Compare commits
18 Commits
v0.2.0-lat
...
main
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
3d346e899d | ||
| 9056dbd9cd | |||
| 543fe66a44 | |||
| 032387c02d | |||
| a251fac053 | |||
| 077b3c027e | |||
| d733e83cb1 | |||
| 0f038a68d8 | |||
| a69d14033d | |||
| 0fb2771279 | |||
|
|
5378bdbc24 | ||
|
|
ab91ad2db6 | ||
|
|
b339c10ca0 | ||
|
|
8dca7d7131 | ||
|
|
8c92c7d78b | ||
|
|
0139327034 | ||
|
|
ba035159f7 | ||
|
|
8e4728c55a |
36
.gitignore
vendored
36
.gitignore
vendored
@@ -1,28 +1,22 @@
|
||||
# LaTeX build artifacts
|
||||
*.aux
|
||||
*.log
|
||||
*.out
|
||||
*.toc
|
||||
*.fls
|
||||
*.fdb_latexmk
|
||||
*.synctex.gz
|
||||
*.synctex(busy)
|
||||
*.sxd
|
||||
*.sxc
|
||||
# Gradle
|
||||
.gradle/
|
||||
build/
|
||||
buildSrc/build/
|
||||
|
||||
# Output directory
|
||||
output/
|
||||
|
||||
# OS files
|
||||
.DS_Store
|
||||
Thumbs.db
|
||||
|
||||
# Editor files
|
||||
# IDE
|
||||
.idea/
|
||||
*.iml
|
||||
.vscode/
|
||||
*~
|
||||
*.swp
|
||||
|
||||
# OS
|
||||
.DS_Store
|
||||
Thumbs.db
|
||||
|
||||
# Output
|
||||
output/
|
||||
|
||||
# Kotlin
|
||||
*.class
|
||||
|
||||
# Claude
|
||||
.claude/
|
||||
|
||||
109
.plans/issue-17-page-overflow.md
Normal file
109
.plans/issue-17-page-overflow.md
Normal file
@@ -0,0 +1,109 @@
|
||||
# Issue #17: Fix page overflow — bounds checking and content splitting
|
||||
|
||||
## Summary
|
||||
|
||||
The PDF renderer (`PdfBookRenderer.renderSongPage()`) currently renders all song sections on page 0 and leaves page 1 blank for 2-page songs. There is no bounds checking — the `y` coordinate can go below the bottom margin, causing content to render outside the visible page area. This plan adds proper `y`-position tracking against a minimum `yMin` boundary, splits content across pages at section boundaries when a song exceeds one page, and reserves space for bottom metadata/references on the last page.
|
||||
|
||||
## AC Verification Checklist
|
||||
|
||||
1. The renderer tracks `y` against the bottom margin during song page rendering
|
||||
2. For 2-page songs, content splits across pages when it exceeds page 0's available space — remaining sections continue on page 1
|
||||
3. Content that would be rendered below the bottom margin (minus reserved footer space) is moved to the next page
|
||||
4. If metadata is "bottom" position, sufficient space is reserved at the bottom of the last page
|
||||
5. No text or images are rendered outside the printable page area
|
||||
6. Existing tests continue to pass
|
||||
7. New tests verify content splitting for songs exceeding one page
|
||||
|
||||
## Implementation Steps
|
||||
|
||||
### Step 1: Add a section height calculation helper in PdfBookRenderer
|
||||
|
||||
Add a private method `calculateSectionHeight()` that computes how many PDF points a given `SongSection` will consume when rendered. This mirrors the measurement engine logic but uses the actual PDF `BaseFont` widths (not stubs). This is needed to decide whether a section fits on the current page.
|
||||
|
||||
The method signature:
|
||||
```kotlin
|
||||
private fun calculateSectionHeight(
|
||||
section: SongSection,
|
||||
fontMetrics: PdfFontMetrics,
|
||||
config: BookConfig,
|
||||
contentWidth: Float
|
||||
): Float
|
||||
```
|
||||
|
||||
### Step 2: Add footer space reservation calculation
|
||||
|
||||
Add a private method `calculateFooterReservation()` that computes how much vertical space must be reserved at the bottom of the **last** page of a song for:
|
||||
- Bottom-position metadata (if `metadataPosition == "bottom"`)
|
||||
- Notes
|
||||
- Reference book footer
|
||||
|
||||
```kotlin
|
||||
private fun calculateFooterReservation(
|
||||
song: Song,
|
||||
fontMetrics: PdfFontMetrics,
|
||||
config: BookConfig,
|
||||
contentWidth: Float
|
||||
): Float
|
||||
```
|
||||
|
||||
### Step 3: Refactor renderSongPage() to split content across pages
|
||||
|
||||
The key change: Instead of `val sections = if (pageIndex == 0) song.sections else emptyList()`, determine which sections belong on each page by:
|
||||
|
||||
1. Calculate `yMin` = bottom margin in points (plus footer reservation for the last page)
|
||||
2. For `pageIndex == 0`: Render sections in order. Before rendering each section, check if the section's height fits above `yMin`. If not, stop — remaining sections go to page 1.
|
||||
3. For `pageIndex == 1`: Render the sections that didn't fit on page 0. The split point is stored via a `splitIndex` that is computed during page 0 rendering.
|
||||
|
||||
**Approach:** Since `renderSongPage()` is called separately for page 0 and page 1, we need a way to know the split point on both calls. The cleanest approach is to compute the split index as a function:
|
||||
|
||||
```kotlin
|
||||
private fun computeSplitIndex(
|
||||
song: Song,
|
||||
fontMetrics: PdfFontMetrics,
|
||||
config: BookConfig,
|
||||
contentWidth: Float,
|
||||
availableHeight: Float // total space on page 0 (contentTop - yMin)
|
||||
): Int // index of first section that goes to page 1
|
||||
```
|
||||
|
||||
This method calculates the cumulative height of header + sections. When the cumulative height exceeds `availableHeight`, it returns the section index. If all sections fit, it returns `song.sections.size`.
|
||||
|
||||
### Step 4: Update renderSongPage() to use bounds checking during rendering
|
||||
|
||||
Even after determining the split, the actual rendering loop should still check `y >= yMin` as a safety net. If a section that was estimated to fit actually overflows (due to measurement inaccuracy), clamp rendering — do not render below `yMin`.
|
||||
|
||||
### Step 5: Update footer rendering for multi-page songs
|
||||
|
||||
Currently `isLastPage` is hardcoded to `pageIndex == 0`. Change it to correctly identify the last page:
|
||||
- For 1-page songs: `pageIndex == 0` is the last page
|
||||
- For 2-page songs: `pageIndex == 1` is the last page
|
||||
|
||||
The song's `pageCount` isn't directly available in the renderer, but we can determine it: if `pageIndex == 1`, it's always the last page. If `pageIndex == 0`, it's the last page only if the song fits on one page (i.e., `computeSplitIndex == song.sections.size`).
|
||||
|
||||
A simpler approach: pass the total page count as a parameter, or compute whether the song needs 2 pages inside `renderSongPage()`.
|
||||
|
||||
**Decision:** Add a `totalPages: Int` parameter to `renderSongPage()`. The caller already knows this from the `PageContent.SongPage` list (consecutive song pages with pageIndex 0 and 1 for the same song).
|
||||
|
||||
Actually, the simplest approach: The renderer sees `PageContent.SongPage(song, 0)` and `PageContent.SongPage(song, 1)` in the page list. We can pre-scan the pages list to know if a song has 2 pages. But even simpler: we can compute `computeSplitIndex` to know whether the song needs a second page. If `splitIndex < song.sections.size`, the song has 2 pages.
|
||||
|
||||
### Step 6: Move notes and bottom-metadata to the last page
|
||||
|
||||
Currently notes and bottom metadata only render on `pageIndex == 0`. Change this to render on the last page (which might be page 1 for 2-page songs). The logic:
|
||||
- Compute `isLastPage` based on split index
|
||||
- Render notes, bottom metadata, and reference footer only on the last page
|
||||
|
||||
### Step 7: Write tests
|
||||
|
||||
Add tests in `PdfBookRendererTest`:
|
||||
|
||||
1. `render handles two-page song with content split across pages` — Create a song with many sections that exceed one page, render with pageIndex 0 and 1, verify PDF is valid.
|
||||
|
||||
2. `render does not overflow below bottom margin` — Create a very long song, verify rendering completes without error.
|
||||
|
||||
3. `render places metadata at bottom of last page for two-page songs` — Use `metadataPosition = "bottom"`, create a 2-page song, verify PDF is valid.
|
||||
|
||||
4. `render handles notes on last page of two-page song` — Song with notes that spans 2 pages, verify rendering.
|
||||
|
||||
### Step 8: Verify existing tests pass
|
||||
|
||||
Run `gradle :renderer-pdf:test` and `gradle :app:test` to ensure no regressions.
|
||||
44
.plans/issue-18-page-preview.md
Normal file
44
.plans/issue-18-page-preview.md
Normal file
@@ -0,0 +1,44 @@
|
||||
# Issue #18: Add page-by-page preview in the GUI after building
|
||||
|
||||
## Summary
|
||||
|
||||
Add a PDF preview panel to the GUI that appears after a successful build. It renders PDF pages as images using Apache PDFBox and displays them with previous/next navigation and a page counter. The preview loads pages lazily for performance and updates automatically on new builds.
|
||||
|
||||
## AC Verification Checklist
|
||||
|
||||
1. After a successful build, a preview panel appears showing generated pages
|
||||
2. Users can navigate between pages (previous/next buttons)
|
||||
3. Current page number and total count displayed (e.g., "Seite 3 / 42")
|
||||
4. Preview renders actual PDF pages as images (PDF-to-image via PDFBox)
|
||||
5. Preview panel can be closed/hidden to return to normal view
|
||||
6. Preview updates automatically when a new build completes
|
||||
7. GUI remains responsive while preview is loading (async rendering)
|
||||
|
||||
## Implementation Steps
|
||||
|
||||
### Step 1: Add PDFBox dependency to gui module
|
||||
|
||||
Add `org.apache.pdfbox:pdfbox:3.0.4` to gui/build.gradle.kts.
|
||||
|
||||
### Step 2: Create PdfPreviewState class
|
||||
|
||||
A state holder for the preview: current page index, total pages, rendered page images (cached), loading state. Pages are rendered lazily — only the current page is rendered at a time.
|
||||
|
||||
### Step 3: Create PdfPreviewPanel composable
|
||||
|
||||
A Compose panel with:
|
||||
- An Image composable showing the current page
|
||||
- Navigation row: "< Prev" button | "Seite X / Y" label | "Next >" button
|
||||
- A close/hide button
|
||||
- Loading indicator while page is rendering
|
||||
|
||||
### Step 4: Integrate preview into App composable
|
||||
|
||||
After a successful build:
|
||||
- Show a "Vorschau" button in the action buttons row
|
||||
- When clicked, show the preview panel (replacing or overlaying the song list area)
|
||||
- When a new build succeeds, update the preview automatically
|
||||
|
||||
### Step 5: Lazy page rendering
|
||||
|
||||
Render pages on demand using coroutines on Dispatchers.IO to keep the UI responsive.
|
||||
41
.plans/issue-19-drag-and-drop.md
Normal file
41
.plans/issue-19-drag-and-drop.md
Normal file
@@ -0,0 +1,41 @@
|
||||
# Issue #19: Add drag-and-drop song reordering in the GUI
|
||||
|
||||
## Summary
|
||||
|
||||
Add drag-and-drop reordering of songs in the GUI song list. When `songs.order` is "manual", users can drag songs to rearrange them. The custom order is passed to the pipeline at build time. When order is "alphabetical", drag-and-drop is disabled with a hint.
|
||||
|
||||
## AC Verification Checklist
|
||||
|
||||
1. Songs can be reordered via drag-and-drop
|
||||
2. Reordered list is used when building (overrides config order)
|
||||
3. Visual indicator shows drop target (highlight)
|
||||
4. Order can be reset via a button
|
||||
5. Reordering only enabled when songs.order is "manual"
|
||||
6. When alphabetical, list shows alphabetical order and drag is disabled (with hint)
|
||||
7. GUI remains responsive during drag operations
|
||||
|
||||
## Implementation Steps
|
||||
|
||||
### Step 1: Add customSongOrder parameter to SongbookPipeline.build()
|
||||
|
||||
Add an optional `customSongOrder: List<String>? = null` parameter. When provided, use this ordered list of file names to sort the parsed songs instead of the config-based sort.
|
||||
|
||||
### Step 2: Create ReorderableSongList composable
|
||||
|
||||
Build a song list that supports drag-and-drop reordering:
|
||||
- Use `detectDragGesturesAfterLongPress` on each item to detect drag start
|
||||
- Track the dragged item index and current hover position
|
||||
- Show a visual indicator (highlighted background) at the drop target
|
||||
- On drop, reorder the list
|
||||
|
||||
### Step 3: Integrate into App.kt
|
||||
|
||||
- Track `songsOrder` config value ("alphabetical" or "manual")
|
||||
- Track `originalSongs` list (from file loading) to support reset
|
||||
- When manual: enable drag-and-drop, show reset button
|
||||
- When alphabetical: disable drag-and-drop, show hint
|
||||
- Pass custom order (file names) to pipeline on build
|
||||
|
||||
### Step 4: Add reset button
|
||||
|
||||
"Reihenfolge zurücksetzen" button restores `songs` to `originalSongs`.
|
||||
138
CLAUDE.md
138
CLAUDE.md
@@ -2,83 +2,105 @@
|
||||
|
||||
This file provides guidance to Claude Code (claude.ai/code) when working with code in this repository.
|
||||
|
||||
## Build Commands
|
||||
## Build & Test Commands
|
||||
|
||||
```bash
|
||||
# Build the songbook PDF (two-pass for TOC)
|
||||
make
|
||||
# Build everything
|
||||
gradle build
|
||||
|
||||
# Remove auxiliary files
|
||||
make clean
|
||||
# Run all tests
|
||||
gradle test
|
||||
|
||||
# Remove everything including PDF
|
||||
make distclean
|
||||
# Run tests for a specific module
|
||||
gradle :parser:test
|
||||
gradle :layout:test
|
||||
gradle :renderer-pdf:test
|
||||
gradle :app:test
|
||||
|
||||
# Run a single test class
|
||||
gradle :parser:test --tests ChordProParserTest
|
||||
|
||||
# Run a single test method
|
||||
gradle :parser:test --tests "ChordProParserTest.parse complete song"
|
||||
|
||||
# Build and run CLI
|
||||
gradle :cli:run --args="build -d /path/to/project"
|
||||
gradle :cli:run --args="validate -d /path/to/project"
|
||||
|
||||
# Launch GUI
|
||||
gradle :gui:run
|
||||
```
|
||||
|
||||
Requires LuaLaTeX (TeX Live) and the `leadsheets` package.
|
||||
Requires Java 21 (configured in `gradle.properties`). Kotlin 2.1.10, Gradle 9.3.1.
|
||||
|
||||
## Project Structure
|
||||
## Architecture
|
||||
|
||||
**Pipeline:** Parse → Validate → Measure → Paginate → Render
|
||||
|
||||
`SongbookPipeline` (in `app`) orchestrates the full flow:
|
||||
1. `ConfigParser` reads `songbook.yaml` → `BookConfig`
|
||||
2. `ChordProParser` reads `.chopro`/`.cho`/`.crd` files → `Song` objects
|
||||
3. `ForewordParser` reads optional `foreword.txt` → `Foreword` (if configured)
|
||||
4. `Validator` checks config and songs
|
||||
5. `MeasurementEngine` calculates each song's height in mm using `FontMetrics`
|
||||
6. `TocGenerator` estimates TOC page count and creates entries
|
||||
7. `PaginationEngine` arranges songs into pages (greedy spread packing)
|
||||
8. `PdfBookRenderer` generates the PDF via OpenPDF
|
||||
|
||||
**Module dependency graph:**
|
||||
```
|
||||
songbook.tex # Main document (title page, TOC, song inputs)
|
||||
songbook-style.sty # Style package (geometry, fonts, leadsheets config)
|
||||
songs/ # One .tex file per song
|
||||
fonts/ # Font files (UnifrakturMaguntia for titles)
|
||||
images/ # Filler images (empty for now)
|
||||
Makefile # Build rules (lualatex, two passes)
|
||||
output/ # Generated PDF (gitignored)
|
||||
model ← parser
|
||||
model ← layout
|
||||
model ← renderer-pdf
|
||||
parser, layout, renderer-pdf ← app
|
||||
app ← cli (Clikt)
|
||||
app, parser ← gui (Compose Desktop)
|
||||
```
|
||||
|
||||
## How It Works
|
||||
`model` is the foundation with no dependencies — all data classes, the `FontMetrics` interface, and the `BookRenderer` interface live here. The `FontMetrics` abstraction decouples layout from rendering: `PdfFontMetrics` is the real implementation (in renderer-pdf), `StubFontMetrics` is used in layout tests.
