich-reise-uebers-gruene-land}
\input{songs/ich-und-ein-fass-voller-wein}
\input{songs/ich-war-noch-so-jung-bettelvogt}
\input{songs/ihr-huebschen-jungen-reiter}
\input{songs/ihr-woelfe-kommt-und-schliesst-den-kreis}
\input{songs/im-morgennebel}
\input{songs/in-dem-dunklem-wald-von-paganovo}
\input{songs/in-des-waldes-lola}
\input{songs/in-die-sonne}
\input{songs/in-junkers-kneipe}
\input{songs/islandlied}
\input{songs/jalava-lied}
\input{songs/jasmin}
\input{songs/jauchzende-jungen}
\input{songs/jeden-abend-jerchenkow}
\input{songs/jenseits-des-tales}
\input{songs/jubilaeumslied-der-esm}
\input{songs/joerg-von-frundsberg}
\input{songs/kaffee-und-karin}
\input{songs/kameraden-jagt-die-pferde}
\input{songs/kameraden-wann-sehen-wir-uns-wieder}
\input{songs/karl-der-kaefer}
\input{songs/kein-schoener-land}
\input{songs/klingt-ein-lied-durch-die-nacht-piratenlied}
\input{songs/kommt-ihr-menschen}
\input{songs/komodowaran-intro-ad7g-ad7g}
\input{songs/land-der-dunklen-waelder}
\input{songs/lasst-die-banner}
\input{songs/leave-her-johnny}
\input{songs/leut-die-leut}
\input{songs/lord-of-the-dance}
\input{songs/laender-fahrten-abenteuer}
\input{songs/loewen-sind-jetzt-los}
\input{songs/man-sagt}
\input{songs/meersalz-seht}
\input{songs/mein-ganzes-leben}
\input{songs/mein-kleines-boot}
\input{songs/meine-sonne-will-ich-fragen}
\input{songs/michel-warum-weinest-du}
\input{songs/miners-song}
\input{songs/molly-malone}
\input{songs/moorsoldaten}
\input{songs/maedchen-maenner-meister}
\input{songs/nacht-in-portugal}
\input{songs/nachts-auf-dem-dorfplatz}
\input{songs/nachts-steht-hunger}
\input{songs/nehmt-abschied-brueder}
\input{songs/nicht-nur-nebenbei}
\input{songs/nichts-fuer-suesse-ziehharmonika}
\input{songs/noch-lange-sassen-wir}
\input{songs/nordwaerts}
\input{songs/nun-greift-in-die-saiten}
\input{songs/nun-lustig-lustig}
\input{songs/oh-fischer}
\input{songs/oh-bootsmann}
\input{songs/originale-3-strophe}
\input{songs/panama}
\input{songs/papst-sultan}
\input{songs/platoff}
\input{songs/refrain-2x}
\input{songs/rote-ritterscharen}
\input{songs/roter-mond}
\input{songs/roter-wein-im-becher}
\input{songs/santiano}
\input{songs/santiano-2}
\input{songs/scarborough-fair}
\input{songs/schilf-bleicht}
\input{songs/schlaf-mein-bub}
\input{songs/schliess-aug-und-ohr}
\input{songs/sei-der-abend}
\input{songs/she-hangs-her-head-sad-lisa}
\input{songs/siehst-du-die-feuer}
\input{songs/singt-freunde-lasst-die-klampfen}
\input{songs/so-trolln-wir-uns}
\input{songs/sonnenschein-und-wilde-feste}
\input{songs/star-of-county-down}
\input{songs/stiebt-vom-kasbek}
\input{songs/stille-tage}
\input{songs/strassen-auf-und-strassen-ab}
\input{songs/sturm-bricht-los}
\input{songs/sturm-und-drang}
\input{songs/tief-im-busch}
\input{songs/trinklied-vor-dem-abgang}
\input{songs/trommeln-und-pfeifen}
\input{songs/turm-um-uns}
\input{songs/ty-morjak-deutscher-text}
\input{songs/und-am-abend}
\input{songs/und-der-herbst}
\input{songs/und-die-morgenfruehe}
\input{songs/unglueck-vor-mir}
\input{songs/unser-stammesbus}
\input{songs/unter-den-toren}
\input{songs/vagabundenlied}
\input{songs/verliebt-in-du-intro-c-g-a-a-2x}
\input{songs/viva-la-feria}
\input{songs/vom-barette}
\input{songs/von-allen-blauen-huegeln}
\input{songs/von-der-festung-droehnt}
\input{songs/von-ueberall}
\input{songs/wach-nun-auf}
\input{songs/was-gehn-euch-meine}
\input{songs/was-helfen-mir-tausend-dukaten}
\input{songs/was-kann-ich-denn-dafuer}
\input{songs/was-keiner-wagt}
\input{songs/was-sollen-wir-trinken}
\input{songs/weisser-sand}
\input{songs/welle-wogte}
\input{songs/wem-gott-will-rechte-gunst-erweisen}
\input{songs/wenn-alle-bruennlein}
\input{songs/wenn-der-abend-naht}
\input{songs/wenn-der-fruehling-kommt}
\input{songs/wenn-die-bunten-fahnen}
\input{songs/wenn-die-zeit}
\input{songs/wenn-hell-die-goldne-sonne}
\input{songs/wenn-ich-des-morgens}
\input{songs/weronika-mit-w}
\input{songs/what-shall-we-do-drunken-sailor}
\input{songs/whats-right-ye-jacobites}
\input{songs/whiskey-in-the-jar}
\input{songs/wie-ein-fest-nach-langer-trauer}
\input{songs/wie-kommts-dass-du}
\input{songs/wie-schoen-blueht}
\input{songs/wild-rover}
\input{songs/wilde-gesellen}
\input{songs/wilde-reiter}
\input{songs/wildgaense}
\input{songs/wir-drei-wir-gehn-jetzt}
\input{songs/wir-fahren-uebers-weite-meer}
\input{songs/wir-haben-das-sehen}
\input{songs/wir-kamen-einst}
\input{songs/wir-lagen-vor-madagaskar}
\input{songs/wir-lieben-die-stuerme}
\input{songs/wir-rufen-zu-dir-michaelslied}
\input{songs/wir-sassen-in-johnnys-spelunke}
\input{songs/wir-sind-des-geyers}
\input{songs/wir-sind-durch-deutschland-gefahren}
\input{songs/wir-sind-eine-kleine}
\input{songs/wir-sind-kameraden}
\input{songs/wir-sind-wieder-da-st-goar-hymne}
\input{songs/wir-sitzen-im-rostigen-haifsch}
\input{songs/wir-sitzen-zu-pferde}
\input{songs/wir-wollen-zu-land-ausfahren}
\input{songs/wir-wolln-im-gruenen-wald}
\input{songs/wo-schorle-der-apfelschorlen-blues}
\input{songs/wohl-ueber-erde}
\input{songs/wohlauf-die-luft}
\input{songs/wollt-ihr-hoeren}
\input{songs/wos-nur-felsen}
\input{songs/zieh-meiner-strasse}
\input{songs/zogen-einst}
\input{songs/zogen-viele-strassen}
\input{songs/ueber-meiner-heimat}

16
app/build.gradle.kts Normal file
View File

@@ -0,0 +1,16 @@
plugins {
id("songbook-conventions")
}
dependencies {
implementation(project(":model"))
implementation(project(":parser"))
implementation(project(":layout"))
implementation(project(":renderer-pdf"))
implementation("io.github.microutils:kotlin-logging-jvm:3.0.5")
implementation("ch.qos.logback:logback-classic:1.5.16")
testImplementation(kotlin("test"))
testImplementation("io.kotest:kotest-assertions-core:5.9.1")
}

View File

@@ -0,0 +1,183 @@
package de.pfadfinder.songbook.app
import de.pfadfinder.songbook.model.*
import de.pfadfinder.songbook.parser.*
import de.pfadfinder.songbook.parser.ForewordParser
import de.pfadfinder.songbook.layout.*
import de.pfadfinder.songbook.renderer.pdf.*
import mu.KotlinLogging
import java.io.File
import java.io.FileOutputStream
private val logger = KotlinLogging.logger {}
data class BuildResult(
val success: Boolean,
val outputFile: File? = null,
val errors: List<ValidationError> = emptyList(),
val songCount: Int = 0,
val pageCount: Int = 0
)
class SongbookPipeline(private val projectDir: File) {
fun build(): BuildResult {
// 1. Parse config
val configFile = File(projectDir, "songbook.yaml")
if (!configFile.exists()) {
return BuildResult(false, errors = listOf(ValidationError(configFile.name, null, "songbook.yaml not found")))
}
logger.info { "Parsing config: ${configFile.absolutePath}" }
val config = ConfigParser.parse(configFile)
// Validate config
val configErrors = Validator.validateConfig(config)
if (configErrors.isNotEmpty()) {
return BuildResult(false, errors = configErrors)
}
// 2. Parse songs
val songsDir = File(projectDir, config.songs.directory)
if (!songsDir.exists() || !songsDir.isDirectory) {
return BuildResult(false, errors = listOf(ValidationError(config.songs.directory, null, "Songs directory not found")))
}
val songFiles = songsDir.listFiles { f: File -> f.extension in listOf("chopro", "cho", "crd") }
?.sortedBy { it.name }
?: emptyList()
if (songFiles.isEmpty()) {
return BuildResult(false, errors = listOf(ValidationError(config.songs.directory, null, "No song files found")))
}
logger.info { "Found ${songFiles.size} song files" }
val songs = mutableListOf<Song>()
val allErrors = mutableListOf<ValidationError>()
for (file in songFiles) {
try {
val song = ChordProParser.parseFile(file)
val songErrors = Validator.validateSong(song, file.name)
if (songErrors.isNotEmpty()) {
allErrors.addAll(songErrors)
} else {
songs.add(song)
}
} catch (e: Exception) {
allErrors.add(ValidationError(file.name, null, "Parse error: ${e.message}"))
}
}
if (allErrors.isNotEmpty()) {
return BuildResult(false, errors = allErrors)
}
// Sort songs
val sortedSongs = when (config.songs.order) {
"alphabetical" -> songs.sortedBy { it.title.lowercase() }
else -> songs // manual order = file order
}
logger.info { "Parsed ${sortedSongs.size} songs" }
// 2b. Parse foreword (if configured)
var foreword: Foreword? = null
val forewordConfig = config.foreword
if (forewordConfig != null) {
val forewordFile = File(projectDir, forewordConfig.file)
if (forewordFile.exists()) {
logger.info { "Parsing foreword: ${forewordFile.absolutePath}" }
foreword = ForewordParser.parseFile(forewordFile)
} else {
logger.warn { "Foreword file not found: ${forewordFile.absolutePath}" }
}
}
// 3. Measure songs
val fontMetrics = PdfFontMetrics()
val measurementEngine = MeasurementEngine(fontMetrics, config)
val measuredSongs = sortedSongs.map { measurementEngine.measure(it) }
// 4. Generate TOC and paginate
val tocGenerator = TocGenerator(config)
val tocPages = tocGenerator.estimateTocPages(sortedSongs)
// Foreword always takes 2 pages (for double-sided printing)
val forewordPages = if (foreword != null) 2 else 0
val paginationEngine = PaginationEngine(config)
val pages = paginationEngine.paginate(measuredSongs, tocPages + forewordPages)
val tocEntries = tocGenerator.generate(pages, tocPages + forewordPages)
// Build final page list with foreword pages inserted before song content
val allPages = mutableListOf<PageContent>()
if (foreword != null) {
allPages.add(PageContent.ForewordPage(foreword, 0))
allPages.add(PageContent.ForewordPage(foreword, 1))
}
allPages.addAll(pages)
val layoutResult = LayoutResult(
tocPages = tocPages,
pages = allPages,
tocEntries = tocEntries
)
logger.info { "Layout: ${tocPages} TOC pages, ${pages.size} content pages" }
// 5. Render PDF
val outputDir = File(projectDir, config.output.directory)
outputDir.mkdirs()
val outputFile = File(outputDir, config.output.filename)
logger.info { "Rendering PDF: ${outputFile.absolutePath}" }
val renderer = PdfBookRenderer()
FileOutputStream(outputFile).use { fos ->
renderer.render(layoutResult, config, fos)
}
logger.info { "Build complete: ${sortedSongs.size} songs, ${pages.size + tocPages} pages" }
return BuildResult(
success = true,
outputFile = outputFile,
songCount = sortedSongs.size,
pageCount = pages.size + tocPages
)
}
fun validate(): List<ValidationError> {
val configFile = File(projectDir, "songbook.yaml")
if (!configFile.exists()) {
return listOf(ValidationError(configFile.name, null, "songbook.yaml not found"))
}
val config = ConfigParser.parse(configFile)
val errors = mutableListOf<ValidationError>()
errors.addAll(Validator.validateConfig(config))
val songsDir = File(projectDir, config.songs.directory)
if (!songsDir.exists()) {
errors.add(ValidationError(config.songs.directory, null, "Songs directory not found"))
return errors
}
val songFiles = songsDir.listFiles { f: File -> f.extension in listOf("chopro", "cho", "crd") }
?.sortedBy { it.name }
?: emptyList()
for (file in songFiles) {
try {
val song = ChordProParser.parseFile(file)
errors.addAll(Validator.validateSong(song, file.name))
} catch (e: Exception) {
errors.add(ValidationError(file.name, null, "Parse error: ${e.message}"))
}
}
return errors
}
}

View File

@@ -0,0 +1,534 @@
package de.pfadfinder.songbook.app
import io.kotest.matchers.booleans.shouldBeFalse
import io.kotest.matchers.booleans.shouldBeTrue
import io.kotest.matchers.collections.shouldBeEmpty
import io.kotest.matchers.collections.shouldHaveSize
import io.kotest.matchers.collections.shouldNotBeEmpty
import io.kotest.matchers.ints.shouldBeGreaterThan
import io.kotest.matchers.nulls.shouldBeNull
import io.kotest.matchers.nulls.shouldNotBeNull
import io.kotest.matchers.shouldBe
import io.kotest.matchers.string.shouldContain
import java.io.File
import kotlin.test.Test
class SongbookPipelineTest {
private fun createTempProject(): File {
val dir = kotlin.io.path.createTempDirectory("songbook-test").toFile()
dir.deleteOnExit()
return dir
}
private fun writeConfig(projectDir: File, config: String = defaultConfig()) {
File(projectDir, "songbook.yaml").writeText(config)
}
private fun defaultConfig(
songsDir: String = "./songs",
outputDir: String = "./output",
outputFilename: String = "liederbuch.pdf",
order: String = "alphabetical"
): String = """
book:
title: "Test Liederbuch"
format: "A5"
songs:
directory: "$songsDir"
order: "$order"
fonts:
lyrics:
family: "Helvetica"
size: 10
chords:
family: "Helvetica"
size: 9
title:
family: "Helvetica"
size: 14
metadata:
family: "Helvetica"
size: 8
toc:
family: "Helvetica"
size: 9
layout:
margins:
top: 15
bottom: 15
inner: 20
outer: 12
images:
directory: "./images"
output:
directory: "$outputDir"
filename: "$outputFilename"
""".trimIndent()
private fun writeSongFile(songsDir: File, filename: String, content: String) {
songsDir.mkdirs()
File(songsDir, filename).writeText(content)
}
private fun sampleSong(title: String = "Test Song"): String = """
{title: $title}
{start_of_verse}
[Am]Hello [C]world
This is a test
{end_of_verse}
""".trimIndent()
// --- build() tests ---
@Test
fun `build returns error when songbook yaml is missing`() {
val projectDir = createTempProject()
try {
val pipeline = SongbookPipeline(projectDir)
val result = pipeline.build()
result.success.shouldBeFalse()
result.errors shouldHaveSize 1
result.errors[0].message shouldContain "songbook.yaml not found"
result.outputFile.shouldBeNull()
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `build returns error when songs directory does not exist`() {
val projectDir = createTempProject()
try {
writeConfig(projectDir, defaultConfig(songsDir = "./nonexistent"))
val pipeline = SongbookPipeline(projectDir)
val result = pipeline.build()
result.success.shouldBeFalse()
result.errors shouldHaveSize 1
result.errors[0].message shouldContain "Songs directory not found"
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `build returns error when songs directory is empty`() {
val projectDir = createTempProject()
try {
writeConfig(projectDir)
File(projectDir, "songs").mkdirs()
val pipeline = SongbookPipeline(projectDir)
val result = pipeline.build()
result.success.shouldBeFalse()
result.errors shouldHaveSize 1
result.errors[0].message shouldContain "No song files found"
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `build returns error for invalid config with zero margins`() {
val projectDir = createTempProject()
try {
val config = """
book:
title: "Test"
layout:
margins:
top: 0
bottom: 15
inner: 20
outer: 12
""".trimIndent()
writeConfig(projectDir, config)
val pipeline = SongbookPipeline(projectDir)
val result = pipeline.build()
result.success.shouldBeFalse()
result.errors.shouldNotBeEmpty()
result.errors.any { it.message.contains("margin", ignoreCase = true) }.shouldBeTrue()
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `build returns error for song with missing title`() {
val projectDir = createTempProject()
try {
writeConfig(projectDir)
val songsDir = File(projectDir, "songs")
writeSongFile(songsDir, "bad_song.chopro", """
{start_of_verse}
[Am]Hello world
{end_of_verse}
""".trimIndent())
val pipeline = SongbookPipeline(projectDir)
val result = pipeline.build()
result.success.shouldBeFalse()
result.errors.shouldNotBeEmpty()
result.errors.any { it.message.contains("title", ignoreCase = true) }.shouldBeTrue()
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `build returns error for song with no sections`() {
val projectDir = createTempProject()
try {
writeConfig(projectDir)
val songsDir = File(projectDir, "songs")
writeSongFile(songsDir, "empty_song.chopro", "{title: Empty Song}")
val pipeline = SongbookPipeline(projectDir)
val result = pipeline.build()
result.success.shouldBeFalse()
result.errors.shouldNotBeEmpty()
result.errors.any { it.message.contains("section", ignoreCase = true) }.shouldBeTrue()
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `build succeeds with valid project`() {
val projectDir = createTempProject()
try {
writeConfig(projectDir)
val songsDir = File(projectDir, "songs")
writeSongFile(songsDir, "song1.chopro", sampleSong("Alpha Song"))
writeSongFile(songsDir, "song2.chopro", sampleSong("Beta Song"))
val pipeline = SongbookPipeline(projectDir)
val result = pipeline.build()
result.success.shouldBeTrue()
result.errors.shouldBeEmpty()
result.outputFile.shouldNotBeNull()
result.outputFile!!.exists().shouldBeTrue()
result.songCount shouldBe 2
result.pageCount shouldBeGreaterThan 0
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `build creates output directory if it does not exist`() {
val projectDir = createTempProject()
try {
writeConfig(projectDir, defaultConfig(outputDir = "./out/build"))
val songsDir = File(projectDir, "songs")
writeSongFile(songsDir, "song1.chopro", sampleSong())
val pipeline = SongbookPipeline(projectDir)
val result = pipeline.build()
result.success.shouldBeTrue()
File(projectDir, "out/build").exists().shouldBeTrue()
result.outputFile!!.exists().shouldBeTrue()
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `build with alphabetical order sorts songs by title`() {
val projectDir = createTempProject()
try {
writeConfig(projectDir, defaultConfig(order = "alphabetical"))
val songsDir = File(projectDir, "songs")
writeSongFile(songsDir, "z_first.chopro", sampleSong("Zebra Song"))
writeSongFile(songsDir, "a_second.chopro", sampleSong("Alpha Song"))
val pipeline = SongbookPipeline(projectDir)
val result = pipeline.build()
result.success.shouldBeTrue()
result.songCount shouldBe 2
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `build with manual order preserves file order`() {
val projectDir = createTempProject()
try {
writeConfig(projectDir, defaultConfig(order = "manual"))
val songsDir = File(projectDir, "songs")
writeSongFile(songsDir, "02_second.chopro", sampleSong("Second Song"))
writeSongFile(songsDir, "01_first.chopro", sampleSong("First Song"))
val pipeline = SongbookPipeline(projectDir)
val result = pipeline.build()
result.success.shouldBeTrue()
result.songCount shouldBe 2
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `build recognizes cho extension`() {
val projectDir = createTempProject()
try {
writeConfig(projectDir)
val songsDir = File(projectDir, "songs")
writeSongFile(songsDir, "song1.cho", sampleSong("Cho Song"))
val pipeline = SongbookPipeline(projectDir)
val result = pipeline.build()
result.success.shouldBeTrue()
result.songCount shouldBe 1
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `build recognizes crd extension`() {
val projectDir = createTempProject()
try {
writeConfig(projectDir)
val songsDir = File(projectDir, "songs")
writeSongFile(songsDir, "song1.crd", sampleSong("Crd Song"))
val pipeline = SongbookPipeline(projectDir)
val result = pipeline.build()
result.success.shouldBeTrue()
result.songCount shouldBe 1
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `build ignores non-song files in songs directory`() {
val projectDir = createTempProject()
try {
writeConfig(projectDir)
val songsDir = File(projectDir, "songs")
writeSongFile(songsDir, "song1.chopro", sampleSong("Real Song"))
writeSongFile(songsDir, "readme.txt", "Not a song")
writeSongFile(songsDir, "notes.md", "# Notes")
val pipeline = SongbookPipeline(projectDir)
val result = pipeline.build()
result.success.shouldBeTrue()
result.songCount shouldBe 1
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `build output file has correct name`() {
val projectDir = createTempProject()
try {
writeConfig(projectDir, defaultConfig(outputFilename = "my-book.pdf"))
val songsDir = File(projectDir, "songs")
writeSongFile(songsDir, "song1.chopro", sampleSong())
val pipeline = SongbookPipeline(projectDir)
val result = pipeline.build()
result.success.shouldBeTrue()
result.outputFile!!.name shouldBe "my-book.pdf"
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `build pageCount includes toc pages`() {
val projectDir = createTempProject()
try {
writeConfig(projectDir)
val songsDir = File(projectDir, "songs")
writeSongFile(songsDir, "song1.chopro", sampleSong())
val pipeline = SongbookPipeline(projectDir)
val result = pipeline.build()
result.success.shouldBeTrue()
// At least 1 content page + TOC pages (minimum 2 for even count)
result.pageCount shouldBeGreaterThan 1
} finally {
projectDir.deleteRecursively()
}
}
// --- validate() tests ---
@Test
fun `validate returns error when songbook yaml is missing`() {
val projectDir = createTempProject()
try {
val pipeline = SongbookPipeline(projectDir)
val errors = pipeline.validate()
errors shouldHaveSize 1
errors[0].message shouldContain "songbook.yaml not found"
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `validate returns error when songs directory does not exist`() {
val projectDir = createTempProject()
try {
writeConfig(projectDir, defaultConfig(songsDir = "./nonexistent"))
val pipeline = SongbookPipeline(projectDir)
val errors = pipeline.validate()
errors.shouldNotBeEmpty()
errors.any { it.message.contains("Songs directory not found") }.shouldBeTrue()
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `validate returns empty list for valid project`() {
val projectDir = createTempProject()
try {
writeConfig(projectDir)
val songsDir = File(projectDir, "songs")
writeSongFile(songsDir, "song1.chopro", sampleSong())
val pipeline = SongbookPipeline(projectDir)
val errors = pipeline.validate()
errors.shouldBeEmpty()
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `validate reports config errors`() {
val projectDir = createTempProject()
try {
val config = """
layout:
margins:
top: 0
bottom: 0
inner: 0
outer: 0
""".trimIndent()
writeConfig(projectDir, config)
// Still need songs dir to exist for full validate
File(projectDir, "./songs").mkdirs()
val pipeline = SongbookPipeline(projectDir)
val errors = pipeline.validate()
errors shouldHaveSize 4
errors.all { it.message.contains("margin", ignoreCase = true) }.shouldBeTrue()
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `validate reports song validation errors`() {
val projectDir = createTempProject()
try {
writeConfig(projectDir)
val songsDir = File(projectDir, "songs")
writeSongFile(songsDir, "bad_song.chopro", "{title: }")
val pipeline = SongbookPipeline(projectDir)
val errors = pipeline.validate()
errors.shouldNotBeEmpty()
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `validate reports errors for multiple invalid songs`() {
val projectDir = createTempProject()
try {
writeConfig(projectDir)
val songsDir = File(projectDir, "songs")
writeSongFile(songsDir, "bad1.chopro", "{title: Good Title}") // no sections
writeSongFile(songsDir, "bad2.chopro", "{title: Another Title}") // no sections
val pipeline = SongbookPipeline(projectDir)
val errors = pipeline.validate()
errors.shouldNotBeEmpty()
errors.size shouldBeGreaterThan 1
} finally {
projectDir.deleteRecursively()
}
}
@Test
fun `validate with empty songs directory returns no song errors`() {
val projectDir = createTempProject()
try {
writeConfig(projectDir)
File(projectDir, "songs").mkdirs()
val pipeline = SongbookPipeline(projectDir)
val errors = pipeline.validate()
// No errors because there are no song files to validate
errors.shouldBeEmpty()
} finally {
projectDir.deleteRecursively()
}
}
// --- BuildResult data class tests ---
@Test
fun `BuildResult defaults are correct`() {
val result = BuildResult(success = false)
result.success.shouldBeFalse()
result.outputFile.shouldBeNull()
result.errors.shouldBeEmpty()
result.songCount shouldBe 0
result.pageCount shouldBe 0
}
@Test
fun `BuildResult with all fields set`() {
val file = File("/tmp/test.pdf")
val errors = listOf(de.pfadfinder.songbook.parser.ValidationError("test", 1, "error"))
val result = BuildResult(
success = true,
outputFile = file,
errors = errors,
songCount = 5,
pageCount = 10
)
result.success.shouldBeTrue()
result.outputFile shouldBe file
result.errors shouldHaveSize 1
result.songCount shouldBe 5
result.pageCount shouldBe 10
}
}

4
build.gradle.kts Normal file
View File

@@ -0,0 +1,4 @@
plugins {
id("org.jetbrains.compose") version "1.7.3" apply false
id("org.jetbrains.kotlin.plugin.compose") version "2.1.10" apply false
}

12
buildSrc/build.gradle.kts Normal file
View File

@@ -0,0 +1,12 @@
plugins {
`kotlin-dsl`
}
repositories {
mavenCentral()
gradlePluginPortal()
}
dependencies {
implementation("org.jetbrains.kotlin:kotlin-gradle-plugin:2.1.10")
}

View File

@@ -0,0 +1,18 @@
plugins {
kotlin("jvm")
}
java {
sourceCompatibility = JavaVersion.VERSION_21
targetCompatibility = JavaVersion.VERSION_21
}
kotlin {
compilerOptions {
jvmTarget.set(org.jetbrains.kotlin.gradle.dsl.JvmTarget.JVM_21)
}
}
tasks.withType<Test> {
useJUnitPlatform()
}

17
cli/build.gradle.kts Normal file
View File

@@ -0,0 +1,17 @@
plugins {
id("songbook-conventions")
application
}
application {
mainClass.set("de.pfadfinder.songbook.cli.MainKt")
}
dependencies {
implementation(project(":app"))
implementation(project(":model"))
implementation(project(":parser"))
implementation("com.github.ajalt.clikt:clikt:5.0.3")
implementation("io.github.microutils:kotlin-logging-jvm:3.0.5")
implementation("ch.qos.logback:logback-classic:1.5.16")
}

View File

@@ -0,0 +1,37 @@
package de.pfadfinder.songbook.cli
import com.github.ajalt.clikt.core.CliktCommand
import com.github.ajalt.clikt.core.Context
import com.github.ajalt.clikt.core.ProgramResult
import com.github.ajalt.clikt.parameters.options.default
import com.github.ajalt.clikt.parameters.options.option
import de.pfadfinder.songbook.app.SongbookPipeline
import java.io.File
class BuildCommand : CliktCommand(name = "build") {
override fun help(context: Context) = "Build the songbook PDF"
private val projectDir by option("-d", "--dir", help = "Project directory").default(".")
override fun run() {
val dir = File(projectDir).absoluteFile
echo("Building songbook from: ${dir.path}")
val pipeline = SongbookPipeline(dir)
val result = pipeline.build()
if (result.success) {
echo("Build successful!")
echo(" Songs: ${result.songCount}")
echo(" Pages: ${result.pageCount}")
echo(" Output: ${result.outputFile?.absolutePath}")
} else {
echo("Build failed with ${result.errors.size} error(s):", err = true)
for (error in result.errors) {
val location = listOfNotNull(error.file, error.line?.toString()).joinToString(":")
echo(" [$location] ${error.message}", err = true)
}
throw ProgramResult(1)
}
}
}

View File

@@ -0,0 +1,15 @@
package de.pfadfinder.songbook.cli
import com.github.ajalt.clikt.core.CliktCommand
import com.github.ajalt.clikt.core.main
import com.github.ajalt.clikt.core.subcommands
class SongbookCli : CliktCommand(name = "songbook") {
override fun run() = Unit
}
fun main(args: Array<String>) {
SongbookCli()
.subcommands(BuildCommand(), ValidateCommand())
.main(args)
}

View File

@@ -0,0 +1,34 @@
package de.pfadfinder.songbook.cli
import com.github.ajalt.clikt.core.CliktCommand
import com.github.ajalt.clikt.core.Context
import com.github.ajalt.clikt.core.ProgramResult
import com.github.ajalt.clikt.parameters.options.default
import com.github.ajalt.clikt.parameters.options.option
import de.pfadfinder.songbook.app.SongbookPipeline
import java.io.File
class ValidateCommand : CliktCommand(name = "validate") {
override fun help(context: Context) = "Validate all song files"
private val projectDir by option("-d", "--dir", help = "Project directory").default(".")
override fun run() {
val dir = File(projectDir).absoluteFile
echo("Validating songbook in: ${dir.path}")
val pipeline = SongbookPipeline(dir)
val errors = pipeline.validate()
if (errors.isEmpty()) {
echo("All songs are valid!")
} else {
echo("Found ${errors.size} error(s):", err = true)
for (error in errors) {
val location = listOfNotNull(error.file, error.line?.toString()).joinToString(":")
echo(" [$location] ${error.message}", err = true)
}
throw ProgramResult(1)
}
}
}

Binary file not shown.

1
gradle.properties Normal file
View File

@@ -0,0 +1 @@
org.gradle.java.home=/usr/lib/jvm/java-25-openjdk

BIN
gradle/wrapper/gradle-wrapper.jar vendored Normal file

Binary file not shown.

View File

@@ -0,0 +1,7 @@
distributionBase=GRADLE_USER_HOME
distributionPath=wrapper/dists
distributionUrl=https\://services.gradle.org/distributions/gradle-9.3.1-bin.zip
networkTimeout=10000
validateDistributionUrl=true
zipStoreBase=GRADLE_USER_HOME
zipStorePath=wrapper/dists

248
gradlew vendored Executable file
View File

@@ -0,0 +1,248 @@
#!/bin/sh
#
# Copyright © 2015 the original authors.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# https://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
#
# SPDX-License-Identifier: Apache-2.0
#
##############################################################################
#
# Gradle start up script for POSIX generated by Gradle.
#
# Important for running:
#
# (1) You need a POSIX-compliant shell to run this script. If your /bin/sh is
# noncompliant, but you have some other compliant shell such as ksh or
# bash, then to run this script, type that shell name before the whole
# command line, like:
#
# ksh Gradle
#
# Busybox and similar reduced shells will NOT work, because this script
# requires all of these POSIX shell features:
# * functions;
# * expansions «$var», «${var}», «${var:-default}», «${var+SET}»,
# «${var#prefix}», «${var%suffix}», and «$( cmd )»;
# * compound commands having a testable exit status, especially «case»;
# * various built-in commands including «command», «set», and «ulimit».
#
# Important for patching:
#
# (2) This script targets any POSIX shell, so it avoids extensions provided
# by Bash, Ksh, etc; in particular arrays are avoided.
#
# The "traditional" practice of packing multiple parameters into a
# space-separated string is a well documented source of bugs and security
# problems, so this is (mostly) avoided, by progressively accumulating
# options in "$@", and eventually passing that to Java.
#
# Where the inherited environment variables (DEFAULT_JVM_OPTS, JAVA_OPTS,
# and GRADLE_OPTS) rely on word-splitting, this is performed explicitly;
# see the in-line comments for details.
#
# There are tweaks for specific operating systems such as AIX, CygWin,
# Darwin, MinGW, and NonStop.
#
# (3) This script is generated from the Groovy template
# https://github.com/gradle/gradle/blob/HEAD/platforms/jvm/plugins-application/src/main/resources/org/gradle/api/internal/plugins/unixStartScript.txt
# within the Gradle project.
#
# You can find Gradle at https://github.com/gradle/gradle/.
#
##############################################################################
# Attempt to set APP_HOME
# Resolve links: $0 may be a link
app_path=$0
# Need this for daisy-chained symlinks.
while
APP_HOME=${app_path%"${app_path##*/}"} # leaves a trailing /; empty if no leading path
[ -h "$app_path" ]
do
ls=$( ls -ld "$app_path" )
link=${ls#*' -> '}
case $link in #(
/*) app_path=$link ;; #(
*) app_path=$APP_HOME$link ;;
esac
done
# This is normally unused
# shellcheck disable=SC2034
APP_BASE_NAME=${0##*/}
# Discard cd standard output in case $CDPATH is set (https://github.com/gradle/gradle/issues/25036)
APP_HOME=$( cd -P "${APP_HOME:-./}" > /dev/null && printf '%s\n' "$PWD" ) || exit
# Use the maximum available, or set MAX_FD != -1 to use that value.
MAX_FD=maximum
warn () {
echo "$*"
} >&2
die () {
echo
echo "$*"
echo
exit 1
} >&2
# OS specific support (must be 'true' or 'false').
cygwin=false
msys=false
darwin=false
nonstop=false
case "$( uname )" in #(
CYGWIN* ) cygwin=true ;; #(
Darwin* ) darwin=true ;; #(
MSYS* | MINGW* ) msys=true ;; #(
NONSTOP* ) nonstop=true ;;
esac
# Determine the Java command to use to start the JVM.
if [ -n "$JAVA_HOME" ] ; then
if [ -x "$JAVA_HOME/jre/sh/java" ] ; then
# IBM's JDK on AIX uses strange locations for the executables
JAVACMD=$JAVA_HOME/jre/sh/java
else
JAVACMD=$JAVA_HOME/bin/java
fi
if [ ! -x "$JAVACMD" ] ; then
die "ERROR: JAVA_HOME is set to an invalid directory: $JAVA_HOME
Please set the JAVA_HOME variable in your environment to match the
location of your Java installation."
fi
else
JAVACMD=java
if ! command -v java >/dev/null 2>&1
then
die "ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH.
Please set the JAVA_HOME variable in your environment to match the
location of your Java installation."
fi
fi
# Increase the maximum file descriptors if we can.
if ! "$cygwin" && ! "$darwin" && ! "$nonstop" ; then
case $MAX_FD in #(
max*)
# In POSIX sh, ulimit -H is undefined. That's why the result is checked to see if it worked.
# shellcheck disable=SC2039,SC3045
MAX_FD=$( ulimit -H -n ) ||
warn "Could not query maximum file descriptor limit"
esac
case $MAX_FD in #(
'' | soft) :;; #(
*)
# In POSIX sh, ulimit -n is undefined. That's why the result is checked to see if it worked.
# shellcheck disable=SC2039,SC3045
ulimit -n "$MAX_FD" ||
warn "Could not set maximum file descriptor limit to $MAX_FD"
esac
fi
# Collect all arguments for the java command, stacking in reverse order:
# * args from the command line
# * the main class name
# * -classpath
# * -D...appname settings
# * --module-path (only if needed)
# * DEFAULT_JVM_OPTS, JAVA_OPTS, and GRADLE_OPTS environment variables.
# For Cygwin or MSYS, switch paths to Windows format before running java
if "$cygwin" || "$msys" ; then
APP_HOME=$( cygpath --path --mixed "$APP_HOME" )
JAVACMD=$( cygpath --unix "$JAVACMD" )
# Now convert the arguments - kludge to limit ourselves to /bin/sh
for arg do
if
case $arg in #(
-*) false ;; # don't mess with options #(
/?*) t=${arg#/} t=/${t%%/*} # looks like a POSIX filepath
[ -e "$t" ] ;; #(
*) false ;;
esac
then
arg=$( cygpath --path --ignore --mixed "$arg" )
fi
# Roll the args list around exactly as many times as the number of
# args, so each arg winds up back in the position where it started, but
# possibly modified.
#
# NB: a `for` loop captures its iteration list before it begins, so
# changing the positional parameters here affects neither the number of
# iterations, nor the values presented in `arg`.
shift # remove old arg
set -- "$@" "$arg" # push replacement arg
done
fi
# Add default JVM options here. You can also use JAVA_OPTS and GRADLE_OPTS to pass JVM options to this script.
DEFAULT_JVM_OPTS='"-Xmx64m" "-Xms64m"'
# Collect all arguments for the java command:
# * DEFAULT_JVM_OPTS, JAVA_OPTS, and optsEnvironmentVar are not allowed to contain shell fragments,
# and any embedded shellness will be escaped.
# * For example: A user cannot expect ${Hostname} to be expanded, as it is an environment variable and will be
# treated as '${Hostname}' itself on the command line.
set -- \
"-Dorg.gradle.appname=$APP_BASE_NAME" \
-jar "$APP_HOME/gradle/wrapper/gradle-wrapper.jar" \
"$@"
# Stop when "xargs" is not available.
if ! command -v xargs >/dev/null 2>&1
then
die "xargs is not available"
fi
# Use "xargs" to parse quoted args.
#
# With -n1 it outputs one arg per line, with the quotes and backslashes removed.
#
# In Bash we could simply go:
#
# readarray ARGS < <( xargs -n1 <<<"$var" ) &&
# set -- "${ARGS[@]}" "$@"
#
# but POSIX shell has neither arrays nor command substitution, so instead we
# post-process each arg (as a line of input to sed) to backslash-escape any
# character that might be a shell metacharacter, then use eval to reverse
# that process (while maintaining the separation between arguments), and wrap
# the whole thing up as a single "set" statement.
#
# This will of course break if any of these variables contains a newline or
# an unmatched quote.
#
eval "set -- $(
printf '%s\n' "$DEFAULT_JVM_OPTS $JAVA_OPTS $GRADLE_OPTS" |
xargs -n1 |
sed ' s~[^-[:alnum:]+,./:=@_]~\\&~g; ' |
tr '\n' ' '
)" '"$@"'
exec "$JAVACMD" "$@"

93
gradlew.bat vendored Normal file
View File

@@ -0,0 +1,93 @@
@rem
@rem Copyright 2015 the original author or authors.
@rem
@rem Licensed under the Apache License, Version 2.0 (the "License");
@rem you may not use this file except in compliance with the License.
@rem You may obtain a copy of the License at
@rem
@rem https://www.apache.org/licenses/LICENSE-2.0
@rem
@rem Unless required by applicable law or agreed to in writing, software
@rem distributed under the License is distributed on an "AS IS" BASIS,
@rem WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
@rem See the License for the specific language governing permissions and
@rem limitations under the License.
@rem
@rem SPDX-License-Identifier: Apache-2.0
@rem
@if "%DEBUG%"=="" @echo off
@rem ##########################################################################
@rem
@rem Gradle startup script for Windows
@rem
@rem ##########################################################################
@rem Set local scope for the variables with windows NT shell
if "%OS%"=="Windows_NT" setlocal
set DIRNAME=%~dp0
if "%DIRNAME%"=="" set DIRNAME=.
@rem This is normally unused
set APP_BASE_NAME=%~n0
set APP_HOME=%DIRNAME%
@rem Resolve any "." and ".." in APP_HOME to make it shorter.
for %%i in ("%APP_HOME%") do set APP_HOME=%%~fi
@rem Add default JVM options here. You can also use JAVA_OPTS and GRADLE_OPTS to pass JVM options to this script.
set DEFAULT_JVM_OPTS="-Xmx64m" "-Xms64m"
@rem Find java.exe
if defined JAVA_HOME goto findJavaFromJavaHome
set JAVA_EXE=java.exe
%JAVA_EXE% -version >NUL 2>&1
if %ERRORLEVEL% equ 0 goto execute
echo. 1>&2
echo ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH. 1>&2
echo. 1>&2
echo Please set the JAVA_HOME variable in your environment to match the 1>&2
echo location of your Java installation. 1>&2
goto fail
:findJavaFromJavaHome
set JAVA_HOME=%JAVA_HOME:"=%
set JAVA_EXE=%JAVA_HOME%/bin/java.exe
if exist "%JAVA_EXE%" goto execute
echo. 1>&2
echo ERROR: JAVA_HOME is set to an invalid directory: %JAVA_HOME% 1>&2
echo. 1>&2
echo Please set the JAVA_HOME variable in your environment to match the 1>&2
echo location of your Java installation. 1>&2
goto fail
:execute
@rem Setup the command line
@rem Execute Gradle
"%JAVA_EXE%" %DEFAULT_JVM_OPTS% %JAVA_OPTS% %GRADLE_OPTS% "-Dorg.gradle.appname=%APP_BASE_NAME%" -jar "%APP_HOME%\gradle\wrapper\gradle-wrapper.jar" %*
:end
@rem End local scope for the variables with windows NT shell
if %ERRORLEVEL% equ 0 goto mainEnd
:fail
rem Set variable GRADLE_EXIT_CONSOLE if you need the _script_ return code instead of
rem the _cmd.exe /c_ return code!
set EXIT_CODE=%ERRORLEVEL%
if %EXIT_CODE% equ 0 set EXIT_CODE=1
if not ""=="%GRADLE_EXIT_CONSOLE%" exit %EXIT_CODE%
exit /b %EXIT_CODE%
:mainEnd
if "%OS%"=="Windows_NT" endlocal
:omega

20
gui/build.gradle.kts Normal file
View File

@@ -0,0 +1,20 @@
plugins {
id("songbook-conventions")
id("org.jetbrains.compose")
id("org.jetbrains.kotlin.plugin.compose")
}
dependencies {
implementation(project(":app"))
implementation(project(":model"))
implementation(project(":parser"))
implementation(compose.desktop.currentOs)
implementation("io.github.microutils:kotlin-logging-jvm:3.0.5")
implementation("ch.qos.logback:logback-classic:1.5.16")
}
compose.desktop {
application {
mainClass = "de.pfadfinder.songbook.gui.AppKt"
}
}

View File

@@ -0,0 +1,347 @@
package de.pfadfinder.songbook.gui
import androidx.compose.desktop.ui.tooling.preview.Preview
import androidx.compose.foundation.VerticalScrollbar
import androidx.compose.foundation.layout.*
import androidx.compose.foundation.lazy.LazyColumn
import androidx.compose.foundation.lazy.items
import androidx.compose.foundation.lazy.rememberLazyListState
import androidx.compose.foundation.rememberScrollbarAdapter
import androidx.compose.material.*
import androidx.compose.runtime.*
import androidx.compose.ui.Alignment
import androidx.compose.ui.Modifier
import androidx.compose.ui.graphics.Color
import androidx.compose.ui.text.font.FontWeight
import androidx.compose.ui.unit.dp
import androidx.compose.ui.unit.sp
import androidx.compose.ui.window.Window
import androidx.compose.ui.window.application
import de.pfadfinder.songbook.app.BuildResult
import de.pfadfinder.songbook.app.SongbookPipeline
import de.pfadfinder.songbook.parser.ChordProParser
import de.pfadfinder.songbook.parser.ValidationError
import kotlinx.coroutines.Dispatchers
import kotlinx.coroutines.launch
import kotlinx.coroutines.withContext
import java.awt.Desktop
import java.io.File
import javax.swing.JFileChooser
fun main() = application {
Window(
onCloseRequest = ::exitApplication,
title = "Songbook Builder"
) {
App()
}
}
data class SongEntry(val fileName: String, val title: String)
@Composable
@Preview
fun App() {
var projectPath by remember { mutableStateOf("") }
var songs by remember { mutableStateOf<List<SongEntry>>(emptyList()) }
var statusMessages by remember { mutableStateOf<List<StatusMessage>>(emptyList()) }
var isRunning by remember { mutableStateOf(false) }
var lastBuildResult by remember { mutableStateOf<BuildResult?>(null) }
val scope = rememberCoroutineScope()
fun loadSongs(path: String) {
val projectDir = File(path)
songs = emptyList()
if (!projectDir.isDirectory) return
val configFile = File(projectDir, "songbook.yaml")
val songsDir = if (configFile.exists()) {
try {
val config = de.pfadfinder.songbook.parser.ConfigParser.parse(configFile)
File(projectDir, config.songs.directory)
} catch (_: Exception) {
File(projectDir, "songs")
}
} else {
File(projectDir, "songs")
}
if (!songsDir.isDirectory) return
val songFiles = songsDir.listFiles { f: File -> f.extension in listOf("chopro", "cho", "crd") }
?.sortedBy { it.name }
?: emptyList()
songs = songFiles.mapNotNull { file ->
try {
val song = ChordProParser.parseFile(file)
SongEntry(fileName = file.name, title = song.title.ifBlank { file.nameWithoutExtension })
} catch (_: Exception) {
SongEntry(fileName = file.name, title = "${file.nameWithoutExtension} (Fehler beim Lesen)")
}
}
}
MaterialTheme {
Surface(modifier = Modifier.fillMaxSize()) {
Column(modifier = Modifier.padding(16.dp)) {
// Project directory selection
Text(
text = "Songbook Builder",
fontSize = 20.sp,
fontWeight = FontWeight.Bold,
modifier = Modifier.padding(bottom = 16.dp)
)
Text("Projektverzeichnis:", fontWeight = FontWeight.Medium)
Spacer(modifier = Modifier.height(4.dp))
Row(verticalAlignment = Alignment.CenterVertically) {
OutlinedTextField(
value = projectPath,
onValueChange = {
projectPath = it
loadSongs(it)
},
modifier = Modifier.weight(1f),
singleLine = true,
placeholder = { Text("Pfad zum Projektverzeichnis...") }
)
Spacer(modifier = Modifier.width(8.dp))
Button(
onClick = {
val chooser = JFileChooser().apply {
fileSelectionMode = JFileChooser.DIRECTORIES_ONLY
dialogTitle = "Projektverzeichnis auswählen"
if (projectPath.isNotBlank()) {
currentDirectory = File(projectPath)
}
}
if (chooser.showOpenDialog(null) == JFileChooser.APPROVE_OPTION) {
projectPath = chooser.selectedFile.absolutePath
loadSongs(projectPath)
}
},
enabled = !isRunning
) {
Text("Durchsuchen...")
}
}
Spacer(modifier = Modifier.height(16.dp))
// Song list
Text(
text = "Lieder (${songs.size}):",
fontWeight = FontWeight.Medium
)
Spacer(modifier = Modifier.height(4.dp))
Box(modifier = Modifier.weight(1f).fillMaxWidth()) {
val listState = rememberLazyListState()
LazyColumn(
state = listState,
modifier = Modifier.fillMaxSize().padding(end = 12.dp)
) {
if (songs.isEmpty() && projectPath.isNotBlank()) {
item {
Text(
"Keine Lieder gefunden. Bitte Projektverzeichnis prüfen.",
color = Color.Gray,
modifier = Modifier.padding(8.dp)
)
}
} else if (projectPath.isBlank()) {
item {
Text(
"Bitte ein Projektverzeichnis auswählen.",
color = Color.Gray,
modifier = Modifier.padding(8.dp)
)
}
}
items(songs) { song ->
Row(modifier = Modifier.fillMaxWidth().padding(vertical = 2.dp, horizontal = 8.dp)) {
Text(song.title, modifier = Modifier.weight(1f))
Text(song.fileName, color = Color.Gray, fontSize = 12.sp)
}
Divider()
}
}
VerticalScrollbar(
modifier = Modifier.align(Alignment.CenterEnd).fillMaxHeight(),
adapter = rememberScrollbarAdapter(listState)
)
}
Spacer(modifier = Modifier.height(16.dp))
// Action buttons
Row(horizontalArrangement = Arrangement.spacedBy(8.dp)) {
Button(
onClick = {
if (projectPath.isBlank()) return@Button
isRunning = true
lastBuildResult = null
statusMessages = listOf(StatusMessage("Buch wird erstellt...", MessageType.INFO))
scope.launch {
val result = withContext(Dispatchers.IO) {
try {
SongbookPipeline(File(projectPath)).build()
} catch (e: Exception) {
BuildResult(
success = false,
errors = listOf(
ValidationError(null, null, "Unerwarteter Fehler: ${e.message}")
)
)
}
}
lastBuildResult = result
statusMessages = if (result.success) {
listOf(
StatusMessage(
"Buch erfolgreich erstellt! ${result.songCount} Lieder, ${result.pageCount} Seiten.",
MessageType.SUCCESS
),
StatusMessage(
"Ausgabedatei: ${result.outputFile?.absolutePath ?: "unbekannt"}",
MessageType.INFO
)
)
} else {
result.errors.map { error ->
val location = buildString {
if (error.file != null) append(error.file)
if (error.line != null) append(":${error.line}")
}
val prefix = if (location.isNotEmpty()) "[$location] " else ""
StatusMessage("$prefix${error.message}", MessageType.ERROR)
}
}
isRunning = false
}
},
enabled = !isRunning && projectPath.isNotBlank()
) {
Text("Buch erstellen")
}
Button(
onClick = {
if (projectPath.isBlank()) return@Button
isRunning = true
lastBuildResult = null
statusMessages = listOf(StatusMessage("Validierung läuft...", MessageType.INFO))
scope.launch {
val errors = withContext(Dispatchers.IO) {
try {
SongbookPipeline(File(projectPath)).validate()
} catch (e: Exception) {
listOf(
ValidationError(null, null, "Unerwarteter Fehler: ${e.message}")
)
}
}
statusMessages = if (errors.isEmpty()) {
listOf(StatusMessage("Validierung erfolgreich! Keine Fehler gefunden.", MessageType.SUCCESS))
} else {
errors.map { error ->
val location = buildString {
if (error.file != null) append(error.file)
if (error.line != null) append(":${error.line}")
}
val prefix = if (location.isNotEmpty()) "[$location] " else ""
StatusMessage("$prefix${error.message}", MessageType.ERROR)
}
}
isRunning = false
}
},
enabled = !isRunning && projectPath.isNotBlank()
) {
Text("Validieren")
}
if (lastBuildResult?.success == true && lastBuildResult?.outputFile != null) {
Button(
onClick = {
lastBuildResult?.outputFile?.let { file ->
try {
Desktop.getDesktop().open(file)
} catch (e: Exception) {
statusMessages = statusMessages + StatusMessage(
"PDF konnte nicht geöffnet werden: ${e.message}",
MessageType.ERROR
)
}
}
},
enabled = !isRunning
) {
Text("PDF öffnen")
}
}
if (isRunning) {
Spacer(modifier = Modifier.width(8.dp))
CircularProgressIndicator(
modifier = Modifier.size(24.dp).align(Alignment.CenterVertically),
strokeWidth = 2.dp
)
}
}
Spacer(modifier = Modifier.height(16.dp))
// Status/log area
Text("Status:", fontWeight = FontWeight.Medium)
Spacer(modifier = Modifier.height(4.dp))
Box(
modifier = Modifier
.fillMaxWidth()
.height(150.dp)
) {
val logListState = rememberLazyListState()
LazyColumn(
state = logListState,
modifier = Modifier.fillMaxSize().padding(end = 12.dp)
) {
if (statusMessages.isEmpty()) {
item {
Text(
"Bereit.",
color = Color.Gray,
modifier = Modifier.padding(4.dp)
)
}
}
items(statusMessages) { msg ->
Text(
text = msg.text,
color = when (msg.type) {
MessageType.ERROR -> MaterialTheme.colors.error
MessageType.SUCCESS -> Color(0xFF2E7D32)
MessageType.INFO -> Color.Unspecified
},
fontSize = 13.sp,
modifier = Modifier.padding(vertical = 2.dp, horizontal = 4.dp)
)
}
}
VerticalScrollbar(
modifier = Modifier.align(Alignment.CenterEnd).fillMaxHeight(),
adapter = rememberScrollbarAdapter(logListState)
)
}
}
}
}
}
enum class MessageType {
INFO, SUCCESS, ERROR
}
data class StatusMessage(val text: String, val type: MessageType)

File diff suppressed because it is too large Load Diff

10
layout/build.gradle.kts Normal file
View File

@@ -0,0 +1,10 @@
plugins {
id("songbook-conventions")
}
dependencies {
implementation(project(":model"))
testImplementation(kotlin("test"))
testImplementation("io.kotest:kotest-assertions-core:5.9.1")
}

View File

@@ -0,0 +1,13 @@
package de.pfadfinder.songbook.layout
import java.io.File
object GapFiller {
fun findImages(directory: String): List<String> {
val dir = File(directory)
if (!dir.exists() || !dir.isDirectory) return emptyList()
return dir.listFiles { f ->
f.extension.lowercase() in listOf("png", "jpg", "jpeg")
}?.map { it.absolutePath }?.sorted() ?: emptyList()
}
}

View File

@@ -0,0 +1,104 @@
package de.pfadfinder.songbook.layout
import de.pfadfinder.songbook.model.*
class MeasurementEngine(
private val fontMetrics: FontMetrics,
private val config: BookConfig
) {
// A5 content height = 210mm - top margin - bottom margin
private val contentHeightMm: Float = 210f - config.layout.margins.top - config.layout.margins.bottom
fun measure(song: Song): MeasuredSong {
var heightMm = 0f
// Title height
heightMm += fontMetrics.measureLineHeight(config.fonts.title, config.fonts.title.size) * 1.5f
// Metadata lines (composer/lyricist) - may be 1 or 2 lines depending on label style
if (song.composer != null || song.lyricist != null) {
val metaLineHeight = fontMetrics.measureLineHeight(config.fonts.metadata, config.fonts.metadata.size) * 1.8f
val useGerman = config.layout.metadataLabels == "german"
if (useGerman && song.lyricist != null && song.composer != null && song.lyricist != song.composer) {
// Two separate lines: "Worte: ..." and "Weise: ..."
heightMm += metaLineHeight * 2
} else {
heightMm += metaLineHeight
}
}
// Key/capo line
if (song.key != null || song.capo != null) {
heightMm += fontMetrics.measureLineHeight(config.fonts.metadata, config.fonts.metadata.size) * 1.8f
}
// Gap before sections
heightMm += 1.5f // ~4pt in mm
// Sections
for (section in song.sections) {
// Section label
if (section.label != null || section.type == SectionType.CHORUS) {
heightMm += fontMetrics.measureLineHeight(config.fonts.metadata, config.fonts.metadata.size) * 1.5f
}
// Chorus repeat reference (no lines)
if (section.type == SectionType.CHORUS && section.lines.isEmpty()) {
heightMm += fontMetrics.measureLineHeight(config.fonts.metadata, config.fonts.metadata.size) * 1.8f
continue
}
// Lines in section
for (line in section.lines) {
if (line.imagePath != null) {
// Inline image: estimate height as 40mm (default image block height)
heightMm += 40f
heightMm += 2f // gap around image
} else {
val hasChords = line.segments.any { it.chord != null }
val lyricHeight = fontMetrics.measureLineHeight(config.fonts.lyrics, config.fonts.lyrics.size)
if (hasChords) {
val chordHeight = fontMetrics.measureLineHeight(config.fonts.chords, config.fonts.chords.size)
heightMm += chordHeight + config.layout.chordLineSpacing + lyricHeight
} else {
heightMm += lyricHeight
}
heightMm += 0.35f // ~1pt gap between lines
}
}
// Verse spacing
heightMm += config.layout.verseSpacing
}
// Notes at bottom (with word-wrap estimation for multi-paragraph notes)
if (song.notes.isNotEmpty()) {
heightMm += 1.5f // gap before notes
val metaLineHeight = fontMetrics.measureLineHeight(config.fonts.metadata, config.fonts.metadata.size) * 1.5f
// A5 content width in mm = 148 - inner margin - outer margin
val contentWidthMm = 148f - config.layout.margins.inner - config.layout.margins.outer
for ((idx, note) in song.notes.withIndex()) {
// Estimate how many wrapped lines this note paragraph needs
val noteWidthMm = fontMetrics.measureTextWidth(note, config.fonts.metadata, config.fonts.metadata.size)
val estimatedLines = maxOf(1, kotlin.math.ceil((noteWidthMm / contentWidthMm).toDouble()).toInt())
heightMm += metaLineHeight * estimatedLines
// Paragraph spacing between note paragraphs
if (idx < song.notes.size - 1) {
heightMm += metaLineHeight * 0.3f
}
}
}
// Reference book footer: reserve space for abbreviation row + page number row + separator line
if (config.referenceBooks.isNotEmpty() && song.references.isNotEmpty()) {
val metaLineHeight = fontMetrics.measureLineHeight(config.fonts.metadata, config.fonts.metadata.size)
heightMm += metaLineHeight * 1.4f * 2 // two rows (headers + numbers)
heightMm += metaLineHeight * 0.5f // separator line gap
}
val pageCount = if (heightMm <= contentHeightMm) 1 else 2
return MeasuredSong(song, heightMm, pageCount)
}
}

View File

@@ -0,0 +1,53 @@
package de.pfadfinder.songbook.layout
import de.pfadfinder.songbook.model.*
import java.io.File
class PaginationEngine(private val config: BookConfig) {
fun paginate(measuredSongs: List<MeasuredSong>, tocPages: Int): List<PageContent> {
val pages = mutableListOf<PageContent>()
// Current page number (1-based, after TOC)
// TOC occupies pages 1..tocPages
// Content starts at page tocPages + 1
var currentPage = tocPages + 1
// Collect available filler images
val imageDir = File(config.images.directory)
val images = if (imageDir.exists() && imageDir.isDirectory) {
imageDir.listFiles { f -> f.extension.lowercase() in listOf("png", "jpg", "jpeg", "svg") }
?.map { it.absolutePath }
?.shuffled()
?.toMutableList()
?: mutableListOf()
} else {
mutableListOf()
}
var imageIndex = 0
for (ms in measuredSongs) {
if (ms.pageCount == 1) {
pages.add(PageContent.SongPage(ms.song, 0))
currentPage++
} else {
// 2-page song: must start on left page (even page number)
val isLeftPage = currentPage % 2 == 0
if (!isLeftPage) {
// Insert filler on the right page
if (images.isNotEmpty()) {
pages.add(PageContent.FillerImage(images[imageIndex % images.size]))
imageIndex++
} else {
pages.add(PageContent.BlankPage)
}
currentPage++
}
pages.add(PageContent.SongPage(ms.song, 0))
pages.add(PageContent.SongPage(ms.song, 1))
currentPage += 2
}
}
return pages
}
}

View File

@@ -0,0 +1,52 @@
package de.pfadfinder.songbook.layout
import de.pfadfinder.songbook.model.*
class TocGenerator(private val config: BookConfig) {
fun generate(pages: List<PageContent>, tocStartPage: Int): List<TocEntry> {
val entries = mutableListOf<TocEntry>()
val refAbbreviations = config.referenceBooks.associate { it.id to it.abbreviation }
// Map songs to their page numbers
val songPages = mutableMapOf<String, Int>() // song title -> first page number
var currentPageNum = tocStartPage
for (page in pages) {
currentPageNum++
if (page is PageContent.SongPage && page.pageIndex == 0) {
songPages[page.song.title] = currentPageNum
}
}
// Create entries for each song
for ((title, pageNumber) in songPages) {
// Find the song to get aliases and references
val song = pages.filterIsInstance<PageContent.SongPage>()
.find { it.song.title == title && it.pageIndex == 0 }?.song
?: continue
// Map references from book IDs to abbreviations
val refs = song.references.mapKeys { (bookId, _) ->
refAbbreviations[bookId] ?: bookId
}
entries.add(TocEntry(title = title, pageNumber = pageNumber, references = refs))
// Add alias entries
for (alias in song.aliases) {
entries.add(TocEntry(title = alias, pageNumber = pageNumber, isAlias = true, references = refs))
}
}
return entries.sortedBy { it.title.lowercase() }
}
fun estimateTocPages(songs: List<Song>): Int {
// Rough estimate: count total titles + aliases
val totalEntries = songs.sumOf { 1 + it.aliases.size }
// Assume ~40 entries per A5 page
val pages = (totalEntries / 40) + 1
// TOC should be even number of pages (for double-sided printing)
return if (pages % 2 == 0) pages else pages + 1
}
}

View File

@@ -0,0 +1,74 @@
package de.pfadfinder.songbook.layout
import io.kotest.matchers.collections.shouldBeEmpty
import io.kotest.matchers.collections.shouldHaveSize
import io.kotest.matchers.shouldBe
import kotlin.test.Test
class GapFillerTest {
@Test
fun `findImages returns empty for nonexistent directory`() {
val images = GapFiller.findImages("/nonexistent/path/to/images")
images.shouldBeEmpty()
}
@Test
fun `findImages returns empty for empty directory`() {
val tempDir = kotlin.io.path.createTempDirectory("songbook-test-empty").toFile()
try {
val images = GapFiller.findImages(tempDir.absolutePath)
images.shouldBeEmpty()
} finally {
tempDir.deleteRecursively()
}
}
@Test
fun `findImages returns image files sorted`() {
val tempDir = kotlin.io.path.createTempDirectory("songbook-test-images").toFile()
try {
java.io.File(tempDir, "c_image.png").writeText("fake")
java.io.File(tempDir, "a_image.jpg").writeText("fake")
java.io.File(tempDir, "b_image.jpeg").writeText("fake")
val images = GapFiller.findImages(tempDir.absolutePath)
images shouldHaveSize 3
// Should be sorted by absolute path (which means sorted by filename here)
images[0] shouldBe java.io.File(tempDir, "a_image.jpg").absolutePath
images[1] shouldBe java.io.File(tempDir, "b_image.jpeg").absolutePath
images[2] shouldBe java.io.File(tempDir, "c_image.png").absolutePath
} finally {
tempDir.deleteRecursively()
}
}
@Test
fun `findImages ignores non-image files`() {
val tempDir = kotlin.io.path.createTempDirectory("songbook-test-nonimage").toFile()
try {
java.io.File(tempDir, "image.png").writeText("fake")
java.io.File(tempDir, "document.txt").writeText("fake")
java.io.File(tempDir, "data.json").writeText("fake")
java.io.File(tempDir, "photo.jpg").writeText("fake")
val images = GapFiller.findImages(tempDir.absolutePath)
images shouldHaveSize 2
} finally {
tempDir.deleteRecursively()
}
}
@Test
fun `findImages returns empty when directory is a file`() {
val tempFile = kotlin.io.path.createTempFile("songbook-test-file").toFile()
try {
val images = GapFiller.findImages(tempFile.absolutePath)
images.shouldBeEmpty()
} finally {
tempFile.delete()
}
}
}