|
||||
|
||||
Pure LaTeX songbook using the `leadsheets` package with LuaLaTeX. The style matches the Carmina Leonis songbook format:
|
||||
- Song titles in Fraktur/blackletter font (UnifrakturMaguntia)
|
||||
- Chords above lyrics in regular weight, black
|
||||
- No verse labels (verses separated by blank lines)
|
||||
- Metadata (Worte/Weise) at bottom of each song page
|
||||
- Reference book cross-references (MO, PfLB) in footer
|
||||
- Each song starts on a new page
|
||||
- A5 twoside format with page numbers at bottom-outer
|
||||
**Pagination constraint:** Songs spanning 2 pages must start on a left (even) page. The `PaginationEngine` inserts filler images or blank pages to enforce this.
|
||||
|
||||
## Key Types
|
||||
|
||||
- `Song` → sections → `SongLine` → `LineSegment(chord?, text)` — chord is placed above the text segment. Also has `aliases`, `lyricist`, `composer`, `key`, `tags`, `notes: List<String>`, `references: Map<String, Int>` (bookId → page), `capo`
|
||||
- `SongLine` — holds `segments` plus optional `imagePath` (when set, the line is an inline image)
|
||||
- `Foreword` — `quote`, `paragraphs`, `signatures` — parsed from a plain-text file
|
||||
- `PageContent` — sealed class: `SongPage`, `FillerImage`, `BlankPage`, `ForewordPage`
|
||||
- `SectionType` — enum: `VERSE`, `CHORUS`, `BRIDGE`, `REPEAT`
|
||||
- `BookConfig` — top-level config with `FontsConfig`, `LayoutConfig`, `TocConfig`, `ForewordConfig`, `ReferenceBook` list. `FontSpec.file` supports custom font files. `LayoutConfig.metadataLabels` (`"abbreviated"` or `"german"`) and `metadataPosition` (`"top"` or `"bottom"`) control metadata rendering
|
||||
- `BuildResult` — returned by `SongbookPipeline.build()` with success/errors/counts
|
||||
|
||||
## Song Format
|
||||
|
||||
Each song uses the `leadsheets` `song` environment:
|
||||
ChordPro-compatible `.chopro`/`.cho`/`.crd` files: directives in `{braces}`, chords in `[brackets]` inline with lyrics, comments with `#`. See `songs/` for examples.
|
||||
|
||||
```latex
|
||||
\begin{song}{
|
||||
title = Song Title,
|
||||
lyrics = Lyricist,
|
||||
composer = Composer,
|
||||
key = G,
|
||||
mundorgel = 42,
|
||||
pfadfinderliederbuch = 118,
|
||||
note = {Optional note text.},
|
||||
}
|
||||
**Metadata directives:** `{title: }` / `{t: }`, `{alias: }`, `{lyricist: }`, `{composer: }`, `{key: }`, `{tags: }`, `{note: }`, `{capo: }`
|
||||
|
||||
\begin{verse}
|
||||
\chord{G}Lyrics with \chord{D}chords above. \\
|
||||
Next \chord{C}line here.
|
||||
\end{verse}
|
||||
**Section directives:** `{start_of_verse}` / `{sov}`, `{end_of_verse}` / `{eov}`, `{start_of_chorus}` / `{soc}`, `{end_of_chorus}` / `{eoc}`, `{start_of_repeat}` / `{sor}`, `{end_of_repeat}` / `{eor}`. Section starts accept an optional label. `{chorus}` inserts a chorus reference, `{repeat}` sets a repeat label.
|
||||
|
||||
\begin{verse}
|
||||
Second verse without chords (or with).
|
||||
\end{verse}
|
||||
**Notes block:** `{start_of_notes}` / `{son}` … `{end_of_notes}` / `{eon}` — multi-paragraph rich-text notes rendered at the end of a song.
|
||||
|
||||
\end{song}
|
||||
```
|
||||
**Inline image:** `{image: path}` — embeds an image within a song section.
|
||||
|
||||
**Important constraints:**
|
||||
- Use `\\` for line breaks within verses (not blank lines)
|
||||
- Never place two `\chord{}` commands without a space between them — split compound words with a hyphen: `\chord{D}Abend- \chord{A}zeit.`
|
||||
- Custom properties: `alias`, `note`, `mundorgel`, `pfadfinderliederbuch`
|
||||
- Verse types: `verse` (no label), `verse*` (for custom-labeled sections like Kanon, Ref.)
|
||||
- `musicsymbols` library skipped (requires `musix11` font not installed)
|
||||
**Reference:** `{ref: bookId pageNumber}` — cross-reference to a page in another songbook (configured in `reference_books`).
|
||||
|
||||
## Style Details (songbook-style.sty)
|
||||
## Configuration
|
||||
|
||||
- Page geometry: A5, margins (top 15mm, bottom 20mm, inner 20mm, outer 12mm)
|
||||
- Body font: TeX Gyre Heros (Helvetica clone)
|
||||
- Title font: UnifrakturMaguntia (Fraktur/blackletter, from `fonts/` directory)
|
||||
- Chord format: small, regular weight, black
|
||||
- Song title template: Fraktur title only (metadata rendered at bottom via `after-song` hook)
|
||||
- Reference style based on Carmina Leonis (Pfadfinder scout songbook)
|
||||
`songbook.yaml` at the project root. Key options beyond the basics:
|
||||
|
||||
- `fonts.<role>.file` — path to a custom font file (TTF/OTF) for any font role (`lyrics`, `chords`, `title`, `metadata`, `toc`)
|
||||
- `layout.metadata_labels` — `"abbreviated"` (M:/T:) or `"german"` (Worte:/Weise:)
|
||||
- `layout.metadata_position` — `"top"` (after title) or `"bottom"` (bottom of last page)
|
||||
- `toc.highlight_column` — abbreviation of the reference-book column to highlight (e.g. `"CL"`)
|
||||
- `foreword.file` — path to a foreword text file (default `./foreword.txt`)
|
||||
- `reference_books` — list of `{id, name, abbreviation}` for cross-reference columns in the TOC
|
||||
- `songs.order` — `"alphabetical"` or `"manual"` (file-system order)
|
||||
|
||||
## Test Patterns
|
||||
|
||||
Tests use `kotlin.test` annotations with Kotest assertions (`shouldBe`, `shouldHaveSize`, etc.) on JUnit 5. Layout tests use `StubFontMetrics` to avoid PDF font dependencies. App integration tests create temp directories with song files and config.
|
||||
|
||||
## Package
|
||||
|
||||
All code under `de.pfadfinder.songbook.*` — subpackages match module names (`.model`, `.parser`, `.layout`, `.renderer.pdf`, `.app`, `.cli`, `.gui`).
|
||||
|
||||
23
Makefile
23
Makefile
@@ -1,23 +0,0 @@
|
||||
MAIN = songbook
|
||||
ENGINE = lualatex
|
||||
OUTDIR = output
|
||||
FLAGS = --output-directory=$(OUTDIR) --interaction=nonstopmode
|
||||
|
||||
.PHONY: all clean distclean
|
||||
|
||||
all: $(OUTDIR)/$(MAIN).pdf
|
||||
|
||||
$(OUTDIR):
|
||||
mkdir -p $(OUTDIR)
|
||||
|
||||
$(OUTDIR)/$(MAIN).pdf: $(MAIN).tex songbook-style.sty songs/*.tex | $(OUTDIR)
|
||||
TEXINPUTS=.:$(shell pwd):$(shell pwd)/$(OUTDIR): $(ENGINE) $(FLAGS) $(MAIN).tex
|
||||
TEXINPUTS=.:$(shell pwd):$(shell pwd)/$(OUTDIR): $(ENGINE) $(FLAGS) $(MAIN).tex
|
||||
|
||||
clean:
|
||||
rm -f $(OUTDIR)/*.aux $(OUTDIR)/*.log $(OUTDIR)/*.out \
|
||||
$(OUTDIR)/*.toc $(OUTDIR)/*.fls $(OUTDIR)/*.fdb_latexmk \
|
||||
$(OUTDIR)/*.sxd $(OUTDIR)/*.sxc $(OUTDIR)/*.songtoc
|
||||
|
||||
distclean: clean
|
||||
rm -f $(OUTDIR)/$(MAIN).pdf
|
||||
16
app/build.gradle.kts
Normal file
16
app/build.gradle.kts
Normal file
@@ -0,0 +1,16 @@
|
||||
plugins {
|
||||
id("songbook-conventions")
|
||||
}
|
||||
|
||||
dependencies {
|
||||
implementation(project(":model"))
|
||||
implementation(project(":parser"))
|
||||
implementation(project(":layout"))
|
||||
implementation(project(":renderer-pdf"))
|
||||
|
||||
implementation("io.github.microutils:kotlin-logging-jvm:3.0.5")
|
||||
implementation("ch.qos.logback:logback-classic:1.5.16")
|
||||
|
||||
testImplementation(kotlin("test"))
|
||||
testImplementation("io.kotest:kotest-assertions-core:5.9.1")
|
||||
}
|
||||
@@ -0,0 +1,259 @@
|
||||
package de.pfadfinder.songbook.app
|
||||
|
||||
import de.pfadfinder.songbook.model.*
|
||||
import de.pfadfinder.songbook.parser.*
|
||||
import de.pfadfinder.songbook.parser.ForewordParser
|
||||
import de.pfadfinder.songbook.layout.*
|
||||
import de.pfadfinder.songbook.renderer.pdf.PdfBookRenderer
|
||||
import de.pfadfinder.songbook.renderer.pdf.PdfFontMetrics
|
||||
import de.pfadfinder.songbook.renderer.pdf.TocRenderer
|
||||
import mu.KotlinLogging
|
||||
import java.io.File
|
||||
import java.io.FileOutputStream
|
||||
|
||||
private val logger = KotlinLogging.logger {}
|
||||
|
||||
data class BuildResult(
|
||||
val success: Boolean,
|
||||
val outputFile: File? = null,
|
||||
val errors: List<ValidationError> = emptyList(),
|
||||
val songCount: Int = 0,
|
||||
val pageCount: Int = 0
|
||||
)
|
||||
|
||||
class SongbookPipeline(private val projectDir: File) {
|
||||
|
||||
/**
|
||||
* Build the songbook PDF.
|
||||
*
|
||||
* @param customSongOrder Optional list of song file names in the desired order.
|
||||
* When provided, songs are sorted to match this order instead of using the
|
||||
* config-based sort (alphabetical or manual). Files not in this list are
|
||||
* appended at the end.
|
||||
* @param onProgress Optional callback invoked with status messages during the build.
|
||||
*/
|
||||
fun build(customSongOrder: List<String>? = null, onProgress: ((String) -> Unit)? = null): BuildResult {
|
||||
// 1. Parse config
|
||||
onProgress?.invoke("Konfiguration wird geladen...")
|
||||
val configFile = File(projectDir, "songbook.yaml")
|
||||
if (!configFile.exists()) {
|
||||
return BuildResult(false, errors = listOf(ValidationError(configFile.name, null, "songbook.yaml not found")))
|
||||
}
|
||||
logger.info { "Parsing config: ${configFile.absolutePath}" }
|
||||
val rawConfig = ConfigParser.parse(configFile)
|
||||
|
||||
// Resolve font file paths relative to the project directory
|
||||
val config = resolveFontPaths(rawConfig)
|
||||
|
||||
// Validate config (including font file existence)
|
||||
val configErrors = Validator.validateConfig(config)
|
||||
if (configErrors.isNotEmpty()) {
|
||||
return BuildResult(false, errors = configErrors)
|
||||
}
|
||||
|
||||
// 2. Parse songs
|
||||
val songsDir = File(projectDir, config.songs.directory)
|
||||
if (!songsDir.exists() || !songsDir.isDirectory) {
|
||||
return BuildResult(false, errors = listOf(ValidationError(config.songs.directory, null, "Songs directory not found")))
|
||||
}
|
||||
|
||||
val songFiles = songsDir.listFiles { f: File -> f.extension in listOf("chopro", "cho", "crd") }
|
||||
?.sortedBy { it.name }
|
||||
?: emptyList()
|
||||
|
||||
if (songFiles.isEmpty()) {
|
||||
return BuildResult(false, errors = listOf(ValidationError(config.songs.directory, null, "No song files found")))
|
||||
}
|
||||
|
||||
onProgress?.invoke("Lieder werden importiert (${songFiles.size} Dateien)...")
|
||||
logger.info { "Found ${songFiles.size} song files" }
|
||||
|
||||
val songsByFileName = mutableMapOf<String, Song>()
|
||||
val allErrors = mutableListOf<ValidationError>()
|
||||
|
||||
for ((index, file) in songFiles.withIndex()) {
|
||||
if (index > 0 && index % 50 == 0) {
|
||||
onProgress?.invoke("Lieder werden importiert... ($index/${songFiles.size})")
|
||||
}
|
||||
try {
|
||||
val song = ChordProParser.parseFile(file)
|
||||
val songErrors = Validator.validateSong(song, file.name)
|
||||
if (songErrors.isNotEmpty()) {
|
||||
allErrors.addAll(songErrors)
|
||||
} else {
|
||||
songsByFileName[file.name] = song
|
||||
}
|
||||
} catch (e: Exception) {
|
||||
allErrors.add(ValidationError(file.name, null, "Parse error: ${e.message}"))
|
||||
}
|
||||
}
|
||||
|
||||
if (allErrors.isNotEmpty()) {
|
||||
return BuildResult(false, errors = allErrors)
|
||||
}
|
||||
|
||||
val songs = songsByFileName.values.toList()
|
||||
|
||||
// Sort songs: custom order takes priority, then config-based sort
|
||||
val sortedSongs = if (customSongOrder != null) {
|
||||
val orderMap = customSongOrder.withIndex().associate { (index, name) -> name to index }
|
||||
songs.sortedBy { song ->
|
||||
val fileName = songsByFileName.entries.find { it.value === song }?.key
|
||||
orderMap[fileName] ?: Int.MAX_VALUE
|
||||
}
|
||||
} else {
|
||||
when (config.songs.order) {
|
||||
"alphabetical" -> songs.sortedBy { it.title.lowercase() }
|
||||
else -> songs // manual order = file order
|
||||
}
|
||||
}
|
||||
|
||||
logger.info { "Parsed ${sortedSongs.size} songs" }
|
||||
|
||||
// 2b. Parse foreword (if configured)
|
||||
var foreword: Foreword? = null
|
||||
val forewordConfig = config.foreword
|
||||
if (forewordConfig != null) {
|
||||
val forewordFile = File(projectDir, forewordConfig.file)
|
||||
if (forewordFile.exists()) {
|
||||
logger.info { "Parsing foreword: ${forewordFile.absolutePath}" }
|
||||
foreword = ForewordParser.parseFile(forewordFile)
|
||||
} else {
|
||||
logger.warn { "Foreword file not found: ${forewordFile.absolutePath}" }
|
||||
}
|
||||
}
|
||||
|
||||
// 3. Measure songs
|
||||
onProgress?.invoke("Layout wird berechnet...")
|
||||
val fontMetrics = PdfFontMetrics()
|
||||
val measurementEngine = MeasurementEngine(fontMetrics, config)
|
||||
val measuredSongs = sortedSongs.map { measurementEngine.measure(it) }
|
||||
|
||||
// 4. Generate TOC and paginate
|
||||
val tocGenerator = TocGenerator(config)
|
||||
val estimatedTocPages = tocGenerator.estimateTocPages(sortedSongs)
|
||||
|
||||
// Intro page takes 2 pages (title + blank back) for double-sided printing
|
||||
val introPages = if (config.intro?.enabled == true) 2 else 0
|
||||
// Foreword always takes 2 pages (for double-sided printing)
|
||||
val forewordPages = if (foreword != null) 2 else 0
|
||||
|
||||
val headerPages = introPages + estimatedTocPages + forewordPages
|
||||
val paginationEngine = PaginationEngine(config)
|
||||
val pages = paginationEngine.paginate(measuredSongs, headerPages)
|
||||
|
||||
// Generate initial TOC entries, then measure actual pages needed
|
||||
val initialTocEntries = tocGenerator.generate(pages, headerPages)
|
||||
val tocRenderer = TocRenderer(fontMetrics, config)
|
||||
val tocPages = tocRenderer.measurePages(initialTocEntries)
|
||||
|
||||
// Re-generate TOC entries with corrected page offset if count changed.
|
||||
// Since tocPages is always even, the pagination layout (left/right parity)
|
||||
// stays the same — only page numbers in the TOC entries need updating.