View File

@@ -0,0 +1,363 @@
package de.pfadfinder.songbook.layout
import de.pfadfinder.songbook.model.*
import io.kotest.matchers.floats.shouldBeGreaterThan
import io.kotest.matchers.floats.shouldBeLessThan
import io.kotest.matchers.shouldBe
import kotlin.test.Test
class MeasurementEngineTest {
private val fontMetrics = StubFontMetrics()
private val config = BookConfig()
private val engine = MeasurementEngine(fontMetrics, config)
// Content height = 210 - 15 (top) - 15 (bottom) = 180mm
private val contentHeight = 210f - config.layout.margins.top - config.layout.margins.bottom
@Test
fun `simple song with one verse and no chords fits on one page`() {
val song = Song(
title = "Simple Song",
sections = listOf(
SongSection(
type = SectionType.VERSE,
label = "Verse 1",
lines = listOf(
SongLine(listOf(LineSegment(text = "This is a simple line"))),
SongLine(listOf(LineSegment(text = "Another simple line")))
)
)
)
)
val result = engine.measure(song)
result.pageCount shouldBe 1
result.song shouldBe song
result.totalHeightMm shouldBeGreaterThan 0f
result.totalHeightMm shouldBeLessThan contentHeight
}
@Test
fun `song with many sections exceeds one page`() {
// Create a song with many sections to exceed content height
val sections = (1..30).map { i ->
SongSection(
type = SectionType.VERSE,
label = "Verse $i",
lines = (1..5).map {
SongLine(
listOf(
LineSegment(chord = "Am", text = "Some "),
LineSegment(chord = "G", text = "text with chords")
)
)
}
)
}
val song = Song(title = "Long Song", sections = sections)
val result = engine.measure(song)
result.pageCount shouldBe 2
result.totalHeightMm shouldBeGreaterThan contentHeight
}
@Test
fun `font metrics is used for title measurement`() {
val song = Song(title = "Title Only")
val result = engine.measure(song)
// Title contributes: measureLineHeight(title font, 14f) * 1.5
val expectedTitleHeight = fontMetrics.measureLineHeight(config.fonts.title, config.fonts.title.size) * 1.5f
// Plus gap before sections
val expectedMinHeight = expectedTitleHeight + 1.5f
result.totalHeightMm shouldBeGreaterThan (expectedMinHeight - 0.01f)
}
@Test
fun `composer and lyricist add metadata height`() {
val songWithoutMeta = Song(title = "No Meta")
val songWithMeta = Song(title = "With Meta", composer = "Bach", lyricist = "Goethe")
val heightWithout = engine.measure(songWithoutMeta).totalHeightMm
val heightWith = engine.measure(songWithMeta).totalHeightMm
val metadataLineHeight = fontMetrics.measureLineHeight(config.fonts.metadata, config.fonts.metadata.size) * 1.8f
heightWith shouldBeGreaterThan heightWithout
// The difference should be approximately the metadata line height
val diff = heightWith - heightWithout
diff shouldBeGreaterThan (metadataLineHeight - 0.01f)
diff shouldBeLessThan (metadataLineHeight + 0.01f)
}
@Test
fun `key and capo add metadata height`() {
val songWithoutKeyCap = Song(title = "No Key")
val songWithKey = Song(title = "With Key", key = "Am")
val heightWithout = engine.measure(songWithoutKeyCap).totalHeightMm
val heightWith = engine.measure(songWithKey).totalHeightMm
heightWith shouldBeGreaterThan heightWithout
}
@Test
fun `capo alone adds metadata height`() {
val songWithout = Song(title = "No Capo")
val songWith = Song(title = "With Capo", capo = 2)
val heightWithout = engine.measure(songWithout).totalHeightMm
val heightWith = engine.measure(songWith).totalHeightMm
heightWith shouldBeGreaterThan heightWithout
}
@Test
fun `chords add extra height compared to lyrics only`() {
val songWithoutChords = Song(
title = "No Chords",
sections = listOf(
SongSection(
type = SectionType.VERSE,
lines = listOf(SongLine(listOf(LineSegment(text = "Just lyrics"))))
)
)
)
val songWithChords = Song(
title = "With Chords",
sections = listOf(
SongSection(
type = SectionType.VERSE,
lines = listOf(SongLine(listOf(LineSegment(chord = "Am", text = "With chords"))))
)
)
)
val heightWithout = engine.measure(songWithoutChords).totalHeightMm
val heightWith = engine.measure(songWithChords).totalHeightMm
heightWith shouldBeGreaterThan heightWithout
}
@Test
fun `chorus section label adds height`() {
val songWithChorus = Song(
title = "Chorus Song",
sections = listOf(
SongSection(
type = SectionType.CHORUS,
lines = listOf(SongLine(listOf(LineSegment(text = "Chorus line"))))
)
)
)
val songWithVerse = Song(
title = "Verse Song",
sections = listOf(
SongSection(
type = SectionType.VERSE,
// No label, type is VERSE - no label height added
lines = listOf(SongLine(listOf(LineSegment(text = "Verse line"))))
)
)
)
val chorusHeight = engine.measure(songWithChorus).totalHeightMm
val verseHeight = engine.measure(songWithVerse).totalHeightMm
// Chorus always gets a section label, verse without label does not
chorusHeight shouldBeGreaterThan verseHeight
}
@Test
fun `empty chorus repeat reference adds height without lines`() {
val song = Song(
title = "Repeat Song",
sections = listOf(
SongSection(
type = SectionType.CHORUS,
lines = emptyList() // chorus repeat reference
)
)
)
val result = engine.measure(song)
// Should have title + gap + chorus label height + chorus repeat height + verse spacing
result.totalHeightMm shouldBeGreaterThan 0f
}
@Test
fun `notes add height at bottom`() {
val songWithout = Song(title = "No Notes")
val songWith = Song(title = "With Notes", notes = listOf("Note 1", "Note 2"))
val heightWithout = engine.measure(songWithout).totalHeightMm
val heightWith = engine.measure(songWith).totalHeightMm
heightWith shouldBeGreaterThan heightWithout
}
@Test
fun `verse spacing is added per section`() {
val oneSectionSong = Song(
title = "One Section",
sections = listOf(
SongSection(
type = SectionType.VERSE,
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
)
)
)
val twoSectionSong = Song(
title = "Two Sections",
sections = listOf(
SongSection(
type = SectionType.VERSE,
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
),
SongSection(
type = SectionType.VERSE,
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
)
)
)
val oneHeight = engine.measure(oneSectionSong).totalHeightMm
val twoHeight = engine.measure(twoSectionSong).totalHeightMm
twoHeight shouldBeGreaterThan oneHeight
}
@Test
fun `section with label adds label height`() {
val songWithLabel = Song(
title = "Labeled",
sections = listOf(
SongSection(
type = SectionType.VERSE,
label = "Verse 1",
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
)
)
)
val songWithoutLabel = Song(
title = "Unlabeled",
sections = listOf(
SongSection(
type = SectionType.VERSE,
label = null,
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
)
)
)
val labeledHeight = engine.measure(songWithLabel).totalHeightMm
val unlabeledHeight = engine.measure(songWithoutLabel).totalHeightMm
labeledHeight shouldBeGreaterThan unlabeledHeight
}
@Test
fun `references add footer height when reference books configured`() {
val configWithRefs = BookConfig(
referenceBooks = listOf(
ReferenceBook(id = "mo", name = "Mundorgel", abbreviation = "MO"),
ReferenceBook(id = "pl", name = "Pfadfinderlied", abbreviation = "PL")
)
)
val engineWithRefs = MeasurementEngine(fontMetrics, configWithRefs)
val songWithRefs = Song(
title = "With Refs",
references = mapOf("mo" to 42, "pl" to 17),
sections = listOf(
SongSection(
type = SectionType.VERSE,
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
)
)
)
val songWithoutRefs = Song(
title = "No Refs",
sections = listOf(
SongSection(
type = SectionType.VERSE,
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
)
)
)
val heightWith = engineWithRefs.measure(songWithRefs).totalHeightMm
val heightWithout = engineWithRefs.measure(songWithoutRefs).totalHeightMm
heightWith shouldBeGreaterThan heightWithout
}
@Test
fun `references do not add height when no reference books configured`() {
val songWithRefs = Song(
title = "With Refs",
references = mapOf("mo" to 42),
sections = listOf(
SongSection(
type = SectionType.VERSE,
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
)
)
)
val songWithoutRefs = Song(
title = "No Refs",
sections = listOf(
SongSection(
type = SectionType.VERSE,
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
)
)
)
// Default config has no reference books
val heightWith = engine.measure(songWithRefs).totalHeightMm
val heightWithout = engine.measure(songWithoutRefs).totalHeightMm
// Should be the same since no reference books are configured
heightWith shouldBe heightWithout
}
@Test
fun `inline image adds significant height`() {
val songWithImage = Song(
title = "With Image",
sections = listOf(
SongSection(
type = SectionType.VERSE,
lines = listOf(
SongLine(listOf(LineSegment(text = "Line before"))),
SongLine(imagePath = "images/test.png"),
SongLine(listOf(LineSegment(text = "Line after")))
)
)
)
)
val songWithoutImage = Song(
title = "No Image",
sections = listOf(
SongSection(
type = SectionType.VERSE,
lines = listOf(
SongLine(listOf(LineSegment(text = "Line before"))),
SongLine(listOf(LineSegment(text = "Line after")))
)
)
)
)
val heightWith = engine.measure(songWithImage).totalHeightMm
val heightWithout = engine.measure(songWithoutImage).totalHeightMm
// Inline image adds ~42mm (40mm image + 2mm gap)
val diff = heightWith - heightWithout
diff shouldBeGreaterThan 30f // should be substantial
}
}

View File

@@ -0,0 +1,205 @@
package de.pfadfinder.songbook.layout
import de.pfadfinder.songbook.model.*
import io.kotest.matchers.collections.shouldHaveSize
import io.kotest.matchers.shouldBe
import io.kotest.matchers.types.shouldBeInstanceOf
import kotlin.test.Test
class PaginationEngineTest {
private val config = BookConfig(images = ImagesConfig(directory = "/nonexistent/images"))
private val engine = PaginationEngine(config)
private fun song(title: String) = Song(title = title)
private fun onePage(song: Song) = MeasuredSong(song, 100f, 1)
private fun twoPage(song: Song) = MeasuredSong(song, 200f, 2)
@Test
fun `single page songs are placed sequentially`() {
val songs = listOf(
onePage(song("Song A")),
onePage(song("Song B")),
onePage(song("Song C"))
)
val pages = engine.paginate(songs, tocPages = 2)
pages shouldHaveSize 3
pages.forEach { it.shouldBeInstanceOf<PageContent.SongPage>() }
(pages[0] as PageContent.SongPage).song.title shouldBe "Song A"
(pages[1] as PageContent.SongPage).song.title shouldBe "Song B"
(pages[2] as PageContent.SongPage).song.title shouldBe "Song C"
}
@Test
fun `single page songs all have pageIndex 0`() {
val songs = listOf(
onePage(song("Song A")),
onePage(song("Song B"))
)
val pages = engine.paginate(songs, tocPages = 2)
pages.forEach {
(it as PageContent.SongPage).pageIndex shouldBe 0
}
}
@Test
fun `two page song starting on left page has no filler`() {
// tocPages = 2, so content starts at page 3 (odd/right page)
// First one-page song occupies page 3, next page is 4 (even/left)
val songs = listOf(
onePage(song("Song A")),
twoPage(song("Song B"))
)
val pages = engine.paginate(songs, tocPages = 2)
// Song A at page 3, Song B starts at page 4 (even = left)
pages shouldHaveSize 3
(pages[0] as PageContent.SongPage).song.title shouldBe "Song A"
(pages[1] as PageContent.SongPage).song.title shouldBe "Song B"
(pages[1] as PageContent.SongPage).pageIndex shouldBe 0
(pages[2] as PageContent.SongPage).song.title shouldBe "Song B"
(pages[2] as PageContent.SongPage).pageIndex shouldBe 1
}
@Test
fun `two page song on odd page gets blank filler before it`() {
// tocPages = 2, content starts at page 3 (odd/right)
// First 2-page song needs to start on even page, so filler at page 3
val songs = listOf(
twoPage(song("Song A"))
)
val pages = engine.paginate(songs, tocPages = 2)
// Blank at page 3, Song A at pages 4-5
pages shouldHaveSize 3
pages[0].shouldBeInstanceOf<PageContent.BlankPage>()
(pages[1] as PageContent.SongPage).song.title shouldBe "Song A"
(pages[1] as PageContent.SongPage).pageIndex shouldBe 0
(pages[2] as PageContent.SongPage).song.title shouldBe "Song A"
(pages[2] as PageContent.SongPage).pageIndex shouldBe 1
}
@Test
fun `two page song after two single page songs does not need filler`() {
// tocPages = 2, content starts at page 3
// Song A at page 3, Song B at page 4, Song C (2-page) should start at page 5 (odd)
// Page 5 is odd, so it needs filler
val songs = listOf(
onePage(song("Song A")),
onePage(song("Song B")),
twoPage(song("Song C"))
)
val pages = engine.paginate(songs, tocPages = 2)
// Song A at 3, Song B at 4, filler at 5, Song C at 6-7
pages shouldHaveSize 5
(pages[0] as PageContent.SongPage).song.title shouldBe "Song A"
(pages[1] as PageContent.SongPage).song.title shouldBe "Song B"
pages[2].shouldBeInstanceOf<PageContent.BlankPage>()
(pages[3] as PageContent.SongPage).song.title shouldBe "Song C"
(pages[4] as PageContent.SongPage).song.title shouldBe "Song C"
}
@Test
fun `two consecutive two-page songs are placed correctly`() {
// tocPages = 2, content starts at page 3 (odd)
// Song A (2-page): needs even start -> filler at 3, Song A at 4-5
// Song B (2-page): next page is 6 (even/left) -> no filler, Song B at 6-7
val songs = listOf(
twoPage(song("Song A")),
twoPage(song("Song B"))
)
val pages = engine.paginate(songs, tocPages = 2)
pages shouldHaveSize 5
pages[0].shouldBeInstanceOf<PageContent.BlankPage>()
(pages[1] as PageContent.SongPage).song.title shouldBe "Song A"
(pages[2] as PageContent.SongPage).song.title shouldBe "Song A"
(pages[3] as PageContent.SongPage).song.title shouldBe "Song B"
(pages[4] as PageContent.SongPage).song.title shouldBe "Song B"
}
@Test
fun `empty input produces empty output`() {
val pages = engine.paginate(emptyList(), tocPages = 2)
pages shouldHaveSize 0
}
@Test
fun `tocPages affects page numbering for alignment`() {
// tocPages = 3, content starts at page 4 (even/left)
// 2-page song should start directly on page 4 (even) - no filler needed
val songs = listOf(
twoPage(song("Song A"))
)
val pages = engine.paginate(songs, tocPages = 3)
// Page 4 is even -> no filler needed
pages shouldHaveSize 2
(pages[0] as PageContent.SongPage).song.title shouldBe "Song A"
(pages[0] as PageContent.SongPage).pageIndex shouldBe 0
(pages[1] as PageContent.SongPage).song.title shouldBe "Song A"
(pages[1] as PageContent.SongPage).pageIndex shouldBe 1
}
@Test
fun `filler uses image when images directory exists`() {
// Create a temp directory with an image file
val tempDir = kotlin.io.path.createTempDirectory("songbook-test-images").toFile()
try {
val imageFile = java.io.File(tempDir, "filler.png")
imageFile.writeText("fake image")
val configWithImages = BookConfig(images = ImagesConfig(directory = tempDir.absolutePath))
val engineWithImages = PaginationEngine(configWithImages)
val songs = listOf(twoPage(song("Song A")))
val pages = engineWithImages.paginate(songs, tocPages = 2)
// tocPages=2, start at page 3 (odd), needs filler
pages shouldHaveSize 3
val filler = pages[0]
filler.shouldBeInstanceOf<PageContent.FillerImage>()
(filler as PageContent.FillerImage).imagePath shouldBe imageFile.absolutePath
} finally {
tempDir.deleteRecursively()
}
}
@Test
fun `mixed single and two-page songs layout correctly`() {
// tocPages = 4, content starts at page 5 (odd)
val songs = listOf(
onePage(song("Song A")), // page 5
twoPage(song("Song B")), // starts page 6 (even) - no filler
onePage(song("Song C")), // page 8
onePage(song("Song D")), // page 9
twoPage(song("Song E")) // starts page 10 (even) - no filler
)
val pages = engine.paginate(songs, tocPages = 4)
pages shouldHaveSize 7
(pages[0] as PageContent.SongPage).song.title shouldBe "Song A"
(pages[1] as PageContent.SongPage).song.title shouldBe "Song B"
(pages[1] as PageContent.SongPage).pageIndex shouldBe 0
(pages[2] as PageContent.SongPage).song.title shouldBe "Song B"
(pages[2] as PageContent.SongPage).pageIndex shouldBe 1
(pages[3] as PageContent.SongPage).song.title shouldBe "Song C"
(pages[4] as PageContent.SongPage).song.title shouldBe "Song D"
(pages[5] as PageContent.SongPage).song.title shouldBe "Song E"
(pages[5] as PageContent.SongPage).pageIndex shouldBe 0
(pages[6] as PageContent.SongPage).song.title shouldBe "Song E"
(pages[6] as PageContent.SongPage).pageIndex shouldBe 1
}
}

View File

@@ -0,0 +1,12 @@
package de.pfadfinder.songbook.layout
import de.pfadfinder.songbook.model.FontMetrics
import de.pfadfinder.songbook.model.FontSpec
class StubFontMetrics : FontMetrics {
override fun measureTextWidth(text: String, font: FontSpec, size: Float): Float =
text.length * size * 0.5f * 0.3528f
override fun measureLineHeight(font: FontSpec, size: Float): Float =
size * 1.2f * 0.3528f
}

View File

@@ -0,0 +1,211 @@
package de.pfadfinder.songbook.layout
import de.pfadfinder.songbook.model.*
import io.kotest.matchers.collections.shouldBeEmpty
import io.kotest.matchers.collections.shouldHaveSize
import io.kotest.matchers.shouldBe
import kotlin.test.Test
class TocGeneratorTest {
private val config = BookConfig(
referenceBooks = listOf(
ReferenceBook(id = "mundorgel", name = "Mundorgel", abbreviation = "MO"),
ReferenceBook(id = "kljb", name = "KLJB Liederbuch", abbreviation = "KLJB")
)
)
private val generator = TocGenerator(config)
@Test
fun `generate creates entries for songs sorted alphabetically`() {
val pages = listOf(
PageContent.SongPage(Song(title = "Zebra Song"), 0),
PageContent.SongPage(Song(title = "Alpha Song"), 0),
PageContent.SongPage(Song(title = "Middle Song"), 0)
)
val entries = generator.generate(pages, tocStartPage = 0)
entries shouldHaveSize 3
entries[0].title shouldBe "Alpha Song"
entries[1].title shouldBe "Middle Song"
entries[2].title shouldBe "Zebra Song"
}
@Test
fun `generate assigns correct page numbers`() {
val pages = listOf(
PageContent.SongPage(Song(title = "Song A"), 0), // page 1
PageContent.SongPage(Song(title = "Song B"), 0), // page 2
PageContent.SongPage(Song(title = "Song C"), 0) // page 3
)
val entries = generator.generate(pages, tocStartPage = 0)
entries.find { it.title == "Song A" }!!.pageNumber shouldBe 1
entries.find { it.title == "Song B" }!!.pageNumber shouldBe 2
entries.find { it.title == "Song C" }!!.pageNumber shouldBe 3
}
@Test
fun `generate with tocStartPage offsets page numbers`() {
val pages = listOf(
PageContent.SongPage(Song(title = "Song A"), 0)
)
val entries = generator.generate(pages, tocStartPage = 4)
entries[0].pageNumber shouldBe 5
}
@Test
fun `generate creates alias entries`() {
val song = Song(title = "Original Title", aliases = listOf("Alias One", "Alias Two"))
val pages = listOf(
PageContent.SongPage(song, 0)
)
val entries = generator.generate(pages, tocStartPage = 0)
entries shouldHaveSize 3
// Sorted: Alias One, Alias Two, Original Title
entries[0].title shouldBe "Alias One"
entries[0].isAlias shouldBe true
entries[0].pageNumber shouldBe 1
entries[1].title shouldBe "Alias Two"
entries[1].isAlias shouldBe true
entries[1].pageNumber shouldBe 1
entries[2].title shouldBe "Original Title"
entries[2].isAlias shouldBe false
entries[2].pageNumber shouldBe 1
}
@Test
fun `generate maps reference book IDs to abbreviations`() {
val song = Song(
title = "Referenced Song",
references = mapOf("mundorgel" to 42, "kljb" to 117)
)
val pages = listOf(PageContent.SongPage(song, 0))
val entries = generator.generate(pages, tocStartPage = 0)
entries shouldHaveSize 1
entries[0].references shouldBe mapOf("MO" to 42, "KLJB" to 117)
}
@Test
fun `generate keeps unknown reference book IDs as-is`() {
val song = Song(
title = "Song",
references = mapOf("unknown_book" to 5)
)
val pages = listOf(PageContent.SongPage(song, 0))
val entries = generator.generate(pages, tocStartPage = 0)
entries[0].references shouldBe mapOf("unknown_book" to 5)
}
@Test
fun `generate skips filler and blank pages for page numbering`() {
val pages = listOf(
PageContent.BlankPage, // page 1
PageContent.SongPage(Song(title = "Song A"), 0), // page 2
PageContent.FillerImage("/path/to/image.png"), // page 3
PageContent.SongPage(Song(title = "Song B"), 0) // page 4
)
val entries = generator.generate(pages, tocStartPage = 0)
entries shouldHaveSize 2
entries.find { it.title == "Song A" }!!.pageNumber shouldBe 2
entries.find { it.title == "Song B" }!!.pageNumber shouldBe 4
}
@Test
fun `generate handles two-page songs correctly`() {
val song = Song(title = "Long Song")
val pages = listOf(
PageContent.SongPage(song, 0), // page 1 - first page of song
PageContent.SongPage(song, 1) // page 2 - second page of song
)
val entries = generator.generate(pages, tocStartPage = 0)
// Should only have one entry pointing to the first page
entries shouldHaveSize 1
entries[0].title shouldBe "Long Song"
entries[0].pageNumber shouldBe 1
}
@Test
fun `generate aliases share references with original song`() {
val song = Song(
title = "Main Song",
aliases = listOf("Alt Name"),
references = mapOf("mundorgel" to 10)
)
val pages = listOf(PageContent.SongPage(song, 0))
val entries = generator.generate(pages, tocStartPage = 0)
entries shouldHaveSize 2
val alias = entries.find { it.isAlias }!!
alias.references shouldBe mapOf("MO" to 10)
val main = entries.find { !it.isAlias }!!
main.references shouldBe mapOf("MO" to 10)
}
@Test
fun `generate with empty pages produces empty entries`() {
val entries = generator.generate(emptyList(), tocStartPage = 0)
entries.shouldBeEmpty()
}
@Test
fun `estimateTocPages returns even number`() {
val songs = (1..10).map { Song(title = "Song $it") }
val pages = generator.estimateTocPages(songs)
(pages % 2) shouldBe 0
}
@Test
fun `estimateTocPages accounts for aliases`() {
val songsWithoutAliases = (1..10).map { Song(title = "Song $it") }
val songsWithAliases = (1..10).map { Song(title = "Song $it", aliases = listOf("Alias $it")) }
val pagesWithout = generator.estimateTocPages(songsWithoutAliases)
val pagesWith = generator.estimateTocPages(songsWithAliases)
pagesWith shouldBe pagesWithout // both under 40 entries, same page count
}
@Test
fun `estimateTocPages with many songs returns more pages`() {
val fewSongs = (1..10).map { Song(title = "Song $it") }
val manySongs = (1..200).map { Song(title = "Song $it") }
val fewPages = generator.estimateTocPages(fewSongs)
val manyPages = generator.estimateTocPages(manySongs)
// 200 songs / 40 per page = 5 + 1 = 6 pages (already even)
manyPages shouldBe 6
fewPages shouldBe 2 // (10/40)+1 = 1, rounded up to 2 for even
}
@Test
fun `generate sorts case-insensitively`() {
val pages = listOf(
PageContent.SongPage(Song(title = "banana"), 0),
PageContent.SongPage(Song(title = "Apple"), 0),
PageContent.SongPage(Song(title = "cherry"), 0)
)
val entries = generator.generate(pages, tocStartPage = 0)
entries[0].title shouldBe "Apple"
entries[1].title shouldBe "banana"
entries[2].title shouldBe "cherry"
}
}

3
model/build.gradle.kts Normal file
View File

@@ -0,0 +1,3 @@
plugins {
id("songbook-conventions")
}

View File

@@ -0,0 +1,79 @@
package de.pfadfinder.songbook.model
data class BookConfig(
val book: BookMeta = BookMeta(),
val songs: SongsConfig = SongsConfig(),
val fonts: FontsConfig = FontsConfig(),
val layout: LayoutConfig = LayoutConfig(),
val images: ImagesConfig = ImagesConfig(),
val referenceBooks: List<ReferenceBook> = emptyList(),
val output: OutputConfig = OutputConfig(),
val foreword: ForewordConfig? = null,
val toc: TocConfig = TocConfig()
)
data class TocConfig(
val highlightColumn: String? = null // abbreviation of the column to highlight (e.g. "CL")
)
data class ForewordConfig(
val file: String = "./foreword.txt"
)
data class BookMeta(
val title: String = "Liederbuch",
val subtitle: String? = null,
val edition: String? = null,
val format: String = "A5"
)
data class SongsConfig(
val directory: String = "./songs",
val order: String = "alphabetical" // "alphabetical" or "manual"
)
data class FontsConfig(
val lyrics: FontSpec = FontSpec(family = "Helvetica", size = 10f),
val chords: FontSpec = FontSpec(family = "Helvetica", size = 9f, color = "#333333"),
val title: FontSpec = FontSpec(family = "Helvetica", size = 14f),
val metadata: FontSpec = FontSpec(family = "Helvetica", size = 8f),
val toc: FontSpec = FontSpec(family = "Helvetica", size = 9f)
)
data class FontSpec(
val family: String = "Helvetica",
val file: String? = null,
val size: Float = 10f,
val color: String = "#000000"
)
data class LayoutConfig(
val margins: Margins = Margins(),
val chordLineSpacing: Float = 3f, // mm
val verseSpacing: Float = 4f, // mm
val pageNumberPosition: String = "bottom-outer",
val metadataLabels: String = "abbreviated", // "abbreviated" (M:/T:) or "german" (Worte:/Weise:)
val metadataPosition: String = "top" // "top" (after title) or "bottom" (bottom of last page)
)
data class Margins(
val top: Float = 15f,
val bottom: Float = 15f,
val inner: Float = 20f,
val outer: Float = 12f
)
data class ImagesConfig(
val directory: String = "./images"
)
data class ReferenceBook(
val id: String,
val name: String,
val abbreviation: String
)
data class OutputConfig(
val directory: String = "./output",
val filename: String = "liederbuch.pdf"
)

View File

@@ -0,0 +1,7 @@
package de.pfadfinder.songbook.model
import java.io.OutputStream
interface BookRenderer {
fun render(layout: LayoutResult, config: BookConfig, output: OutputStream)
}

View File

@@ -0,0 +1,6 @@
package de.pfadfinder.songbook.model
interface FontMetrics {
fun measureTextWidth(text: String, font: FontSpec, size: Float): Float
fun measureLineHeight(font: FontSpec, size: Float): Float
}

View File

@@ -0,0 +1,7 @@
package de.pfadfinder.songbook.model
data class Foreword(
val quote: String? = null,
val paragraphs: List<String> = emptyList(),
val signatures: List<String> = emptyList()
)

View File

@@ -0,0 +1,27 @@
package de.pfadfinder.songbook.model
data class MeasuredSong(
val song: Song,
val totalHeightMm: Float,
val pageCount: Int // 1 or 2
)
sealed class PageContent {
data class SongPage(val song: Song, val pageIndex: Int) : PageContent() // pageIndex 0 or 1 for 2-page songs
data class FillerImage(val imagePath: String) : PageContent()
data object BlankPage : PageContent()
data class ForewordPage(val foreword: Foreword, val pageIndex: Int) : PageContent() // pageIndex 0 or 1 for multi-page forewords
}
data class LayoutResult(
val tocPages: Int,
val pages: List<PageContent>,
val tocEntries: List<TocEntry>
)
data class TocEntry(
val title: String,
val pageNumber: Int,
val isAlias: Boolean = false,
val references: Map<String, Int> = emptyMap() // bookAbbrev → page
)

View File

@@ -0,0 +1,34 @@
package de.pfadfinder.songbook.model
data class Song(
val title: String,
val aliases: List<String> = emptyList(),
val lyricist: String? = null,
val composer: String? = null,
val key: String? = null,
val tags: List<String> = emptyList(),
val notes: List<String> = emptyList(),
val references: Map<String, Int> = emptyMap(), // bookId → page number
val capo: Int? = null,
val sections: List<SongSection> = emptyList()
)
data class SongSection(
val type: SectionType,
val label: String? = null,
val lines: List<SongLine> = emptyList()
)
enum class SectionType {
VERSE, CHORUS, BRIDGE, REPEAT
}
data class SongLine(
val segments: List<LineSegment> = emptyList(),
val imagePath: String? = null // when non-null, this "line" is an inline image (segments ignored)
)
data class LineSegment(
val chord: String? = null, // null = no chord above this segment
val text: String
)

13
parser/build.gradle.kts Normal file
View File

@@ -0,0 +1,13 @@
plugins {
id("songbook-conventions")
}
dependencies {
implementation(project(":model"))
implementation("com.fasterxml.jackson.core:jackson-databind:2.18.3")
implementation("com.fasterxml.jackson.module:jackson-module-kotlin:2.18.3")
implementation("com.fasterxml.jackson.dataformat:jackson-dataformat-yaml:2.18.3")
testImplementation(kotlin("test"))
testImplementation("io.kotest:kotest-assertions-core:5.9.1")
}

View File

@@ -0,0 +1,246 @@
package de.pfadfinder.songbook.parser
import de.pfadfinder.songbook.model.*
import java.io.File
object ChordProParser {
fun parse(input: String): Song {
val lines = input.lines()
var title: String? = null
val aliases = mutableListOf<String>()
var lyricist: String? = null
var composer: String? = null
var key: String? = null
val tags = mutableListOf<String>()
val notes = mutableListOf<String>()
val references = mutableMapOf<String, Int>()
var capo: Int? = null
val sections = mutableListOf<SongSection>()
// Current section being built
var currentType: SectionType? = null
var currentLabel: String? = null
var currentLines = mutableListOf<SongLine>()
// Notes block state
var inNotesBlock = false
var currentNoteParagraph = StringBuilder()
fun flushNoteParagraph() {
if (currentNoteParagraph.isNotEmpty()) {
notes.add(currentNoteParagraph.toString().trim())
currentNoteParagraph = StringBuilder()
}
}
fun flushSection() {
if (currentType != null) {
sections.add(SongSection(type = currentType!!, label = currentLabel, lines = currentLines.toList()))
currentType = null
currentLabel = null
currentLines = mutableListOf()
}
}
for (rawLine in lines) {
val line = rawLine.trimEnd()
// Inside a notes block: collect lines as paragraphs
if (inNotesBlock) {
if (line.trimStart().startsWith("{") && line.trimEnd().endsWith("}")) {
val inner = line.trim().removePrefix("{").removeSuffix("}").trim().lowercase()
if (inner == "end_of_notes" || inner == "eon") {
flushNoteParagraph()
inNotesBlock = false
continue
}
}
if (line.isBlank()) {
flushNoteParagraph()
} else {
if (currentNoteParagraph.isNotEmpty()) {
currentNoteParagraph.append(" ")
}
currentNoteParagraph.append(line.trim())
}
continue
}
// Skip comments
if (line.trimStart().startsWith("#")) continue
// Skip empty lines
if (line.isBlank()) continue
// Directive line
if (line.trimStart().startsWith("{") && line.trimEnd().endsWith("}")) {
val inner = line.trim().removePrefix("{").removeSuffix("}").trim()
val colonIndex = inner.indexOf(':')
val directive: String
val value: String?
if (colonIndex >= 0) {
directive = inner.substring(0, colonIndex).trim().lowercase()
value = inner.substring(colonIndex + 1).trim()
} else {
directive = inner.trim().lowercase()
value = null
}
when (directive) {
"title", "t" -> title = value
"alias" -> if (value != null) aliases.add(value)
"lyricist" -> lyricist = value
"composer" -> composer = value
"key" -> key = value
"tags" -> if (value != null) {
tags.addAll(value.split(",").map { it.trim() }.filter { it.isNotEmpty() })
}
"note" -> if (value != null) notes.add(value)
"capo" -> capo = value?.toIntOrNull()
"ref" -> if (value != null) {
parseReference(value)?.let { (bookId, page) ->
references[bookId] = page
}
}
"start_of_verse", "sov" -> {
flushSection()
currentType = SectionType.VERSE
currentLabel = value
}
"end_of_verse", "eov" -> {
flushSection()
}
"start_of_chorus", "soc" -> {
flushSection()
currentType = SectionType.CHORUS
currentLabel = value
}
"end_of_chorus", "eoc" -> {
flushSection()
}
"start_of_repeat", "sor" -> {
flushSection()
currentType = SectionType.REPEAT
currentLabel = value
}
"end_of_repeat", "eor" -> {
flushSection()
}
"image" -> if (value != null) {
// Inline image within a song section
if (currentType == null) {
currentType = SectionType.VERSE
}
currentLines.add(SongLine(imagePath = value.trim()))
}
"start_of_notes", "son" -> {
inNotesBlock = true
}
"end_of_notes", "eon" -> {
// Should have been handled in the notes block above
flushNoteParagraph()
inNotesBlock = false
}
"chorus" -> {
flushSection()
sections.add(SongSection(type = SectionType.CHORUS))
}
"repeat" -> {
// Store repeat count as label on current section or create a new section
if (currentType != null) {
currentLabel = value
}
}
}
continue
}
// Text/chord line: if we're not inside a section, start an implicit VERSE
if (currentType == null) {
currentType = SectionType.VERSE
}
val songLine = parseChordLine(line)
currentLines.add(songLine)
}
// Flush any remaining section
flushSection()
return Song(
title = title ?: "",
aliases = aliases.toList(),
lyricist = lyricist,
composer = composer,
key = key,
tags = tags.toList(),
notes = notes.toList(),
references = references.toMap(),
capo = capo,
sections = sections.toList()
)
}
fun parseFile(file: File): Song = parse(file.readText())
internal fun parseChordLine(line: String): SongLine {
val segments = mutableListOf<LineSegment>()
var i = 0
val len = line.length
// Check if line starts with text before any chord
if (len > 0 && line[0] != '[') {
val nextBracket = line.indexOf('[')
if (nextBracket < 0) {
// No chords at all, entire line is text
segments.add(LineSegment(chord = null, text = line))
return SongLine(segments)
}
segments.add(LineSegment(chord = null, text = line.substring(0, nextBracket)))
i = nextBracket
}
while (i < len) {
if (line[i] == '[') {
val closeBracket = line.indexOf(']', i)
if (closeBracket < 0) {
// Malformed: treat rest as text
segments.add(LineSegment(chord = null, text = line.substring(i)))
break
}
val chord = line.substring(i + 1, closeBracket)
val textStart = closeBracket + 1
val nextBracket = line.indexOf('[', textStart)
val text = if (nextBracket < 0) {
line.substring(textStart)
} else {
line.substring(textStart, nextBracket)
}
segments.add(LineSegment(chord = chord, text = text))
i = if (nextBracket < 0) len else nextBracket
} else {
// Should not happen if logic is correct, but handle gracefully
val nextBracket = line.indexOf('[', i)
if (nextBracket < 0) {
segments.add(LineSegment(chord = null, text = line.substring(i)))
break
}
segments.add(LineSegment(chord = null, text = line.substring(i, nextBracket)))
i = nextBracket
}
}
return SongLine(segments)
}
internal fun parseReference(value: String): Pair<String, Int>? {
val parts = value.trim().split("\\s+".toRegex())
if (parts.size < 2) return null
val page = parts.last().toIntOrNull() ?: return null
val bookId = parts.dropLast(1).joinToString(" ")
return bookId to page
}
}

View File

@@ -0,0 +1,25 @@
package de.pfadfinder.songbook.parser
import com.fasterxml.jackson.databind.DeserializationFeature
import com.fasterxml.jackson.databind.ObjectMapper
import com.fasterxml.jackson.databind.PropertyNamingStrategies
import com.fasterxml.jackson.dataformat.yaml.YAMLFactory
import com.fasterxml.jackson.module.kotlin.registerKotlinModule
import de.pfadfinder.songbook.model.BookConfig
import java.io.File
object ConfigParser {
private val mapper: ObjectMapper = ObjectMapper(YAMLFactory())
.registerKotlinModule()
.setPropertyNamingStrategy(PropertyNamingStrategies.SNAKE_CASE)
.configure(DeserializationFeature.FAIL_ON_UNKNOWN_PROPERTIES, false)
fun parse(file: File): BookConfig {
return mapper.readValue(file, BookConfig::class.java)
}
fun parse(input: String): BookConfig {
return mapper.readValue(input, BookConfig::class.java)
}
}

View File

@@ -0,0 +1,96 @@
package de.pfadfinder.songbook.parser
import de.pfadfinder.songbook.model.Foreword
import java.io.File
object ForewordParser {
/**
* Parses a foreword text file into a [Foreword] object.
*
* Format:
* - Lines starting with `> ` are collected as the quote (multiple lines joined)
* - `---` is a horizontal rule separator (marks end of quote section)
* - Lines starting with `-- ` are signatures
* - Other non-blank lines are body text; blank lines separate paragraphs
*/
fun parse(input: String): Foreword {
val lines = input.lines()
val quoteLines = mutableListOf<String>()
val signatures = mutableListOf<String>()
val paragraphs = mutableListOf<String>()
var currentParagraph = StringBuilder()
var inQuote = true // Start assuming we might be in the quote section
var foundSeparator = false
for (rawLine in lines) {
val line = rawLine.trimEnd()
// Quote lines (before separator)
if (!foundSeparator && line.trimStart().startsWith("> ")) {
quoteLines.add(line.trimStart().removePrefix("> "))
continue
}
// If we had quote lines but now see non-quote content before separator,
// the quote section is done
if (!foundSeparator && quoteLines.isNotEmpty() && line.trimStart().isNotEmpty() && !line.trimStart().startsWith("> ")) {
if (line.trim() == "---") {
foundSeparator = true
inQuote = false
continue
}
}
// Separator line
if (line.trim() == "---") {
foundSeparator = true
inQuote = false
continue
}
// Signature lines
if (line.trimStart().startsWith("-- ")) {
signatures.add(line.trimStart().removePrefix("-- "))
continue
}
// Skip quote processing after we established there are no quotes
if (inQuote && quoteLines.isEmpty() && line.isBlank()) {
continue
}
inQuote = false
// Body paragraphs
if (line.isBlank()) {
if (currentParagraph.isNotEmpty()) {
paragraphs.add(currentParagraph.toString().trim())
currentParagraph = StringBuilder()
}
} else {
if (currentParagraph.isNotEmpty()) {
currentParagraph.append(" ")
}
currentParagraph.append(line.trim())
}
}
// Flush remaining paragraph
if (currentParagraph.isNotEmpty()) {
paragraphs.add(currentParagraph.toString().trim())
}
val quote = if (quoteLines.isNotEmpty()) quoteLines.joinToString(" ") else null
return Foreword(
quote = quote,
paragraphs = paragraphs,
signatures = signatures
)
}
fun parseFile(file: File): Foreword = parse(file.readText())
}

View File

@@ -0,0 +1,55 @@
package de.pfadfinder.songbook.parser
import de.pfadfinder.songbook.model.BookConfig
import de.pfadfinder.songbook.model.Song
data class ValidationError(val file: String?, val line: Int?, val message: String)
object Validator {
fun validateSong(song: Song, fileName: String? = null): List<ValidationError> {
val errors = mutableListOf<ValidationError>()
if (song.title.isBlank()) {
errors.add(ValidationError(file = fileName, line = null, message = "Song must have a title"))
}
if (song.sections.isEmpty()) {
errors.add(ValidationError(file = fileName, line = null, message = "Song must have at least one section"))
}
return errors
}
fun validateSong(song: Song, config: BookConfig, fileName: String? = null): List<ValidationError> {
val errors = validateSong(song, fileName).toMutableList()
val knownBookIds = config.referenceBooks.map { it.id }.toSet()
for ((bookId, _) in song.references) {
if (bookId !in knownBookIds) {
errors.add(
ValidationError(
file = fileName,
line = null,
message = "Reference to unknown book '$bookId'. Known books: ${knownBookIds.joinToString(", ")}"
)
)
}
}
return errors
}
fun validateConfig(config: BookConfig): List<ValidationError> {
val errors = mutableListOf<ValidationError>()
with(config.layout.margins) {
if (top <= 0) errors.add(ValidationError(file = null, line = null, message = "Top margin must be greater than 0"))
if (bottom <= 0) errors.add(ValidationError(file = null, line = null, message = "Bottom margin must be greater than 0"))
if (inner <= 0) errors.add(ValidationError(file = null, line = null, message = "Inner margin must be greater than 0"))
if (outer <= 0) errors.add(ValidationError(file = null, line = null, message = "Outer margin must be greater than 0"))
}
return errors
}
}

View File

@@ -0,0 +1,631 @@
package de.pfadfinder.songbook.parser
import de.pfadfinder.songbook.model.SectionType
import io.kotest.matchers.collections.shouldBeEmpty
import io.kotest.matchers.collections.shouldHaveSize
import io.kotest.matchers.shouldBe
import io.kotest.matchers.nulls.shouldBeNull
import io.kotest.matchers.nulls.shouldNotBeNull
import kotlin.test.Test
class ChordProParserTest {
@Test
fun `parse complete song`() {
val input = """
# This is a comment
{title: Wonderwall}
{alias: Wonderwall (Oasis)}
{lyricist: Noel Gallagher}
{composer: Noel Gallagher}
{key: F#m}
{tags: pop, rock, 90s}
{note: Play with capo on 2nd fret}
{ref: mundorgel 42}
{capo: 2}
{start_of_verse: Verse 1}
[Em7]Today is [G]gonna be the day
That they're [Dsus4]gonna throw it back to [A7sus4]you
{end_of_verse}
{start_of_chorus}
[C]And all the [D]roads we have to [Em]walk are winding
{end_of_chorus}
{chorus}
""".trimIndent()
val song = ChordProParser.parse(input)
song.title shouldBe "Wonderwall"
song.aliases shouldHaveSize 1
song.aliases[0] shouldBe "Wonderwall (Oasis)"
song.lyricist shouldBe "Noel Gallagher"
song.composer shouldBe "Noel Gallagher"
song.key shouldBe "F#m"
song.tags shouldBe listOf("pop", "rock", "90s")
song.notes shouldHaveSize 1
song.notes[0] shouldBe "Play with capo on 2nd fret"
song.references shouldBe mapOf("mundorgel" to 42)
song.capo shouldBe 2
song.sections shouldHaveSize 3
// Verse 1
val verse = song.sections[0]
verse.type shouldBe SectionType.VERSE
verse.label shouldBe "Verse 1"
verse.lines shouldHaveSize 2
// First line of verse
val firstLine = verse.lines[0]
firstLine.segments shouldHaveSize 2
firstLine.segments[0].chord shouldBe "Em7"
firstLine.segments[0].text shouldBe "Today is "
firstLine.segments[1].chord shouldBe "G"
firstLine.segments[1].text shouldBe "gonna be the day"
// Chorus
val chorus = song.sections[1]
chorus.type shouldBe SectionType.CHORUS
chorus.label.shouldBeNull()
chorus.lines shouldHaveSize 1
// Empty chorus reference
val chorusRef = song.sections[2]
chorusRef.type shouldBe SectionType.CHORUS
chorusRef.lines.shouldBeEmpty()
}
@Test
fun `parse title directive`() {
val input = "{title: My Song}"
val song = ChordProParser.parse(input)
song.title shouldBe "My Song"
}
@Test
fun `parse short title directive`() {
val input = "{t: My Song}"
val song = ChordProParser.parse(input)
song.title shouldBe "My Song"
}
@Test
fun `parse missing title results in empty string`() {
val input = """
{start_of_verse}
Hello world
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.title shouldBe ""
}
@Test
fun `comments are skipped`() {
val input = """
{title: Test}
# This is a comment
{start_of_verse}
Hello world
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.title shouldBe "Test"
song.sections shouldHaveSize 1
song.sections[0].lines shouldHaveSize 1
song.sections[0].lines[0].segments[0].text shouldBe "Hello world"
}
@Test
fun `parse chord line with no chords`() {
val line = ChordProParser.parseChordLine("Just plain text")
line.segments shouldHaveSize 1
line.segments[0].chord.shouldBeNull()
line.segments[0].text shouldBe "Just plain text"
}
@Test
fun `parse chord line starting with chord`() {
val line = ChordProParser.parseChordLine("[Am]Hello [C]World")
line.segments shouldHaveSize 2
line.segments[0].chord shouldBe "Am"
line.segments[0].text shouldBe "Hello "
line.segments[1].chord shouldBe "C"
line.segments[1].text shouldBe "World"
}
@Test
fun `parse chord line starting with text`() {
val line = ChordProParser.parseChordLine("Hello [Am]World")
line.segments shouldHaveSize 2
line.segments[0].chord.shouldBeNull()
line.segments[0].text shouldBe "Hello "
line.segments[1].chord shouldBe "Am"
line.segments[1].text shouldBe "World"
}
@Test
fun `parse chord line with chord at end`() {
val line = ChordProParser.parseChordLine("[Am]Hello [C]")
line.segments shouldHaveSize 2
line.segments[0].chord shouldBe "Am"
line.segments[0].text shouldBe "Hello "
line.segments[1].chord shouldBe "C"
line.segments[1].text shouldBe ""
}
@Test
fun `parse chord line with only chord`() {
val line = ChordProParser.parseChordLine("[Am]")
line.segments shouldHaveSize 1
line.segments[0].chord shouldBe "Am"
line.segments[0].text shouldBe ""
}
@Test
fun `parse multiple aliases`() {
val input = """
{title: Song}
{alias: Alias One}
{alias: Alias Two}
{start_of_verse}
text
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.aliases shouldBe listOf("Alias One", "Alias Two")
}
@Test
fun `parse reference with multi-word book name`() {
val ref = ChordProParser.parseReference("My Big Songbook 123")
ref.shouldNotBeNull()
ref.first shouldBe "My Big Songbook"
ref.second shouldBe 123
}
@Test
fun `parse reference with single word book name`() {
val ref = ChordProParser.parseReference("mundorgel 42")
ref.shouldNotBeNull()
ref.first shouldBe "mundorgel"
ref.second shouldBe 42
}
@Test
fun `parse reference with invalid page returns null`() {
val ref = ChordProParser.parseReference("mundorgel abc")
ref.shouldBeNull()
}
@Test
fun `parse reference with only one token returns null`() {
val ref = ChordProParser.parseReference("mundorgel")
ref.shouldBeNull()
}
@Test
fun `parse tags directive`() {
val input = """
{title: Song}
{tags: folk, german, campfire}
{start_of_verse}
text
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.tags shouldBe listOf("folk", "german", "campfire")
}
@Test
fun `parse tags with extra whitespace`() {
val input = """
{title: Song}
{tags: folk , german , campfire }
{start_of_verse}
text
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.tags shouldBe listOf("folk", "german", "campfire")
}
@Test
fun `parse chorus directive creates empty section`() {
val input = """
{title: Song}
{start_of_chorus}
[C]La la [G]la
{end_of_chorus}
{chorus}
""".trimIndent()
val song = ChordProParser.parse(input)
song.sections shouldHaveSize 2
song.sections[0].type shouldBe SectionType.CHORUS
song.sections[0].lines shouldHaveSize 1
song.sections[1].type shouldBe SectionType.CHORUS
song.sections[1].lines.shouldBeEmpty()
}
@Test
fun `parse capo directive`() {
val input = """
{title: Song}
{capo: 3}
{start_of_verse}
text
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.capo shouldBe 3
}
@Test
fun `parse capo with invalid value results in null`() {
val input = """
{title: Song}
{capo: abc}
{start_of_verse}
text
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.capo.shouldBeNull()
}
@Test
fun `parse repeat section`() {
val input = """
{title: Song}
{start_of_repeat: 2x}
[Am]La la la
{end_of_repeat}
""".trimIndent()
val song = ChordProParser.parse(input)
song.sections shouldHaveSize 1
song.sections[0].type shouldBe SectionType.REPEAT
song.sections[0].label shouldBe "2x"
song.sections[0].lines shouldHaveSize 1
}
@Test
fun `implicit verse for lines outside sections`() {
val input = """
{title: Song}
[Am]Hello [C]World
Just text
""".trimIndent()
val song = ChordProParser.parse(input)
song.sections shouldHaveSize 1
song.sections[0].type shouldBe SectionType.VERSE
song.sections[0].lines shouldHaveSize 2
}
@Test
fun `multiple sections parsed correctly`() {
val input = """
{title: Song}
{start_of_verse: 1}
Line one
{end_of_verse}
{start_of_verse: 2}
Line two
{end_of_verse}
{start_of_chorus}
Chorus line
{end_of_chorus}
""".trimIndent()
val song = ChordProParser.parse(input)
song.sections shouldHaveSize 3
song.sections[0].type shouldBe SectionType.VERSE
song.sections[0].label shouldBe "1"
song.sections[1].type shouldBe SectionType.VERSE
song.sections[1].label shouldBe "2"
song.sections[2].type shouldBe SectionType.CHORUS
}
@Test
fun `parse multiple notes`() {
val input = """
{title: Song}
{note: First note}
{note: Second note}
{start_of_verse}
text
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.notes shouldBe listOf("First note", "Second note")
}
@Test
fun `parse multiple references`() {
val input = """
{title: Song}
{ref: mundorgel 42}
{ref: pfadfinderlied 17}
{start_of_verse}
text
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.references shouldBe mapOf("mundorgel" to 42, "pfadfinderlied" to 17)
}
@Test
fun `parse key directive`() {
val input = """
{title: Song}
{key: Am}
{start_of_verse}
text
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.key shouldBe "Am"
}
@Test
fun `empty input produces song with empty title and no sections`() {
val song = ChordProParser.parse("")
song.title shouldBe ""
song.sections.shouldBeEmpty()
}
@Test
fun `malformed chord bracket treated as text`() {
val line = ChordProParser.parseChordLine("[Am broken text")
line.segments shouldHaveSize 1
line.segments[0].chord.shouldBeNull()
line.segments[0].text shouldBe "[Am broken text"
}
@Test
fun `repeat directive sets label on current section`() {
val input = """
{title: Song}
{start_of_verse}
Line one
{repeat: 3}
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.sections shouldHaveSize 1
song.sections[0].label shouldBe "3"
}
@Test
fun `parse short directives sov eov soc eoc`() {
val input = """
{title: Song}
{sov: V1}
Line one
{eov}
{soc}
Chorus
{eoc}
""".trimIndent()
val song = ChordProParser.parse(input)
song.sections shouldHaveSize 2
song.sections[0].type shouldBe SectionType.VERSE
song.sections[0].label shouldBe "V1"
song.sections[1].type shouldBe SectionType.CHORUS
}
@Test
fun `parse short directives sor eor`() {
val input = """
{title: Song}
{sor: 2x}
Repeat line
{eor}
""".trimIndent()
val song = ChordProParser.parse(input)
song.sections shouldHaveSize 1
song.sections[0].type shouldBe SectionType.REPEAT
song.sections[0].label shouldBe "2x"
}
@Test
fun `section without explicit end is flushed at end of input`() {
val input = """
{title: Song}
{start_of_verse}
Line one
Line two
""".trimIndent()
val song = ChordProParser.parse(input)
song.sections shouldHaveSize 1
song.sections[0].lines shouldHaveSize 2
}
@Test
fun `section flushed when new section starts without end directive`() {
val input = """
{title: Song}
{start_of_verse: 1}
Line one
{start_of_verse: 2}
Line two
""".trimIndent()
val song = ChordProParser.parse(input)
song.sections shouldHaveSize 2
song.sections[0].label shouldBe "1"
song.sections[0].lines shouldHaveSize 1
song.sections[1].label shouldBe "2"
song.sections[1].lines shouldHaveSize 1
}
@Test
fun `lyricist and composer directives`() {
val input = """
{title: Song}
{lyricist: John Doe}
{composer: Jane Smith}
{start_of_verse}
text
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.lyricist shouldBe "John Doe"
song.composer shouldBe "Jane Smith"
}
@Test
fun `parse consecutive chords with no text between`() {
val line = ChordProParser.parseChordLine("[Am][C][G]End")
line.segments shouldHaveSize 3
line.segments[0].chord shouldBe "Am"
line.segments[0].text shouldBe ""
line.segments[1].chord shouldBe "C"
line.segments[1].text shouldBe ""
line.segments[2].chord shouldBe "G"
line.segments[2].text shouldBe "End"
}
@Test
fun `parse notes block with multiple paragraphs`() {
val input = """
{title: Song}
{start_of_notes}
First paragraph of the notes.
It continues on the next line.
Second paragraph with different content.
{end_of_notes}
{start_of_verse}
text
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.notes shouldHaveSize 2
song.notes[0] shouldBe "First paragraph of the notes. It continues on the next line."
song.notes[1] shouldBe "Second paragraph with different content."
}
@Test
fun `parse notes block with single paragraph`() {
val input = """
{title: Song}
{start_of_notes}
A single note paragraph.
{end_of_notes}
{start_of_verse}
text
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.notes shouldHaveSize 1
song.notes[0] shouldBe "A single note paragraph."
}
@Test
fun `parse notes block with short directives son eon`() {
val input = """
{title: Song}
{son}
Short form notes.
{eon}
{start_of_verse}
text
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.notes shouldHaveSize 1
song.notes[0] shouldBe "Short form notes."
}
@Test
fun `notes block and single note directives combine`() {
val input = """
{title: Song}
{note: Single line note}
{start_of_notes}
Block note paragraph.
{end_of_notes}
{start_of_verse}
text
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.notes shouldHaveSize 2
song.notes[0] shouldBe "Single line note"
song.notes[1] shouldBe "Block note paragraph."
}
@Test
fun `parse notes block with three paragraphs`() {
val input = """
{title: Song}
{start_of_notes}
Paragraph one.
Paragraph two.
Paragraph three.
{end_of_notes}
{start_of_verse}
text
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.notes shouldHaveSize 3
song.notes[0] shouldBe "Paragraph one."
song.notes[1] shouldBe "Paragraph two."
song.notes[2] shouldBe "Paragraph three."
}
@Test
fun `parse image directive within song section`() {
val input = """
{title: Song}
{start_of_verse}
[Am]Hello world
{image: images/drawing.png}
[C]Goodbye world
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.sections shouldHaveSize 1
song.sections[0].lines shouldHaveSize 3
song.sections[0].lines[0].segments[0].chord shouldBe "Am"
song.sections[0].lines[1].imagePath shouldBe "images/drawing.png"
song.sections[0].lines[1].segments.shouldBeEmpty()
song.sections[0].lines[2].segments[0].chord shouldBe "C"
}
@Test
fun `parse image directive outside section creates implicit verse`() {
val input = """
{title: Song}
{image: images/landscape.jpg}
""".trimIndent()
val song = ChordProParser.parse(input)
song.sections shouldHaveSize 1
song.sections[0].type shouldBe SectionType.VERSE
song.sections[0].lines shouldHaveSize 1
song.sections[0].lines[0].imagePath shouldBe "images/landscape.jpg"
}
@Test
fun `parse multiple image directives`() {
val input = """
{title: Song}
{start_of_verse}
{image: img1.png}
Some text
{image: img2.png}
{end_of_verse}
""".trimIndent()
val song = ChordProParser.parse(input)
song.sections[0].lines shouldHaveSize 3
song.sections[0].lines[0].imagePath shouldBe "img1.png"
song.sections[0].lines[0].segments.shouldBeEmpty()
song.sections[0].lines[1].imagePath.shouldBeNull()
song.sections[0].lines[1].segments[0].text shouldBe "Some text"
song.sections[0].lines[2].imagePath shouldBe "img2.png"
}
}

View File

@@ -0,0 +1,254 @@
package de.pfadfinder.songbook.parser
import io.kotest.matchers.collections.shouldHaveSize
import io.kotest.matchers.nulls.shouldBeNull
import io.kotest.matchers.nulls.shouldNotBeNull
import io.kotest.matchers.shouldBe
import kotlin.test.Test
class ConfigParserTest {
private val sampleYaml = """
book:
title: "Pfadfinder Liederbuch"
subtitle: "Ausgabe 2024"
edition: "3. Auflage"
format: A5
songs:
directory: "./songs"
order: alphabetical
fonts:
lyrics: { family: "Garamond", file: "./fonts/Garamond.ttf", size: 10 }
chords: { family: "Garamond", file: "./fonts/Garamond-Bold.ttf", size: 9, color: "#333333" }
title: { family: "Garamond", file: "./fonts/Garamond-Bold.ttf", size: 14 }
metadata: { family: "Garamond", file: "./fonts/Garamond-Italic.ttf", size: 8 }
toc: { family: "Garamond", file: "./fonts/Garamond.ttf", size: 9 }
layout:
margins: { top: 15, bottom: 15, inner: 20, outer: 12 }
chord_line_spacing: 3
verse_spacing: 4
page_number_position: bottom-outer
images:
directory: "./images"
reference_books:
- id: mundorgel
name: "Mundorgel"
abbreviation: "MO"
- id: pfadfinderlied
name: "Das Pfadfinderlied"
abbreviation: "PL"
output:
directory: "./output"
filename: "liederbuch.pdf"
""".trimIndent()
@Test
fun `parse full config from yaml string`() {
val config = ConfigParser.parse(sampleYaml)
// Book meta
config.book.title shouldBe "Pfadfinder Liederbuch"
config.book.subtitle shouldBe "Ausgabe 2024"
config.book.edition shouldBe "3. Auflage"
config.book.format shouldBe "A5"
// Songs config
config.songs.directory shouldBe "./songs"
config.songs.order shouldBe "alphabetical"
// Fonts
config.fonts.lyrics.family shouldBe "Garamond"
config.fonts.lyrics.file shouldBe "./fonts/Garamond.ttf"
config.fonts.lyrics.size shouldBe 10f
config.fonts.lyrics.color shouldBe "#000000" // default
config.fonts.chords.family shouldBe "Garamond"
config.fonts.chords.file shouldBe "./fonts/Garamond-Bold.ttf"
config.fonts.chords.size shouldBe 9f
config.fonts.chords.color shouldBe "#333333"
config.fonts.title.family shouldBe "Garamond"
config.fonts.title.size shouldBe 14f
config.fonts.metadata.family shouldBe "Garamond"
config.fonts.metadata.size shouldBe 8f
config.fonts.toc.family shouldBe "Garamond"
config.fonts.toc.size shouldBe 9f
// Layout
config.layout.margins.top shouldBe 15f
config.layout.margins.bottom shouldBe 15f
config.layout.margins.inner shouldBe 20f
config.layout.margins.outer shouldBe 12f
config.layout.chordLineSpacing shouldBe 3f
config.layout.verseSpacing shouldBe 4f
config.layout.pageNumberPosition shouldBe "bottom-outer"
// Images
config.images.directory shouldBe "./images"
// Reference books
config.referenceBooks shouldHaveSize 2
config.referenceBooks[0].id shouldBe "mundorgel"
config.referenceBooks[0].name shouldBe "Mundorgel"
config.referenceBooks[0].abbreviation shouldBe "MO"
config.referenceBooks[1].id shouldBe "pfadfinderlied"
config.referenceBooks[1].name shouldBe "Das Pfadfinderlied"
config.referenceBooks[1].abbreviation shouldBe "PL"
// Output
config.output.directory shouldBe "./output"
config.output.filename shouldBe "liederbuch.pdf"
}
@Test
fun `parse minimal config uses defaults`() {
val yaml = """
book:
title: "Minimal"
""".trimIndent()
val config = ConfigParser.parse(yaml)
config.book.title shouldBe "Minimal"
config.book.format shouldBe "A5" // default
config.songs.directory shouldBe "./songs" // default
config.fonts.lyrics.family shouldBe "Helvetica" // default
config.layout.margins.top shouldBe 15f // default
config.output.filename shouldBe "liederbuch.pdf" // default
}
@Test
fun `parse config with only book section`() {
val yaml = """
book:
title: "Test"
subtitle: "Sub"
""".trimIndent()
val config = ConfigParser.parse(yaml)
config.book.title shouldBe "Test"
config.book.subtitle shouldBe "Sub"
config.book.edition shouldBe null
}
@Test
fun `parse config with reference books`() {
val yaml = """
book:
title: "Test"
reference_books:
- id: mo
name: "Mundorgel"
abbreviation: "MO"
""".trimIndent()
val config = ConfigParser.parse(yaml)
config.referenceBooks shouldHaveSize 1
config.referenceBooks[0].id shouldBe "mo"
}
@Test
fun `parse config with custom layout margins`() {
val yaml = """
book:
title: "Test"
layout:
margins:
top: 25
bottom: 20
inner: 30
outer: 15
chord_line_spacing: 5
verse_spacing: 6
""".trimIndent()
val config = ConfigParser.parse(yaml)
config.layout.margins.top shouldBe 25f
config.layout.margins.bottom shouldBe 20f
config.layout.margins.inner shouldBe 30f
config.layout.margins.outer shouldBe 15f
config.layout.chordLineSpacing shouldBe 5f
config.layout.verseSpacing shouldBe 6f
}
@Test
fun `parse config with foreword section`() {
val yaml = """
book:
title: "Test"
foreword:
file: "./vorwort.txt"
""".trimIndent()
val config = ConfigParser.parse(yaml)
config.foreword.shouldNotBeNull()
config.foreword!!.file shouldBe "./vorwort.txt"
}
@Test
fun `parse config without foreword section has null foreword`() {
val yaml = """
book:
title: "Test"
""".trimIndent()
val config = ConfigParser.parse(yaml)
config.foreword.shouldBeNull()
}
@Test
fun `parse config with toc highlight column`() {
val yaml = """
book:
title: "Test"
toc:
highlight_column: "CL"
""".trimIndent()
val config = ConfigParser.parse(yaml)
config.toc.highlightColumn shouldBe "CL"
}
@Test
fun `parse config without toc section uses defaults`() {
val yaml = """
book:
title: "Test"
""".trimIndent()
val config = ConfigParser.parse(yaml)
config.toc.highlightColumn.shouldBeNull()
}
@Test
fun `parse config with german metadata labels`() {
val yaml = """
book:
title: "Test"
layout:
metadata_labels: german
metadata_position: bottom
""".trimIndent()
val config = ConfigParser.parse(yaml)
config.layout.metadataLabels shouldBe "german"
config.layout.metadataPosition shouldBe "bottom"
}
@Test
fun `parse config with default metadata settings`() {
val yaml = """
book:
title: "Test"
""".trimIndent()
val config = ConfigParser.parse(yaml)
config.layout.metadataLabels shouldBe "abbreviated"
config.layout.metadataPosition shouldBe "top"
}
@Test
fun `parse config ignores unknown properties`() {
val yaml = """
book:
title: "Test"
unknown_field: "value"
some_extra_section:
key: value
""".trimIndent()
val config = ConfigParser.parse(yaml)
config.book.title shouldBe "Test"
}
}

View File

@@ -0,0 +1,150 @@
package de.pfadfinder.songbook.parser
import io.kotest.matchers.collections.shouldBeEmpty
import io.kotest.matchers.collections.shouldHaveSize
import io.kotest.matchers.nulls.shouldBeNull
import io.kotest.matchers.nulls.shouldNotBeNull
import io.kotest.matchers.shouldBe
import kotlin.test.Test
class ForewordParserTest {
@Test
fun `parse foreword with quote, paragraphs and signatures`() {
val input = """
> This is a quote line one
> and quote line two
---
This is the first paragraph of the foreword body.
It continues on the next line.
This is the second paragraph.
-- Max Mustermann
-- Erika Mustermann
""".trimIndent()
val foreword = ForewordParser.parse(input)
foreword.quote.shouldNotBeNull()
foreword.quote shouldBe "This is a quote line one and quote line two"
foreword.paragraphs shouldHaveSize 2
foreword.paragraphs[0] shouldBe "This is the first paragraph of the foreword body. It continues on the next line."
foreword.paragraphs[1] shouldBe "This is the second paragraph."
foreword.signatures shouldHaveSize 2
foreword.signatures[0] shouldBe "Max Mustermann"
foreword.signatures[1] shouldBe "Erika Mustermann"
}
@Test
fun `parse foreword without quote`() {
val input = """
This is just a paragraph.
And another one.
-- Author Name
""".trimIndent()
val foreword = ForewordParser.parse(input)
foreword.quote.shouldBeNull()
foreword.paragraphs shouldHaveSize 2
foreword.paragraphs[0] shouldBe "This is just a paragraph."
foreword.paragraphs[1] shouldBe "And another one."
foreword.signatures shouldHaveSize 1
foreword.signatures[0] shouldBe "Author Name"
}
@Test
fun `parse foreword without signatures`() {
val input = """
> A beautiful quote
---
The foreword body text goes here.
""".trimIndent()
val foreword = ForewordParser.parse(input)
foreword.quote shouldBe "A beautiful quote"
foreword.paragraphs shouldHaveSize 1
foreword.paragraphs[0] shouldBe "The foreword body text goes here."
foreword.signatures.shouldBeEmpty()
}
@Test
fun `parse empty foreword`() {
val foreword = ForewordParser.parse("")
foreword.quote.shouldBeNull()
foreword.paragraphs.shouldBeEmpty()
foreword.signatures.shouldBeEmpty()
}
@Test
fun `parse foreword with only paragraphs`() {
val input = """
First paragraph.
Second paragraph.
Third paragraph.
""".trimIndent()
val foreword = ForewordParser.parse(input)
foreword.quote.shouldBeNull()
foreword.paragraphs shouldHaveSize 3
foreword.paragraphs[0] shouldBe "First paragraph."
foreword.paragraphs[1] shouldBe "Second paragraph."
foreword.paragraphs[2] shouldBe "Third paragraph."
foreword.signatures.shouldBeEmpty()
}
@Test
fun `parse foreword with multi-line paragraph`() {
val input = """
This is a long paragraph that
spans multiple lines and should
be joined into a single paragraph.
""".trimIndent()
val foreword = ForewordParser.parse(input)
foreword.paragraphs shouldHaveSize 1
foreword.paragraphs[0] shouldBe "This is a long paragraph that spans multiple lines and should be joined into a single paragraph."
}
@Test
fun `parse foreword with only a quote`() {
val input = """
> Just a quote
---
""".trimIndent()
val foreword = ForewordParser.parse(input)
foreword.quote shouldBe "Just a quote"
foreword.paragraphs.shouldBeEmpty()
foreword.signatures.shouldBeEmpty()
}
@Test
fun `parse foreword with multiple signatures`() {
val input = """
Some text here.
-- Person One
-- Person Two
-- Person Three
""".trimIndent()
val foreword = ForewordParser.parse(input)
foreword.paragraphs shouldHaveSize 1
foreword.signatures shouldHaveSize 3
foreword.signatures[0] shouldBe "Person One"
foreword.signatures[1] shouldBe "Person Two"
foreword.signatures[2] shouldBe "Person Three"
}
}

View File

@@ -0,0 +1,209 @@
package de.pfadfinder.songbook.parser
import de.pfadfinder.songbook.model.*
import io.kotest.matchers.collections.shouldBeEmpty
import io.kotest.matchers.collections.shouldHaveSize
import io.kotest.matchers.string.shouldContain
import kotlin.test.Test
class ValidatorTest {
@Test
fun `valid song produces no errors`() {
val song = Song(
title = "Test Song",
sections = listOf(
SongSection(type = SectionType.VERSE, lines = listOf(
SongLine(segments = listOf(LineSegment(text = "Hello")))
))
)
)
val errors = Validator.validateSong(song)
errors.shouldBeEmpty()
}
@Test
fun `missing title produces error`() {
val song = Song(
title = "",
sections = listOf(
SongSection(type = SectionType.VERSE, lines = listOf(
SongLine(segments = listOf(LineSegment(text = "Hello")))
))
)
)
val errors = Validator.validateSong(song)
errors shouldHaveSize 1
errors[0].message shouldContain "title"
}
@Test
fun `blank title produces error`() {
val song = Song(
title = " ",
sections = listOf(
SongSection(type = SectionType.VERSE, lines = listOf(
SongLine(segments = listOf(LineSegment(text = "Hello")))
))
)
)
val errors = Validator.validateSong(song)
errors shouldHaveSize 1
errors[0].message shouldContain "title"
}
@Test
fun `empty sections produces error`() {
val song = Song(
title = "Test",
sections = emptyList()
)
val errors = Validator.validateSong(song)
errors shouldHaveSize 1
errors[0].message shouldContain "section"
}
@Test
fun `missing title and empty sections produces two errors`() {
val song = Song(title = "", sections = emptyList())
val errors = Validator.validateSong(song)
errors shouldHaveSize 2
}
@Test
fun `fileName is included in error`() {
val song = Song(title = "", sections = emptyList())
val errors = Validator.validateSong(song, "test.chopro")
errors.forEach { it.file shouldContain "test.chopro" }
}
@Test
fun `valid song with known references produces no errors`() {
val config = BookConfig(
referenceBooks = listOf(
ReferenceBook(id = "mundorgel", name = "Mundorgel", abbreviation = "MO")
)
)
val song = Song(
title = "Test",
references = mapOf("mundorgel" to 42),
sections = listOf(
SongSection(type = SectionType.VERSE, lines = listOf(
SongLine(segments = listOf(LineSegment(text = "Hello")))
))
)
)
val errors = Validator.validateSong(song, config)
errors.shouldBeEmpty()
}
@Test
fun `unknown reference book produces error`() {
val config = BookConfig(
referenceBooks = listOf(
ReferenceBook(id = "mundorgel", name = "Mundorgel", abbreviation = "MO")
)
)
val song = Song(
title = "Test",
references = mapOf("unknown_book" to 42),
sections = listOf(
SongSection(type = SectionType.VERSE, lines = listOf(
SongLine(segments = listOf(LineSegment(text = "Hello")))
))
)
)
val errors = Validator.validateSong(song, config)
errors shouldHaveSize 1
errors[0].message shouldContain "unknown_book"
}
@Test
fun `multiple unknown references produce multiple errors`() {
val config = BookConfig(referenceBooks = emptyList())
val song = Song(
title = "Test",
references = mapOf("book1" to 1, "book2" to 2),
sections = listOf(
SongSection(type = SectionType.VERSE, lines = listOf(
SongLine(segments = listOf(LineSegment(text = "Hello")))
))
)
)
val errors = Validator.validateSong(song, config)
errors shouldHaveSize 2
}
@Test
fun `valid config produces no errors`() {
val config = BookConfig()
val errors = Validator.validateConfig(config)
errors.shouldBeEmpty()
}
@Test
fun `zero top margin produces error`() {
val config = BookConfig(
layout = LayoutConfig(margins = Margins(top = 0f))
)
val errors = Validator.validateConfig(config)
errors shouldHaveSize 1
errors[0].message shouldContain "Top margin"
}
@Test
fun `negative bottom margin produces error`() {
val config = BookConfig(
layout = LayoutConfig(margins = Margins(bottom = -5f))
)
val errors = Validator.validateConfig(config)
errors shouldHaveSize 1
errors[0].message shouldContain "Bottom margin"
}
@Test
fun `negative inner margin produces error`() {
val config = BookConfig(
layout = LayoutConfig(margins = Margins(inner = -1f))
)
val errors = Validator.validateConfig(config)
errors shouldHaveSize 1
errors[0].message shouldContain "Inner margin"
}
@Test
fun `zero outer margin produces error`() {
val config = BookConfig(
layout = LayoutConfig(margins = Margins(outer = 0f))
)
val errors = Validator.validateConfig(config)
errors shouldHaveSize 1
errors[0].message shouldContain "Outer margin"
}
@Test
fun `all margins zero produces four errors`() {
val config = BookConfig(
layout = LayoutConfig(margins = Margins(top = 0f, bottom = 0f, inner = 0f, outer = 0f))
)
val errors = Validator.validateConfig(config)
errors shouldHaveSize 4
}
@Test
fun `unknown reference with fileName in error`() {
val config = BookConfig(referenceBooks = emptyList())
val song = Song(
title = "Test",
references = mapOf("book1" to 1),
sections = listOf(
SongSection(type = SectionType.VERSE, lines = listOf(
SongLine(segments = listOf(LineSegment(text = "Hello")))
))
)
)
val errors = Validator.validateSong(song, config, "myfile.chopro")
errors shouldHaveSize 1
errors[0].file shouldContain "myfile.chopro"
}
}