|
||||
val actualHeaderPages = introPages + tocPages + forewordPages
|
||||
val tocEntries = if (tocPages != estimatedTocPages) {
|
||||
logger.info { "TOC pages: estimated $estimatedTocPages, actual $tocPages" }
|
||||
tocGenerator.generate(pages, actualHeaderPages)
|
||||
} else {
|
||||
initialTocEntries
|
||||
}
|
||||
|
||||
// Build final page list with foreword pages inserted before song content
|
||||
val allPages = mutableListOf<PageContent>()
|
||||
if (foreword != null) {
|
||||
allPages.add(PageContent.ForewordPage(foreword, 0))
|
||||
allPages.add(PageContent.ForewordPage(foreword, 1))
|
||||
}
|
||||
allPages.addAll(pages)
|
||||
|
||||
val layoutResult = LayoutResult(
|
||||
introPages = introPages,
|
||||
tocPages = tocPages,
|
||||
pages = allPages,
|
||||
tocEntries = tocEntries
|
||||
)
|
||||
|
||||
val totalPages = introPages + tocPages + pages.size
|
||||
logger.info { "Layout: ${introPages} intro, ${tocPages} TOC, ${pages.size} content pages" }
|
||||
|
||||
// 5. Render PDF
|
||||
onProgress?.invoke("PDF wird erzeugt (${sortedSongs.size} Lieder, $totalPages Seiten)...")
|
||||
val outputDir = File(projectDir, config.output.directory)
|
||||
outputDir.mkdirs()
|
||||
val outputFile = File(outputDir, config.output.filename)
|
||||
|
||||
logger.info { "Rendering PDF: ${outputFile.absolutePath}" }
|
||||
|
||||
val renderer = PdfBookRenderer()
|
||||
FileOutputStream(outputFile).use { fos ->
|
||||
renderer.render(layoutResult, config, fos)
|
||||
}
|
||||
|
||||
logger.info { "Build complete: ${sortedSongs.size} songs, $totalPages pages" }
|
||||
|
||||
return BuildResult(
|
||||
success = true,
|
||||
outputFile = outputFile,
|
||||
songCount = sortedSongs.size,
|
||||
pageCount = totalPages
|
||||
)
|
||||
}
|
||||
|
||||
/**
|
||||
* Resolves font file paths relative to the project directory.
|
||||
* If a FontSpec has a `file` property, it is resolved against projectDir
|
||||
* to produce an absolute path.
|
||||
*/
|
||||
private fun resolveFontPaths(config: BookConfig): BookConfig {
|
||||
fun FontSpec.resolveFile(): FontSpec {
|
||||
val fontFile = this.file ?: return this
|
||||
val fontFileObj = File(fontFile)
|
||||
// Only resolve relative paths; absolute paths are left as-is
|
||||
if (fontFileObj.isAbsolute) return this
|
||||
val resolved = File(projectDir, fontFile)
|
||||
return this.copy(file = resolved.absolutePath)
|
||||
}
|
||||
|
||||
val resolvedFonts = config.fonts.copy(
|
||||
lyrics = config.fonts.lyrics.resolveFile(),
|
||||
chords = config.fonts.chords.resolveFile(),
|
||||
title = config.fonts.title.resolveFile(),
|
||||
metadata = config.fonts.metadata.resolveFile(),
|
||||
toc = config.fonts.toc.resolveFile()
|
||||
)
|
||||
return config.copy(fonts = resolvedFonts)
|
||||
}
|
||||
|
||||
fun validate(): List<ValidationError> {
|
||||
val configFile = File(projectDir, "songbook.yaml")
|
||||
if (!configFile.exists()) {
|
||||
return listOf(ValidationError(configFile.name, null, "songbook.yaml not found"))
|
||||
}
|
||||
|
||||
val rawConfig = ConfigParser.parse(configFile)
|
||||
val config = resolveFontPaths(rawConfig)
|
||||
val errors = mutableListOf<ValidationError>()
|
||||
errors.addAll(Validator.validateConfig(config))
|
||||
|
||||
val songsDir = File(projectDir, config.songs.directory)
|
||||
if (!songsDir.exists()) {
|
||||
errors.add(ValidationError(config.songs.directory, null, "Songs directory not found"))
|
||||
return errors
|
||||
}
|
||||
|
||||
val songFiles = songsDir.listFiles { f: File -> f.extension in listOf("chopro", "cho", "crd") }
|
||||
?.sortedBy { it.name }
|
||||
?: emptyList()
|
||||
|
||||
for (file in songFiles) {
|
||||
try {
|
||||
val song = ChordProParser.parseFile(file)
|
||||
errors.addAll(Validator.validateSong(song, file.name))
|
||||
} catch (e: Exception) {
|
||||
errors.add(ValidationError(file.name, null, "Parse error: ${e.message}"))
|
||||
}
|
||||
}
|
||||
|
||||
return errors
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,534 @@
|
||||
package de.pfadfinder.songbook.app
|
||||
|
||||
import io.kotest.matchers.booleans.shouldBeFalse
|
||||
import io.kotest.matchers.booleans.shouldBeTrue
|
||||
import io.kotest.matchers.collections.shouldBeEmpty
|
||||
import io.kotest.matchers.collections.shouldHaveSize
|
||||
import io.kotest.matchers.collections.shouldNotBeEmpty
|
||||
import io.kotest.matchers.ints.shouldBeGreaterThan
|
||||
import io.kotest.matchers.nulls.shouldBeNull
|
||||
import io.kotest.matchers.nulls.shouldNotBeNull
|
||||
import io.kotest.matchers.shouldBe
|
||||
import io.kotest.matchers.string.shouldContain
|
||||
import java.io.File
|
||||
import kotlin.test.Test
|
||||
|
||||
class SongbookPipelineTest {
|
||||
|
||||
private fun createTempProject(): File {
|
||||
val dir = kotlin.io.path.createTempDirectory("songbook-test").toFile()
|
||||
dir.deleteOnExit()
|
||||
return dir
|
||||
}
|
||||
|
||||
private fun writeConfig(projectDir: File, config: String = defaultConfig()) {
|
||||
File(projectDir, "songbook.yaml").writeText(config)
|
||||
}
|
||||
|
||||
private fun defaultConfig(
|
||||
songsDir: String = "./songs",
|
||||
outputDir: String = "./output",
|
||||
outputFilename: String = "liederbuch.pdf",
|
||||
order: String = "alphabetical"
|
||||
): String = """
|
||||
book:
|
||||
title: "Test Liederbuch"
|
||||
format: "A5"
|
||||
songs:
|
||||
directory: "$songsDir"
|
||||
order: "$order"
|
||||
fonts:
|
||||
lyrics:
|
||||
family: "Helvetica"
|
||||
size: 10
|
||||
chords:
|
||||
family: "Helvetica"
|
||||
size: 9
|
||||
title:
|
||||
family: "Helvetica"
|
||||
size: 14
|
||||
metadata:
|
||||
family: "Helvetica"
|
||||
size: 8
|
||||
toc:
|
||||
family: "Helvetica"
|
||||
size: 9
|
||||
layout:
|
||||
margins:
|
||||
top: 15
|
||||
bottom: 15
|
||||
inner: 20
|
||||
outer: 12
|
||||
images:
|
||||
directory: "./images"
|
||||
output:
|
||||
directory: "$outputDir"
|
||||
filename: "$outputFilename"
|
||||
""".trimIndent()
|
||||
|
||||
private fun writeSongFile(songsDir: File, filename: String, content: String) {
|
||||
songsDir.mkdirs()
|
||||
File(songsDir, filename).writeText(content)
|
||||
}
|
||||
|
||||
private fun sampleSong(title: String = "Test Song"): String = """
|
||||
{title: $title}
|
||||
{start_of_verse}
|
||||
[Am]Hello [C]world
|
||||
This is a test
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
|
||||
// --- build() tests ---
|
||||
|
||||
@Test
|
||||
fun `build returns error when songbook yaml is missing`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val result = pipeline.build()
|
||||
|
||||
result.success.shouldBeFalse()
|
||||
result.errors shouldHaveSize 1
|
||||
result.errors[0].message shouldContain "songbook.yaml not found"
|
||||
result.outputFile.shouldBeNull()
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `build returns error when songs directory does not exist`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
writeConfig(projectDir, defaultConfig(songsDir = "./nonexistent"))
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val result = pipeline.build()
|
||||
|
||||
result.success.shouldBeFalse()
|
||||
result.errors shouldHaveSize 1
|
||||
result.errors[0].message shouldContain "Songs directory not found"
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `build returns error when songs directory is empty`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
writeConfig(projectDir)
|
||||
File(projectDir, "songs").mkdirs()
|
||||
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val result = pipeline.build()
|
||||
|
||||
result.success.shouldBeFalse()
|
||||
result.errors shouldHaveSize 1
|
||||
result.errors[0].message shouldContain "No song files found"
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `build returns error for invalid config with zero margins`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
val config = """
|
||||
book:
|
||||
title: "Test"
|
||||
layout:
|
||||
margins:
|
||||
top: 0
|
||||
bottom: 15
|
||||
inner: 20
|
||||
outer: 12
|
||||
""".trimIndent()
|
||||
writeConfig(projectDir, config)
|
||||
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val result = pipeline.build()
|
||||
|
||||
result.success.shouldBeFalse()
|
||||
result.errors.shouldNotBeEmpty()
|
||||
result.errors.any { it.message.contains("margin", ignoreCase = true) }.shouldBeTrue()
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `build returns error for song with missing title`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
writeConfig(projectDir)
|
||||
val songsDir = File(projectDir, "songs")
|
||||
writeSongFile(songsDir, "bad_song.chopro", """
|
||||
{start_of_verse}
|
||||
[Am]Hello world
|
||||
{end_of_verse}
|
||||
""".trimIndent())
|
||||
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val result = pipeline.build()
|
||||
|
||||
result.success.shouldBeFalse()
|
||||
result.errors.shouldNotBeEmpty()
|
||||
result.errors.any { it.message.contains("title", ignoreCase = true) }.shouldBeTrue()
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `build returns error for song with no sections`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
writeConfig(projectDir)
|
||||
val songsDir = File(projectDir, "songs")
|
||||
writeSongFile(songsDir, "empty_song.chopro", "{title: Empty Song}")
|
||||
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val result = pipeline.build()
|
||||
|
||||
result.success.shouldBeFalse()
|
||||
result.errors.shouldNotBeEmpty()
|
||||
result.errors.any { it.message.contains("section", ignoreCase = true) }.shouldBeTrue()
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `build succeeds with valid project`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
writeConfig(projectDir)
|
||||
val songsDir = File(projectDir, "songs")
|
||||
writeSongFile(songsDir, "song1.chopro", sampleSong("Alpha Song"))
|
||||
writeSongFile(songsDir, "song2.chopro", sampleSong("Beta Song"))
|
||||
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val result = pipeline.build()
|
||||
|
||||
result.success.shouldBeTrue()
|
||||
result.errors.shouldBeEmpty()
|
||||
result.outputFile.shouldNotBeNull()
|
||||
result.outputFile!!.exists().shouldBeTrue()
|
||||
result.songCount shouldBe 2
|
||||
result.pageCount shouldBeGreaterThan 0
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `build creates output directory if it does not exist`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
writeConfig(projectDir, defaultConfig(outputDir = "./out/build"))
|
||||
val songsDir = File(projectDir, "songs")
|
||||
writeSongFile(songsDir, "song1.chopro", sampleSong())
|
||||
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val result = pipeline.build()
|
||||
|
||||
result.success.shouldBeTrue()
|
||||
File(projectDir, "out/build").exists().shouldBeTrue()
|
||||
result.outputFile!!.exists().shouldBeTrue()
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `build with alphabetical order sorts songs by title`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
writeConfig(projectDir, defaultConfig(order = "alphabetical"))
|
||||
val songsDir = File(projectDir, "songs")
|
||||
writeSongFile(songsDir, "z_first.chopro", sampleSong("Zebra Song"))
|
||||
writeSongFile(songsDir, "a_second.chopro", sampleSong("Alpha Song"))
|
||||
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val result = pipeline.build()
|
||||
|
||||
result.success.shouldBeTrue()
|
||||
result.songCount shouldBe 2
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `build with manual order preserves file order`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
writeConfig(projectDir, defaultConfig(order = "manual"))
|
||||
val songsDir = File(projectDir, "songs")
|
||||
writeSongFile(songsDir, "02_second.chopro", sampleSong("Second Song"))
|
||||
writeSongFile(songsDir, "01_first.chopro", sampleSong("First Song"))
|
||||
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val result = pipeline.build()
|
||||
|
||||
result.success.shouldBeTrue()
|
||||
result.songCount shouldBe 2
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `build recognizes cho extension`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
writeConfig(projectDir)
|
||||
val songsDir = File(projectDir, "songs")
|
||||
writeSongFile(songsDir, "song1.cho", sampleSong("Cho Song"))
|
||||
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val result = pipeline.build()
|
||||
|
||||
result.success.shouldBeTrue()
|
||||
result.songCount shouldBe 1
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `build recognizes crd extension`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
writeConfig(projectDir)
|
||||
val songsDir = File(projectDir, "songs")
|
||||
writeSongFile(songsDir, "song1.crd", sampleSong("Crd Song"))
|
||||
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val result = pipeline.build()
|
||||
|
||||
result.success.shouldBeTrue()
|
||||
result.songCount shouldBe 1
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `build ignores non-song files in songs directory`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
writeConfig(projectDir)
|
||||
val songsDir = File(projectDir, "songs")
|
||||
writeSongFile(songsDir, "song1.chopro", sampleSong("Real Song"))
|
||||
writeSongFile(songsDir, "readme.txt", "Not a song")
|
||||
writeSongFile(songsDir, "notes.md", "# Notes")
|
||||
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val result = pipeline.build()
|
||||
|
||||
result.success.shouldBeTrue()
|
||||
result.songCount shouldBe 1
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `build output file has correct name`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
writeConfig(projectDir, defaultConfig(outputFilename = "my-book.pdf"))
|
||||
val songsDir = File(projectDir, "songs")
|
||||
writeSongFile(songsDir, "song1.chopro", sampleSong())
|
||||
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val result = pipeline.build()
|
||||
|
||||
result.success.shouldBeTrue()
|
||||
result.outputFile!!.name shouldBe "my-book.pdf"
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `build pageCount includes toc pages`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
writeConfig(projectDir)
|
||||
val songsDir = File(projectDir, "songs")
|
||||
writeSongFile(songsDir, "song1.chopro", sampleSong())
|
||||
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val result = pipeline.build()
|
||||
|
||||
result.success.shouldBeTrue()
|
||||
// At least 1 content page + TOC pages (minimum 2 for even count)
|
||||
result.pageCount shouldBeGreaterThan 1
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
// --- validate() tests ---
|
||||
|
||||
@Test
|
||||
fun `validate returns error when songbook yaml is missing`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val errors = pipeline.validate()
|
||||
|
||||
errors shouldHaveSize 1
|
||||
errors[0].message shouldContain "songbook.yaml not found"
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `validate returns error when songs directory does not exist`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
writeConfig(projectDir, defaultConfig(songsDir = "./nonexistent"))
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val errors = pipeline.validate()
|
||||
|
||||
errors.shouldNotBeEmpty()
|
||||
errors.any { it.message.contains("Songs directory not found") }.shouldBeTrue()
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `validate returns empty list for valid project`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
writeConfig(projectDir)
|
||||
val songsDir = File(projectDir, "songs")
|
||||
writeSongFile(songsDir, "song1.chopro", sampleSong())
|
||||
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val errors = pipeline.validate()
|
||||
|
||||
errors.shouldBeEmpty()
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `validate reports config errors`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
val config = """
|
||||
layout:
|
||||
margins:
|
||||
top: 0
|
||||
bottom: 0
|
||||
inner: 0
|
||||
outer: 0
|
||||
""".trimIndent()
|
||||
writeConfig(projectDir, config)
|
||||
// Still need songs dir to exist for full validate
|
||||
File(projectDir, "./songs").mkdirs()
|
||||
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val errors = pipeline.validate()
|
||||
|
||||
errors shouldHaveSize 4
|
||||
errors.all { it.message.contains("margin", ignoreCase = true) }.shouldBeTrue()
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `validate reports song validation errors`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
writeConfig(projectDir)
|
||||
val songsDir = File(projectDir, "songs")
|
||||
writeSongFile(songsDir, "bad_song.chopro", "{title: }")
|
||||
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val errors = pipeline.validate()
|
||||
|
||||
errors.shouldNotBeEmpty()
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `validate reports errors for multiple invalid songs`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
writeConfig(projectDir)
|
||||
val songsDir = File(projectDir, "songs")
|
||||
writeSongFile(songsDir, "bad1.chopro", "{title: Good Title}") // no sections
|
||||
writeSongFile(songsDir, "bad2.chopro", "{title: Another Title}") // no sections
|
||||
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val errors = pipeline.validate()
|
||||
|
||||
errors.shouldNotBeEmpty()
|
||||
errors.size shouldBeGreaterThan 1
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `validate with empty songs directory returns no song errors`() {
|
||||
val projectDir = createTempProject()
|
||||
try {
|
||||
writeConfig(projectDir)
|
||||
File(projectDir, "songs").mkdirs()
|
||||
|
||||
val pipeline = SongbookPipeline(projectDir)
|
||||
val errors = pipeline.validate()
|
||||
|
||||
// No errors because there are no song files to validate
|
||||
errors.shouldBeEmpty()
|
||||
} finally {
|
||||
projectDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
// --- BuildResult data class tests ---
|
||||
|
||||
@Test
|
||||
fun `BuildResult defaults are correct`() {
|
||||
val result = BuildResult(success = false)
|
||||
|
||||
result.success.shouldBeFalse()
|
||||
result.outputFile.shouldBeNull()
|
||||
result.errors.shouldBeEmpty()
|
||||
result.songCount shouldBe 0
|
||||
result.pageCount shouldBe 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `BuildResult with all fields set`() {
|
||||
val file = File("/tmp/test.pdf")
|
||||
val errors = listOf(de.pfadfinder.songbook.parser.ValidationError("test", 1, "error"))
|
||||
val result = BuildResult(
|
||||
success = true,
|
||||
outputFile = file,
|
||||
errors = errors,
|
||||
songCount = 5,
|
||||
pageCount = 10
|
||||
)
|
||||
|
||||
result.success.shouldBeTrue()
|
||||
result.outputFile shouldBe file
|
||||
result.errors shouldHaveSize 1
|
||||
result.songCount shouldBe 5
|
||||
result.pageCount shouldBe 10
|
||||
}
|
||||
}
|
||||
4
build.gradle.kts
Normal file
4
build.gradle.kts
Normal file
@@ -0,0 +1,4 @@
|
||||
plugins {
|
||||
id("org.jetbrains.compose") version "1.7.3" apply false
|
||||
id("org.jetbrains.kotlin.plugin.compose") version "2.1.10" apply false
|
||||
}
|
||||
12
buildSrc/build.gradle.kts
Normal file
12
buildSrc/build.gradle.kts
Normal file
@@ -0,0 +1,12 @@
|
||||
plugins {
|
||||
`kotlin-dsl`
|
||||
}
|
||||
|
||||
repositories {
|
||||
mavenCentral()
|
||||
gradlePluginPortal()
|
||||
}
|
||||
|
||||
dependencies {
|
||||
implementation("org.jetbrains.kotlin:kotlin-gradle-plugin:2.1.10")
|
||||
}
|
||||
18
buildSrc/src/main/kotlin/songbook-conventions.gradle.kts
Normal file
18
buildSrc/src/main/kotlin/songbook-conventions.gradle.kts
Normal file
@@ -0,0 +1,18 @@
|
||||
plugins {
|
||||
kotlin("jvm")
|
||||
}
|
||||
|
||||
java {
|
||||
sourceCompatibility = JavaVersion.VERSION_21
|
||||
targetCompatibility = JavaVersion.VERSION_21
|
||||
}
|
||||
|
||||
kotlin {
|
||||
compilerOptions {
|
||||
jvmTarget.set(org.jetbrains.kotlin.gradle.dsl.JvmTarget.JVM_21)
|
||||
}
|
||||
}
|
||||
|
||||
tasks.withType<Test> {
|
||||
useJUnitPlatform()
|
||||
}
|
||||
17
cli/build.gradle.kts
Normal file
17
cli/build.gradle.kts
Normal file
@@ -0,0 +1,17 @@
|
||||
plugins {
|
||||
id("songbook-conventions")
|
||||
application
|
||||
}
|
||||
|
||||
application {
|
||||
mainClass.set("de.pfadfinder.songbook.cli.MainKt")
|
||||
}
|
||||
|
||||
dependencies {
|
||||
implementation(project(":app"))
|
||||
implementation(project(":model"))
|
||||
implementation(project(":parser"))
|
||||
implementation("com.github.ajalt.clikt:clikt:5.0.3")
|
||||
implementation("io.github.microutils:kotlin-logging-jvm:3.0.5")
|
||||
implementation("ch.qos.logback:logback-classic:1.5.16")
|
||||
}
|
||||
@@ -0,0 +1,37 @@
|
||||
package de.pfadfinder.songbook.cli
|
||||
|
||||
import com.github.ajalt.clikt.core.CliktCommand
|
||||
import com.github.ajalt.clikt.core.Context
|
||||
import com.github.ajalt.clikt.core.ProgramResult
|
||||
import com.github.ajalt.clikt.parameters.options.default
|
||||
import com.github.ajalt.clikt.parameters.options.option
|
||||
import de.pfadfinder.songbook.app.SongbookPipeline
|
||||
import java.io.File
|
||||
|
||||
class BuildCommand : CliktCommand(name = "build") {
|
||||
override fun help(context: Context) = "Build the songbook PDF"
|
||||
|
||||
private val projectDir by option("-d", "--dir", help = "Project directory").default(".")
|
||||
|
||||
override fun run() {
|
||||
val dir = File(projectDir).absoluteFile
|
||||
echo("Building songbook from: ${dir.path}")
|
||||
|
||||
val pipeline = SongbookPipeline(dir)
|
||||
val result = pipeline.build(onProgress = { msg -> echo(msg) })
|
||||
|
||||
if (result.success) {
|
||||
echo("Build successful!")
|
||||
echo(" Songs: ${result.songCount}")
|
||||
echo(" Pages: ${result.pageCount}")
|
||||
echo(" Output: ${result.outputFile?.absolutePath}")
|
||||
} else {
|
||||
echo("Build failed with ${result.errors.size} error(s):", err = true)
|
||||
for (error in result.errors) {
|
||||
val location = listOfNotNull(error.file, error.line?.toString()).joinToString(":")
|
||||
echo(" [$location] ${error.message}", err = true)
|
||||
}
|
||||
throw ProgramResult(1)
|
||||
}
|
||||
}
|
||||
}
|
||||
15
cli/src/main/kotlin/de/pfadfinder/songbook/cli/Main.kt
Normal file
15
cli/src/main/kotlin/de/pfadfinder/songbook/cli/Main.kt
Normal file
@@ -0,0 +1,15 @@
|
||||
package de.pfadfinder.songbook.cli
|
||||
|
||||
import com.github.ajalt.clikt.core.CliktCommand
|
||||
import com.github.ajalt.clikt.core.main
|
||||
import com.github.ajalt.clikt.core.subcommands
|
||||
|
||||
class SongbookCli : CliktCommand(name = "songbook") {
|
||||
override fun run() = Unit
|
||||
}
|
||||
|
||||
fun main(args: Array<String>) {
|
||||
SongbookCli()
|
||||
.subcommands(BuildCommand(), ValidateCommand())
|
||||
.main(args)
|
||||
}
|
||||
@@ -0,0 +1,34 @@
|
||||
package de.pfadfinder.songbook.cli
|
||||
|
||||
import com.github.ajalt.clikt.core.CliktCommand
|
||||
import com.github.ajalt.clikt.core.Context
|
||||
import com.github.ajalt.clikt.core.ProgramResult
|
||||
import com.github.ajalt.clikt.parameters.options.default
|
||||
import com.github.ajalt.clikt.parameters.options.option
|
||||
import de.pfadfinder.songbook.app.SongbookPipeline
|
||||
import java.io.File
|
||||
|
||||
class ValidateCommand : CliktCommand(name = "validate") {
|
||||
override fun help(context: Context) = "Validate all song files"
|
||||
|
||||
private val projectDir by option("-d", "--dir", help = "Project directory").default(".")
|
||||
|
||||
override fun run() {
|
||||
val dir = File(projectDir).absoluteFile
|
||||
echo("Validating songbook in: ${dir.path}")
|
||||
|
||||
val pipeline = SongbookPipeline(dir)
|
||||
val errors = pipeline.validate()
|
||||
|
||||
if (errors.isEmpty()) {
|
||||
echo("All songs are valid!")
|
||||
} else {
|
||||
echo("Found ${errors.size} error(s):", err = true)
|
||||
for (error in errors) {
|
||||
val location = listOfNotNull(error.file, error.line?.toString()).joinToString(":")
|
||||
echo(" [$location] ${error.message}", err = true)
|
||||
}
|
||||
throw ProgramResult(1)
|
||||
}
|
||||
}
|
||||
}
|
||||
Binary file not shown.
1
gradle.properties
Normal file
1
gradle.properties
Normal file
@@ -0,0 +1 @@
|
||||
org.gradle.java.home=/usr/lib/jvm/java-25-openjdk
|
||||
BIN
gradle/wrapper/gradle-wrapper.jar
vendored
Normal file
BIN
gradle/wrapper/gradle-wrapper.jar
vendored
Normal file
Binary file not shown.
7
gradle/wrapper/gradle-wrapper.properties
vendored
Normal file
7
gradle/wrapper/gradle-wrapper.properties
vendored
Normal file
@@ -0,0 +1,7 @@
|
||||
distributionBase=GRADLE_USER_HOME
|
||||
distributionPath=wrapper/dists
|
||||
distributionUrl=https\://services.gradle.org/distributions/gradle-9.3.1-bin.zip
|
||||
networkTimeout=10000
|
||||
validateDistributionUrl=true
|
||||
zipStoreBase=GRADLE_USER_HOME
|
||||
zipStorePath=wrapper/dists
|
||||
248
gradlew
vendored
Executable file
248
gradlew
vendored
Executable file
@@ -0,0 +1,248 @@
|
||||
#!/bin/sh
|
||||
|
||||
#
|
||||
# Copyright © 2015 the original authors.
|
||||
#
|
||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
||||
# you may not use this file except in compliance with the License.
|
||||
# You may obtain a copy of the License at
|
||||
#
|
||||
# https://www.apache.org/licenses/LICENSE-2.0
|
||||
#
|
||||
# Unless required by applicable law or agreed to in writing, software
|
||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
# See the License for the specific language governing permissions and
|
||||
# limitations under the License.
|
||||
#
|
||||
# SPDX-License-Identifier: Apache-2.0
|
||||
#
|
||||
|
||||
##############################################################################
|
||||
#
|
||||
# Gradle start up script for POSIX generated by Gradle.
|
||||
#
|
||||
# Important for running:
|
||||
#
|
||||
# (1) You need a POSIX-compliant shell to run this script. If your /bin/sh is
|
||||
# noncompliant, but you have some other compliant shell such as ksh or
|
||||
# bash, then to run this script, type that shell name before the whole
|
||||
# command line, like:
|
||||
#
|
||||
# ksh Gradle
|
||||
#
|
||||
# Busybox and similar reduced shells will NOT work, because this script
|
||||
# requires all of these POSIX shell features:
|
||||
# * functions;
|
||||
# * expansions «$var», «${var}», «${var:-default}», «${var+SET}»,
|
||||
# «${var#prefix}», «${var%suffix}», and «$( cmd )»;
|
||||
# * compound commands having a testable exit status, especially «case»;
|
||||
# * various built-in commands including «command», «set», and «ulimit».
|
||||
#
|
||||
# Important for patching:
|
||||
#
|
||||
# (2) This script targets any POSIX shell, so it avoids extensions provided
|
||||
# by Bash, Ksh, etc; in particular arrays are avoided.
|
||||
#
|
||||
# The "traditional" practice of packing multiple parameters into a
|
||||
# space-separated string is a well documented source of bugs and security
|
||||
# problems, so this is (mostly) avoided, by progressively accumulating
|
||||
# options in "$@", and eventually passing that to Java.
|
||||
#
|
||||
# Where the inherited environment variables (DEFAULT_JVM_OPTS, JAVA_OPTS,
|
||||
# and GRADLE_OPTS) rely on word-splitting, this is performed explicitly;
|
||||
# see the in-line comments for details.
|
||||
#
|
||||
# There are tweaks for specific operating systems such as AIX, CygWin,
|
||||
# Darwin, MinGW, and NonStop.
|
||||
#
|
||||
# (3) This script is generated from the Groovy template
|
||||
# https://github.com/gradle/gradle/blob/HEAD/platforms/jvm/plugins-application/src/main/resources/org/gradle/api/internal/plugins/unixStartScript.txt
|
||||
# within the Gradle project.
|
||||
#
|
||||
# You can find Gradle at https://github.com/gradle/gradle/.
|
||||
#
|
||||
##############################################################################
|
||||
|
||||
# Attempt to set APP_HOME
|
||||
|
||||
# Resolve links: $0 may be a link
|
||||
app_path=$0
|
||||
|
||||
# Need this for daisy-chained symlinks.
|
||||
while
|
||||
APP_HOME=${app_path%"${app_path##*/}"} # leaves a trailing /; empty if no leading path
|
||||
[ -h "$app_path" ]
|
||||
do
|
||||
ls=$( ls -ld "$app_path" )
|
||||
link=${ls#*' -> '}
|
||||
case $link in #(
|
||||
/*) app_path=$link ;; #(
|
||||
*) app_path=$APP_HOME$link ;;
|
||||
esac
|
||||
done
|
||||
|
||||
# This is normally unused
|
||||
# shellcheck disable=SC2034
|
||||
APP_BASE_NAME=${0##*/}
|
||||
# Discard cd standard output in case $CDPATH is set (https://github.com/gradle/gradle/issues/25036)
|
||||
APP_HOME=$( cd -P "${APP_HOME:-./}" > /dev/null && printf '%s\n' "$PWD" ) || exit
|
||||
|
||||
# Use the maximum available, or set MAX_FD != -1 to use that value.
|
||||
MAX_FD=maximum
|
||||
|
||||
warn () {
|
||||
echo "$*"
|
||||
} >&2
|
||||
|
||||
die () {
|
||||
echo
|
||||
echo "$*"
|
||||
echo
|
||||
exit 1
|
||||
} >&2
|
||||
|
||||
# OS specific support (must be 'true' or 'false').
|
||||
cygwin=false
|
||||
msys=false
|
||||
darwin=false
|
||||
nonstop=false
|
||||
case "$( uname )" in #(
|
||||
CYGWIN* ) cygwin=true ;; #(
|
||||
Darwin* ) darwin=true ;; #(
|
||||
MSYS* | MINGW* ) msys=true ;; #(
|
||||
NONSTOP* ) nonstop=true ;;
|
||||
esac
|
||||
|
||||
|
||||
|
||||
# Determine the Java command to use to start the JVM.
|
||||
if [ -n "$JAVA_HOME" ] ; then
|
||||
if [ -x "$JAVA_HOME/jre/sh/java" ] ; then
|
||||
# IBM's JDK on AIX uses strange locations for the executables
|
||||
JAVACMD=$JAVA_HOME/jre/sh/java
|
||||
else
|
||||
JAVACMD=$JAVA_HOME/bin/java
|
||||
fi
|
||||
if [ ! -x "$JAVACMD" ] ; then
|
||||
die "ERROR: JAVA_HOME is set to an invalid directory: $JAVA_HOME
|
||||
|
||||
Please set the JAVA_HOME variable in your environment to match the
|
||||
location of your Java installation."
|
||||
fi
|
||||
else
|
||||
JAVACMD=java
|
||||
if ! command -v java >/dev/null 2>&1
|
||||
then
|
||||
die "ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH.
|
||||
|
||||
Please set the JAVA_HOME variable in your environment to match the
|
||||
location of your Java installation."