View File

@@ -0,0 +1,11 @@
plugins {
id("songbook-conventions")
}
dependencies {
implementation(project(":model"))
implementation("com.github.librepdf:openpdf:2.0.3")
testImplementation(kotlin("test"))
testImplementation("io.kotest:kotest-assertions-core:5.9.1")
}

View File

@@ -0,0 +1,70 @@
package de.pfadfinder.songbook.renderer.pdf
import com.lowagie.text.pdf.PdfContentByte
import de.pfadfinder.songbook.model.*
import java.awt.Color
class ChordLyricRenderer(
private val fontMetrics: PdfFontMetrics,
private val config: BookConfig
) {
// Renders a single SongLine (chord line above + lyric line below)
// Returns the total height consumed in PDF points
fun renderLine(
cb: PdfContentByte,
line: SongLine,
x: Float, // left x position in points
y: Float, // top y position in points (PDF coordinates, y goes up)
maxWidth: Float // available width in points
): Float {
val hasChords = line.segments.any { it.chord != null }
val chordFont = fontMetrics.getBaseFontBold(config.fonts.chords)
val lyricFont = fontMetrics.getBaseFont(config.fonts.lyrics)
val chordSize = config.fonts.chords.size
val lyricSize = config.fonts.lyrics.size
val chordLineHeight = chordSize * 1.2f
val lyricLineHeight = lyricSize * 1.2f
val chordLyricGap = config.layout.chordLineSpacing / 0.3528f // mm to points
var totalHeight = lyricLineHeight
if (hasChords) {
totalHeight += chordLineHeight + chordLyricGap
}
val chordColor = parseColor(config.fonts.chords.color)
// Calculate x positions for each segment
var currentX = x
for (segment in line.segments) {
if (hasChords && segment.chord != null) {
// Draw chord above
cb.beginText()
cb.setFontAndSize(chordFont, chordSize)
cb.setColorFill(chordColor)
cb.setTextMatrix(currentX, y - chordLineHeight)
cb.showText(segment.chord)
cb.endText()
}
// Draw lyric text
cb.beginText()
cb.setFontAndSize(lyricFont, lyricSize)
cb.setColorFill(Color.BLACK)
cb.setTextMatrix(currentX, y - totalHeight)
cb.showText(segment.text)
cb.endText()
currentX += lyricFont.getWidthPoint(segment.text, lyricSize)
}
return totalHeight
}
private fun parseColor(hex: String): Color {
val clean = hex.removePrefix("#")
val r = clean.substring(0, 2).toInt(16)
val g = clean.substring(2, 4).toInt(16)
val b = clean.substring(4, 6).toInt(16)
return Color(r, g, b)
}
}

View File

@@ -0,0 +1,37 @@
package de.pfadfinder.songbook.renderer.pdf
import com.lowagie.text.pdf.PdfContentByte
import de.pfadfinder.songbook.model.BookConfig
import java.awt.Color
class PageDecorator(
private val fontMetrics: PdfFontMetrics,
private val config: BookConfig
) {
fun addPageNumber(cb: PdfContentByte, pageNumber: Int, pageWidth: Float, pageHeight: Float) {
val font = fontMetrics.getBaseFont(config.fonts.metadata)
val fontSize = config.fonts.metadata.size
val text = pageNumber.toString()
val textWidth = font.getWidthPoint(text, fontSize)
val marginBottom = config.layout.margins.bottom / 0.3528f // mm to points
val marginOuter = config.layout.margins.outer / 0.3528f
val y = marginBottom / 2 // center in bottom margin
// Outer position: even pages -> left, odd pages -> right (for book binding)
val isRightPage = pageNumber % 2 == 1
val x = if (isRightPage) {
pageWidth - marginOuter / 2 - textWidth / 2
} else {
marginOuter / 2 - textWidth / 2
}
cb.beginText()
cb.setFontAndSize(font, fontSize)
cb.setColorFill(Color.DARK_GRAY)
cb.setTextMatrix(x, y)
cb.showText(text)
cb.endText()
}
}

View File

@@ -0,0 +1,551 @@
package de.pfadfinder.songbook.renderer.pdf
import com.lowagie.text.*
import com.lowagie.text.pdf.*
import de.pfadfinder.songbook.model.*
import java.awt.Color
import java.io.OutputStream
class PdfBookRenderer : BookRenderer {
override fun render(layout: LayoutResult, config: BookConfig, output: OutputStream) {
val fontMetrics = PdfFontMetrics()
val chordLyricRenderer = ChordLyricRenderer(fontMetrics, config)
val tocRenderer = TocRenderer(fontMetrics, config)
val pageDecorator = PageDecorator(fontMetrics, config)
// A5 page size in points: 148mm x 210mm -> 419.53 x 595.28 points
val pageSize = if (config.book.format == "A5") PageSize.A5 else PageSize.A4
val marginInner = config.layout.margins.inner / 0.3528f
val marginOuter = config.layout.margins.outer / 0.3528f
val marginTop = config.layout.margins.top / 0.3528f
val marginBottom = config.layout.margins.bottom / 0.3528f
// Start with right-page margins (page 1 is right/odd page)
val document = Document(pageSize, marginInner, marginOuter, marginTop, marginBottom)
val writer = PdfWriter.getInstance(document, output)
document.open()
// Render TOC first
if (layout.tocEntries.isNotEmpty()) {
tocRenderer.render(document, writer, layout.tocEntries)
// Add blank pages to fill TOC allocation
repeat(layout.tocPages - 1) {
document.newPage()
// Force new page even if empty
writer.directContent.let { cb ->
cb.beginText()
cb.endText()
}
}
document.newPage()
}
// Render content pages
var currentPageNum = layout.tocPages + 1
for (pageContent in layout.pages) {
// Swap margins for left/right pages
val isRightPage = currentPageNum % 2 == 1
if (isRightPage) {
document.setMargins(marginInner, marginOuter, marginTop, marginBottom)
} else {
document.setMargins(marginOuter, marginInner, marginTop, marginBottom)
}
document.newPage()
val cb = writer.directContent
val contentWidth = pageSize.width - marginInner - marginOuter
val contentTop = pageSize.height - marginTop
when (pageContent) {
is PageContent.SongPage -> {
val leftMargin = if (isRightPage) marginInner else marginOuter
renderSongPage(
cb, chordLyricRenderer, fontMetrics, config,
pageContent.song, pageContent.pageIndex,
contentTop, leftMargin, contentWidth
)
}
is PageContent.FillerImage -> {
renderFillerImage(document, pageContent.imagePath, pageSize)
}
is PageContent.BlankPage -> {
// Empty page - just add invisible content to force page creation
cb.beginText()
cb.endText()
}
is PageContent.ForewordPage -> {
val leftMargin = if (isRightPage) marginInner else marginOuter
renderForewordPage(
cb, fontMetrics, config,
pageContent.foreword, pageContent.pageIndex,
contentTop, leftMargin, contentWidth
)
}
}
pageDecorator.addPageNumber(cb, currentPageNum, pageSize.width, pageSize.height)
currentPageNum++
}
document.close()
}
private fun renderSongPage(
cb: PdfContentByte,
chordLyricRenderer: ChordLyricRenderer,
fontMetrics: PdfFontMetrics,
config: BookConfig,
song: Song,
pageIndex: Int, // 0 for first page, 1 for second page of 2-page songs
contentTop: Float,
leftMargin: Float,
contentWidth: Float
) {
var y = contentTop
val renderMetaAtBottom = config.layout.metadataPosition == "bottom"
if (pageIndex == 0) {
// Render title
val titleFont = fontMetrics.getBaseFont(config.fonts.title)
val titleSize = config.fonts.title.size
cb.beginText()
cb.setFontAndSize(titleFont, titleSize)
cb.setColorFill(Color.BLACK)
cb.setTextMatrix(leftMargin, y - titleSize)
cb.showText(song.title)
cb.endText()
y -= titleSize * 1.5f
// Render metadata line (composer/lyricist) - at top position only
if (!renderMetaAtBottom) {
val metaParts = buildMetadataLines(song, config)
if (metaParts.isNotEmpty()) {
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
val metaSize = config.fonts.metadata.size
for (metaLine in metaParts) {
cb.beginText()
cb.setFontAndSize(metaFont, metaSize)
cb.setColorFill(Color.GRAY)
cb.setTextMatrix(leftMargin, y - metaSize)
cb.showText(metaLine)
cb.endText()
y -= metaSize * 1.8f
}
}
}
// Render key and capo
val infoParts = mutableListOf<String>()
song.key?.let { infoParts.add("Tonart: $it") }
song.capo?.let { infoParts.add("Capo: $it") }
if (infoParts.isNotEmpty()) {
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
val metaSize = config.fonts.metadata.size
cb.beginText()
cb.setFontAndSize(metaFont, metaSize)
cb.setColorFill(Color.GRAY)
cb.setTextMatrix(leftMargin, y - metaSize)
cb.showText(infoParts.joinToString(" | "))
cb.endText()
y -= metaSize * 1.8f
}
y -= 4f // gap before sections
}
// Determine which sections to render on this page
// For simplicity in this implementation, render all sections on pageIndex 0
// A more sophisticated implementation would split sections across pages
val sections = if (pageIndex == 0) song.sections else emptyList()
for (section in sections) {
// Section label
if (section.label != null || section.type == SectionType.CHORUS) {
val labelText = section.label ?: when (section.type) {
SectionType.CHORUS -> "Refrain"
SectionType.REPEAT -> "Wiederholung"
else -> null
}
if (labelText != null) {
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
val metaSize = config.fonts.metadata.size
cb.beginText()
cb.setFontAndSize(metaFont, metaSize)
cb.setColorFill(Color.DARK_GRAY)
cb.setTextMatrix(leftMargin, y - metaSize)
cb.showText(labelText)
cb.endText()
y -= metaSize * 1.5f
}
}
// Chorus indication for repeat
if (section.type == SectionType.CHORUS && section.lines.isEmpty()) {
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
val metaSize = config.fonts.metadata.size
cb.beginText()
cb.setFontAndSize(metaFont, metaSize)
cb.setColorFill(Color.DARK_GRAY)
cb.setTextMatrix(leftMargin, y - metaSize)
cb.showText("(Refrain)")
cb.endText()
y -= metaSize * 1.8f
continue
}
// Render repeat markers for REPEAT sections
if (section.type == SectionType.REPEAT) {
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
val metaSize = config.fonts.metadata.size
cb.beginText()
cb.setFontAndSize(metaFont, metaSize)
cb.setColorFill(Color.DARK_GRAY)
cb.setTextMatrix(leftMargin, y - metaSize)
cb.showText("\u2502:")
cb.endText()
}
// Render lines
for (line in section.lines) {
val imgPath = line.imagePath
if (imgPath != null) {
// Render inline image
y -= renderInlineImage(cb, imgPath, leftMargin, y, contentWidth)
} else {
val height = chordLyricRenderer.renderLine(cb, line, leftMargin, y, contentWidth)
y -= height + 1f // 1pt gap between lines
}
}
// End repeat marker
if (section.type == SectionType.REPEAT) {
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
val metaSize = config.fonts.metadata.size
cb.beginText()
cb.setFontAndSize(metaFont, metaSize)
cb.setColorFill(Color.DARK_GRAY)
cb.setTextMatrix(leftMargin, y - metaSize)
cb.showText(":\u2502")
cb.endText()
y -= metaSize * 1.5f
}
// Verse spacing
y -= config.layout.verseSpacing / 0.3528f
}
// Render notes at the bottom (with word-wrap for multi-paragraph notes)
if (pageIndex == 0 && song.notes.isNotEmpty()) {
y -= 4f
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
val metaSize = config.fonts.metadata.size
val noteLineHeight = metaSize * 1.5f
for ((idx, note) in song.notes.withIndex()) {
val wrappedLines = wrapText(note, metaFont, metaSize, contentWidth)
for (wrappedLine in wrappedLines) {
cb.beginText()
cb.setFontAndSize(metaFont, metaSize)
cb.setColorFill(Color.GRAY)
cb.setTextMatrix(leftMargin, y - metaSize)
cb.showText(wrappedLine)
cb.endText()
y -= noteLineHeight
}
// Add paragraph spacing between note paragraphs
if (idx < song.notes.size - 1) {
y -= noteLineHeight * 0.3f
}
}
}
// Render metadata at bottom of song page (if configured)
if (renderMetaAtBottom && pageIndex == 0) {
val metaParts = buildMetadataLines(song, config)
if (metaParts.isNotEmpty()) {
y -= 4f
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
val metaSize = config.fonts.metadata.size
for (metaLine in metaParts) {
val wrappedLines = wrapText(metaLine, metaFont, metaSize, contentWidth)
for (wrappedLine in wrappedLines) {
cb.beginText()
cb.setFontAndSize(metaFont, metaSize)
cb.setColorFill(Color.GRAY)
cb.setTextMatrix(leftMargin, y - metaSize)
cb.showText(wrappedLine)
cb.endText()
y -= metaSize * 1.5f
}
}
}
}
// Render reference book footer on the last page of the song
if (config.referenceBooks.isNotEmpty() && song.references.isNotEmpty()) {
val isLastPage = (pageIndex == 0) // For now, all content renders on page 0
if (isLastPage) {
renderReferenceFooter(
cb, fontMetrics, config, song,
leftMargin, contentWidth,
config.layout.margins.bottom / 0.3528f
)
}
}
}
/**
* Build metadata lines based on configured label style.
* Returns a list of lines to render (may be empty).
*/
private fun buildMetadataLines(song: Song, config: BookConfig): List<String> {
val useGerman = config.layout.metadataLabels == "german"
val lines = mutableListOf<String>()
if (useGerman) {
// German labels: "Worte und Weise:" when same person, otherwise separate
if (song.lyricist != null && song.composer != null && song.lyricist == song.composer) {
lines.add("Worte und Weise: ${song.lyricist}")
} else {
song.lyricist?.let { lines.add("Worte: $it") }
song.composer?.let { lines.add("Weise: $it") }
}
} else {
// Abbreviated labels on a single line
val parts = mutableListOf<String>()
song.composer?.let { parts.add("M: $it") }
song.lyricist?.let { parts.add("T: $it") }
if (parts.isNotEmpty()) {
lines.add(parts.joinToString(" / "))
}
}
return lines
}
/**
* Renders reference book abbreviations and page numbers as a footer row
* at the bottom of the song page, above the page number.
*/
private fun renderReferenceFooter(
cb: PdfContentByte,
fontMetrics: PdfFontMetrics,
config: BookConfig,
song: Song,
leftMargin: Float,
contentWidth: Float,
bottomMargin: Float
) {
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
val metaSize = config.fonts.metadata.size
val lineHeight = metaSize * 1.4f
// Position: just above the page number area
val footerY = bottomMargin + lineHeight * 0.5f
// Map book IDs to abbreviations
val refAbbreviations = config.referenceBooks.associate { it.id to it.abbreviation }
val books = config.referenceBooks
// Calculate column widths: evenly distribute across content width
val colWidth = contentWidth / books.size
// Row 1: Abbreviation headers
for ((i, book) in books.withIndex()) {
val x = leftMargin + i * colWidth
val abbr = book.abbreviation
val textWidth = metaFont.getWidthPoint(abbr, metaSize)
// Center text in column
val textX = x + (colWidth - textWidth) / 2
cb.beginText()
cb.setFontAndSize(metaFont, metaSize)
cb.setColorFill(Color.DARK_GRAY)
cb.setTextMatrix(textX, footerY + lineHeight)
cb.showText(abbr)
cb.endText()
}
// Row 2: Page numbers
for ((i, book) in books.withIndex()) {
val x = leftMargin + i * colWidth
val pageNum = song.references[book.id]
if (pageNum != null) {
val pageText = pageNum.toString()
val textWidth = metaFont.getWidthPoint(pageText, metaSize)
val textX = x + (colWidth - textWidth) / 2
cb.beginText()
cb.setFontAndSize(metaFont, metaSize)
cb.setColorFill(Color.DARK_GRAY)
cb.setTextMatrix(textX, footerY)
cb.showText(pageText)
cb.endText()
}
}
// Draw a thin line above the footer
cb.setLineWidth(0.3f)
cb.setColorStroke(Color.LIGHT_GRAY)
cb.moveTo(leftMargin, footerY + lineHeight * 1.5f)
cb.lineTo(leftMargin + contentWidth, footerY + lineHeight * 1.5f)
cb.stroke()
}
private fun renderForewordPage(
cb: PdfContentByte,
fontMetrics: PdfFontMetrics,
config: BookConfig,
foreword: Foreword,
pageIndex: Int,
contentTop: Float,
leftMargin: Float,
contentWidth: Float
) {
var y = contentTop
val bodyFontSpec = config.fonts.lyrics
val bodyFont = fontMetrics.getBaseFont(bodyFontSpec)
val bodySize = bodyFontSpec.size
val lineHeight = bodySize * 1.5f
if (pageIndex == 0) {
// Page 1: Quote + separator + first paragraphs
// Render quote in italic (bold)
val quoteText = foreword.quote
if (quoteText != null) {
val quoteFont = fontMetrics.getBaseFontBold(bodyFontSpec)
val quoteSize = bodySize * 1.1f
// Word-wrap the quote text
val quoteLines = wrapText(quoteText, quoteFont, quoteSize, contentWidth)
for (quoteLine in quoteLines) {
cb.beginText()
cb.setFontAndSize(quoteFont, quoteSize)
cb.setColorFill(Color.DARK_GRAY)
cb.setTextMatrix(leftMargin, y - quoteSize)
cb.showText(quoteLine)
cb.endText()
y -= quoteSize * 1.5f
}
y -= 6f // gap before separator
// Horizontal rule
cb.setLineWidth(0.5f)
cb.setColorStroke(Color.GRAY)
cb.moveTo(leftMargin, y)
cb.lineTo(leftMargin + contentWidth, y)
cb.stroke()
y -= 10f // gap after separator
}
// Render body paragraphs
for (paragraph in foreword.paragraphs) {
val wrappedLines = wrapText(paragraph, bodyFont, bodySize, contentWidth)
for (wrappedLine in wrappedLines) {
cb.beginText()
cb.setFontAndSize(bodyFont, bodySize)
cb.setColorFill(Color.BLACK)
cb.setTextMatrix(leftMargin, y - bodySize)
cb.showText(wrappedLine)
cb.endText()
y -= lineHeight
}
y -= lineHeight * 0.5f // paragraph spacing
}
// Render signatures (right-aligned)
if (foreword.signatures.isNotEmpty()) {
y -= lineHeight // extra gap before signatures
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
val metaSize = config.fonts.metadata.size
for (signature in foreword.signatures) {
val sigWidth = metaFont.getWidthPoint(signature, metaSize)
cb.beginText()
cb.setFontAndSize(metaFont, metaSize)
cb.setColorFill(Color.DARK_GRAY)
cb.setTextMatrix(leftMargin + contentWidth - sigWidth, y - metaSize)
cb.showText(signature)
cb.endText()
y -= metaSize * 1.8f
}
}
} else {
// Page 2: blank (or overflow content if needed in the future)
cb.beginText()
cb.endText()
}
}
/**
* Simple word-wrap: splits text into lines that fit within maxWidth (in points).
*/
private fun wrapText(text: String, font: BaseFont, fontSize: Float, maxWidth: Float): List<String> {
val words = text.split(" ")
val lines = mutableListOf<String>()
var currentLine = StringBuilder()
for (word in words) {
val testLine = if (currentLine.isEmpty()) word else "$currentLine $word"
val testWidth = font.getWidthPoint(testLine, fontSize)
if (testWidth <= maxWidth) {
currentLine = StringBuilder(testLine)
} else {
if (currentLine.isNotEmpty()) {
lines.add(currentLine.toString())
}
currentLine = StringBuilder(word)
}
}
if (currentLine.isNotEmpty()) {
lines.add(currentLine.toString())
}
return lines
}
/**
* Renders an inline image within a song page at the given position.
* Returns the total height consumed in PDF points.
*/
private fun renderInlineImage(
cb: PdfContentByte,
imagePath: String,
leftMargin: Float,
y: Float,
contentWidth: Float
): Float {
try {
val img = Image.getInstance(imagePath)
// Scale to fit within content width, max height 40mm (~113 points)
val maxHeight = 40f / 0.3528f // 40mm in points
img.scaleToFit(contentWidth * 0.8f, maxHeight)
// Center horizontally
val imgX = leftMargin + (contentWidth - img.scaledWidth) / 2
val imgY = y - img.scaledHeight - 3f // 3pt gap above
img.setAbsolutePosition(imgX, imgY)
cb.addImage(img)
return img.scaledHeight + 6f // image height + gaps above/below
} catch (_: Exception) {
// If image can't be loaded, consume minimal space
return 5f
}
}
private fun renderFillerImage(document: Document, imagePath: String, pageSize: Rectangle) {
try {
val img = Image.getInstance(imagePath)
img.scaleToFit(pageSize.width * 0.7f, pageSize.height * 0.7f)
img.alignment = Image.ALIGN_CENTER or Image.ALIGN_MIDDLE
document.add(img)
} catch (_: Exception) {
// If image can't be loaded, just leave the page blank
}
}
}

View File

@@ -0,0 +1,54 @@
package de.pfadfinder.songbook.renderer.pdf
import com.lowagie.text.pdf.BaseFont
import de.pfadfinder.songbook.model.FontMetrics
import de.pfadfinder.songbook.model.FontSpec
class PdfFontMetrics : FontMetrics {
private val fontCache = mutableMapOf<String, BaseFont>()
fun getBaseFont(font: FontSpec): BaseFont {
val key = font.file ?: font.family
return fontCache.getOrPut(key) {
if (font.file != null) {
BaseFont.createFont(font.file, BaseFont.IDENTITY_H, BaseFont.EMBEDDED)
} else {
// Map common family names to built-in PDF fonts
val pdfFontName = when (font.family.lowercase()) {
"helvetica" -> BaseFont.HELVETICA
"courier" -> BaseFont.COURIER
"times", "times new roman" -> BaseFont.TIMES_ROMAN
else -> BaseFont.HELVETICA
}
BaseFont.createFont(pdfFontName, BaseFont.CP1252, BaseFont.NOT_EMBEDDED)
}
}
}
// Also provide bold variants for chord fonts
fun getBaseFontBold(font: FontSpec): BaseFont {
if (font.file != null) return getBaseFont(font)
val key = "${font.family}_bold"
return fontCache.getOrPut(key) {
val pdfFontName = when (font.family.lowercase()) {
"helvetica" -> BaseFont.HELVETICA_BOLD
"courier" -> BaseFont.COURIER_BOLD
"times", "times new roman" -> BaseFont.TIMES_BOLD
else -> BaseFont.HELVETICA_BOLD
}
BaseFont.createFont(pdfFontName, BaseFont.CP1252, BaseFont.NOT_EMBEDDED)
}
}
override fun measureTextWidth(text: String, font: FontSpec, size: Float): Float {
val baseFont = getBaseFont(font)
// BaseFont.getWidthPoint returns width in PDF points
// Convert to mm: 1 point = 0.3528 mm
return baseFont.getWidthPoint(text, size) * 0.3528f
}
override fun measureLineHeight(font: FontSpec, size: Float): Float {
// Approximate line height as 1.2 * font size, converted to mm
return size * 1.2f * 0.3528f
}
}

View File

@@ -0,0 +1,108 @@
package de.pfadfinder.songbook.renderer.pdf
import com.lowagie.text.*
import com.lowagie.text.pdf.*
import de.pfadfinder.songbook.model.*
import java.awt.Color
class TocRenderer(
private val fontMetrics: PdfFontMetrics,
private val config: BookConfig
) {
// Light gray background for the highlighted column
private val highlightColor = Color(220, 220, 220)
fun render(document: Document, writer: PdfWriter, tocEntries: List<TocEntry>) {
val tocFont = fontMetrics.getBaseFont(config.fonts.toc)
val tocBoldFont = fontMetrics.getBaseFontBold(config.fonts.toc)
val fontSize = config.fonts.toc.size
// Title "Inhaltsverzeichnis"
val titleFont = Font(fontMetrics.getBaseFont(config.fonts.title), config.fonts.title.size, Font.BOLD)
val title = Paragraph("Inhaltsverzeichnis", titleFont)
title.alignment = Element.ALIGN_CENTER
title.spacingAfter = 12f
document.add(title)
// Determine columns: Title | Page | ref book abbreviations...
val refBooks = config.referenceBooks
val numCols = 2 + refBooks.size
val table = PdfPTable(numCols)
table.widthPercentage = 100f
// Set column widths: title takes most space
val widths = FloatArray(numCols)
widths[0] = 10f // title
widths[1] = 1.5f // page
for (i in refBooks.indices) {
widths[2 + i] = 1.5f
}
table.setWidths(widths)
// Determine which column index should be highlighted
val highlightAbbrev = config.toc.highlightColumn
val highlightColumnIndex: Int? = if (highlightAbbrev != null) {
// Check "Seite" (page) column first - the current book's page number column
if (highlightAbbrev == "Seite") {
1
} else {
val refIndex = refBooks.indexOfFirst { it.abbreviation == highlightAbbrev }
if (refIndex >= 0) 2 + refIndex else null
}
} else null
// Header row
val headerFont = Font(tocBoldFont, fontSize, Font.BOLD)
table.addCell(headerCell("Titel", headerFont, isHighlighted = false))
table.addCell(headerCell("Seite", headerFont, isHighlighted = highlightColumnIndex == 1))
for ((i, book) in refBooks.withIndex()) {
val isHighlighted = highlightColumnIndex == 2 + i
table.addCell(headerCell(book.abbreviation, headerFont, isHighlighted = isHighlighted))
}
table.headerRows = 1
// TOC entries
val entryFont = Font(tocFont, fontSize)
val aliasFont = Font(tocFont, fontSize, Font.ITALIC)
for (entry in tocEntries.sortedBy { it.title.lowercase() }) {
val font = if (entry.isAlias) aliasFont else entryFont
table.addCell(entryCell(entry.title, font, isHighlighted = false))
table.addCell(entryCell(entry.pageNumber.toString(), entryFont, Element.ALIGN_RIGHT, isHighlighted = highlightColumnIndex == 1))
for ((i, book) in refBooks.withIndex()) {
val ref = entry.references[book.abbreviation]
val isHighlighted = highlightColumnIndex == 2 + i
table.addCell(entryCell(ref?.toString() ?: "", entryFont, Element.ALIGN_RIGHT, isHighlighted = isHighlighted))
}
}
document.add(table)
}
private fun headerCell(text: String, font: Font, isHighlighted: Boolean): PdfPCell {
val cell = PdfPCell(Phrase(text, font))
cell.borderWidth = 0f
cell.borderWidthBottom = 0.5f
cell.paddingBottom = 4f
if (isHighlighted) {
cell.backgroundColor = highlightColor
}
return cell
}
private fun entryCell(
text: String,
font: Font,
alignment: Int = Element.ALIGN_LEFT,
isHighlighted: Boolean = false
): PdfPCell {
val cell = PdfPCell(Phrase(text, font))
cell.borderWidth = 0f
cell.horizontalAlignment = alignment
cell.paddingTop = 1f
cell.paddingBottom = 1f
if (isHighlighted) {
cell.backgroundColor = highlightColor
}
return cell
}
}

View File

@@ -0,0 +1,103 @@
package de.pfadfinder.songbook.renderer.pdf
import com.lowagie.text.Document
import com.lowagie.text.PageSize
import com.lowagie.text.pdf.PdfWriter
import de.pfadfinder.songbook.model.*
import io.kotest.matchers.floats.shouldBeGreaterThan
import java.io.ByteArrayOutputStream
import kotlin.test.Test
class ChordLyricRendererTest {
private val fontMetrics = PdfFontMetrics()
private val config = BookConfig()
private val renderer = ChordLyricRenderer(fontMetrics, config)
private fun withPdfContentByte(block: (com.lowagie.text.pdf.PdfContentByte) -> Unit) {
val baos = ByteArrayOutputStream()
val document = Document(PageSize.A5)
val writer = PdfWriter.getInstance(document, baos)
document.open()
val cb = writer.directContent
block(cb)
document.close()
}
@Test
fun `renderLine returns positive height for lyric-only line`() {
withPdfContentByte { cb ->
val line = SongLine(listOf(LineSegment(text = "Hello world")))
val height = renderer.renderLine(cb, line, 50f, 500f, 300f)
height shouldBeGreaterThan 0f
}
}
@Test
fun `renderLine returns greater height for chord+lyric line than lyric-only`() {
withPdfContentByte { cb ->
val lyricOnly = SongLine(listOf(LineSegment(text = "Hello world")))
val withChords = SongLine(listOf(LineSegment(chord = "Am", text = "Hello world")))
val lyricHeight = renderer.renderLine(cb, lyricOnly, 50f, 500f, 300f)
val chordHeight = renderer.renderLine(cb, withChords, 50f, 500f, 300f)
chordHeight shouldBeGreaterThan lyricHeight
}
}
@Test
fun `renderLine handles multiple segments`() {
withPdfContentByte { cb ->
val line = SongLine(
listOf(
LineSegment(chord = "C", text = "Amazing "),
LineSegment(chord = "G", text = "Grace, how "),
LineSegment(chord = "Am", text = "sweet the "),
LineSegment(chord = "F", text = "sound")
)
)
val height = renderer.renderLine(cb, line, 50f, 500f, 300f)
height shouldBeGreaterThan 0f
}
}
@Test
fun `renderLine handles segments with mixed chords and no-chords`() {
withPdfContentByte { cb ->
val line = SongLine(
listOf(
LineSegment(chord = "C", text = "Hello "),
LineSegment(text = "world"),
LineSegment(chord = "G", text = " today")
)
)
val height = renderer.renderLine(cb, line, 50f, 500f, 300f)
height shouldBeGreaterThan 0f
}
}
@Test
fun `renderLine handles empty text segments`() {
withPdfContentByte { cb ->
val line = SongLine(listOf(LineSegment(chord = "Am", text = "")))
val height = renderer.renderLine(cb, line, 50f, 500f, 300f)
height shouldBeGreaterThan 0f
}
}
@Test
fun `renderLine handles custom chord color from config`() {
val customConfig = BookConfig(
fonts = FontsConfig(
chords = FontSpec(family = "Helvetica", size = 9f, color = "#FF0000")
)
)
val customRenderer = ChordLyricRenderer(fontMetrics, customConfig)
withPdfContentByte { cb ->
val line = SongLine(listOf(LineSegment(chord = "Am", text = "Hello")))
val height = customRenderer.renderLine(cb, line, 50f, 500f, 300f)
height shouldBeGreaterThan 0f
}
}
}