|
||||
fi
|
||||
fi
|
||||
|
||||
# Increase the maximum file descriptors if we can.
|
||||
if ! "$cygwin" && ! "$darwin" && ! "$nonstop" ; then
|
||||
case $MAX_FD in #(
|
||||
max*)
|
||||
# In POSIX sh, ulimit -H is undefined. That's why the result is checked to see if it worked.
|
||||
# shellcheck disable=SC2039,SC3045
|
||||
MAX_FD=$( ulimit -H -n ) ||
|
||||
warn "Could not query maximum file descriptor limit"
|
||||
esac
|
||||
case $MAX_FD in #(
|
||||
'' | soft) :;; #(
|
||||
*)
|
||||
# In POSIX sh, ulimit -n is undefined. That's why the result is checked to see if it worked.
|
||||
# shellcheck disable=SC2039,SC3045
|
||||
ulimit -n "$MAX_FD" ||
|
||||
warn "Could not set maximum file descriptor limit to $MAX_FD"
|
||||
esac
|
||||
fi
|
||||
|
||||
# Collect all arguments for the java command, stacking in reverse order:
|
||||
# * args from the command line
|
||||
# * the main class name
|
||||
# * -classpath
|
||||
# * -D...appname settings
|
||||
# * --module-path (only if needed)
|
||||
# * DEFAULT_JVM_OPTS, JAVA_OPTS, and GRADLE_OPTS environment variables.
|
||||
|
||||
# For Cygwin or MSYS, switch paths to Windows format before running java
|
||||
if "$cygwin" || "$msys" ; then
|
||||
APP_HOME=$( cygpath --path --mixed "$APP_HOME" )
|
||||
|
||||
JAVACMD=$( cygpath --unix "$JAVACMD" )
|
||||
|
||||
# Now convert the arguments - kludge to limit ourselves to /bin/sh
|
||||
for arg do
|
||||
if
|
||||
case $arg in #(
|
||||
-*) false ;; # don't mess with options #(
|
||||
/?*) t=${arg#/} t=/${t%%/*} # looks like a POSIX filepath
|
||||
[ -e "$t" ] ;; #(
|
||||
*) false ;;
|
||||
esac
|
||||
then
|
||||
arg=$( cygpath --path --ignore --mixed "$arg" )
|
||||
fi
|
||||
# Roll the args list around exactly as many times as the number of
|
||||
# args, so each arg winds up back in the position where it started, but
|
||||
# possibly modified.
|
||||
#
|
||||
# NB: a `for` loop captures its iteration list before it begins, so
|
||||
# changing the positional parameters here affects neither the number of
|
||||
# iterations, nor the values presented in `arg`.
|
||||
shift # remove old arg
|
||||
set -- "$@" "$arg" # push replacement arg
|
||||
done
|
||||
fi
|
||||
|
||||
|
||||
# Add default JVM options here. You can also use JAVA_OPTS and GRADLE_OPTS to pass JVM options to this script.
|
||||
DEFAULT_JVM_OPTS='"-Xmx64m" "-Xms64m"'
|
||||
|
||||
# Collect all arguments for the java command:
|
||||
# * DEFAULT_JVM_OPTS, JAVA_OPTS, and optsEnvironmentVar are not allowed to contain shell fragments,
|
||||
# and any embedded shellness will be escaped.
|
||||
# * For example: A user cannot expect ${Hostname} to be expanded, as it is an environment variable and will be
|
||||
# treated as '${Hostname}' itself on the command line.
|
||||
|
||||
set -- \
|
||||
"-Dorg.gradle.appname=$APP_BASE_NAME" \
|
||||
-jar "$APP_HOME/gradle/wrapper/gradle-wrapper.jar" \
|
||||
"$@"
|
||||
|
||||
# Stop when "xargs" is not available.
|
||||
if ! command -v xargs >/dev/null 2>&1
|
||||
then
|
||||
die "xargs is not available"
|
||||
fi
|
||||
|
||||
# Use "xargs" to parse quoted args.
|
||||
#
|
||||
# With -n1 it outputs one arg per line, with the quotes and backslashes removed.
|
||||
#
|
||||
# In Bash we could simply go:
|
||||
#
|
||||
# readarray ARGS < <( xargs -n1 <<<"$var" ) &&
|
||||
# set -- "${ARGS[@]}" "$@"
|
||||
#
|
||||
# but POSIX shell has neither arrays nor command substitution, so instead we
|
||||
# post-process each arg (as a line of input to sed) to backslash-escape any
|
||||
# character that might be a shell metacharacter, then use eval to reverse
|
||||
# that process (while maintaining the separation between arguments), and wrap
|
||||
# the whole thing up as a single "set" statement.
|
||||
#
|
||||
# This will of course break if any of these variables contains a newline or
|
||||
# an unmatched quote.
|
||||
#
|
||||
|
||||
eval "set -- $(
|
||||
printf '%s\n' "$DEFAULT_JVM_OPTS $JAVA_OPTS $GRADLE_OPTS" |
|
||||
xargs -n1 |
|
||||
sed ' s~[^-[:alnum:]+,./:=@_]~\\&~g; ' |
|
||||
tr '\n' ' '
|
||||
)" '"$@"'
|
||||
|
||||
exec "$JAVACMD" "$@"
|
||||
93
gradlew.bat
vendored
Normal file
93
gradlew.bat
vendored
Normal file
@@ -0,0 +1,93 @@
|
||||
@rem
|
||||
@rem Copyright 2015 the original author or authors.
|
||||
@rem
|
||||
@rem Licensed under the Apache License, Version 2.0 (the "License");
|
||||
@rem you may not use this file except in compliance with the License.
|
||||
@rem You may obtain a copy of the License at
|
||||
@rem
|
||||
@rem https://www.apache.org/licenses/LICENSE-2.0
|
||||
@rem
|
||||
@rem Unless required by applicable law or agreed to in writing, software
|
||||
@rem distributed under the License is distributed on an "AS IS" BASIS,
|
||||
@rem WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
@rem See the License for the specific language governing permissions and
|
||||
@rem limitations under the License.
|
||||
@rem
|
||||
@rem SPDX-License-Identifier: Apache-2.0
|
||||
@rem
|
||||
|
||||
@if "%DEBUG%"=="" @echo off
|
||||
@rem ##########################################################################
|
||||
@rem
|
||||
@rem Gradle startup script for Windows
|
||||
@rem
|
||||
@rem ##########################################################################
|
||||
|
||||
@rem Set local scope for the variables with windows NT shell
|
||||
if "%OS%"=="Windows_NT" setlocal
|
||||
|
||||
set DIRNAME=%~dp0
|
||||
if "%DIRNAME%"=="" set DIRNAME=.
|
||||
@rem This is normally unused
|
||||
set APP_BASE_NAME=%~n0
|
||||
set APP_HOME=%DIRNAME%
|
||||
|
||||
@rem Resolve any "." and ".." in APP_HOME to make it shorter.
|
||||
for %%i in ("%APP_HOME%") do set APP_HOME=%%~fi
|
||||
|
||||
@rem Add default JVM options here. You can also use JAVA_OPTS and GRADLE_OPTS to pass JVM options to this script.
|
||||
set DEFAULT_JVM_OPTS="-Xmx64m" "-Xms64m"
|
||||
|
||||
@rem Find java.exe
|
||||
if defined JAVA_HOME goto findJavaFromJavaHome
|
||||
|
||||
set JAVA_EXE=java.exe
|
||||
%JAVA_EXE% -version >NUL 2>&1
|
||||
if %ERRORLEVEL% equ 0 goto execute
|
||||
|
||||
echo. 1>&2
|
||||
echo ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH. 1>&2
|
||||
echo. 1>&2
|
||||
echo Please set the JAVA_HOME variable in your environment to match the 1>&2
|
||||
echo location of your Java installation. 1>&2
|
||||
|
||||
goto fail
|
||||
|
||||
:findJavaFromJavaHome
|
||||
set JAVA_HOME=%JAVA_HOME:"=%
|
||||
set JAVA_EXE=%JAVA_HOME%/bin/java.exe
|
||||
|
||||
if exist "%JAVA_EXE%" goto execute
|
||||
|
||||
echo. 1>&2
|
||||
echo ERROR: JAVA_HOME is set to an invalid directory: %JAVA_HOME% 1>&2
|
||||
echo. 1>&2
|
||||
echo Please set the JAVA_HOME variable in your environment to match the 1>&2
|
||||
echo location of your Java installation. 1>&2
|
||||
|
||||
goto fail
|
||||
|
||||
:execute
|
||||
@rem Setup the command line
|
||||
|
||||
|
||||
|
||||
@rem Execute Gradle
|
||||
"%JAVA_EXE%" %DEFAULT_JVM_OPTS% %JAVA_OPTS% %GRADLE_OPTS% "-Dorg.gradle.appname=%APP_BASE_NAME%" -jar "%APP_HOME%\gradle\wrapper\gradle-wrapper.jar" %*
|
||||
|
||||
:end
|
||||
@rem End local scope for the variables with windows NT shell
|
||||
if %ERRORLEVEL% equ 0 goto mainEnd
|
||||
|
||||
:fail
|
||||
rem Set variable GRADLE_EXIT_CONSOLE if you need the _script_ return code instead of
|
||||
rem the _cmd.exe /c_ return code!
|
||||
set EXIT_CODE=%ERRORLEVEL%
|
||||
if %EXIT_CODE% equ 0 set EXIT_CODE=1
|
||||
if not ""=="%GRADLE_EXIT_CONSOLE%" exit %EXIT_CODE%
|
||||
exit /b %EXIT_CODE%
|
||||
|
||||
:mainEnd
|
||||
if "%OS%"=="Windows_NT" endlocal
|
||||
|
||||
:omega
|
||||
21
gui/build.gradle.kts
Normal file
21
gui/build.gradle.kts
Normal file
@@ -0,0 +1,21 @@
|
||||
plugins {
|
||||
id("songbook-conventions")
|
||||
id("org.jetbrains.compose")
|
||||
id("org.jetbrains.kotlin.plugin.compose")
|
||||
}
|
||||
|
||||
dependencies {
|
||||
implementation(project(":app"))
|
||||
implementation(project(":model"))
|
||||
implementation(project(":parser"))
|
||||
implementation(compose.desktop.currentOs)
|
||||
implementation("io.github.microutils:kotlin-logging-jvm:3.0.5")
|
||||
implementation("ch.qos.logback:logback-classic:1.5.16")
|
||||
implementation("org.apache.pdfbox:pdfbox:3.0.4")
|
||||
}
|
||||
|
||||
compose.desktop {
|
||||
application {
|
||||
mainClass = "de.pfadfinder.songbook.gui.AppKt"
|
||||
}
|
||||
}
|
||||
447
gui/src/main/kotlin/de/pfadfinder/songbook/gui/App.kt
Normal file
447
gui/src/main/kotlin/de/pfadfinder/songbook/gui/App.kt
Normal file
@@ -0,0 +1,447 @@
|
||||
package de.pfadfinder.songbook.gui
|
||||
|
||||
import androidx.compose.desktop.ui.tooling.preview.Preview
|
||||
import androidx.compose.foundation.text.selection.SelectionContainer
|
||||
import androidx.compose.foundation.VerticalScrollbar
|
||||
import androidx.compose.foundation.layout.*
|
||||
import androidx.compose.foundation.lazy.LazyColumn
|
||||
import androidx.compose.foundation.lazy.items
|
||||
import androidx.compose.foundation.lazy.rememberLazyListState
|
||||
import androidx.compose.foundation.rememberScrollbarAdapter
|
||||
import androidx.compose.material.*
|
||||
import androidx.compose.runtime.*
|
||||
import androidx.compose.ui.Alignment
|
||||
import androidx.compose.ui.Modifier
|
||||
import androidx.compose.ui.graphics.Color
|
||||
import androidx.compose.ui.text.font.FontWeight
|
||||
import androidx.compose.ui.unit.dp
|
||||
import androidx.compose.ui.unit.sp
|
||||
import androidx.compose.ui.window.Window
|
||||
import androidx.compose.ui.window.application
|
||||
import de.pfadfinder.songbook.app.BuildResult
|
||||
import de.pfadfinder.songbook.app.SongbookPipeline
|
||||
import de.pfadfinder.songbook.parser.ChordProParser
|
||||
import de.pfadfinder.songbook.parser.ConfigParser
|
||||
import de.pfadfinder.songbook.parser.ValidationError
|
||||
import kotlinx.coroutines.Dispatchers
|
||||
import kotlinx.coroutines.launch
|
||||
import kotlinx.coroutines.withContext
|
||||
import java.awt.Desktop
|
||||
import java.io.File
|
||||
import javax.swing.JFileChooser
|
||||
|
||||
fun main() = application {
|
||||
Window(
|
||||
onCloseRequest = ::exitApplication,
|
||||
title = "Songbook Builder"
|
||||
) {
|
||||
App()
|
||||
}
|
||||
}
|
||||
|
||||
data class SongEntry(val fileName: String, val title: String)
|
||||
|
||||
@Composable
|
||||
@Preview
|
||||
fun App() {
|
||||
var projectPath by remember { mutableStateOf("") }
|
||||
var songs by remember { mutableStateOf<List<SongEntry>>(emptyList()) }
|
||||
var originalSongs by remember { mutableStateOf<List<SongEntry>>(emptyList()) }
|
||||
var songsOrderConfig by remember { mutableStateOf("alphabetical") }
|
||||
var isCustomOrder by remember { mutableStateOf(false) }
|
||||
var statusMessages by remember { mutableStateOf<List<StatusMessage>>(emptyList()) }
|
||||
var isRunning by remember { mutableStateOf(false) }
|
||||
var isLoadingSongs by remember { mutableStateOf(false) }
|
||||
var lastBuildResult by remember { mutableStateOf<BuildResult?>(null) }
|
||||
val previewState = remember { PdfPreviewState() }
|
||||
|
||||
val scope = rememberCoroutineScope()
|
||||
|
||||
val reorderEnabled = songsOrderConfig != "alphabetical"
|
||||
|
||||
fun loadSongs(path: String) {
|
||||
val projectDir = File(path)
|
||||
songs = emptyList()
|
||||
originalSongs = emptyList()
|
||||
isCustomOrder = false
|
||||
if (!projectDir.isDirectory) return
|
||||
|
||||
isLoadingSongs = true
|
||||
statusMessages = listOf(StatusMessage("Lieder werden geladen...", MessageType.INFO))
|
||||
|
||||
scope.launch {
|
||||
val (loadedSongs, order) = withContext(Dispatchers.IO) {
|
||||
val configFile = File(projectDir, "songbook.yaml")
|
||||
var songsDir: File
|
||||
var orderConfig = "alphabetical"
|
||||
|
||||
if (configFile.exists()) {
|
||||
try {
|
||||
val config = ConfigParser.parse(configFile)
|
||||
songsDir = File(projectDir, config.songs.directory)
|
||||
orderConfig = config.songs.order
|
||||
} catch (_: Exception) {
|
||||
songsDir = File(projectDir, "songs")
|
||||
}
|
||||
} else {
|
||||
songsDir = File(projectDir, "songs")
|
||||
}
|
||||
|
||||
if (!songsDir.isDirectory) return@withContext Pair(emptyList<SongEntry>(), orderConfig)
|
||||
|
||||
val songFiles = songsDir.listFiles { f: File -> f.extension in listOf("chopro", "cho", "crd") }
|
||||
?.sortedBy { it.name }
|
||||
?: emptyList()
|
||||
|
||||
val loaded = songFiles.mapNotNull { file ->
|
||||
try {
|
||||
val song = ChordProParser.parseFile(file)
|
||||
SongEntry(fileName = file.name, title = song.title.ifBlank { file.nameWithoutExtension })
|
||||
} catch (_: Exception) {
|
||||
SongEntry(fileName = file.name, title = "${file.nameWithoutExtension} (Fehler beim Lesen)")
|
||||
}
|
||||
}
|
||||
Pair(loaded, orderConfig)
|
||||
}
|
||||
|
||||
songsOrderConfig = order
|
||||
songs = if (order == "alphabetical") {
|
||||
loadedSongs.sortedBy { it.title.lowercase() }
|
||||
} else {
|
||||
loadedSongs
|
||||
}
|
||||
originalSongs = songs.toList()
|
||||
isLoadingSongs = false
|
||||
statusMessages = if (loadedSongs.isNotEmpty()) {
|
||||
listOf(StatusMessage("${loadedSongs.size} Lieder geladen.", MessageType.SUCCESS))
|
||||
} else {
|
||||
listOf(StatusMessage("Keine Lieder gefunden.", MessageType.INFO))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
MaterialTheme {
|
||||
Surface(modifier = Modifier.fillMaxSize()) {
|
||||
SelectionContainer {
|
||||
Column(modifier = Modifier.padding(16.dp)) {
|
||||
// Project directory selection
|
||||
Text(
|
||||
text = "Songbook Builder",
|
||||
fontSize = 20.sp,
|
||||
fontWeight = FontWeight.Bold,
|
||||
modifier = Modifier.padding(bottom = 16.dp)
|
||||
)
|
||||
|
||||
Text("Projektverzeichnis:", fontWeight = FontWeight.Medium)
|
||||
Spacer(modifier = Modifier.height(4.dp))
|
||||
Row(verticalAlignment = Alignment.CenterVertically) {
|
||||
OutlinedTextField(
|
||||
value = projectPath,
|
||||
onValueChange = {
|
||||
projectPath = it
|
||||
loadSongs(it)
|
||||
},
|
||||
modifier = Modifier.weight(1f),
|
||||
singleLine = true,
|
||||
placeholder = { Text("Pfad zum Projektverzeichnis...") }
|
||||
)
|
||||
Spacer(modifier = Modifier.width(8.dp))
|
||||
Button(
|
||||
onClick = {
|
||||
val chooser = JFileChooser().apply {
|
||||
fileSelectionMode = JFileChooser.DIRECTORIES_ONLY
|
||||
dialogTitle = "Projektverzeichnis auswählen"
|
||||
if (projectPath.isNotBlank()) {
|
||||
currentDirectory = File(projectPath)
|
||||
}
|
||||
}
|
||||
if (chooser.showOpenDialog(null) == JFileChooser.APPROVE_OPTION) {
|
||||
projectPath = chooser.selectedFile.absolutePath
|
||||
loadSongs(projectPath)
|
||||
}
|
||||
},
|
||||
enabled = !isRunning
|
||||
) {
|
||||
Text("Durchsuchen...")
|
||||
}
|
||||
}
|
||||
|
||||
Spacer(modifier = Modifier.height(16.dp))
|
||||
|
||||
// Central content area: song list or preview panel
|
||||
if (previewState.isVisible) {
|
||||
// Show preview panel
|
||||
PdfPreviewPanel(
|
||||
state = previewState,
|
||||
modifier = Modifier.weight(1f)
|
||||
)
|
||||
} else {
|
||||
// Song list header with optional reset button
|
||||
Row(
|
||||
verticalAlignment = Alignment.CenterVertically,
|
||||
modifier = Modifier.fillMaxWidth()
|
||||
) {
|
||||
Text(
|
||||
text = "Lieder (${songs.size}):",
|
||||
fontWeight = FontWeight.Medium,
|
||||
modifier = Modifier.weight(1f)
|
||||
)
|
||||
if (reorderEnabled && isCustomOrder) {
|
||||
Button(
|
||||
onClick = {
|
||||
songs = originalSongs.toList()
|
||||
isCustomOrder = false
|
||||
},
|
||||
enabled = !isRunning
|
||||
) {
|
||||
Text("Reihenfolge zuruecksetzen")
|
||||
}
|
||||
}
|
||||
}
|
||||
Spacer(modifier = Modifier.height(4.dp))
|
||||
|
||||
if (isLoadingSongs) {
|
||||
Box(
|
||||
modifier = Modifier.weight(1f).fillMaxWidth(),
|
||||
contentAlignment = Alignment.Center
|
||||
) {
|
||||
Column(horizontalAlignment = Alignment.CenterHorizontally) {
|
||||
CircularProgressIndicator(modifier = Modifier.size(32.dp))
|
||||
Spacer(modifier = Modifier.height(8.dp))
|
||||
Text("Lieder werden geladen...", color = Color.Gray)
|
||||
}
|
||||
}
|
||||
} else if (songs.isEmpty() && projectPath.isNotBlank()) {
|
||||
Box(modifier = Modifier.weight(1f).fillMaxWidth()) {
|
||||
Text(
|
||||
"Keine Lieder gefunden. Bitte Projektverzeichnis pruefen.",
|
||||
color = Color.Gray,
|
||||
modifier = Modifier.padding(8.dp)
|
||||
)
|
||||
}
|
||||
} else if (projectPath.isBlank()) {
|
||||
Box(modifier = Modifier.weight(1f).fillMaxWidth()) {
|
||||
Text(
|
||||
"Bitte ein Projektverzeichnis auswaehlen.",
|
||||
color = Color.Gray,
|
||||
modifier = Modifier.padding(8.dp)
|
||||
)
|
||||
}
|
||||
} else {
|
||||
ReorderableSongList(
|
||||
songs = songs,
|
||||
reorderEnabled = reorderEnabled,
|
||||
onReorder = { newList ->
|
||||
songs = newList
|
||||
isCustomOrder = true
|
||||
},
|
||||
modifier = Modifier.weight(1f)
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
Spacer(modifier = Modifier.height(16.dp))
|
||||
|
||||
// Action buttons
|
||||
Row(horizontalArrangement = Arrangement.spacedBy(8.dp)) {
|
||||
Button(
|
||||
onClick = {
|
||||
if (projectPath.isBlank()) return@Button
|
||||
isRunning = true
|
||||
lastBuildResult = null
|
||||
statusMessages = listOf(StatusMessage("Buch wird erstellt...", MessageType.INFO))
|
||||
scope.launch {
|
||||
// Build custom song order from the current GUI list
|
||||
val customOrder = if (isCustomOrder) {
|
||||
songs.map { it.fileName }
|
||||
} else {
|
||||
null
|
||||
}
|
||||
val result = withContext(Dispatchers.IO) {
|
||||
try {
|
||||
SongbookPipeline(File(projectPath)).build(customOrder) { msg ->
|
||||
statusMessages = listOf(StatusMessage(msg, MessageType.INFO))
|
||||
}
|
||||
} catch (e: Exception) {
|
||||
BuildResult(
|
||||
success = false,
|
||||
errors = listOf(
|
||||
ValidationError(null, null, "Unerwarteter Fehler: ${e.message}")
|
||||
)
|
||||
)
|
||||
}
|
||||
}
|
||||
lastBuildResult = result
|
||||
statusMessages = if (result.success) {
|
||||
listOf(
|
||||
StatusMessage(
|
||||
"Buch erfolgreich erstellt! ${result.songCount} Lieder, ${result.pageCount} Seiten.",
|
||||
MessageType.SUCCESS
|
||||
),
|
||||
StatusMessage(
|
||||
"Ausgabedatei: ${result.outputFile?.absolutePath ?: "unbekannt"}",
|
||||
MessageType.INFO
|
||||
)
|
||||
)
|
||||
} else {
|
||||
result.errors.map { error ->
|
||||
val location = buildString {
|
||||
if (error.file != null) append(error.file)
|
||||
if (error.line != null) append(":${error.line}")
|
||||
}
|
||||
val prefix = if (location.isNotEmpty()) "[$location] " else ""
|
||||
StatusMessage("$prefix${error.message}", MessageType.ERROR)
|
||||
}
|
||||
}
|
||||
isRunning = false
|
||||
|
||||
// Automatically load preview after successful build
|
||||
if (result.success && result.outputFile != null) {
|
||||
previewState.loadPdf(result.outputFile!!)
|
||||
}
|
||||
}
|
||||
},
|
||||
enabled = !isRunning && projectPath.isNotBlank()
|
||||
) {
|
||||
Text("Buch erstellen")
|
||||
}
|
||||
|
||||
Button(
|
||||
onClick = {
|
||||
if (projectPath.isBlank()) return@Button
|
||||
isRunning = true
|
||||
lastBuildResult = null
|
||||
statusMessages = listOf(StatusMessage("Validierung laeuft...", MessageType.INFO))
|
||||
scope.launch {
|
||||
val errors = withContext(Dispatchers.IO) {
|
||||
try {
|
||||
SongbookPipeline(File(projectPath)).validate()
|
||||
} catch (e: Exception) {
|
||||
listOf(
|
||||
ValidationError(null, null, "Unerwarteter Fehler: ${e.message}")
|
||||
)
|
||||
}
|
||||
}
|
||||
statusMessages = if (errors.isEmpty()) {
|
||||
listOf(StatusMessage("Validierung erfolgreich! Keine Fehler gefunden.", MessageType.SUCCESS))
|
||||
} else {
|
||||
errors.map { error ->
|
||||
val location = buildString {
|
||||
if (error.file != null) append(error.file)
|
||||
if (error.line != null) append(":${error.line}")
|
||||
}
|
||||
val prefix = if (location.isNotEmpty()) "[$location] " else ""
|
||||
StatusMessage("$prefix${error.message}", MessageType.ERROR)
|
||||
}
|
||||
}
|
||||
isRunning = false
|
||||
}
|
||||
},
|
||||
enabled = !isRunning && projectPath.isNotBlank()
|
||||
) {
|
||||
Text("Validieren")
|
||||
}
|
||||
|
||||
if (lastBuildResult?.success == true && lastBuildResult?.outputFile != null) {
|
||||
Button(
|
||||
onClick = {
|
||||
lastBuildResult?.outputFile?.let { file ->
|
||||
try {
|
||||
Desktop.getDesktop().open(file)
|
||||
} catch (e: Exception) {
|
||||
statusMessages = statusMessages + StatusMessage(
|
||||
"PDF konnte nicht geoeffnet werden: ${e.message}",
|
||||
MessageType.ERROR
|
||||
)
|
||||
}
|
||||
}
|
||||
},
|
||||
enabled = !isRunning
|
||||
) {
|
||||
Text("PDF oeffnen")
|
||||
}
|
||||
|
||||
// Show/hide preview button
|
||||
Button(
|
||||
onClick = {
|
||||
if (previewState.isVisible) {
|
||||
previewState.isVisible = false
|
||||
} else {
|
||||
scope.launch {
|
||||
if (previewState.totalPages == 0) {
|
||||
lastBuildResult?.outputFile?.let { previewState.loadPdf(it) }
|
||||
} else {
|
||||
previewState.isVisible = true
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
enabled = !isRunning
|
||||
) {
|
||||
Text(if (previewState.isVisible) "Vorschau ausblenden" else "Vorschau")
|
||||
}
|
||||
}
|
||||
|
||||
if (isRunning) {
|
||||
Spacer(modifier = Modifier.width(8.dp))
|
||||
CircularProgressIndicator(
|
||||
modifier = Modifier.size(24.dp).align(Alignment.CenterVertically),
|
||||
strokeWidth = 2.dp
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
Spacer(modifier = Modifier.height(16.dp))
|
||||
|
||||
// Status/log area
|
||||
Text("Status:", fontWeight = FontWeight.Medium)
|
||||
Spacer(modifier = Modifier.height(4.dp))
|
||||
|
||||
Box(
|
||||
modifier = Modifier
|
||||
.fillMaxWidth()
|
||||
.height(150.dp)
|
||||
) {
|
||||
val logListState = rememberLazyListState()
|
||||
LazyColumn(
|
||||
state = logListState,
|
||||
modifier = Modifier.fillMaxSize().padding(end = 12.dp)
|
||||
) {
|
||||
if (statusMessages.isEmpty()) {
|
||||
item {
|
||||
Text(
|
||||
"Bereit.",
|
||||
color = Color.Gray,
|
||||
modifier = Modifier.padding(4.dp)
|
||||
)
|
||||
}
|
||||
}
|
||||
items(statusMessages) { msg ->
|
||||
Text(
|
||||
text = msg.text,
|
||||
color = when (msg.type) {
|
||||
MessageType.ERROR -> MaterialTheme.colors.error
|
||||
MessageType.SUCCESS -> Color(0xFF2E7D32)
|
||||
MessageType.INFO -> Color.Unspecified
|
||||
},
|
||||
fontSize = 13.sp,
|
||||
modifier = Modifier.padding(vertical = 2.dp, horizontal = 4.dp)
|
||||
)
|
||||
}
|
||||
}
|
||||
VerticalScrollbar(
|
||||
modifier = Modifier.align(Alignment.CenterEnd).fillMaxHeight(),
|
||||
adapter = rememberScrollbarAdapter(logListState)
|
||||
)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
enum class MessageType {
|
||||
INFO, SUCCESS, ERROR
|
||||
}
|
||||
|
||||
data class StatusMessage(val text: String, val type: MessageType)
|
||||
@@ -0,0 +1,221 @@
|
||||
package de.pfadfinder.songbook.gui
|
||||
|
||||
import androidx.compose.foundation.Image
|
||||
import androidx.compose.foundation.background
|
||||
import androidx.compose.foundation.layout.*
|
||||
import androidx.compose.material.*
|
||||
import androidx.compose.runtime.*
|
||||
import androidx.compose.ui.Alignment
|
||||
import androidx.compose.ui.Modifier
|
||||
import androidx.compose.ui.graphics.Color
|
||||
import androidx.compose.ui.graphics.ImageBitmap
|
||||
import androidx.compose.ui.graphics.toComposeImageBitmap
|
||||
import androidx.compose.ui.layout.ContentScale
|
||||
import androidx.compose.ui.text.font.FontWeight
|
||||
import androidx.compose.ui.text.style.TextAlign
|
||||
import androidx.compose.ui.unit.dp
|
||||
import androidx.compose.ui.unit.sp
|
||||
import kotlinx.coroutines.Dispatchers
|
||||
import kotlinx.coroutines.launch
|
||||
import kotlinx.coroutines.withContext
|
||||
import org.apache.pdfbox.Loader
|
||||
import org.apache.pdfbox.pdmodel.PDDocument
|
||||
import org.apache.pdfbox.rendering.PDFRenderer
|
||||
import java.awt.image.BufferedImage
|
||||
import java.io.File
|
||||
|
||||
/**
|
||||
* State holder for the PDF preview. Manages the current page, total page count,
|
||||
* and a cache of rendered page images.
|
||||
*/
|
||||
class PdfPreviewState {
|
||||
var pdfFile: File? by mutableStateOf(null)
|
||||
private set
|
||||
var totalPages: Int by mutableStateOf(0)
|
||||
private set
|
||||
var currentPage: Int by mutableStateOf(0)
|
||||
private set
|
||||
var isLoading: Boolean by mutableStateOf(false)
|
||||
private set
|
||||
var currentImage: ImageBitmap? by mutableStateOf(null)
|
||||
private set
|
||||
var isVisible: Boolean by mutableStateOf(false)
|
||||
|
||||
private var document: PDDocument? = null
|
||||
private var renderer: PDFRenderer? = null
|
||||
private val pageCache = mutableMapOf<Int, ImageBitmap>()
|
||||
|
||||
/**
|
||||
* Load a new PDF file for preview. Resets state and renders the first page.