View File

@@ -0,0 +1,55 @@
package de.pfadfinder.songbook.renderer.pdf
import com.lowagie.text.Document
import com.lowagie.text.PageSize
import com.lowagie.text.pdf.PdfWriter
import de.pfadfinder.songbook.model.BookConfig
import java.io.ByteArrayOutputStream
import kotlin.test.Test
class PageDecoratorTest {
private val fontMetrics = PdfFontMetrics()
private val config = BookConfig()
private val decorator = PageDecorator(fontMetrics, config)
private fun withPdfContentByte(block: (com.lowagie.text.pdf.PdfContentByte) -> Unit) {
val baos = ByteArrayOutputStream()
val document = Document(PageSize.A5)
val writer = PdfWriter.getInstance(document, baos)
document.open()
val cb = writer.directContent
block(cb)
document.close()
}
@Test
fun `addPageNumber renders odd page number on right side`() {
// Odd page = right side of book spread
withPdfContentByte { cb ->
decorator.addPageNumber(cb, 1, PageSize.A5.width, PageSize.A5.height)
}
}
@Test
fun `addPageNumber renders even page number on left side`() {
// Even page = left side of book spread
withPdfContentByte { cb ->
decorator.addPageNumber(cb, 2, PageSize.A5.width, PageSize.A5.height)
}
}
@Test
fun `addPageNumber handles large page numbers`() {
withPdfContentByte { cb ->
decorator.addPageNumber(cb, 999, PageSize.A5.width, PageSize.A5.height)
}
}
@Test
fun `addPageNumber works with A4 page size`() {
withPdfContentByte { cb ->
decorator.addPageNumber(cb, 5, PageSize.A4.width, PageSize.A4.height)
}
}
}

View File

@@ -0,0 +1,420 @@
package de.pfadfinder.songbook.renderer.pdf
import de.pfadfinder.songbook.model.*
import io.kotest.matchers.ints.shouldBeGreaterThan
import io.kotest.matchers.shouldBe
import java.io.ByteArrayOutputStream
import kotlin.test.Test
import kotlin.test.assertFails
class PdfBookRendererTest {
private val renderer = PdfBookRenderer()
private fun createSimpleSong(title: String = "Test Song"): Song {
return Song(
title = title,
composer = "Test Composer",
lyricist = "Test Lyricist",
key = "Am",
capo = 2,
notes = listOf("Play gently"),
sections = listOf(
SongSection(
type = SectionType.VERSE,
label = "Verse 1",
lines = listOf(
SongLine(
listOf(
LineSegment(chord = "Am", text = "Hello "),
LineSegment(chord = "C", text = "World")
)
),
SongLine(
listOf(
LineSegment(text = "This is a test line")
)
)
)
),
SongSection(
type = SectionType.CHORUS,
lines = listOf(
SongLine(
listOf(
LineSegment(chord = "F", text = "Chorus "),
LineSegment(chord = "G", text = "line")
)
)
)
)
)
)
}
@Test
fun `render produces valid PDF with single song`() {
val song = createSimpleSong()
val layout = LayoutResult(
tocPages = 0,
pages = listOf(PageContent.SongPage(song, 0)),
tocEntries = emptyList()
)
val baos = ByteArrayOutputStream()
renderer.render(layout, BookConfig(), baos)
baos.size() shouldBeGreaterThan 0
// Check PDF header
val bytes = baos.toByteArray()
val header = String(bytes.sliceArray(0..4))
header shouldBe "%PDF-"
}
@Test
fun `render produces valid PDF with TOC`() {
val song = createSimpleSong()
val layout = LayoutResult(
tocPages = 2,
pages = listOf(PageContent.SongPage(song, 0)),
tocEntries = listOf(
TocEntry(title = "Test Song", pageNumber = 3)
)
)
val baos = ByteArrayOutputStream()
renderer.render(layout, BookConfig(), baos)
baos.size() shouldBeGreaterThan 0
}
@Test
fun `render handles blank pages`() {
val layout = LayoutResult(
tocPages = 0,
pages = listOf(PageContent.BlankPage),
tocEntries = emptyList()
)
val baos = ByteArrayOutputStream()
renderer.render(layout, BookConfig(), baos)
baos.size() shouldBeGreaterThan 0
}
@Test
fun `render handles mixed page types`() {
val song = createSimpleSong()
val layout = LayoutResult(
tocPages = 0,
pages = listOf(
PageContent.SongPage(song, 0),
PageContent.BlankPage,
PageContent.SongPage(song, 0)
),
tocEntries = emptyList()
)
val baos = ByteArrayOutputStream()
renderer.render(layout, BookConfig(), baos)
baos.size() shouldBeGreaterThan 0
}
@Test
fun `render handles A4 format`() {
val song = createSimpleSong()
val config = BookConfig(book = BookMeta(format = "A4"))
val layout = LayoutResult(
tocPages = 0,
pages = listOf(PageContent.SongPage(song, 0)),
tocEntries = emptyList()
)
val baos = ByteArrayOutputStream()
renderer.render(layout, config, baos)
baos.size() shouldBeGreaterThan 0
}
@Test
fun `render handles song with all section types`() {
val song = Song(
title = "Full Song",
sections = listOf(
SongSection(
type = SectionType.VERSE,
label = "Verse 1",
lines = listOf(
SongLine(listOf(LineSegment(chord = "C", text = "Verse line")))
)
),
SongSection(
type = SectionType.CHORUS,
lines = listOf(
SongLine(listOf(LineSegment(chord = "G", text = "Chorus line")))
)
),
SongSection(
type = SectionType.BRIDGE,
label = "Bridge",
lines = listOf(
SongLine(listOf(LineSegment(text = "Bridge line")))
)
),
SongSection(
type = SectionType.REPEAT,
lines = listOf(
SongLine(listOf(LineSegment(chord = "Am", text = "Repeat line")))
)
)
)
)
val layout = LayoutResult(
tocPages = 0,
pages = listOf(PageContent.SongPage(song, 0)),
tocEntries = emptyList()
)
val baos = ByteArrayOutputStream()
renderer.render(layout, BookConfig(), baos)
baos.size() shouldBeGreaterThan 0
}
@Test
fun `render handles empty chorus section (chorus reference)`() {
val song = Song(
title = "Song with chorus ref",
sections = listOf(
SongSection(
type = SectionType.CHORUS,
lines = emptyList() // empty = just a reference
)
)
)
val layout = LayoutResult(
tocPages = 0,
pages = listOf(PageContent.SongPage(song, 0)),
tocEntries = emptyList()
)
val baos = ByteArrayOutputStream()
renderer.render(layout, BookConfig(), baos)
baos.size() shouldBeGreaterThan 0
}
@Test
fun `render handles song without metadata`() {
val song = Song(
title = "Minimal Song",
sections = listOf(
SongSection(
type = SectionType.VERSE,
lines = listOf(
SongLine(listOf(LineSegment(text = "Just lyrics")))
)
)
)
)
val layout = LayoutResult(
tocPages = 0,
pages = listOf(PageContent.SongPage(song, 0)),
tocEntries = emptyList()
)
val baos = ByteArrayOutputStream()
renderer.render(layout, BookConfig(), baos)
baos.size() shouldBeGreaterThan 0
}
@Test
fun `render handles second page of two-page song`() {
val song = createSimpleSong()
val layout = LayoutResult(
tocPages = 0,
pages = listOf(
PageContent.SongPage(song, 0),
PageContent.SongPage(song, 1)
),
tocEntries = emptyList()
)
val baos = ByteArrayOutputStream()
renderer.render(layout, BookConfig(), baos)
baos.size() shouldBeGreaterThan 0
}
@Test
fun `render handles filler image with nonexistent path gracefully`() {
val layout = LayoutResult(
tocPages = 0,
pages = listOf(PageContent.FillerImage("/nonexistent/image.png")),
tocEntries = emptyList()
)
val baos = ByteArrayOutputStream()
renderer.render(layout, BookConfig(), baos)
baos.size() shouldBeGreaterThan 0
}
@Test
fun `render handles TOC with reference books`() {
val config = BookConfig(
referenceBooks = listOf(
ReferenceBook(id = "mundorgel", name = "Mundorgel", abbreviation = "MO")
)
)
val song = createSimpleSong()
val layout = LayoutResult(
tocPages = 2,
pages = listOf(PageContent.SongPage(song, 0)),
tocEntries = listOf(
TocEntry(title = "Test Song", pageNumber = 3, references = mapOf("MO" to 42))
)
)
val baos = ByteArrayOutputStream()
renderer.render(layout, config, baos)
baos.size() shouldBeGreaterThan 0
}
@Test
fun `render handles multiple songs with proper page numbering`() {
val song1 = createSimpleSong("Song One")
val song2 = createSimpleSong("Song Two")
val layout = LayoutResult(
tocPages = 0,
pages = listOf(
PageContent.SongPage(song1, 0),
PageContent.SongPage(song2, 0)
),
tocEntries = emptyList()
)
val baos = ByteArrayOutputStream()
renderer.render(layout, BookConfig(), baos)
baos.size() shouldBeGreaterThan 0
}
@Test
fun `render handles song with multiple notes`() {
val song = Song(
title = "Song with Notes",
notes = listOf("Note 1: Play slowly", "Note 2: Repeat chorus twice"),
sections = listOf(
SongSection(
type = SectionType.VERSE,
lines = listOf(
SongLine(listOf(LineSegment(text = "A simple line")))
)
)
)
)
val layout = LayoutResult(
tocPages = 0,
pages = listOf(PageContent.SongPage(song, 0)),
tocEntries = emptyList()
)
val baos = ByteArrayOutputStream()
renderer.render(layout, BookConfig(), baos)
baos.size() shouldBeGreaterThan 0
}
@Test
fun `render with custom margins`() {
val config = BookConfig(
layout = LayoutConfig(
margins = Margins(top = 20f, bottom = 20f, inner = 25f, outer = 15f)
)
)
val song = createSimpleSong()
val layout = LayoutResult(
tocPages = 0,
pages = listOf(PageContent.SongPage(song, 0)),
tocEntries = emptyList()
)
val baos = ByteArrayOutputStream()
renderer.render(layout, config, baos)
baos.size() shouldBeGreaterThan 0
}
@Test
fun `render throws on empty layout with no content`() {
val layout = LayoutResult(
tocPages = 0,
pages = emptyList(),
tocEntries = emptyList()
)
val baos = ByteArrayOutputStream()
// OpenPDF requires at least one page of content
assertFails {
renderer.render(layout, BookConfig(), baos)
}
}
@Test
fun `render handles song with only key no capo`() {
val song = Song(
title = "Key Only Song",
key = "G",
sections = listOf(
SongSection(
type = SectionType.VERSE,
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
)
)
)
val layout = LayoutResult(
tocPages = 0,
pages = listOf(PageContent.SongPage(song, 0)),
tocEntries = emptyList()
)
val baos = ByteArrayOutputStream()
renderer.render(layout, BookConfig(), baos)
baos.size() shouldBeGreaterThan 0
}
@Test
fun `render handles song with only capo no key`() {
val song = Song(
title = "Capo Only Song",
capo = 3,
sections = listOf(
SongSection(
type = SectionType.VERSE,
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
)
)
)
val layout = LayoutResult(
tocPages = 0,
pages = listOf(PageContent.SongPage(song, 0)),
tocEntries = emptyList()
)
val baos = ByteArrayOutputStream()
renderer.render(layout, BookConfig(), baos)
baos.size() shouldBeGreaterThan 0
}
}

View File

@@ -0,0 +1,161 @@
package de.pfadfinder.songbook.renderer.pdf
import de.pfadfinder.songbook.model.FontSpec
import io.kotest.matchers.floats.shouldBeGreaterThan
import io.kotest.matchers.floats.shouldBeLessThan
import io.kotest.matchers.shouldBe
import io.kotest.matchers.types.shouldBeSameInstanceAs
import kotlin.test.Test
class PdfFontMetricsTest {
private val metrics = PdfFontMetrics()
@Test
fun `getBaseFont returns Helvetica for default font spec`() {
val font = FontSpec(family = "Helvetica", size = 10f)
val baseFont = metrics.getBaseFont(font)
// Helvetica built-in returns a non-null BaseFont
baseFont.postscriptFontName shouldBe "Helvetica"
}
@Test
fun `getBaseFont returns Courier for courier family`() {
val font = FontSpec(family = "Courier", size = 10f)
val baseFont = metrics.getBaseFont(font)
baseFont.postscriptFontName shouldBe "Courier"
}
@Test
fun `getBaseFont returns Times-Roman for times family`() {
val font = FontSpec(family = "Times", size = 10f)
val baseFont = metrics.getBaseFont(font)
baseFont.postscriptFontName shouldBe "Times-Roman"
}
@Test
fun `getBaseFont returns Times-Roman for times new roman family`() {
val font = FontSpec(family = "Times New Roman", size = 10f)
val baseFont = metrics.getBaseFont(font)
baseFont.postscriptFontName shouldBe "Times-Roman"
}
@Test
fun `getBaseFont falls back to Helvetica for unknown family`() {
val font = FontSpec(family = "UnknownFont", size = 10f)
val baseFont = metrics.getBaseFont(font)
baseFont.postscriptFontName shouldBe "Helvetica"
}
@Test
fun `getBaseFont caches fonts by family name`() {
val font = FontSpec(family = "Helvetica", size = 10f)
val first = metrics.getBaseFont(font)
val second = metrics.getBaseFont(font)
first shouldBeSameInstanceAs second
}
@Test
fun `getBaseFontBold returns Helvetica-Bold for Helvetica`() {
val font = FontSpec(family = "Helvetica", size = 10f)
val boldFont = metrics.getBaseFontBold(font)
boldFont.postscriptFontName shouldBe "Helvetica-Bold"
}
@Test
fun `getBaseFontBold returns Courier-Bold for Courier`() {
val font = FontSpec(family = "Courier", size = 10f)
val boldFont = metrics.getBaseFontBold(font)
boldFont.postscriptFontName shouldBe "Courier-Bold"
}
@Test
fun `getBaseFontBold returns Times-Bold for Times`() {
val font = FontSpec(family = "Times", size = 10f)
val boldFont = metrics.getBaseFontBold(font)
boldFont.postscriptFontName shouldBe "Times-Bold"
}
@Test
fun `getBaseFontBold falls back to Helvetica-Bold for unknown family`() {
val font = FontSpec(family = "UnknownFont", size = 10f)
val boldFont = metrics.getBaseFontBold(font)
boldFont.postscriptFontName shouldBe "Helvetica-Bold"
}
@Test
fun `getBaseFontBold returns regular font when file is specified`() {
// When a file is specified, bold should return the same as regular
// (custom fonts don't have bold variants auto-resolved)
// We can't test with a real file here, but verify the logic path:
// file != null -> delegates to getBaseFont
// Since we don't have a real font file, we test with family-based fonts
val font = FontSpec(family = "Helvetica", size = 10f)
val bold1 = metrics.getBaseFontBold(font)
val bold2 = metrics.getBaseFontBold(font)
bold1 shouldBeSameInstanceAs bold2
}
@Test
fun `measureTextWidth returns positive value for non-empty text`() {
val font = FontSpec(family = "Helvetica", size = 10f)
val width = metrics.measureTextWidth("Hello World", font, 10f)
width shouldBeGreaterThan 0f
}
@Test
fun `measureTextWidth returns zero for empty text`() {
val font = FontSpec(family = "Helvetica", size = 10f)
val width = metrics.measureTextWidth("", font, 10f)
width shouldBe 0f
}
@Test
fun `measureTextWidth wider text returns larger width`() {
val font = FontSpec(family = "Helvetica", size = 10f)
val shortWidth = metrics.measureTextWidth("Hi", font, 10f)
val longWidth = metrics.measureTextWidth("Hello World, this is longer", font, 10f)
longWidth shouldBeGreaterThan shortWidth
}
@Test
fun `measureTextWidth scales with font size`() {
val font = FontSpec(family = "Helvetica", size = 10f)
val smallWidth = metrics.measureTextWidth("Test", font, 10f)
val largeWidth = metrics.measureTextWidth("Test", font, 20f)
largeWidth shouldBeGreaterThan smallWidth
}
@Test
fun `measureTextWidth returns value in mm`() {
val font = FontSpec(family = "Helvetica", size = 10f)
val width = metrics.measureTextWidth("M", font, 10f)
// A single 'M' at 10pt should be roughly 2-4mm
width shouldBeGreaterThan 1f
width shouldBeLessThan 10f
}
@Test
fun `measureLineHeight returns positive value`() {
val font = FontSpec(family = "Helvetica", size = 10f)
val height = metrics.measureLineHeight(font, 10f)
height shouldBeGreaterThan 0f
}
@Test
fun `measureLineHeight scales with font size`() {
val font = FontSpec(family = "Helvetica", size = 10f)
val smallHeight = metrics.measureLineHeight(font, 10f)
val largeHeight = metrics.measureLineHeight(font, 20f)
largeHeight shouldBeGreaterThan smallHeight
}
@Test
fun `measureLineHeight returns value in mm`() {
val font = FontSpec(family = "Helvetica", size = 10f)
val height = metrics.measureLineHeight(font, 10f)
// 10pt * 1.2 * 0.3528 = ~4.23mm
height shouldBeGreaterThan 3f
height shouldBeLessThan 6f
}
}

View File

@@ -0,0 +1,124 @@
package de.pfadfinder.songbook.renderer.pdf
import com.lowagie.text.Document
import com.lowagie.text.PageSize
import com.lowagie.text.pdf.PdfWriter
import de.pfadfinder.songbook.model.*
import io.kotest.matchers.ints.shouldBeGreaterThan
import java.io.ByteArrayOutputStream
import kotlin.test.Test
class TocRendererTest {
private val fontMetrics = PdfFontMetrics()
private val config = BookConfig()
private val renderer = TocRenderer(fontMetrics, config)
@Test
fun `render creates TOC with entries`() {
val baos = ByteArrayOutputStream()
val document = Document(PageSize.A5)
val writer = PdfWriter.getInstance(document, baos)
document.open()
val entries = listOf(
TocEntry(title = "Amazing Grace", pageNumber = 3),
TocEntry(title = "Blowin' in the Wind", pageNumber = 5),
TocEntry(title = "Country Roads", pageNumber = 7)
)
renderer.render(document, writer, entries)
document.close()
baos.size() shouldBeGreaterThan 0
}
@Test
fun `render handles alias entries in italics`() {
val baos = ByteArrayOutputStream()
val document = Document(PageSize.A5)
val writer = PdfWriter.getInstance(document, baos)
document.open()
val entries = listOf(
TocEntry(title = "Amazing Grace", pageNumber = 3),
TocEntry(title = "Grace (Amazing)", pageNumber = 3, isAlias = true)
)
renderer.render(document, writer, entries)
document.close()
baos.size() shouldBeGreaterThan 0
}
@Test
fun `render includes reference book columns`() {
val configWithRefs = BookConfig(
referenceBooks = listOf(
ReferenceBook(id = "mundorgel", name = "Mundorgel", abbreviation = "MO"),
ReferenceBook(id = "pfadfinder", name = "Pfadfinderliederbuch", abbreviation = "PL")
)
)
val rendererWithRefs = TocRenderer(fontMetrics, configWithRefs)
val baos = ByteArrayOutputStream()
val document = Document(PageSize.A5)
val writer = PdfWriter.getInstance(document, baos)
document.open()
val entries = listOf(
TocEntry(
title = "Amazing Grace",
pageNumber = 3,
references = mapOf("MO" to 42, "PL" to 15)
),
TocEntry(
title = "Country Roads",
pageNumber = 7,
references = mapOf("MO" to 88)
)
)
rendererWithRefs.render(document, writer, entries)
document.close()
baos.size() shouldBeGreaterThan 0
}
@Test
fun `render sorts entries alphabetically`() {
val baos = ByteArrayOutputStream()
val document = Document(PageSize.A5)
val writer = PdfWriter.getInstance(document, baos)
document.open()
// Entries given out of order
val entries = listOf(
TocEntry(title = "Zzz Last", pageNumber = 10),
TocEntry(title = "Aaa First", pageNumber = 1),
TocEntry(title = "Mmm Middle", pageNumber = 5)
)
renderer.render(document, writer, entries)
document.close()
baos.size() shouldBeGreaterThan 0
}
@Test
fun `render handles empty reference books list`() {
val baos = ByteArrayOutputStream()
val document = Document(PageSize.A5)
val writer = PdfWriter.getInstance(document, baos)
document.open()
val entries = listOf(
TocEntry(title = "Test Song", pageNumber = 1)
)
renderer.render(document, writer, entries)
document.close()
baos.size() shouldBeGreaterThan 0
}
}

25
settings.gradle.kts Normal file
View File

@@ -0,0 +1,25 @@
rootProject.name = "songbook"
pluginManagement {
repositories {
gradlePluginPortal()
maven("https://maven.pkg.jetbrains.space/public/p/compose/dev")
google()
}
}
dependencyResolutionManagement {
repositories {
mavenCentral()
maven("https://maven.pkg.jetbrains.space/public/p/compose/dev")
google()
}
}
include("model")
include("parser")
include("layout")
include("renderer-pdf")
include("app")
include("cli")
include("gui")

View File

@@ -1,256 +0,0 @@
\NeedsTeXFormat{LaTeX2e}
\ProvidesPackage{songbook-style}[2026/04/01 Pfadfinder Liederbuch Style]
% --- Core packages ---
\RequirePackage{fontspec}
\RequirePackage[ngerman]{babel}
\RequirePackage[
a5paper,
top=15mm,
bottom=20mm,
inner=20mm,
outer=12mm
]{geometry}
\RequirePackage[hidelinks]{hyperref}
\RequirePackage{fancyhdr}
\RequirePackage{xcolor}
\RequirePackage{longtable}
\RequirePackage{array}
\RequirePackage{colortbl}
\RequirePackage{rotating}
\RequirePackage{graphicx}
\RequirePackage{csquotes}
\RequirePackage[minimal]{leadsheets}
\ExplSyntaxOn
\cs_new:cpn {leadsheets-library-musicsymbols-loaded} {}
\ExplSyntaxOff
\useleadsheetslibraries{chordnames,chords,shorthands,properties,templates,translations,songs}
% --- Repeat markers (used by shorthands library for |: and :| ) ---
\providecommand{\leftrepeat}{|:\,}
\providecommand{\rightrepeat}{\,:|}
\providecommand{\leftrightrepeat}{|:\,:|}
% --- Font setup ---
\setmainfont{TeX Gyre Heros}
\newfontfamily\frakfont{UnifrakturMaguntia-Book}[Path=fonts/,Extension=.ttf]
% --- Colors ---
\definecolor{tocrowgray}{gray}{0.92}
\definecolor{tocheadgray}{gray}{0.75}
% --- Page style ---
\pagestyle{fancy}
\fancyhf{}
\fancyfoot[LE]{\large\bfseries\thepage}
\fancyfoot[RO]{\large\bfseries\thepage}
\renewcommand{\headrulewidth}{0pt}
\renewcommand{\footrulewidth}{0pt}
% --- Custom song properties ---
\definesongproperty{alias}
\definesongproperty{note}
\definesongproperty{mundorgel}
\definesongproperty{pfadfinderliederbuch}
\definesongproperty{bulibu}
\definesongproperty{bulibull}
\definesongproperty{cl}
\definesongproperty{swa}
\definesongproperty{barde}
\definesongproperty{libock}
% --- leadsheets settings ---
\setleadsheets{
title-template = songbook,
verse/numbered = false,
verse/named = false,
chorus/named = false,
chorus/numbered = false,
after-song = \songendsection,
bar-shortcuts = false,
}
\setchords{
format = \small,
}
% ==========================================================================
% Song TOC matrix
% ==========================================================================
\newcounter{songnumber}
\newcounter{tocrowcount}
\ExplSyntaxOn
\iow_new:N \g__sb_toc_iow
\tl_new:N \l__sb_title_tl
\tl_new:N \l__sb_mo_tl
\tl_new:N \l__sb_pflb_tl
\tl_new:N \l__sb_num_tl
\tl_new:N \l__sb_songid_tl
\bool_new:N \g__sb_toc_opened_bool
\seq_new:N \g__sb_written_seq
% Lazy-open: only truncate the file when first song writes to it
% This ensures the TOC reads the PREVIOUS run's data before truncation
\cs_new_protected:Npn \__sb_ensure_toc_open:
{
\bool_if:NF \g__sb_toc_opened_bool
{
\iow_open:Nn \g__sb_toc_iow { \c_sys_jobname_str .songtoc }
\bool_gset_true:N \g__sb_toc_opened_bool
}
}
\AtEndDocument{
\bool_if:NT \g__sb_toc_opened_bool
{ \iow_close:N \g__sb_toc_iow }
}
\cs_new_protected:Npn \writesongtoc
{
% Use leadsheets song ID to skip duplicate calls (measurement pass)
\tl_set:NV \l__sb_songid_tl \l_leadsheets_current_song_id_tl
\seq_if_in:NVF \g__sb_written_seq \l__sb_songid_tl
{
\seq_gput_right:NV \g__sb_written_seq \l__sb_songid_tl
\__sb_ensure_toc_open:
\stepcounter{songnumber}
\tl_set:Nx \l__sb_num_tl { \int_use:N \c@songnumber }
\tl_set:Nx \l__sb_title_tl { \songproperty{title} }
\tl_set:Nx \l__sb_mo_tl { \songproperty{mundorgel} }
\tl_set:Nx \l__sb_pflb_tl { \songproperty{pfadfinderliederbuch} }
\iow_now:Nx \g__sb_toc_iow
{
\exp_not:N \songtocrow
{ \l__sb_title_tl }
{ \l__sb_mo_tl }
{ \l__sb_pflb_tl }
{ \exp_not:N \pageref { song: \l__sb_num_tl } }
}
}
% Label MUST be outside guard: measurement pass label is discarded (inside vbox),
% but the real pass label survives and gets written to .aux
\tl_set:Nx \l__sb_num_tl { \int_use:N \c@songnumber }
\label{song:\tl_use:N \l__sb_num_tl}
}
\ExplSyntaxOff
% --- Render one TOC row ---
\newcommand{\songtocrow}[4]{%
#1 & #2 & #3 & \cellcolor{tocheadgray}\textbf{#4} \\
\hline
}
% --- Rotated column header ---
\newcommand{\rotheader}[1]{%
\begin{turn}{70}\footnotesize\textbf{#1}\end{turn}%
}
% --- Print the song TOC table ---
\newcommand{\printsongtoc}{%
\thispagestyle{fancy}%
{\Large\bfseries Inhaltsverzeichnis\par}%
\vspace{5mm}%
\footnotesize
\rowcolors{2}{tocrowgray}{white}%
\begin{longtable}{%
>{\raggedright\arraybackslash}p{0.52\textwidth}|%
>{\centering\arraybackslash}p{0.10\textwidth}|%
>{\centering\arraybackslash}p{0.10\textwidth}|%
>{\centering\arraybackslash\columncolor{tocheadgray}}p{0.12\textwidth}%
}
& \rotheader{MO} & \rotheader{PfLB}
& \rotheader{\normalsize Lieder-\newline\normalsize buch} \\
\hline
\endfirsthead
& \rotheader{MO} & \rotheader{PfLB}
& \rotheader{\normalsize Lieder-\newline\normalsize buch} \\
\hline
\endhead
\InputIfFileExists{\jobname.songtoc}{}{}%
\end{longtable}%
\rowcolors{1}{}{}%
}
% ==========================================================================
% Song end section
% ==========================================================================
\newcommand{\songendsection}{%
\vfill
\ifsongproperty{note}{%
{\footnotesize\songproperty{note}\par\smallskip}%
}{}%
\begingroup\footnotesize
\ifsongproperty{lyrics}{%
\ifsongproperty{composer}{%
Worte: \songproperty{lyrics}\par
Weise: \songproperty{composer}\par
}{%
Worte und Weise: \songproperty{lyrics}\par
}%
}{%
\ifsongproperty{composer}{%
Weise: \songproperty{composer}\par
}{}%
}%
\endgroup
\vspace{3mm}%
\begingroup\footnotesize\centering
\begin{tabular}{ccc}
MO & PfLB & Liederbuch \\
\ifsongproperty{mundorgel}{\songproperty{mundorgel}}{} &
\ifsongproperty{pfadfinderliederbuch}{\songproperty{pfadfinderliederbuch}}{} &
\thepage
\end{tabular}\par
\endgroup
\newpage
}
% ==========================================================================
% Song title template
% ==========================================================================
\definesongtitletemplate{songbook}{%
{\LARGE\frakfont\songproperty{title}\par}%
\writesongtoc
\vspace{4mm}%
}
% ==========================================================================
% Image placement
% ==========================================================================
% Full-page filler image (centered, scaled to fit, own page)
% Usage: \fillerpage{images/drawing.png}
\newcommand{\fillerpage}[1]{%
\clearpage
\thispagestyle{empty}%
\vspace*{\fill}%
\begin{center}%
\includegraphics[width=0.85\textwidth,height=0.85\textheight,keepaspectratio]{#1}%
\end{center}%
\vspace*{\fill}%
\clearpage
}
% Inline image within a page (e.g., at end of a song with remaining space)
% Usage: \songimage{images/landscape.png}
\newcommand{\songimage}[1]{%
\begin{center}%
\includegraphics[width=0.8\textwidth,keepaspectratio]{#1}%
\end{center}%
}
% Full-page image with no margins (bleeds to edges)
% Usage: \fullpageimage{images/cover.png}
\newcommand{\fullpageimage}[1]{%
\clearpage
\thispagestyle{empty}%
\newgeometry{margin=0pt}%
\noindent\includegraphics[width=\paperwidth,height=\paperheight]{#1}%
\restoregeometry
\clearpage
}

View File

@@ -1,54 +0,0 @@
% songbook.tex - Pfadfinder Liederbuch
\documentclass[a5paper, 10pt, twoside]{article}
\usepackage{songbook-style}
\begin{document}
% --- Title page ---
\begin{titlepage}
\centering
\vspace*{3cm}
{\Huge\bfseries Pfadfinder Liederbuch\par}
\vspace{1cm}
{\Large Beispiel-Ausgabe\par}
\vspace{2cm}
{\large 1. Auflage, 2026\par}
\vfill
\end{titlepage}
% --- Foreword / Introductory page ---
\thispagestyle{empty}
{\large\bfseries\itshape
\enquote{Das Volkslied ist nun einmal da --, daran k\"onnen wir nicht
vorbei -- es ergreift uns stark und tief, und die Antwort auf
das Warum? bleiben wir schuldig.}
\par}
\vspace{2mm}
\noindent\rule{\textwidth}{0.4pt}
\vspace{4mm}
\small
So hei\ss t es im Vorwort des wohl bekanntesten Liederbuchs
in der Jugendbewegung, dem \textit{Zupfgeigenhansl}, aus dem Jahr 1913.
Und auch wir erleben auf Fahrt und Lager immer wieder die Kraft des
gemeinsamen Singens. Mit diesem Liederbuch haben wir eine Auswahl
an Liedern aus unterschiedlichen Quellen zusammengetragen.
Singen verbindet uns, macht Freude und ist ein entscheidendes Element
unserer Lager und Fahrt.
\vspace{5mm}
Herzlichst Gut Pfad
\clearpage
% --- Table of Contents ---
\printsongtoc
\clearpage
% --- Songs (alphabetical, auto-generated from import) ---
\input{all-songs}
\end{document}

37
songbook.yaml Normal file
View File

@@ -0,0 +1,37 @@
book:
title: "Pfadfinder Liederbuch"
subtitle: "Beispiel-Ausgabe"
edition: "1. Auflage, 2026"
format: A5
songs:
directory: "./songs"
order: alphabetical
fonts:
lyrics: { family: "Helvetica", size: 10 }
chords: { family: "Helvetica", size: 9, color: "#333333" }
title: { family: "Helvetica", size: 14 }
metadata: { family: "Helvetica", size: 8 }
toc: { family: "Helvetica", size: 9 }
layout:
margins: { top: 15, bottom: 15, inner: 20, outer: 12 }
chord_line_spacing: 3
verse_spacing: 4
page_number_position: bottom-outer
images:
directory: "./images"
reference_books:
- id: mundorgel
name: "Mundorgel"
abbreviation: "MO"
- id: pfadfinderliederbuch
name: "Pfadfinderliederbuch"
abbreviation: "PfLB"
output:
directory: "./output"
filename: "liederbuch.pdf"

View File

@@ -0,0 +1,27 @@
{title: Abend wird es wieder}
{lyricist: Christian Gottlob Barth, 1836}
{composer: Volksweise}
{key: C}
{tags: Abendlied}
{ref: pfadfinderliederbuch 12}
{start_of_verse: Strophe 1}
[C]Abend wird es [G]wieder,
[G]über Wald und [C]Feld
säuselt [F]Frieden [C]nieder,
und es [G]ruht die [C]Welt.
{end_of_verse}
{start_of_verse: Strophe 2}
[C]Nur der Bach er[G]gießet
[G]sich am Felsen [C]dort,
und er [F]braust und [C]fließet
immer, [G]immer [C]fort.
{end_of_verse}
{start_of_verse: Strophe 3}
[C]Und kein Abend [G]bringet
[G]Frieden ihm und [C]Ruh,
keine [F]Glocke [C]klinget
ihm ein [G]Rastlied [C]zu.
{end_of_verse}

View File

@@ -1,31 +0,0 @@
\begin{song}{
title = Abend wird es wieder,
lyrics = {Christian Gottlob Barth, 1836},
composer = Volksweise,
key = C,
tags = Abendlied,
pfadfinderliederbuch = 12,
}
\begin{verse}
\chord{C}Abend wird es \chord{G}wieder, \\
\chord{G}über Wald und \chord{C}Feld \\
säuselt \chord{F}Frieden \chord{C}nieder, \\
und es \chord{G}ruht die \chord{C}Welt.
\end{verse}
\begin{verse}
\chord{C}Nur der Bach er\chord{G}gießet \\
\chord{G}sich am Felsen \chord{C}dort, \\
und er \chord{F}braust und \chord{C}fließet \\
immer, \chord{G}immer \chord{C}fort.
\end{verse}
\begin{verse}
\chord{C}Und kein Abend \chord{G}bringet \\
\chord{G}Frieden ihm und \chord{C}Ruh, \\
keine \chord{F}Glocke \chord{C}klinget \\
ihm ein \chord{G}Rastlied \chord{C}zu.
\end{verse}
\end{song}