|
||||
*/
|
||||
suspend fun loadPdf(file: File) {
|
||||
close()
|
||||
pdfFile = file
|
||||
currentPage = 0
|
||||
pageCache.clear()
|
||||
currentImage = null
|
||||
|
||||
withContext(Dispatchers.IO) {
|
||||
try {
|
||||
val doc = Loader.loadPDF(file)
|
||||
document = doc
|
||||
renderer = PDFRenderer(doc)
|
||||
totalPages = doc.numberOfPages
|
||||
} catch (_: Exception) {
|
||||
totalPages = 0
|
||||
}
|
||||
}
|
||||
|
||||
if (totalPages > 0) {
|
||||
isVisible = true
|
||||
renderCurrentPage()
|
||||
}
|
||||
}
|
||||
|
||||
suspend fun goToPage(page: Int) {
|
||||
if (page < 0 || page >= totalPages) return
|
||||
currentPage = page
|
||||
renderCurrentPage()
|
||||
}
|
||||
|
||||
suspend fun nextPage() {
|
||||
goToPage(currentPage + 1)
|
||||
}
|
||||
|
||||
suspend fun previousPage() {
|
||||
goToPage(currentPage - 1)
|
||||
}
|
||||
|
||||
private suspend fun renderCurrentPage() {
|
||||
val cached = pageCache[currentPage]
|
||||
if (cached != null) {
|
||||
currentImage = cached
|
||||
return
|
||||
}
|
||||
|
||||
isLoading = true
|
||||
try {
|
||||
val image = withContext(Dispatchers.IO) {
|
||||
try {
|
||||
val pdfRenderer = renderer ?: return@withContext null
|
||||
// Render at 150 DPI for a good balance of quality and speed
|
||||
val bufferedImage: BufferedImage = pdfRenderer.renderImageWithDPI(currentPage, 150f)
|
||||
bufferedImage.toComposeImageBitmap()
|
||||
} catch (_: Exception) {
|
||||
null
|
||||
}
|
||||
}
|
||||
if (image != null) {
|
||||
pageCache[currentPage] = image
|
||||
currentImage = image
|
||||
}
|
||||
} finally {
|
||||
isLoading = false
|
||||
}
|
||||
}
|
||||
|
||||
fun close() {
|
||||
try {
|
||||
document?.close()
|
||||
} catch (_: Exception) {
|
||||
// ignore
|
||||
}
|
||||
document = null
|
||||
renderer = null
|
||||
pageCache.clear()
|
||||
currentImage = null
|
||||
totalPages = 0
|
||||
currentPage = 0
|
||||
isVisible = false
|
||||
}
|
||||
}
|
||||
|
||||
@Composable
|
||||
fun PdfPreviewPanel(
|
||||
state: PdfPreviewState,
|
||||
modifier: Modifier = Modifier
|
||||
) {
|
||||
val scope = rememberCoroutineScope()
|
||||
|
||||
Column(modifier = modifier.fillMaxWidth()) {
|
||||
// Header with title and close button
|
||||
Row(
|
||||
modifier = Modifier.fillMaxWidth().padding(bottom = 8.dp),
|
||||
horizontalArrangement = Arrangement.SpaceBetween,
|
||||
verticalAlignment = Alignment.CenterVertically
|
||||
) {
|
||||
Text(
|
||||
text = "Vorschau",
|
||||
fontSize = 16.sp,
|
||||
fontWeight = FontWeight.Bold
|
||||
)
|
||||
Button(
|
||||
onClick = { state.isVisible = false },
|
||||
colors = ButtonDefaults.buttonColors(backgroundColor = Color.LightGray)
|
||||
) {
|
||||
Text("Schliessen")
|
||||
}
|
||||
}
|
||||
|
||||
// Page image area
|
||||
Box(
|
||||
modifier = Modifier
|
||||
.fillMaxWidth()
|
||||
.weight(1f)
|
||||
.background(Color(0xFFE0E0E0)),
|
||||
contentAlignment = Alignment.Center
|
||||
) {
|
||||
if (state.isLoading) {
|
||||
CircularProgressIndicator()
|
||||
} else if (state.currentImage != null) {
|
||||
Image(
|
||||
bitmap = state.currentImage!!,
|
||||
contentDescription = "Seite ${state.currentPage + 1}",
|
||||
modifier = Modifier.fillMaxSize().padding(4.dp),
|
||||
contentScale = ContentScale.Fit
|
||||
)
|
||||
} else {
|
||||
Text(
|
||||
"Keine Vorschau verfuegbar",
|
||||
color = Color.Gray
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
// Navigation row
|
||||
Row(
|
||||
modifier = Modifier.fillMaxWidth().padding(top = 8.dp),
|
||||
horizontalArrangement = Arrangement.Center,
|
||||
verticalAlignment = Alignment.CenterVertically
|
||||
) {
|
||||
Button(
|
||||
onClick = {
|
||||
scope.launch { state.previousPage() }
|
||||
},
|
||||
enabled = state.currentPage > 0 && !state.isLoading
|
||||
) {
|
||||
Text("<")
|
||||
}
|
||||
|
||||
Spacer(modifier = Modifier.width(16.dp))
|
||||
|
||||
Text(
|
||||
text = "Seite ${state.currentPage + 1} / ${state.totalPages}",
|
||||
fontWeight = FontWeight.Medium,
|
||||
textAlign = TextAlign.Center,
|
||||
modifier = Modifier.widthIn(min = 120.dp)
|
||||
)
|
||||
|
||||
Spacer(modifier = Modifier.width(16.dp))
|
||||
|
||||
Button(
|
||||
onClick = {
|
||||
scope.launch { state.nextPage() }
|
||||
},
|
||||
enabled = state.currentPage < state.totalPages - 1 && !state.isLoading
|
||||
) {
|
||||
Text(">")
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,142 @@
|
||||
package de.pfadfinder.songbook.gui
|
||||
|
||||
import androidx.compose.foundation.VerticalScrollbar
|
||||
import androidx.compose.foundation.background
|
||||
import androidx.compose.foundation.gestures.detectDragGesturesAfterLongPress
|
||||
import androidx.compose.foundation.layout.*
|
||||
import androidx.compose.foundation.lazy.LazyColumn
|
||||
import androidx.compose.foundation.lazy.itemsIndexed
|
||||
import androidx.compose.foundation.lazy.rememberLazyListState
|
||||
import androidx.compose.foundation.rememberScrollbarAdapter
|
||||
import androidx.compose.material.Divider
|
||||
import androidx.compose.material.Icon
|
||||
import androidx.compose.material.Text
|
||||
import androidx.compose.material.icons.Icons
|
||||
import androidx.compose.material.icons.filled.Menu
|
||||
import androidx.compose.runtime.*
|
||||
import androidx.compose.ui.Alignment
|
||||
import androidx.compose.ui.Modifier
|
||||
import androidx.compose.ui.graphics.Color
|
||||
import androidx.compose.ui.input.pointer.pointerInput
|
||||
import androidx.compose.ui.text.font.FontStyle
|
||||
import androidx.compose.ui.unit.dp
|
||||
import androidx.compose.ui.unit.sp
|
||||
|
||||
/**
|
||||
* A song list that supports drag-and-drop reordering when enabled.
|
||||
*
|
||||
* @param songs The current song list
|
||||
* @param reorderEnabled Whether drag-and-drop is enabled
|
||||
* @param onReorder Callback when songs are reordered, provides the new list
|
||||
*/
|
||||
@Composable
|
||||
fun ReorderableSongList(
|
||||
songs: List<SongEntry>,
|
||||
reorderEnabled: Boolean,
|
||||
onReorder: (List<SongEntry>) -> Unit,
|
||||
modifier: Modifier = Modifier
|
||||
) {
|
||||
// Track drag state
|
||||
var draggedIndex by remember { mutableStateOf(-1) }
|
||||
var hoverIndex by remember { mutableStateOf(-1) }
|
||||
var dragOffset by remember { mutableStateOf(0f) }
|
||||
|
||||
// Approximate item height for calculating target index from drag offset
|
||||
val itemHeightPx = 36f // approximate height of each row in pixels
|
||||
|
||||
Box(modifier = modifier.fillMaxWidth()) {
|
||||
val listState = rememberLazyListState()
|
||||
LazyColumn(
|
||||
state = listState,
|
||||
modifier = Modifier.fillMaxSize().padding(end = 12.dp)
|
||||
) {
|
||||
itemsIndexed(songs, key = { _, song -> song.fileName }) { index, song ->
|
||||
val isDragTarget = hoverIndex == index && draggedIndex != -1 && draggedIndex != index
|
||||
val isBeingDragged = draggedIndex == index
|
||||
|
||||
Row(
|
||||
modifier = Modifier
|
||||
.fillMaxWidth()
|
||||
.then(
|
||||
if (isDragTarget) {
|
||||
Modifier.background(Color(0xFFBBDEFB)) // light blue drop indicator
|
||||
} else if (isBeingDragged) {
|
||||
Modifier.background(Color(0xFFE0E0E0)) // grey for dragged item
|
||||
} else {
|
||||
Modifier
|
||||
}
|
||||
)
|
||||
.padding(vertical = 2.dp, horizontal = 8.dp)
|
||||
.then(
|
||||
if (reorderEnabled) {
|
||||
Modifier.pointerInput(songs) {
|
||||
detectDragGesturesAfterLongPress(
|
||||
onDragStart = {
|
||||
draggedIndex = index
|
||||
hoverIndex = index
|
||||
dragOffset = 0f
|
||||
},
|
||||
onDrag = { change, dragAmount ->
|
||||
change.consume()
|
||||
dragOffset += dragAmount.y
|
||||
// Calculate target index based on cumulative drag offset
|
||||
val indexDelta = (dragOffset / itemHeightPx).toInt()
|
||||
val newHover = (draggedIndex + indexDelta).coerceIn(0, songs.size - 1)
|
||||
hoverIndex = newHover
|
||||
},
|
||||
onDragEnd = {
|
||||
if (draggedIndex != -1 && hoverIndex != -1 && draggedIndex != hoverIndex) {
|
||||
val mutable = songs.toMutableList()
|
||||
val item = mutable.removeAt(draggedIndex)
|
||||
mutable.add(hoverIndex, item)
|
||||
onReorder(mutable)
|
||||
}
|
||||
draggedIndex = -1
|
||||
hoverIndex = -1
|
||||
dragOffset = 0f
|
||||
},
|
||||
onDragCancel = {
|
||||
draggedIndex = -1
|
||||
hoverIndex = -1
|
||||
dragOffset = 0f
|
||||
}
|
||||
)
|
||||
}
|
||||
} else {
|
||||
Modifier
|
||||
}
|
||||
),
|
||||
verticalAlignment = Alignment.CenterVertically
|
||||
) {
|
||||
if (reorderEnabled) {
|
||||
Icon(
|
||||
imageVector = Icons.Default.Menu,
|
||||
contentDescription = "Ziehen zum Verschieben",
|
||||
modifier = Modifier.size(16.dp).padding(end = 4.dp),
|
||||
tint = Color.Gray
|
||||
)
|
||||
}
|
||||
Text(song.title, modifier = Modifier.weight(1f))
|
||||
Text(song.fileName, color = Color.Gray, fontSize = 12.sp)
|
||||
}
|
||||
Divider()
|
||||
}
|
||||
|
||||
if (!reorderEnabled && songs.isNotEmpty()) {
|
||||
item {
|
||||
Text(
|
||||
"Reihenfolge ist alphabetisch. Wechsle in songbook.yaml zu songs.order: \"manual\" um die Reihenfolge zu aendern.",
|
||||
color = Color.Gray,
|
||||
fontStyle = FontStyle.Italic,
|
||||
fontSize = 11.sp,
|
||||
modifier = Modifier.padding(8.dp)
|
||||
)
|
||||
}
|
||||
}
|
||||
}
|
||||
VerticalScrollbar(
|
||||
modifier = Modifier.align(Alignment.CenterEnd).fillMaxHeight(),
|
||||
adapter = rememberScrollbarAdapter(listState)
|
||||
)
|
||||
}
|
||||
}
|
||||
10
layout/build.gradle.kts
Normal file
10
layout/build.gradle.kts
Normal file
@@ -0,0 +1,10 @@
|
||||
plugins {
|
||||
id("songbook-conventions")
|
||||
}
|
||||
|
||||
dependencies {
|
||||
implementation(project(":model"))
|
||||
|
||||
testImplementation(kotlin("test"))
|
||||
testImplementation("io.kotest:kotest-assertions-core:5.9.1")
|
||||
}
|
||||
@@ -0,0 +1,13 @@
|
||||
package de.pfadfinder.songbook.layout
|
||||
|
||||
import java.io.File
|
||||
|
||||
object GapFiller {
|
||||
fun findImages(directory: String): List<String> {
|
||||
val dir = File(directory)
|
||||
if (!dir.exists() || !dir.isDirectory) return emptyList()
|
||||
return dir.listFiles { f ->
|
||||
f.extension.lowercase() in listOf("png", "jpg", "jpeg")
|
||||
}?.map { it.absolutePath }?.sorted() ?: emptyList()
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,104 @@
|
||||
package de.pfadfinder.songbook.layout
|
||||
|
||||
import de.pfadfinder.songbook.model.*
|
||||
|
||||
class MeasurementEngine(
|
||||
private val fontMetrics: FontMetrics,
|
||||
private val config: BookConfig
|
||||
) {
|
||||
// A5 content height = 210mm - top margin - bottom margin
|
||||
private val contentHeightMm: Float = 210f - config.layout.margins.top - config.layout.margins.bottom
|
||||
|
||||
fun measure(song: Song): MeasuredSong {
|
||||
var heightMm = 0f
|
||||
|
||||
// Title height
|
||||
heightMm += fontMetrics.measureLineHeight(config.fonts.title, config.fonts.title.size) * 1.5f
|
||||
|
||||
// Metadata lines (composer/lyricist) - may be 1 or 2 lines depending on label style
|
||||
if (song.composer != null || song.lyricist != null) {
|
||||
val metaLineHeight = fontMetrics.measureLineHeight(config.fonts.metadata, config.fonts.metadata.size) * 1.8f
|
||||
val useGerman = config.layout.metadataLabels == "german"
|
||||
if (useGerman && song.lyricist != null && song.composer != null && song.lyricist != song.composer) {
|
||||
// Two separate lines: "Worte: ..." and "Weise: ..."
|
||||
heightMm += metaLineHeight * 2
|
||||
} else {
|
||||
heightMm += metaLineHeight
|
||||
}
|
||||
}
|
||||
|
||||
// Key/capo line
|
||||
if (song.key != null || song.capo != null) {
|
||||
heightMm += fontMetrics.measureLineHeight(config.fonts.metadata, config.fonts.metadata.size) * 1.8f
|
||||
}
|
||||
|
||||
// Gap before sections
|
||||
heightMm += 1.5f // ~4pt in mm
|
||||
|
||||
// Sections
|
||||
for (section in song.sections) {
|
||||
// Section label
|
||||
if (section.label != null || section.type == SectionType.CHORUS) {
|
||||
heightMm += fontMetrics.measureLineHeight(config.fonts.metadata, config.fonts.metadata.size) * 1.5f
|
||||
}
|
||||
|
||||
// Chorus repeat reference (no lines)
|
||||
if (section.type == SectionType.CHORUS && section.lines.isEmpty()) {
|
||||
heightMm += fontMetrics.measureLineHeight(config.fonts.metadata, config.fonts.metadata.size) * 1.8f
|
||||
continue
|
||||
}
|
||||
|
||||
// Lines in section
|
||||
for (line in section.lines) {
|
||||
if (line.imagePath != null) {
|
||||
// Inline image: estimate height as 40mm (default image block height)
|
||||
heightMm += 40f
|
||||
heightMm += 2f // gap around image
|
||||
} else {
|
||||
val hasChords = line.segments.any { it.chord != null }
|
||||
val lyricHeight = fontMetrics.measureLineHeight(config.fonts.lyrics, config.fonts.lyrics.size)
|
||||
if (hasChords) {
|
||||
val chordHeight = fontMetrics.measureLineHeight(config.fonts.chords, config.fonts.chords.size)
|
||||
heightMm += chordHeight + config.layout.chordLineSpacing + lyricHeight
|
||||
} else {
|
||||
heightMm += lyricHeight
|
||||
}
|
||||
heightMm += 0.35f // ~1pt gap between lines
|
||||
}
|
||||
}
|
||||
|
||||
// Verse spacing
|
||||
heightMm += config.layout.verseSpacing
|
||||
}
|
||||
|
||||
// Notes at bottom (with word-wrap estimation for multi-paragraph notes)
|
||||
if (song.notes.isNotEmpty()) {
|
||||
heightMm += 1.5f // gap before notes
|
||||
val metaLineHeight = fontMetrics.measureLineHeight(config.fonts.metadata, config.fonts.metadata.size) * 1.5f
|
||||
// A5 content width in mm = 148 - inner margin - outer margin
|
||||
val contentWidthMm = 148f - config.layout.margins.inner - config.layout.margins.outer
|
||||
|
||||
for ((idx, note) in song.notes.withIndex()) {
|
||||
// Estimate how many wrapped lines this note paragraph needs
|
||||
val noteWidthMm = fontMetrics.measureTextWidth(note, config.fonts.metadata, config.fonts.metadata.size)
|
||||
val estimatedLines = maxOf(1, kotlin.math.ceil((noteWidthMm / contentWidthMm).toDouble()).toInt())
|
||||
heightMm += metaLineHeight * estimatedLines
|
||||
|
||||
// Paragraph spacing between note paragraphs
|
||||
if (idx < song.notes.size - 1) {
|
||||
heightMm += metaLineHeight * 0.3f
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Reference book footer: gap + separator line + abbreviation row + page number row
|
||||
if (config.referenceBooks.isNotEmpty() && song.references.isNotEmpty()) {
|
||||
val metaLineHeight = fontMetrics.measureLineHeight(config.fonts.metadata, config.fonts.metadata.size)
|
||||
heightMm += 4f * 0.3528f // gap before footer (4pt converted to mm)
|
||||
heightMm += metaLineHeight * 1.4f * 2 // two rows (headers + numbers)
|
||||
}
|
||||
|
||||
val pageCount = if (heightMm <= contentHeightMm) 1 else 2
|
||||
return MeasuredSong(song, heightMm, pageCount)
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,53 @@
|
||||
package de.pfadfinder.songbook.layout
|
||||
|
||||
import de.pfadfinder.songbook.model.*
|
||||
import java.io.File
|
||||
|
||||
class PaginationEngine(private val config: BookConfig) {
|
||||
|
||||
fun paginate(measuredSongs: List<MeasuredSong>, tocPages: Int): List<PageContent> {
|
||||
val pages = mutableListOf<PageContent>()
|
||||
// Current page number (1-based, after TOC)
|
||||
// TOC occupies pages 1..tocPages
|
||||
// Content starts at page tocPages + 1
|
||||
var currentPage = tocPages + 1
|
||||
|
||||
// Collect available filler images
|
||||
val imageDir = File(config.images.directory)
|
||||
val images = if (imageDir.exists() && imageDir.isDirectory) {
|
||||
imageDir.listFiles { f -> f.extension.lowercase() in listOf("png", "jpg", "jpeg", "svg") }
|
||||
?.map { it.absolutePath }
|
||||
?.shuffled()
|
||||
?.toMutableList()
|
||||
?: mutableListOf()
|
||||
} else {
|
||||
mutableListOf()
|
||||
}
|
||||
var imageIndex = 0
|
||||
|
||||
for (ms in measuredSongs) {
|
||||
if (ms.pageCount == 1) {
|
||||
pages.add(PageContent.SongPage(ms.song, 0))
|
||||
currentPage++
|
||||
} else {
|
||||
// 2-page song: must start on left page (even page number)
|
||||
val isLeftPage = currentPage % 2 == 0