View File

@@ -1,30 +0,0 @@
\begin{song}{
title = {Abends gehn die Liebespaare},
lyrics = {Hermann Hesse},
composer = {Flo (Florian Schön), Stamm Raugrafen, BdP},
cl = 12,
}
\begin{verse}
\chord{d}Abends gehn die Liebespaar \chord{C}e langsam durc \chord{d}h das Feld, \\
F \chord{d}rauen lösen ihre \chord{C} Haare, Händle \chord{d}r zählen G \chord{C}eld, \\
B \chord{F}ürger lesen ban \chord{C}g das Neuste in dem Ab \chord{d}endblatt \chord{C}, \\
K \chord{F}inder ballen kle \chord{C}ine Fäuste, schlaf \chord{d}en tief un \chord{C}d satt. \\
Je \chord{B}der tut das ei \chord{F}nzig Wahre, folgt \chord{C}erhabner Pflicht, \\
S \chord{B}äugling, Bürger, Lieb \chord{F}espaare - und ich \chord{C}selber nic \chord{d}ht \chord{C}? \\
|: L \chord{B}eider, l \chord{F}eider, \chord{C}la \chord{d}-la leider; \chord{B}l \chord{F}a- \chord{d}l \chord{C}a \chord{d} leider. :| \\
Doch! Auch meiner Abendtaten, deren Sklav ich bin, \\
kann der Weltgeist nicht entraten, sie auch haben Sinn. \\
Und so geh ich auf und nieder, tanze innerlich, summe \\
dumme Gassenlieder, lobe Gott und mich, trinke Wein \\
und fantasiere, dass ich Pascha wär, fühle Sorgen an \\
der Niere, lächle, trinke mehr, \\
|: Weiter, weiter, immer weiter; wa-wa weiter. :| \\
Sage ja zu meinem Herzen, morgens geht es nicht, \\
spinne aus vergangenen Schmerzen spielend ein Ge- \\
dicht, sehe Mond und Sterne kreisen, ahne ihren Sinn, \\
fühle mich mit ihnen reisen einerlei wohin. \\
|: Leider, leider, la-la leider; la-la leider. :|
\end{verse}
\end{song}

View File

@@ -1,37 +0,0 @@
\begin{song}{
title = {Abends treten Elche},
lyrics = {Heinrich Eichen},
composer = {Gerd Lascheit},
bulibu = 359,
cl = 13,
swa = 6,
barde = 4,
}
\begin{verse}
\chord{a}Abends treten Elc \chord{d}he aus den Düne \chord{a}n, \\
ziehen von der Palv \chord{E}e an den Stran \chord{a}d. \\
/: W \chord{d}enn die Nac \chord{a}ht, wie e \chord{d}ine gute Mu \chord{a}tter, \\
leise deckt ihr Tu \chord{E}ch auf Haff und L \chord{a}and. :/
\end{verse}
\begin{verse}
Ruhig trinken sie vom großen Wasser, \\
darin Sterne wie am Himmel stehn. \\
/: Und sie heben ihre starken Köpfe \\
lautlos in des Sommerwindes Wehn. :/
\end{verse}
\begin{verse}
Langsam schreiten wieder sie von dannen, \\
Tiere einer längst versunknen Zeit. \\
/: Und sie schwinden in der Ferne Nebel, \\
wie im hohen Tor der Ewigkeit. :/
\end{verse}
\begin{verse}
Heinrich Eichen schrieb den Text in Erinnerung an eine mehrmalige Begeg- \\
nung mit Elchen.
\end{verse}
\end{song}

View File

@@ -1,36 +0,0 @@
\begin{song}{
title = {Abends wenn das Tageslicht},
bulibu = 360,
cl = 14,
swa = 7,
}
\begin{verse}
A \chord{A}bends wenn das Tageslich \chord{D}t verweht \\
u \chord{E}nd der Mond am Himmel steht, \\
|: s \chord{D}itzen wir am Lagerfeuer, r \chord{E}ingsum schweigt die W \chord{A}elt, \\
n \chord{D}ur der Wind sein A \chord{E}bendlied erzäh \chord{A}lt :|
\end{verse}
\begin{verse}
Flammen steigen hoch wie ein Fanal, \\
Lieder klingen durch das Tal. \\
|: Lieder aus der Heimat und von allem, was uns lieb, \\
leise der Gesang zum Himmel zieht. :|
\end{verse}
\begin{verse}
Wo auch unser Lagerfeuer brennt, \\
unterm nächtigen Firmament, \\
|: sind vergessen alle Trübsal, aller Herzen Not, \\
in uns Glaube, Treue, Freundschaft lohnt. :|
\end{verse}
\begin{verse}
Und es öffnet sich die weite Welt, \\
bis hinauf zum Sternenzelt. \\
|: Uns ́re Lieder klingen durch die Lande weit und breit, \\
schlagen Brücken über Raum und Zeit. :|
\end{verse}
\end{song}

View File

@@ -1,41 +0,0 @@
\begin{song}{
title = {Ade nun zur guten Nacht},
cl = 15,
swa = 10,
}
\begin{verse}
Ad \chord{D}e \chord{A7}nun zur gu \chord{D}ten Nacht! \\
J \chord{A7}etz \chord{D}t \chord{G}wird der Sch \chord{D}luss gema \chord{h}cht, / dass i \chord{e}ch muss \\
sch \chord{A7}eid \chord{D}en. /: \chord{A7}Im \chord{D}Sommer, da wä \chord{G}chst der Klee \chord{e}, \\
im W \chord{A7}inter, da schne \chord{D}it's den Schn \chord{h}ee, \\
da k \chord{e}omme ich wie \chord{A7}der \chord{D}.:/
\end{verse}
\begin{verse}
So trauern nun Berg und Tal, \\
wo ich viel tausendmal / bin drüber gegangen; \\
l: das hat deine Schönheit gemacht, \\
sie hat mich zum Lieben gebracht / \\
mit großem Verlangen. :l
\end{verse}
\begin{verse}
Das Brünnlein rinnt und rauscht \\
wohl unterm Holderstrauch, / wo wir gesessen. \\
l: Wie manchen Glockenschlag, \\
da Herz bei Herzen lag, / das hast du vergessen. :l
\end{verse}
\begin{verse}
Die Mädchen in der Welt \\
sind falscher als das Geld / mit ihrem Lieben. \\
l: Ade nun zur guten Nacht, \\
jetzt wird der Schluss gemacht, / \\
dass ich muss scheiden. :l \\
Das deutsche Volkslied ist seit der Mitte des 19. Jahrhunderts in Deutschland, \\
Österreich und der Schweiz bekannt. Diese Fassung mit vier Strophen ent- \\
stammt dem in der Jugendbewegung weit verbreiteten „Zupfgeigenhansl“.
\end{verse}
\end{song}

View File

@@ -1,43 +0,0 @@
\begin{song}{
title = {Alle, die mit uns auf Kaperfahrt},
lyrics = {Gottfried Wolters},
composer = {Lieselotte Holzmeister},
bulibu = 238,
cl = 17,
}
\begin{verse}
Al \chord{e}le, die mit uns auf K \chord{H7}aperfahrt \chord{e}fahren, \\
müssen Männer mit Bärte \chord{H7}n sein \chord{e}. \\
Ref.: J \chord{G}an und Hein und Klaas und Pitt, \\
di \chord{e}e haben B \chord{H7}ärte, die haben Bä \chord{e}rte. \\
J \chord{G}an und Hein und Klaas und Pitt, \\
d \chord{e}ie haben B \chord{H7}ärte, die fahren \chord{e}mit.
\end{verse}
\begin{verse}
Alle, die Tod und Teufel nicht fürchten, \\
müssen Männer mit Bärten sein.
\end{verse}
\begin{verse}
Alle, die Weiber und Branntwein lieben, \\
müssen Männer mit Bärten sein.
\end{verse}
\begin{verse}
Alle, die mit uns das Walross killen, \\
müssen Männer mit Bärten sein.
\end{verse}
\begin{verse}
Alle, die öligen Zwieback lieben, \\
müssen Männer mit Bärten sein.
\end{verse}
\begin{verse}
Alle, die endlich zur Hölle mitfahren, \\
müssen Männer mit Bärten sein.
\end{verse}
\end{song}

View File

@@ -1,42 +0,0 @@
\begin{song}{
title = {Alle Straßen},
lyrics = {axi (Alexej Stachowitsch)},
composer = {axi (Alexej Stachowitsch)},
cl = 18,
}
\begin{verse}
Alle St \chord{G}raßen dies \chord{D}er \chord{G} Erde führen j \chord{e}eden nur im Kr \chord{D}eis, \\
der dem \chord{a}ewgen Stirb \chord{G}und W \chord{C}erde, \chord{D}nicht den Hafen \chord{G}weiß.
\end{verse}
\begin{verse}
Ref: \\
/: S \chord{G}onne \chord{C}jagt die W \chord{G}olken, über Zellhof streicht d \chord{e}er \chord{D} Wind. \\
Was der T \chord{D}ag gebracht, \chord{a}deckt die Nacht, \\
dass sich Tr \chord{D}aum und W \chord{D7}achen f \chord{G}ind :/
\end{verse}
\begin{verse}
Alle Wasser, alle Zeiten, fließen einem Ziele zu, \\
geht ein Strömen und ein Gleiten in die große Ruh!
\end{verse}
\begin{verse}
Alle Lieder sind ein Fragen, \\
nach woher? und nach wohin? \\
Alle jagen und verzagen an des Lebens Sinn.
\end{verse}
\begin{verse}
Wo verstummt der Alten Singen, \\
vor dem Streit, um was und wie, \\
soll aus Österreich erklingen, junge Melodie!
\end{verse}
\begin{verse}
Alternativ zur letzten Zeile in der 4. Strophe: \\
...wird aus jungen Herzen dringen neue Melodie.
\end{verse}
\end{song}

View File

@@ -1,30 +0,0 @@
\begin{song}{
title = {Allzeit bereit (Bundeslied der CPD)},
lyrics = {Hermann Mettel (1879-1956), aus dem Bibelkreis-Liederbuch, Barmen 1927},
composer = {(Johann) Jakob Heinrich Lützel (1823-1899)},
cl = 19,
libock = 8,
}
\begin{verse}
Al \chord{F}lzeit be \chord{C}reit! Den k \chord{a}urzen S \chord{d}pruch als L \chord{F}osung \chord{D}ic \chord{C}h erkor; \\
ihn sc \chord{F}hreib ich \chord{d}in mein \chord{B}Lebensb \chord{C}uch, ihn halt ich stets \chord{G}mi \chord{C}r vor. \\
Das gibt dem L \chord{F}eben Z \chord{B}weck und Ziel, gibt \chord{D}Mut und H \chord{d}ei \chord{C}te \chord{F}rkeit; \\
zu heilgem E \chord{B}rnst, zu frohem Spiel a \chord{F}llzeit, \chord{C}allzeit b \chord{F}ereit!
\end{verse}
\begin{verse}
Allzeit bereit, dem zu entflieh'n, was mir das Herz befleckt. \\
Nichts Schlechtes soll mich abwärts zieh'n, hoch ist mein Ziel \\
gesteckt Gott zum lebend'gen Eigentum sei Leib und Seel ge- \\
weiht, zu seines Namens Ehr' und Ruhm, allzeit, allzeit bereit!
\end{verse}
\begin{verse}
Allzeit bereit! Wahr sei der Mund, unwandelbar die Treu. \\
Rein sei das Herz, fest sei der Bund, der Wandel ohne Scheu! \\
O hilf mir Gott, du starker Hort, dass ich kann jederzeit \\
erfüllen treu das Losungswort: allzeit, allzeit bereit!
\end{verse}
\end{song}

View File

@@ -1,38 +0,0 @@
\begin{song}{
title = {Almost heaven},
lyrics = {John Denver},
composer = {John Denver},
bulibu = 140,
cl = 20,
barde = 7,
libock = 10,
}
\begin{verse}
\chord{D}Almost heaven, We \chord{h}st Virginia, \\
blue ridge Mountains, Shena \chord{G}ndoah River. \\
Life is old there, \chord{h}older than the trees, \\
\chord{A}younger than the mountains growin \chord{G}g like a b \chord{D}reeze. \\
Ref.: \\
Country \chord{D}roads, take me ho \chord{A}me to the pl \chord{h}ace I bel \chord{G}ong: \\
West V \chord{D}irginia, mountain m \chord{A}omma, \\
take me h \chord{G}ome, Country ro \chord{D}ads.
\end{verse}
\begin{verse}
All my memries gather round her, \\
miner´s lady, stranger to blue water. \\
Dark and dusty, painted on the sky, \\
misty taste of moonshine, teardrops in my eye. \\
Country roads....
\end{verse}
\begin{verse}
I hear the v \chord{A}oice in the mor \chord{D}nin´ hour she calls me, \\
the r \chord{G}adio remind \chord{D}s me of my home \chord{A} far away, \\
and dr \chord{h}iving down the roa \chord{C}ds \\
I get a f \chord{G}eeling that I sh \chord{D}ould have been home \\
ye \chord{A}sterday, yesterda \chord{A7}y, Country road \chord{D}s...
\end{verse}
\end{song}

View File

@@ -1,69 +0,0 @@
\begin{song}{
title = {Als wir nach Frankreich},
lyrics = {Josef von Lauff},
composer = {Aus dem 1. Weltkrieg},
cl = 22,
libock = 12,
}
% Der Schriftsteller und Dramaturg Josef von Lauff war so kaisertreu, dass die-
% ser ihn 1913 in den Adelsstand erhob - kein Wunder, dass er dann als Kriegs-
% berichterstatter mit Gedichten wie diesem dem Kaiser entsprechend dankte.
\begin{verse}
Als wi \chord{G}r nach Fr \chord{D}ankreich zo \chord{G}g \chord{e}en, \\
wir wa \chord{a}ren un \chord{D}srer d \chord{G}rei, \\
/: ein Sch \chord{G}ütze und ein J \chord{e}äger, \\
und ic \chord{a}h, der Fahnenträ \chord{D}ger \\
der schwe \chord{G}ren Re \chord{D}it \chord{G}erei. :/
\end{verse}
\begin{verse}
Drei Brüder und drei Herzen, \\
der Fahnen folgten sie, \\
/: zu Lüttich auf dem Plane, \\
da flüsterte die Fahne, \\
Herr Jesus und Marie. :/
\end{verse}
\begin{verse}
Und als wir weiterzogen, \\
wir waren unsrer zwei, \\
/: ein Bückeburger Jäger \\
und ich, der Fahnenträger \\
der schweren Reiterei. :/
\end{verse}
\begin{verse}
Zwei Brüder und zwei Herzen \\
begrüßten Tau und Tag. \\
/: Am Abend purpurfarben, \\
zu Longwy in den Garben, \\
die Fahne Amen sprach. :/
\end{verse}
\begin{verse}
Und als sie Amen sagte, \\
brach noch ein Herz entzwei. \\
/: Ade, mein lieber Jäger, \\
dich grüßt der Fahnenträger \\
der schweren Reiterei. :/
\end{verse}
\begin{verse}
Ach Mutter, liebste Mutter, \\
nur fest auf Gott gebaut! \\
/: Noch tut die Fahne schweben, \\
die mir auf Tod und Leben \\
mein Kaiser anvertraut. :/
\end{verse}
\begin{verse}
Und flüstert sie einst leise: \\
Nun gilt es dir Gesell! \\
/: dann folgt der Fahnenträger \\
dem großen Trommelschläger \\
zum himmlischen Appell. :/
\end{verse}
\end{song}

View File

@@ -1,64 +0,0 @@
\begin{song}{
title = {Als wir noch Knaben waren},
lyrics = {Bärenrotte, Zugvogel},
composer = {nach einem irischen Lied},
cl = 24,
libock = 14,
}
\begin{verse}
Als w \chord{C}ir noch Knaben waren, die Z \chord{a}eit ist lang vorbei, \\
ein je \chord{F}des Jahr im Frühling beg \chord{C}ann die Tippelei. \\
Wir tr \chord{C}äumten von Kosaken, Sold \chord{a}aten und Piraten, \\
von D \chord{F}schingis Goldner Horde und \chord{C}andren Heldentaten.
\end{verse}
\begin{verse}
Ref.: \\
/: H \chord{C}e, \chord{G} heute gehts uns gut! \chord{C}Es ist noch Suppe da, \\
e \chord{F}s ist noch Suppe da, he, z \chord{C}ünd´ das F \chord{G}euer a \chord{C}n! :/
\end{verse}
\begin{verse}
Wir waren stolze Burschen, was galten uns die Weiber? \\
Tramptour´n in fremden Ländern, wir pfiffen auf die Neider. \\
Doch unsre wilden Fahrten, die sind heut nur noch nett, \\
erst bauen wir die Kohte auf und dann das Lotterbett.
\end{verse}
\begin{verse}
Wir sind die Fähnchen Rotte, der Jojo führt uns an, \\
wir sind ein kleiner Haufen, ein halbes Dutzend Mann. \\
Von uns, da kennt ein jeder den Wert der Eisenpfanne, \\
des Morgens ein paar Eier und Kaffee in der Kanne.
\end{verse}
\begin{verse}
Am Mittag Fleisch im Potte, wir könnens ja berappen, \\
und wer nicht satt zu essen hat, das sind die armen Knap- \\
pen. Des Abends Wein im Becher, gefüllt bis an den Rand, \\
wir freu´n uns unseres Lebens, wir tippeln durch das Land.
\end{verse}
\begin{verse}
Jetzt Arbeit und ´ne Frau, wer hätte das gedacht? \\
Und nebenbei ein Haus gebaut, wir habens weit gebracht. \\
Doch schon nach ein paar Jahren, da dachten wir zurück, \\
an unsre wilden Feste und an das Jugendglück.
\end{verse}
\begin{verse}
Die besten Freunde lachen, das ist ein starkes Stück. \\
Was macht ihr denn für Sachen, seid ihr im zweiten Glück? \\
Drum Männer rückt zusammen, es ist noch Tschai im Becher, \\
obwohl wir alte Säcke sind, sind wir gewaltge Zecher.
\end{verse}
\begin{verse}
Und ruft Jan Hein zur Reise, was ist denn schon dabei? \\
Wir kommen in den Himmel und spielen die Schalmei. \\
Wenn wir auf Wolken schweben und Hosianna singen, \\
sehn wir auf Erden Jüngere die Eisenpfanne schwingen.
\end{verse}
\end{song}

View File

@@ -1,38 +0,0 @@
\begin{song}{
title = {Am alten Hafen (Piratenhafen)},
lyrics = {cux (Jan Franke), Orden der Freibeuter, Wandervogel BfJ},
composer = {cux (Jan Franke), Orden der Freibeuter, Wandervogel BfJ},
cl = 26,
}
\begin{verse}
Am \chord{a}alten Hafen ein \chord{d}Lichtlein noch brennt, \\
die ge \chord{E}sunk'nen Gestalten mit N \chord{a}amen man nicht kennt. \\
Raue Kehle letztes \chord{d}Lied noch nicht sang, \\
am H \chord{E}olztisch, der letzte \chord{a}Heller noch nicht sprang. \\
|: Unser Ruf eilt uns vora \chord{d}us: \\
Der T \chord{E}od kann warten auf uns Pi \chord{a}raten! :|
\end{verse}
\begin{verse}
Der ranzige Wirt 'ne Pistole erzählt, \\
die geschundene Dirne der Schnaps am Leben hält. \\
Keine Pfaff diesen Ort jemals sah, \\
dafür war'n so ziemlich alle andern Gauner da.
\end{verse}
\begin{verse}
Der alte Schipper, der schläft langsam ein, \\
auf der Schulter 'ne Krähe mit noch einem Bein. \\
Eine Wespe summt ganz müde herum, \\
durch das Wettergetose hört man ihr Gebrumm.
\end{verse}
\begin{verse}
Plötzlich wird es totenstill im Raum, \\
man hört der Fremden Schritte erst noch kaum. \\
Ein jeder schenkt sein Glas nochmal ein, \\
er weiß, es werden seine letzten Schlücke sein.
\end{verse}
\end{song}

View File

@@ -1,42 +0,0 @@
\begin{song}{
title = {Am Brunnen vor dem Tore},
lyrics = {Wilhelm Müller},
composer = {Franz Schubert},
cl = 27,
libock = 16,
}
\begin{verse}
Am Br \chord{D}unnen vor dem Tore, da s \chord{A}teht ein Lindenb \chord{D}aum. \\
Ich t \chord{D}räumt in seinem Schatten so m \chord{A}anchen süßen Tr \chord{D}aum. \\
Ich schn \chord{A}itt in seine R \chord{D}inde so m \chord{G}anches liebe W \chord{A}ort. \\
Es \chord{A7}zog in Freud und Le \chord{D}iden /: zu ihm mich i \chord{A}mmer f \chord{D}ort. :/
\end{verse}
\begin{verse}
Ich musst auch heute wandern, vorbei in tiefer Nacht. \\
Da hab ich noch im Dunkeln, die Augen zugemacht. \\
Und seine Zweige rauschten, als riefen sie mir zu: \\
Komm her zu mir, Geselle, /: hier findst du deine Ruh. :/
\end{verse}
\begin{verse}
Die kalten Winde bliesen, mir grad ins Angesicht. \\
Der Hut flog mir vom Kopfe, ich wendete mich nicht. \\
Nun bin ich manche Stunde entfernt von jenem Ort, \\
und immer hör ichs rauschen: /: Du fändest Ruhe dort.:/
\end{verse}
\begin{verse}
Der ursprüngliche Titel lautet „Der Lindenbaum“. \\
Der Text gehört zu einem Gedichtzyklus, den Mül- \\
ler Die Winterreise überschrieb. Franz Schubert \\
vertonte den gesamten Gedichtzyklus unter dem \\
Titel Winterreise und in diesem Rahmen auch den \\
Lindenbaum als Kunstlied. In der bekanntesten \\
und populärsten Bearbeitung der Schubertschen \\
Vertonung von Friedrich Silcher ist das Werk zum \\
Volkslied geworden.
\end{verse}
\end{song}

View File

@@ -1,41 +0,0 @@
\begin{song}{
title = {Am Ural},
lyrics = {axi (Alexej Stachowitsch)},
composer = {axi (Alexej Stachowitsch)},
bulibu = 2,
cl = 28,
swa = 14,
barde = 12,
libock = 18,
}
\begin{verse}
\chord{e}Am Ura \chord{D}l \chord{e}, fern von der Heimat, \\
sitzen Kos \chord{D}aken beim Feuersch \chord{e}ei \chord{D}n \chord{e}. \\
Der e \chord{e}in \chord{D}e \chord{e} spielt Balaleika, \\
die a \chord{D}nderen, sie stimmen mit \chord{e}ei \chord{D}n \chord{e}.
\end{verse}
\begin{verse}
Ref.: \\
Hey, \chord{e}Ossa, Ossa, schöne Stadt am Karmar, \\
\chord{D}Ossa, Ossa, schöne Stadt am Karmar, \\
O \chord{e}ssa, Ossa, schöne Stadt am Karmar, \\
j \chord{D}ohei, j \chord{e}oh \chord{D}ei \chord{e} j \chord{D}o, \chord{e} j \chord{D}oh \chord{e}ei jo, hei jo,
\end{verse}
\begin{verse}
Den Pferden gellt es in den Ohren, \\
wenn die Kosaken jauchzen und schrein. \\
Sie geben den Tieren die Sporen, \\
drüben liegt Ossa im Feuerschein.
\end{verse}
\begin{verse}
Am Himmel, da leuchten die Sterne, \\
der Wolf heult im finsteren Tann. \\
Die Heimat, so grüßt sie von Ferne, \\
vergessen ist alle Qual.
\end{verse}
\end{song}

View File

@@ -1,43 +0,0 @@
\begin{song}{
title = {Am Westermanns Lönstief},
lyrics = {trenk (Alo Hamm).},
composer = {trenk (Alo Hamm).},
bulibu = 236,
cl = 29,
swa = 15,
barde = 14,
libock = 18,
}
\begin{verse}
\chord{d}Am Westermanns Lönstief pfeift e \chord{g}isiger W \chord{d}ind. \\
Uns s \chord{g}chaukelt die S \chord{d}ee wie die M \chord{A}utter ihr \chord{d}Kind. \\
\chord{C}Am \chord{F} Westermanns L \chord{C}önstief ist a \chord{F}lles so gr \chord{C}au, \\
wir f \chord{g}angen den H \chord{d}ering, den K \chord{A}ab \chord{d}eljau. \\
Ref: \\
Tschire \chord{g}e macht die S \chord{d}ee, tschi \chord{A}ra, tschi \chord{d}ree, \\
tschir \chord{g}ee macht die \chord{d}See, tsch \chord{A}ira-ha-ha-ha tschi \chord{d}re \chord{F}e \chord{C}.
\end{verse}
\begin{verse}
Durch Tage und Nächte wir kurren im Nord \\
und hieven die zappelnde Beute an Bord. \\
Wir kehlen den Hering und salzen ihn ein, \\
sind voll unsere Katjes, wir fahren heim.
\end{verse}
\begin{verse}
Südwester, das Ölzeug und Isländer Wams, \\
was nützen die Plünnen im Schneeflockentanz. \\
Ein daumenbreit Schluck aus der Buttel mit Rum, \\
das krempelt uns wieder ne Weile um.
\end{verse}
\begin{verse}
Spring über die Reling Jan Rasmus, tschiree, \\
fass Taue, halt fest dich, sonst fährst du zur See. \\
So mancher fuhr tief in den Meerkeller weg, \\
der Teufel soll holen den Höllenfreck.
\end{verse}
\end{song}

View File

@@ -1,52 +0,0 @@
\begin{song}{
title = {An de Eck},
lyrics = {Leopold und James Wolf Ludwig, 1911},
composer = {Leopold und James Wolf Ludwig, 1911},
cl = 30,
libock = 20,
}
\begin{verse}
An de E \chord{A}ck steiht ´n Jung mit´n Tüddelband \\
in de anner Hand ´n Bodderbrood mit Ke \chord{E7}es,
\end{verse}
\begin{verse}
wenn he blots nich mit de Been in´n Tüddel kümmt \\
un dor liggt he ok all lang op de \chord{A}Nees
\end{verse}
\begin{verse}
un he rasselt mit´n Dassel op´n Kantsteen \\
un he bitt sick ganz geheurig op de Tu \chord{D}ng, \\
as he o \chord{E}psteiht, seggt he: hett nich w \chord{A}eeh doon, \\
ischa ´n K \chord{E}lacks för ´n H \chord{E7}amborger Jun \chord{A}g.
\end{verse}
\begin{verse}
Refrain
\end{verse}
\begin{verse}
J \chord{A}o, \chord{D} j \chord{E}o, \chord{A} jo, klaun, klaun, Äppel wüllt wi klaun, \\
ruck zuck övern Zaun \chord{E7}, \\
Ein j \chord{E}eder aber ka \chord{A}nn dat nich, denn he mutt \chord{D} ut \\
Ha \chord{E}mborg sien \chord{A}.
\end{verse}
\begin{verse}
An de Eck steiht ´n Deern mit´n Eierkorf \\
in de anner Hand ´n groote Buddel Rum \\
Wenn se blots nich mit de Eier op dat Plaaster sleit \\
un dor seggt dat ok al lang "bum bum". \\
Un se smitt de Eiers un den Rum tosomen \\
un se seggt "so'n Eiergrog den hebb ik geern" \\
as se opsteiht, seggt se: "hett nich weeh doon, \\
ischa´n Klacks för´n Hamborger Deern.
\end{verse}
\begin{verse}
Refrain
\end{verse}
\end{song}

View File

@@ -1,55 +0,0 @@
\begin{song}{
title = {An Land},
lyrics = {Element of Crime},
composer = {Element of Crime},
bulibull = 1,
cl = 82,
barde = 140,
libock = 180,
}
\begin{verse}
H \chord{C}eute wird wohl kein \chord{a}Schiff mehr gehn \\
und k \chord{d}einer geht mehr vor die T \chord{G}ür. \\
\chord{C}Alle sind heute versch \chord{a}üchtert; \\
nur i \chord{d}ch bin es nicht und \chord{G}das liegt an dir. \\
Am F \chord{E}enster fliegt eine \chord{a}Kuh vorbei; \\
da kommt j \chord{F}ede Hilfe zu \chord{C}s \chord{G}pät. \\
\chord{C}Ein Glas auf die K \chord{G}uh und eins auf die \chord{C}See.
\end{verse}
\begin{verse}
Ich liebe die See und sie liebt mich auch. \\
Hörst du, wie sie nach mir brüllt? \\
Ich hätte sie niemals verlassen sollen \\
und das ist, was sie mir klarmachen will. \\
Wenn hinter uns nicht der Deich wär', \\
käme jede Hilfe zu spät. \\
Ein Glas auf den Deich und eins auf die See.
\end{verse}
\begin{verse}
Hier wurd' ich an Land gespült, \\
hier setz' ich mich fest. \\
Von dir weht mich kein Sturm mehr fort. \\
Bei dir werd' ich bleiben so lang du mich lässt. \\
Deine Hand kommt in meine \\
und jede Hilfe zu spät. \\
Ein Glas auf uns und eins auf die See.
\end{verse}
\begin{verse}
Heute wird wohl kein Schiff mehr gehn \\
und keiner geht mehr vor die Tür. \\
Alle sind heute verschüchtert; \\
nur ich bin es nicht und das liegt an dir. \\
Am Fenster fliegt eine Kuh vorbei; \\
da kommt jede Hilfe zu spät. \\
Ein Glas auf die Kuh und eins auf die See.
\end{verse}
\begin{verse}
\chord{C}Ein Glas auf \chord{G}uns und eins auf die S \chord{C}ee.
\end{verse}
\end{song}

View File

@@ -1,64 +0,0 @@
\begin{song}{
title = {Andre, die das Land},
lyrics = {Theodor Kramer},
composer = {Erich Schmeckenbecher},
bulibu = 280,
cl = 36,
barde = 20,
}
% Der Lyriker Theodor Kramer stammte aus einer jüdischen Familie und war
% Sozialdemokrat eine denkbar schlechte Kombination in Österreich zur NS-
% Zeit. Alle seine Schriften landeten auf der „Liste des schädlichen und uner-
% wünschten Schrifttums“ der Nazis, womit Kramer, der insgesamt über 12.000
% Gedichte verfasst hat, seine Lebensgrundlage verlor. Seine Heimat wollte er
% zunächst dennoch nicht verlassen. Die Verzweiflung über seine Situation
% brachte er im Juli 1938 in diesem Gedicht zum Ausdruck. Nur einen Monat
% später versuchte er erfolglos, sich das Leben zu nehmen. 1939 entschied er
% sich doch noch zur Emigration und gelangte nach England. 1957 kehrte er
% nach Österreich zurück und starb nur ein Jahr später. Seine Gedichte gerieten
% zunächst in Vergessenheit, doch die Vertonung einiger seiner Lieder durch
% das Folk-Duo Zupfgeigenhansel trug zur Wiederentdeckung seines Werkes
% bei.
\begin{verse}
A \chord{G}ndre, die das Land so sehr nicht l \chord{D}iebten, \\
wa \chord{e}rn von Anfang \chord{C}an gewillt zu g \chord{G}ehn. \\
I \chord{e}hnen - manche s \chord{C}ind schon fort - ists \chord{G}besser, \\
ich doch müsste mit dem eignen Mess \chord{D}er, \\
me \chord{e}ine Wurzeln au \chord{C}s der Er \chord{D}de dre \chord{G}hn.
\end{verse}
\begin{verse}
Keine Nacht hab ich seither geschlafen, \\
und es ist mir mehr als weh zumut; \\
viele Wochen sind seither verstrichen, \\
alle Kraft ist längst aus mir gewichen, \\
und ich fühl, dass ich daran verblut.
\end{verse}
\begin{verse}
Und doch müsst ich mich von hinnen heben, \\
seis auch nur zu bleiben, was ich war. \\
Nimmer kann ich, wo ich bin, gedeihen; \\
draußen braucht ich wahrlich nicht zu schreien, \\
denn mein leises Wort war immer wahr.
\end{verse}
\begin{verse}
Seiner wär ich wie in alten Tagen, \\
sicher schluchzend wider mich gewandt, \\
hätt´ ich Tag und Nacht mich nur zu heißen, \\
mich samt meinen Wurzeln auszureißen \\
und zu setzen in ein andres Land.
\end{verse}
\begin{verse}
Andre, die das Land so sehr nicht liebten, \\
warn von Anfang an gewillt zu gehn. \\
Ihnen - manche sind schon fort - ist besser, \\
ich doch müsste mit dem eignen Messer, \\
meine Wurzeln aus der Erde drehn.
\end{verse}
\end{song}

View File

@@ -0,0 +1,26 @@
{title: Auf, auf zum fröhlichen Jagen}
{lyricist: Traditionell, 18. Jahrhundert}
{composer: Volksweise}
{key: F}
{tags: Volkslied, Jagd}
{start_of_verse: Strophe 1}
[F]Auf, auf zum fröhlichen [C]Jagen,
auf [C]in die grüne [F]Heid'!
Es [F]gibt nichts Schönres [Bb]auf Erden,
als [C]jetzt zur Herbstes[F]zeit.
{end_of_verse}
{start_of_chorus}
Halli, hallo, halli, hallo,
auf [C]in die grüne [F]Heid'!
{end_of_chorus}
{start_of_verse: Strophe 2}
[F]Der Hirsch, der springt im [C]Walde,
das [C]Reh steht auf der [F]Flur,
die [F]Vöglein singen [Bb]alle
zur [C]schönen Jägerei[F]natur.
{end_of_verse}
{chorus}

View File

@@ -1,29 +0,0 @@
\begin{song}{
title = {Auf, auf zum fröhlichen Jagen},
lyrics = {Traditionell, 18. Jahrhundert},
composer = Volksweise,
key = F,
tags = {Volkslied, Jagd},
}
\begin{verse}
\chord{F}Auf, auf zum fröhlichen \chord{C}Jagen, \\
auf \chord{C}in die grüne \chord{F}Heid'! \\
Es \chord{F}gibt nichts Schönres \chord{Bb}auf Erden, \\
als \chord{C}jetzt zur Herbstes\chord{F}zeit.
\end{verse}
\begin{verse*}
Ref.: \\
Halli, hallo, halli, hallo, \\
auf \chord{C}in die grüne \chord{F}Heid'!
\end{verse*}
\begin{verse}
\chord{F}Der Hirsch, der springt im \chord{C}Walde, \\
das \chord{C}Reh steht auf der \chord{F}Flur, \\
die \chord{F}Vöglein singen \chord{Bb}alle \\
zur \chord{C}schönen Jägerei\chord{F}natur.
\end{verse}
\end{song}

View File

@@ -1,38 +0,0 @@
\begin{song}{
title = {Auf vielen Straßen},
lyrics = {Björn Behnke},
composer = {Alfred Zschiesche},
bulibull = 32,
cl = 42,
swa = 21,
barde = 34,
}
% Alfred Zschiesche (*22.02.1908 in Wiesbaden † 1992) Fahrtenname alf, war
% ein bekannter Liedschöpfer, Komponist, Dichter, Zeichner und Fotograf. Er
% war Nerother Wandervogel und im bündischen Widerstand aktiv. Ihm verdan-
% ken wir Lieder wie: "Wenn die bunten Fahnen wehen", "Wir sind eine kleine
% verlorene Schar" oder "Wo wollt ihr hin, ihr tollen Jungen "
\begin{verse}
Auf vielen St \chord{d}raßen dieser Wel \chord{A}t, \\
habt ihr euch sorglos rum getri \chord{d}eben, \\
/: so ohne Z \chord{g}elt und ohne Ge \chord{d}ld \\
der Tippel \chord{A}ei verschr \chord{d}ieben. :/
\end{verse}
\begin{verse}
Was galt euch Armut, was Gefahr? \\
Ihr habt, verachtet und zerschunden, \\
/: da draußen treibend Jahr für Jahr \\
doch euer Glück gefunden. :/
\end{verse}
\begin{verse}
Habt manches Lied der Einsamkeit \\
wohl in die Nacht hinaus gesungen. \\
/: Auf fremden Meeren fern der Zeit \\
ist euer Sang verklungen. :/
\end{verse}
\end{song}

View File

@@ -1,37 +0,0 @@
\begin{song}{
title = {Balkanlied},
lyrics = {Fredl Mayr, aus Lieder der Eisbrechermannschaft, 1932 Ein Lied aus der späten Phase der Jugendbewegung. In der Verbotszeit gehörte es zu den nicht-opportunen Erkennungsliedern der Bündischen. Als Willi Graf, später Mitglied der Weißen Rose, Als er 1938 wegen bündischer Umtriebe (er gehörte seit 1934 dem Grauen Orden an) angeklagt wurde, brachte die Anklage unter anderem das Singen dieses Liedes als Beweis vor. Das Lied wurde erstmals abgedruckt in „Lagerfeuer“, Heft 3/1932, und dann in den „Liedern der Eisbrechermannschaft“.},
composer = {Fredl Mayr, aus Lieder der Eisbrechermannschaft, 1932 Ein Lied aus der späten Phase der Jugendbewegung. In der Verbotszeit gehörte es zu den nicht-opportunen Erkennungsliedern der Bündischen. Als Willi Graf, später Mitglied der Weißen Rose, Als er 1938 wegen bündischer Umtriebe (er gehörte seit 1934 dem Grauen Orden an) angeklagt wurde, brachte die Anklage unter anderem das Singen dieses Liedes als Beweis vor. Das Lied wurde erstmals abgedruckt in „Lagerfeuer“, Heft 3/1932, und dann in den „Liedern der Eisbrechermannschaft“.},
cl = 312,
swa = 224,
barde = 309,
}
\begin{verse}
Und wir k \chord{e}auern wied \chord{H7}er \chord{e}um die heiße Glut \\
und erz \chord{a}ählen vom A \chord{D}bent \chord{e}euer. \\
und der wilde Bal \chord{H7}kan \chord{e} ist gerad noch gut \\
und wir s \chord{a}chwören am L \chord{D}agerf \chord{e}euer. \\
/: Dass die N \chord{G}eider verda \chord{D}mmt und die Sp \chord{C}ießer verflu \chord{H7}cht, \\
d \chord{e}ie uns gehemmt viel t \chord{H7}ausend M \chord{e}ale. :/
\end{verse}
\begin{verse}
Doch sehr bald wird es wahr, dass wir stehen am Meer und \\
gedenken der fernen Heimat. \\
Und der kleine Trupp, der rüstet gar sehr \\
zu verlassen die grauen Mauern. \\
l: Und es hält uns nichts mehr und wir freuen uns sehr, \\
bald flattern Segel nach Osten. :l
\end{verse}
\begin{verse}
Und der schwarze Adler flattert uns voran \\
auf der hellgelben Fahne am Maste. \\
Und ein wildes Lied schwingt sich von Kahn zu Kahn, \\
das verwegne, das vielfach verhasste. \\
l: Dass die Neider verdammt und die Spießer verflucht, \\
die uns gehemmt viel tausend Male.
\end{verse}
\end{song}

View File

@@ -1,28 +0,0 @@
\begin{song}{
title = {Ballade von Bergen},
lyrics = {Lina Sobral Bastos, Frederick Oelbaum},
composer = {Lina Sobral Bastos, Sophie Manstorfer},
libock = 214,
}
\begin{verse}
Im N \chord{a}orden hängen die W \chord{d}olken tief, die \chord{G}Nässe durch die \\
P \chord{C}onchos trieft. \\
Das \chord{a}Wasser in der K \chord{e}ohte s \chord{G}teht und der R \chord{F}egen nicht verg \chord{a}eht. \\
Der Magen bis zum \chord{d}Boden hing, die L \chord{G}ust auf Pampf uns \\
\chord{C}bald verging. \\
Weil \chord{a}uns das nur der N \chord{e}orden \chord{G}gibt: haben wir uns tr \chord{F}otzdem in \\
das Land verli \chord{a}ebt. \\
Ref.: J \chord{a}aa, so ist F \chord{G}ahrt, manchmal \chord{F}hart, sie macht uns st \chord{e}ark \\
J \chord{a}aa, so ist F \chord{G}ahrt, macht uns S \chord{F}paß, ja, ja, \chord{e}ja \chord{E/e}, jaa
\end{verse}
\begin{verse}
Wir leuchten hell am Horizont, die Sonne aus den Wolken \\
kommt. / Sie strahlt uns auf die nasse Haut, doch sie hält es \\
lang nicht aus. / Von Bergen aus die Fjorde sehen, wenn wir \\
auf der Fähre stehen. / Weil uns das nur der Norden gibt: \\
haben wir uns trotzdem in das Land verliebt.
\end{verse}
\end{song}

View File

@@ -1,71 +0,0 @@
\begin{song}{
title = {Ballade von der gemeinsamen Zeit Vorspiel: /: d A :/ d g C F d g A /: d A :/},
lyrics = {Konny Kleinkunstpunk},
composer = {Konny Kleinkunstpunk},
cl = 414,
libock = 446,
}
\begin{verse}
\chord{d}Zähle doch nicht unsere \chord{g}Stunden und weine doch nicht, \\
wenn du \chord{d}gehst. Du vergießt doch \chord{C}auch keine \chord{B}Tr \chord{d}änen, \\
B F Gis \\
wenn der Wind mal nicht weht. So frier ich auch nicht in \\
der \chord{g}Nacht, wenn der Mond am Himmel ve \chord{F}rrät, dass die \\
F Dis Cis C \\
Sonne ihr Licht jetzt woanders austrägt.
\end{verse}
\begin{verse}
Halte mich in deinen Armen und lass uns gehen ein Stück. Ande- \\
re machen es anders. Was wissen denn die schon vom Glück? \\
Was wissen denn die schon von Abschied? Und ists nur ein Ab- \\
schied auf Zeit, so hab ich doch einen Zeitvertreib: \\
\chord{d}Heute säh ich, morgen mäh ich, \chord{g}übermorgen back ich \\
Brot, p \chord{C}ress den Saft aus Südhangreben \chord{F} dieser Wein \\
wird \chord{g}süß und \chord{A}ro \chord{d}t! Bau ein Haus aus Wegrandsteinen, \\
p \chord{g}flanze Rosen, roten Mohn, l \chord{C}ern das schöne Spiel der \\
Geige, \chord{F}kauf mir ein Ban \chord{g}done \chord{A}om. \chord{d}Hack das Holz und \\
heiz die Stube, n \chord{g}ehm ein Bad mit Elixier, \chord{C}reiß die Blätter \\
vom Kalender u \chord{F}nd dann bist du w \chord{g}ieder hi \chord{A}er...
\end{verse}
\begin{verse}
So kamst du zurück eines Tages, der Koffer verschwand unterm \\
Bett. Jetzt liegst du in meinen Armen, doch weiß ich, du gehst \\
wieder weg. Noch halten wir unsere Hände, noch lächelt dein \\
Gesicht, noch drückt dein Koffer unter uns nicht.
\end{verse}
\begin{verse}
Dann sagst du, du hast noch zwei Stunden, dann ruft dich wieder \\
die Pflicht. Wir haben ne Art gefunden, dass uns das Herz nicht \\
zerbricht. Unser Gang endet wieder am Bahnsteig. Ich seh zu, \\
wie der Zug sich entfernt. Hör zu, ich hab ein Lied gelernt:
\end{verse}
\begin{verse}
Heute säh ich, morgen mäh ich, …
\end{verse}
\begin{verse}
Hat man uns denn so erzogen? Oder was hat uns soweit ge- \\
bracht, dass dieses dumme Leben uns hindern kann an unsrer \\
Pracht, uns hindert an unserer Nähe? Denn die Liebe verhin- \\
derts ja nicht wie die Traurigkeit, wenn der Morgen anbricht.
\end{verse}
\begin{verse}
Was bringt uns das viele Gerenne? Was sagt mir dies klagende \\
Lied? Es sagt mir, dass sich nichts ändert, wenn keine Änderung \\
geschieht. Wir haben nur dies kurze Leben, dann sind wir wieder \\
allein. So könnte es jetzt doch mal andersrum sein. \\
J \chord{d}a, dann säen wir gemeinsam, \chord{g}backen unser eigen Brot, \chord{C} trinken \\
Wein aus vollen Schläuchen, t \chord{F}anzen bis ins \chord{g}Morgenr \chord{A}ot \chord{d}. Bauen \\
noch ein Haus aus Kieselsteinen, \chord{g}pflanzen auch noch Majoran, \\
u \chord{C}nd du singst zu den Akkorden, i \chord{F}ch spiel Geige, w \chord{g}as ich \chord{A}kann. \\
\chord{d}Und das Holz im Ofen knistert, \chord{g}wenn du aus der Wanne steigst. \\
\chord{C}Der Kalender liegt im Feuer, \chord{F}wenn du mir den \chord{g}Nordstern \chord{A}zeigst.
\end{verse}
\end{song}

View File

@@ -1,69 +0,0 @@
\begin{song}{
title = {Banner},
lyrics = {Wolfgang Hartmann, VCP Stamm Franken (Wiesbaden-Erbenheim), Sommer 1984},
composer = {Wolfgang Hartmann, VCP Stamm Franken (Wiesbaden-Erbenheim), Sommer 1984},
cl = 44,
libock = 36,
}
\begin{verse}
\chord{a}Banner, Zelte, "Wer da?" \chord{F}Rufe, Stille um das L \chord{G}ager her, \\
Feuer scheinen \chord{a}in der Nacht. \chord{E} Im \chord{C}Mantel schläft die Wache \chord{G}ein, \\
ein Leutnant schritt vor \chord{a}bei, das Würfelspiel ist f \chord{E}alsch. \\
Aus \chord{C}einem Schatten tritt her \chord{G}bei ein Spielmann in den K \chord{a}reis, \\
der Posten lässt vor \chord{E}bei und flüstert l \chord{a}eis: \\
\chord{a}Vagabund so hör` mich an: \\
Die N \chord{F}acht ist kurz und i \chord{F}rgendwann der R \chord{G}uf vom Kornett laut \\
ertönt, drum s \chord{a}piele mir das a \chord{E}ltgesung'ne Lied. \\
Und der S \chord{C}pielmann \chord{G}singt ein L \chord{a}ied: \\
Fünf Sc \chord{a}hwäne durch die Ödmark ziehn, ein K \chord{F}önig mit vier \\
Recken hin, im \chord{G}Morgenrot ihr Banner fliegt, und \chord{a}weiter geht \\
es f \chord{E}ür das gute Ziel.
\end{verse}
\begin{verse}
In Feindes Lager hört man's auch; \\
durch Stille säuselt Melodie, \\
und Herzen horchen wie noch nie. \\
Die Klampfe in der Hand \\
der Spielmann singt allein, \\
und alles lauscht in dieser Nacht. \\
Doch plötzlich hinter sich hört er \\
wie vereint der Chor, \\
und alle stimmen ein in diese Melodie:
\end{verse}
\begin{verse}
Fünf Schwäne durch die Ödmark ziehn...
\end{verse}
\begin{verse}
Und als der Morgen hell erstrahlt, \\
die Schlacht beginnt, die Trommel warnt. \\
Vorne steht ein Grenadier, \\
der denkt zurück und legt nieder das Schwert.
\end{verse}
\begin{verse}
Und als drei Jahr' vergangen war'n \\
das Feld liegt öd und leer vornweg, \\
und nichts erinnert mehr daran; \\
an eine nicht gewes'ne Schlacht, \\
doch plötzlich hört man dann der Nachtigallen Schlag. \\
Als ob eine fremde Melodie zog über das Land; \\
von Ferne weht ein Wind und trägt sie fort.
\end{verse}
\begin{verse}
Fünf Schwäne durch die Ödmark ziehn...
\end{verse}
\begin{verse}
Lalalalala...
\end{verse}
\begin{verse}
Und der Spielmann singt ein Lied.
\end{verse}
\end{song}

View File

@@ -1,45 +0,0 @@
\begin{song}{
title = {Bella Ciao},
lyrics = {italienisches Volkslied},
composer = {italienisches Volkslied},
libock = 328,
}
\begin{verse}
Una matti \chord{e}na mi sono alzato , o bella ciao …, \\
Una matti \chord{a}na mi sono alza \chord{e}to, \\
e ho tro \chord{H7}vato linvas \chord{e}or.
\end{verse}
\begin{verse}
O partigiano, portami via, o bella ciao …, \\
O partigiano, portami via \\
Ché mi sento di morir
\end{verse}
\begin{verse}
E se io muoio da partigiano, o bella ciao …, \\
E se io muoio da partigiano, \\
tu mi devi seppellir.
\end{verse}
\begin{verse}
E seppellire lassù in montagna, o bella ciao …, \\
E seppellire lassù in montagna, \\
Sotto lombra di un bel fior.
\end{verse}
\begin{verse}
Tutte le genti che passeranno, o bella ciao …, \\
Tutte le genti che passeranno \\
Mi diranno: "Che bel fior"
\end{verse}
\begin{verse}
E questo è il fiore del partigiano, \\
o bella ciao …, \\
/: E Questo è il fiore del partigiano \\
Morto per la libertà :/
\end{verse}
\end{song}

View File

@@ -1,44 +0,0 @@
\begin{song}{
title = {Big Bomb Dolly aus Dover},
lyrics = {Fritz Graßhoff},
composer = {klappe (Klaus Eckhardt)},
cl = 384,
libock = 416,
}
\begin{verse}
Wir ko \chord{e}mmen mit dem W \chord{H7}alfischkahn zwei \chord{C}mal im J \chord{H7}ahr nach \\
Ha \chord{e}us. Ne Wolke Dunst von \chord{H7}Lebertran, die \chord{C}weht dem \chord{H7}Pott \\
vor \chord{e}aus. \\
\chord{D}Wi \chord{G}r mähen unser \chord{D}Sauerkraut und \chord{G}wetzen in die \chord{D}Stadt, \\
weil d \chord{e}ie perfekte S \chord{H7}eemannsbraut uns lä \chord{C}ngst ge \chord{H7}rochen h \chord{e}at.
\end{verse}
\begin{verse}
Refrain:
\end{verse}
\begin{verse}
D \chord{D}as ist die \chord{G}Big Bomb \chord{D}Dolly aus D \chord{G}over, hehohe! \\
Die hat Sprengstoff u \chord{D}nterm Pullo \chord{G}ver, hehohe! \\
Die macht \chord{D}Feuer aus der Heuer in der \chord{G} Pinte an der See, \\
dass die F \chord{D}lusen nur so brennen und die L \chord{G}eute in Calais \\
nachts die Z \chord{e}eitung l \chord{H7}ese \chord{e}n \chord{H7}kön \chord{e}nen!
\end{verse}
\begin{verse}
Sitzt mal der Käptn abgebrannt in Schulden und in Gin, \\
dann gehen wir mit Fisch an Hand und ohne Piepen hin. Die \\
Dame ist nicht lasterhaft, drum rechnet sie genau. Sie nimmt \\
für ihre Einsatzkraft zwei Zentner Kabeljau.
\end{verse}
\begin{verse}
Es bleibt nicht aus, dass unser Pott den letzten Kai bezieht. \\
Im Seemannsheim „Zum lieben Gott“ gibt s nichts auf dem \\
Gebiet. Doch findet unser scharfer Blick das ferne Leuchtsig- \\
nal. Denn unten brennt ja noch zum Glück das Feuer am Ka- \\
nal!
\end{verse}
\end{song}

View File

@@ -1,36 +0,0 @@
\begin{song}{
title = {Bin ja nur ein armer Zigeuner},
lyrics = {Andreas Hönisch},
composer = {Andreas Hönisch},
cl = 46,
}
\begin{verse}
Ref.: \\
/: \chord{D}Bin ja nur ein \chord{A}armer Zig \chord{D}euner, \\
habe nichts als Wage \chord{A}n und Pfer \chord{D}d. :/ \\
No \chord{D}rmandie \chord{G}und Pyren \chord{D}äe \chord{A}n, \\
h \chord{D}ab die ha \chord{G}lbe Wel \chord{D}t geseh \chord{A}n.
\end{verse}
\begin{verse}
Keiner fragt, woher ich komm, \\
keiner fragt, wohin ich geh.
\end{verse}
\begin{verse}
Kommt mein Wagen vor ein Dorf, \\
laufen schon die Leute fort.
\end{verse}
\begin{verse}
Nur die Kinder bleiben stehn, \\
wollen den Zigeuner sehn.
\end{verse}
\begin{verse}
Führt der Weg wer weiß wohin, \\
der da droben kennt mein Ziel.
\end{verse}
\end{song}

View File

@@ -1,53 +0,0 @@
\begin{song}{
title = {Birkenring},
lyrics = {Margarete Jehn},
composer = {Wolfgang Jehn},
cl = 330,
barde = 327,
libock = 356,
}
\begin{verse}
Warum zöge \chord{d}rst du noch und bleibst ste \chord{A}hn in der Nacht? \\
Horch, im Wald hinterm Dorf ist der S \chord{d}ommer erwacht! \\
Tritt doch näher, mein Freund, und reich \chord{A}mir deine Hand, \\
komm herein in den fröhlichen Bir \chord{d}kenring.
\end{verse}
\begin{verse}
Refrain: \\
Sieh das Glüc \chord{g}k wird vergehn, denn die Ze \chord{d}it bleibt nicht \\
stehn, mit den W \chord{A}inden wird der S \chord{d}ommer vergeh \chord{d7}n. \\
Drum drück fes \chord{g}t an dein Herz, was die Fr \chord{d}eude dir gibt, \\
komm herei \chord{A}n in den fröhlichen Bi \chord{d}rkenring.
\end{verse}
\begin{verse}
Was die Kantele sagt, darfst du glauben, mein Freund. \\
Heut wird wahr, was du einsam im Winter geträumt! \\
Wenn die Liebe dir lacht, wend nicht ab deinen Blick, \\
komm herein in den fröhlichen Birkenring.
\end{verse}
\begin{verse}
Einmal kam ich auch schon als Wanderbursch her. Ich \\
wollt gern was erleben, ich wünschte es so sehr. Und der \\
Frühling war mir eine zweite Geburt, komm herein in den \\
fröhlichen Birkenring.
\end{verse}
\begin{verse}
Und nun wohne ich hier, hier im Wald bei dem Weib. \\
Und im Winter, da sagt mir die Kantele bald. Wirst Du \\
staunen und schaun, was du einsam geträumt. Komm \\
herein in den fröhlichen Birkenring.
\end{verse}
\begin{verse}
Wenn du mitsummst das Lied und ein Blick tut dir kund, \\
in den Augen der anderen spiegelt sichs bunt, die Liebe \\
zu dir in den Farben der Welt, dann bleib hier in dem \\
fröhlichen Birkenring.
\end{verse}
\end{song}

View File

@@ -1,58 +0,0 @@
\begin{song}{
title = {Bis in die roten Morgenstunden},
lyrics = {Lina Sobral Bastos, Frederick Oelbaum},
composer = {Lina Sobral Bastos, Frederick Oelbaum},
libock = 92,
}
\begin{verse}
Die \chord{C}Sonne ist schon unter \chord{a}gegangen \\
\chord{F}in der Jurte die D \chord{C}unkelheit b \chord{G}richt. \\
Ein F \chord{C}euer, das uns \chord{a}alle verbindet, \\
die F \chord{F}lammen flackern w \chord{C}arm und \chord{G}dicht
\end{verse}
\begin{verse}
Rein in die Jurte auf den Teppich, \\
Doch „Schuhe aus!“, sonst wird er dreckig. \\
Gitarren werden schnell gestimmt, \\
der Abend erst beginnt.
\end{verse}
\begin{verse}
Ref.: Der C \chord{F}hai geht durch die Runde und wir s \chord{C}ingen: \\
\chord{E}Dai da da da d \chord{a}ai \\
Bis in die r \chord{F}oten Morgenstunden wird es k \chord{C}lingen: \\
\chord{E}Dai da da da \chord{a}da \chord{E}i
\end{verse}
\begin{verse}
Die letzte Runde schläft gleich ein, \\
so soll es heute nicht sein. \\
Die Kekse gehen rum „Hurra!“ \\
Nach den Wölflingen ist keiner mehr da.
\end{verse}
\begin{verse}
Das Leben als Wölfling ist echt hart, \\
wenn man nicht ins Bett gehen mag. \\
Das Leben als Pfadi ist auch nicht leicht, \\
wenn drei Stunden schlafen nicht reicht.
\end{verse}
\begin{verse}
Refrain
\end{verse}
\begin{verse}
Das F \chord{E}euer ist fast erl \chord{a}oschen. \\
Um das l \chord{F}etzte Lied wurde oft best \chord{E}ochen. \\
In \chord{F}ein paar Stunden ist A \chord{a}ufsteh-Zeit \\
\chord{E}Allezeit be \chord{E7}reit!“
\end{verse}
\begin{verse}
Refrain 2x
\end{verse}
\end{song}

View File

@@ -1,32 +0,0 @@
\begin{song}{
title = {Brennt die Sonne},
lyrics = {Andreas Hönisch},
composer = {Andreas Hönisch},
cl = 48,
libock = 38,
}
\begin{verse}
Br \chord{D}ennt die Sonne, tropft der Regen, scheint \\
verloren \chord{A}jeder Pfad, / ei \chord{e}ne Spur auf neuen Wegen, \\
f \chord{A}ührt zum Ziel und \chord{E}führt zur T \chord{A}at. \\
Ref.: \\
/: Nie \chord{D}mals liegen bleiben, \chord{G}bis zum G \chord{A7}ipfel steigen \\
Pfa \chord{D}dfinder in Europa: „ \chord{G}Al \chord{A}lezeit Be \chord{D}reit!“ :/
\end{verse}
\begin{verse}
Sind die Sohlen durchgelaufen, \\
hängt der Magen bis zum Kinn, \\
wollen Teufel mit uns raufen, \\
weiter geht´s durch dick und dünn.
\end{verse}
\begin{verse}
Unserm Herrn in Demut dienen \\
mehr als Gold und Silber wiegt. \\
Darum auch den Nächsten lieben, \\
wenn er arm am Wege liegt.
\end{verse}
\end{song}

View File

@@ -1,42 +0,0 @@
\begin{song}{
title = {Bruder, nun wird es Abend},
lyrics = {olka (Erich Scholz)},
composer = {olka (Erich Scholz)},
bulibu = 386,
cl = 49,
swa = 26,
barde = 39,
libock = 42,
}
\begin{verse}
Bru \chord{a}der, nun wird es \chord{E}Abend, \\
ni \chord{a}mm dir ein Glas zum Wei \chord{E}n. \\
/: Sc \chord{G}he \chord{G7}nke \chord{C} Triodimali, T \chord{a}riodimali, T \chord{F}riodimali \chord{a}ein :/
\end{verse}
\begin{verse}
Stopf dir die lange Pfeife, \\
denke nicht viel dabei. \\
/: Singe Triodimali, Triodimali, Triodimali zwei. :/
\end{verse}
\begin{verse}
Nichts will das Lied bedeuten, \\
als etwas glücklich sein. \\
/: Dreimal Triodimali, Triodimali, Triodimali drei. :/
\end{verse}
\begin{verse}
Mondlampe lacht am Fenster, \\
Schlaf klopft an die Tür. \\
/: Leise Triodimali, Triodimali, Triodimali vier. :/
\end{verse}
\begin{verse}
Traumschwere Worte fallen, \\
Stille besiegt das Haus. \\
/: Trinke Triodimali, Triodimali, Triodimali aus. :/
\end{verse}
\end{song}

View File

@@ -1,51 +0,0 @@
\begin{song}{
title = {Bündische Vaganten},
lyrics = {Alfons „Alo“ Hamm (Trenk)},
composer = {Alfons „Alo“ Hamm (Trenk)},
bulibu = 50,
cl = 176,
swa = 117,
barde = 137,
libock = 174,
}
% „Ayen“ ist der traditionelle Zugvogel-Gruß. Die Bundesordnung sagt hierüber
% nur: „Unser Bundesgruß in Ruf und Brief Ayen ist eine Verstümmelung des
% Wortes Mayenne und hat eine historische Bedeutung.“
% Angeblich war „Mayenne“ das Codewort das die Posten der „Ritter von Ma-
% yenne“ an der Westfront verbindenden Kradmelders (Motorrad-Kurier). Und
% über das Knattern des Motors blieb von dem Codewort eben nur „...ayenne“
% übrig.
\begin{verse}
H \chord{e}ei, wie vorn der F \chord{H7}etzen fliegt, \\
hei, w \chord{e}ie er sich im W \chord{H7}inde wiegt \\
\chord{a}ohne Ra \chord{e}st und o \chord{H7}hne \chord{e} Ruh. \\
So wiegen wir mit fr \chord{H7}eiem Sinn \\
uns ü \chord{e}ber tausend St \chord{H7}raßen hin, \\
\chord{a}ohne E \chord{e}nde, i \chord{H7}mmerz \chord{e}u.
\end{verse}
\begin{verse}
Ref: \\
B \chord{C}ündische Va \chord{G}ganten \\
ti \chord{D}ppeln in die Welt. Hey - t \chord{G}ippeln in die Welt. \\
B \chord{C}ündische Vaga \chord{G}nten \\
tip \chord{D}peln in die Welt - Ho o Ay \chord{G}en!
\end{verse}
\begin{verse}
Treiben wir dem Süden zu, lässt uns der Norden keine Ruh, \\
überall zu Haus sind wir. \\
Mal rüber nach Amerika, mal runter bis nach Afrika - \\
Hoija - hoija - das sind wir.
\end{verse}
\begin{verse}
Hast du noch ein jung Gesicht, so zage nicht und fackle \\
nicht, frage niemals nach dem Wie! \\
Wer nur am Rand der Straße klebt, für seinen dummen \\
Bauche lebt, misst der Ferne Zauber nie!
\end{verse}
\end{song}

View File

@@ -1,73 +0,0 @@
\begin{song}{
title = {Bürgerlied},
lyrics = {Adalbert Harnisch, im Mai 1845 für den Elbinger Bürgerverein geschrieben},
composer = {auf die Melodie von “Als Chursachsen das vernommen, dass der Turk vor Wien was kommen” aus dem Jahr 1683. Der Verfasser der Melodie ist nicht überliefert.},
bulibu = 302,
cl = 270,
barde = 235,
libock = 278,
}
\begin{verse}
Ob wir ro \chord{G}te, gelbe Kragen, Helme oder Hüte tragen, \\
Stiefel tr \chord{G}agen oder Sc \chord{D}huh´; oder o \chord{G}b wir R \chord{C}öcke \\
nähen und zu Sch \chord{D}uhen Dräh \chord{G}te drehen, das tut, da \chord{e}s \\
tut, n \chord{a}ichts \chord{D}d \chord{G}azu.
\end{verse}
\begin{verse}
Ob wir können präsidieren \\
oder müssen Akten schmieren \\
ohne Rast und ohne Ruh´; \\
ob wir just Collegia lesen, \\
oder aber binden Besen, \\
das tut, das tut nichts dazu.
\end{verse}
\begin{verse}
Ob wir stolz zu Rosse reiten, \\
oder ob zu Fuß wir schreiten \\
immer unserm Ziele zu; \\
ob uns Kreuze vorne schmücken, \\
oder Kreuze hinten drücken, \\
das tut, das tut nichts dazu.
\end{verse}
\begin{verse}
Das Bürgerlied (auch Königsberger Volkslied) ist ein 1845 von Adalbert \\
Harnisch (* 1815, † 1889) geschriebenes Volkslied. Ursprünglich für den Bür- \\
gerverein der Stadt Elbing (heute Elbląg) geschrieben, entwickelte es sich \\
rasch zu einem beliebten Lied, zunächst in der nationalliberalen Bewegung \\
und später in der Arbeiterbewegung. In der zweiten Hälfte des 20. Jahrhun- \\
derts wurde es von deutschen Folk-Musikern wie Hannes Wader neu aufge- \\
griffen und so einem breiten Publikum bekannt.
\end{verse}
\begin{verse}
Aber ob wir Neues bauen, \\
oder Altes nur verdauen, \\
wie das Gras verdaut die Kuh; \\
ob wir in der Welt was schaffen, \\
oder nur die Welt begaffen, \\
das tut, das tut was dazu.
\end{verse}
\begin{verse}
Ob wir rüstig und geschäftig, \\
wo es gilt zu wirken kräftig, \\
immer tapfer greifen zu, \\
oder ob wir schläfrig denken: \\
“Gott wird´s schon im Schlafe schenken“, \\
das tut, das tut was dazu.
\end{verse}
\begin{verse}
Drum ihr Bürger, drum ihr Brüder, \\
alle eines Bundes Glieder; \\
was auch jeder von uns tu! \\
Alle die dies Lied gesungen, \\
so die Alten wie die Jungen, \\
tun wir, tun wir was dazu!
\end{verse}
\end{song}

View File

@@ -1,43 +0,0 @@
\begin{song}{
title = {Burschen, Burschen},
lyrics = {aus Lettland, überliefert von Helmut König Worte (deutsch): Rudolf Blaumanis, Hans Schmidt},
composer = {aus Lettland, überliefert von Helmut König Worte (deutsch): Rudolf Blaumanis, Hans Schmidt},
bulibu = 341,
cl = 50,
swa = 29,
barde = 41,
}
\begin{verse}
Bu \chord{a}rschen, Burs \chord{G}chen, wir v \chord{d}erderben \chord{a}, \\
geht es fort so wil \chord{E}d und tol \chord{a}l. \\
/: H \chord{a}ej \chord{G}, \chord{a}hej, hej, hej \chord{G}o, \chord{a} w \chord{E}il \chord{a}d und toll. :/
\end{verse}
\begin{verse}
Von den Füßen weg gesoffen, \\
werden bald die Stiefel sein.
\end{verse}
\begin{verse}
Eine Nacht, zwei tolle Tage, \\
zechen wir an diesem Ort.
\end{verse}
\begin{verse}
Zechen wir an diesem Orte, \\
hier in diesem blauen Krug.
\end{verse}
\begin{verse}
Süß das Bier und weiß die Kannen, \\
schön die flinke Krügerin.
\end{verse}
\begin{verse}
Trinkt das Bier, zerschlagt die Kannen, \\
küsst die schöne Krügerin. \\
/ Hej, hej, hej, hejo, wenn sie will. /
\end{verse}
\end{song}

Some files were not shown because too many files have changed in this diff Show More