|
||||
if (!isLeftPage) {
|
||||
// Insert filler on the right page
|
||||
if (images.isNotEmpty()) {
|
||||
pages.add(PageContent.FillerImage(images[imageIndex % images.size]))
|
||||
imageIndex++
|
||||
} else {
|
||||
pages.add(PageContent.BlankPage)
|
||||
}
|
||||
currentPage++
|
||||
}
|
||||
pages.add(PageContent.SongPage(ms.song, 0))
|
||||
pages.add(PageContent.SongPage(ms.song, 1))
|
||||
currentPage += 2
|
||||
}
|
||||
}
|
||||
|
||||
return pages
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,52 @@
|
||||
package de.pfadfinder.songbook.layout
|
||||
|
||||
import de.pfadfinder.songbook.model.*
|
||||
|
||||
class TocGenerator(private val config: BookConfig) {
|
||||
|
||||
fun generate(pages: List<PageContent>, tocStartPage: Int): List<TocEntry> {
|
||||
val entries = mutableListOf<TocEntry>()
|
||||
val refAbbreviations = config.referenceBooks.associate { it.id to it.abbreviation }
|
||||
|
||||
// Map songs to their page numbers
|
||||
val songPages = mutableMapOf<String, Int>() // song title -> first page number
|
||||
var currentPageNum = tocStartPage
|
||||
for (page in pages) {
|
||||
currentPageNum++
|
||||
if (page is PageContent.SongPage && page.pageIndex == 0) {
|
||||
songPages[page.song.title] = currentPageNum
|
||||
}
|
||||
}
|
||||
|
||||
// Create entries for each song
|
||||
for ((title, pageNumber) in songPages) {
|
||||
// Find the song to get aliases and references
|
||||
val song = pages.filterIsInstance<PageContent.SongPage>()
|
||||
.find { it.song.title == title && it.pageIndex == 0 }?.song
|
||||
?: continue
|
||||
|
||||
// Map references from book IDs to abbreviations
|
||||
val refs = song.references.mapKeys { (bookId, _) ->
|
||||
refAbbreviations[bookId] ?: bookId
|
||||
}
|
||||
|
||||
entries.add(TocEntry(title = title, pageNumber = pageNumber, references = refs))
|
||||
|
||||
// Add alias entries
|
||||
for (alias in song.aliases) {
|
||||
entries.add(TocEntry(title = alias, pageNumber = pageNumber, isAlias = true, references = refs))
|
||||
}
|
||||
}
|
||||
|
||||
return entries.sortedBy { it.title.lowercase() }
|
||||
}
|
||||
|
||||
fun estimateTocPages(songs: List<Song>): Int {
|
||||
// Rough estimate: count total titles + aliases
|
||||
val totalEntries = songs.sumOf { 1 + it.aliases.size }
|
||||
// Assume ~40 entries per A5 page
|
||||
val pages = (totalEntries / 40) + 1
|
||||
// TOC should be even number of pages (for double-sided printing)
|
||||
return if (pages % 2 == 0) pages else pages + 1
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,74 @@
|
||||
package de.pfadfinder.songbook.layout
|
||||
|
||||
import io.kotest.matchers.collections.shouldBeEmpty
|
||||
import io.kotest.matchers.collections.shouldHaveSize
|
||||
import io.kotest.matchers.shouldBe
|
||||
import kotlin.test.Test
|
||||
|
||||
class GapFillerTest {
|
||||
|
||||
@Test
|
||||
fun `findImages returns empty for nonexistent directory`() {
|
||||
val images = GapFiller.findImages("/nonexistent/path/to/images")
|
||||
images.shouldBeEmpty()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `findImages returns empty for empty directory`() {
|
||||
val tempDir = kotlin.io.path.createTempDirectory("songbook-test-empty").toFile()
|
||||
try {
|
||||
val images = GapFiller.findImages(tempDir.absolutePath)
|
||||
images.shouldBeEmpty()
|
||||
} finally {
|
||||
tempDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `findImages returns image files sorted`() {
|
||||
val tempDir = kotlin.io.path.createTempDirectory("songbook-test-images").toFile()
|
||||
try {
|
||||
java.io.File(tempDir, "c_image.png").writeText("fake")
|
||||
java.io.File(tempDir, "a_image.jpg").writeText("fake")
|
||||
java.io.File(tempDir, "b_image.jpeg").writeText("fake")
|
||||
|
||||
val images = GapFiller.findImages(tempDir.absolutePath)
|
||||
|
||||
images shouldHaveSize 3
|
||||
// Should be sorted by absolute path (which means sorted by filename here)
|
||||
images[0] shouldBe java.io.File(tempDir, "a_image.jpg").absolutePath
|
||||
images[1] shouldBe java.io.File(tempDir, "b_image.jpeg").absolutePath
|
||||
images[2] shouldBe java.io.File(tempDir, "c_image.png").absolutePath
|
||||
} finally {
|
||||
tempDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `findImages ignores non-image files`() {
|
||||
val tempDir = kotlin.io.path.createTempDirectory("songbook-test-nonimage").toFile()
|
||||
try {
|
||||
java.io.File(tempDir, "image.png").writeText("fake")
|
||||
java.io.File(tempDir, "document.txt").writeText("fake")
|
||||
java.io.File(tempDir, "data.json").writeText("fake")
|
||||
java.io.File(tempDir, "photo.jpg").writeText("fake")
|
||||
|
||||
val images = GapFiller.findImages(tempDir.absolutePath)
|
||||
|
||||
images shouldHaveSize 2
|
||||
} finally {
|
||||
tempDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `findImages returns empty when directory is a file`() {
|
||||
val tempFile = kotlin.io.path.createTempFile("songbook-test-file").toFile()
|
||||
try {
|
||||
val images = GapFiller.findImages(tempFile.absolutePath)
|
||||
images.shouldBeEmpty()
|
||||
} finally {
|
||||
tempFile.delete()
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,363 @@
|
||||
package de.pfadfinder.songbook.layout
|
||||
|
||||
import de.pfadfinder.songbook.model.*
|
||||
import io.kotest.matchers.floats.shouldBeGreaterThan
|
||||
import io.kotest.matchers.floats.shouldBeLessThan
|
||||
import io.kotest.matchers.shouldBe
|
||||
import kotlin.test.Test
|
||||
|
||||
class MeasurementEngineTest {
|
||||
|
||||
private val fontMetrics = StubFontMetrics()
|
||||
private val config = BookConfig()
|
||||
private val engine = MeasurementEngine(fontMetrics, config)
|
||||
|
||||
// Content height = 210 - 15 (top) - 15 (bottom) = 180mm
|
||||
private val contentHeight = 210f - config.layout.margins.top - config.layout.margins.bottom
|
||||
|
||||
@Test
|
||||
fun `simple song with one verse and no chords fits on one page`() {
|
||||
val song = Song(
|
||||
title = "Simple Song",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
label = "Verse 1",
|
||||
lines = listOf(
|
||||
SongLine(listOf(LineSegment(text = "This is a simple line"))),
|
||||
SongLine(listOf(LineSegment(text = "Another simple line")))
|
||||
)
|
||||
)
|
||||
)
|
||||
)
|
||||
|
||||
val result = engine.measure(song)
|
||||
|
||||
result.pageCount shouldBe 1
|
||||
result.song shouldBe song
|
||||
result.totalHeightMm shouldBeGreaterThan 0f
|
||||
result.totalHeightMm shouldBeLessThan contentHeight
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `song with many sections exceeds one page`() {
|
||||
// Create a song with many sections to exceed content height
|
||||
val sections = (1..30).map { i ->
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
label = "Verse $i",
|
||||
lines = (1..5).map {
|
||||
SongLine(
|
||||
listOf(
|
||||
LineSegment(chord = "Am", text = "Some "),
|
||||
LineSegment(chord = "G", text = "text with chords")
|
||||
)
|
||||
)
|
||||
}
|
||||
)
|
||||
}
|
||||
val song = Song(title = "Long Song", sections = sections)
|
||||
|
||||
val result = engine.measure(song)
|
||||
|
||||
result.pageCount shouldBe 2
|
||||
result.totalHeightMm shouldBeGreaterThan contentHeight
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `font metrics is used for title measurement`() {
|
||||
val song = Song(title = "Title Only")
|
||||
val result = engine.measure(song)
|
||||
|
||||
// Title contributes: measureLineHeight(title font, 14f) * 1.5
|
||||
val expectedTitleHeight = fontMetrics.measureLineHeight(config.fonts.title, config.fonts.title.size) * 1.5f
|
||||
// Plus gap before sections
|
||||
val expectedMinHeight = expectedTitleHeight + 1.5f
|
||||
|
||||
result.totalHeightMm shouldBeGreaterThan (expectedMinHeight - 0.01f)
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `composer and lyricist add metadata height`() {
|
||||
val songWithoutMeta = Song(title = "No Meta")
|
||||
val songWithMeta = Song(title = "With Meta", composer = "Bach", lyricist = "Goethe")
|
||||
|
||||
val heightWithout = engine.measure(songWithoutMeta).totalHeightMm
|
||||
val heightWith = engine.measure(songWithMeta).totalHeightMm
|
||||
|
||||
val metadataLineHeight = fontMetrics.measureLineHeight(config.fonts.metadata, config.fonts.metadata.size) * 1.8f
|
||||
heightWith shouldBeGreaterThan heightWithout
|
||||
// The difference should be approximately the metadata line height
|
||||
val diff = heightWith - heightWithout
|
||||
diff shouldBeGreaterThan (metadataLineHeight - 0.01f)
|
||||
diff shouldBeLessThan (metadataLineHeight + 0.01f)
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `key and capo add metadata height`() {
|
||||
val songWithoutKeyCap = Song(title = "No Key")
|
||||
val songWithKey = Song(title = "With Key", key = "Am")
|
||||
|
||||
val heightWithout = engine.measure(songWithoutKeyCap).totalHeightMm
|
||||
val heightWith = engine.measure(songWithKey).totalHeightMm
|
||||
|
||||
heightWith shouldBeGreaterThan heightWithout
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `capo alone adds metadata height`() {
|
||||
val songWithout = Song(title = "No Capo")
|
||||
val songWith = Song(title = "With Capo", capo = 2)
|
||||
|
||||
val heightWithout = engine.measure(songWithout).totalHeightMm
|
||||
val heightWith = engine.measure(songWith).totalHeightMm
|
||||
|
||||
heightWith shouldBeGreaterThan heightWithout
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `chords add extra height compared to lyrics only`() {
|
||||
val songWithoutChords = Song(
|
||||
title = "No Chords",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
lines = listOf(SongLine(listOf(LineSegment(text = "Just lyrics"))))
|
||||
)
|
||||
)
|
||||
)
|
||||
val songWithChords = Song(
|
||||
title = "With Chords",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
lines = listOf(SongLine(listOf(LineSegment(chord = "Am", text = "With chords"))))
|
||||
)
|
||||
)
|
||||
)
|
||||
|
||||
val heightWithout = engine.measure(songWithoutChords).totalHeightMm
|
||||
val heightWith = engine.measure(songWithChords).totalHeightMm
|
||||
|
||||
heightWith shouldBeGreaterThan heightWithout
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `chorus section label adds height`() {
|
||||
val songWithChorus = Song(
|
||||
title = "Chorus Song",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.CHORUS,
|
||||
lines = listOf(SongLine(listOf(LineSegment(text = "Chorus line"))))
|
||||
)
|
||||
)
|
||||
)
|
||||
val songWithVerse = Song(
|
||||
title = "Verse Song",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
// No label, type is VERSE - no label height added
|
||||
lines = listOf(SongLine(listOf(LineSegment(text = "Verse line"))))
|
||||
)
|
||||
)
|
||||
)
|
||||
|
||||
val chorusHeight = engine.measure(songWithChorus).totalHeightMm
|
||||
val verseHeight = engine.measure(songWithVerse).totalHeightMm
|
||||
|
||||
// Chorus always gets a section label, verse without label does not
|
||||
chorusHeight shouldBeGreaterThan verseHeight
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `empty chorus repeat reference adds height without lines`() {
|
||||
val song = Song(
|
||||
title = "Repeat Song",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.CHORUS,
|
||||
lines = emptyList() // chorus repeat reference
|
||||
)
|
||||
)
|
||||
)
|
||||
|
||||
val result = engine.measure(song)
|
||||
// Should have title + gap + chorus label height + chorus repeat height + verse spacing
|
||||
result.totalHeightMm shouldBeGreaterThan 0f
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `notes add height at bottom`() {
|
||||
val songWithout = Song(title = "No Notes")
|
||||
val songWith = Song(title = "With Notes", notes = listOf("Note 1", "Note 2"))
|
||||
|
||||
val heightWithout = engine.measure(songWithout).totalHeightMm
|
||||
val heightWith = engine.measure(songWith).totalHeightMm
|
||||
|
||||
heightWith shouldBeGreaterThan heightWithout
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `verse spacing is added per section`() {
|
||||
val oneSectionSong = Song(
|
||||
title = "One Section",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
|
||||
)
|
||||
)
|
||||
)
|
||||
val twoSectionSong = Song(
|
||||
title = "Two Sections",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
|
||||
),
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
|
||||
)
|
||||
)
|
||||
)
|
||||
|
||||
val oneHeight = engine.measure(oneSectionSong).totalHeightMm
|
||||
val twoHeight = engine.measure(twoSectionSong).totalHeightMm
|
||||
|
||||
twoHeight shouldBeGreaterThan oneHeight
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `section with label adds label height`() {
|
||||
val songWithLabel = Song(
|
||||
title = "Labeled",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
label = "Verse 1",
|
||||
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
|
||||
)
|
||||
)
|
||||
)
|
||||
val songWithoutLabel = Song(
|
||||
title = "Unlabeled",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
label = null,
|
||||
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
|
||||
)
|
||||
)
|
||||
)
|
||||
|
||||
val labeledHeight = engine.measure(songWithLabel).totalHeightMm
|
||||
val unlabeledHeight = engine.measure(songWithoutLabel).totalHeightMm
|
||||
|
||||
labeledHeight shouldBeGreaterThan unlabeledHeight
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `references add footer height when reference books configured`() {
|
||||
val configWithRefs = BookConfig(
|
||||
referenceBooks = listOf(
|
||||
ReferenceBook(id = "mo", name = "Mundorgel", abbreviation = "MO"),
|
||||
ReferenceBook(id = "pl", name = "Pfadfinderlied", abbreviation = "PL")
|
||||
)
|
||||
)
|
||||
val engineWithRefs = MeasurementEngine(fontMetrics, configWithRefs)
|
||||
|
||||
val songWithRefs = Song(
|
||||
title = "With Refs",
|
||||
references = mapOf("mo" to 42, "pl" to 17),
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
|
||||
)
|
||||
)
|
||||
)
|
||||
val songWithoutRefs = Song(
|
||||
title = "No Refs",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
|
||||
)
|
||||
)
|
||||
)
|
||||
|
||||
val heightWith = engineWithRefs.measure(songWithRefs).totalHeightMm
|
||||
val heightWithout = engineWithRefs.measure(songWithoutRefs).totalHeightMm
|
||||
|
||||
heightWith shouldBeGreaterThan heightWithout
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `references do not add height when no reference books configured`() {
|
||||
val songWithRefs = Song(
|
||||
title = "With Refs",
|
||||
references = mapOf("mo" to 42),
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
|
||||
)
|
||||
)
|
||||
)
|
||||
val songWithoutRefs = Song(
|
||||
title = "No Refs",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
|
||||
)
|
||||
)
|
||||
)
|
||||
|
||||
// Default config has no reference books
|
||||
val heightWith = engine.measure(songWithRefs).totalHeightMm
|
||||
val heightWithout = engine.measure(songWithoutRefs).totalHeightMm
|
||||
|
||||
// Should be the same since no reference books are configured
|
||||
heightWith shouldBe heightWithout
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `inline image adds significant height`() {
|
||||
val songWithImage = Song(
|
||||
title = "With Image",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
lines = listOf(
|
||||
SongLine(listOf(LineSegment(text = "Line before"))),
|
||||
SongLine(imagePath = "images/test.png"),
|
||||
SongLine(listOf(LineSegment(text = "Line after")))
|
||||
)
|
||||
)
|
||||
)
|
||||
)
|
||||
val songWithoutImage = Song(
|
||||
title = "No Image",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
lines = listOf(
|
||||
SongLine(listOf(LineSegment(text = "Line before"))),
|
||||
SongLine(listOf(LineSegment(text = "Line after")))
|
||||
)
|
||||
)
|
||||
)
|
||||
)
|
||||
|
||||
val heightWith = engine.measure(songWithImage).totalHeightMm
|
||||
val heightWithout = engine.measure(songWithoutImage).totalHeightMm
|
||||
|
||||
// Inline image adds ~42mm (40mm image + 2mm gap)
|
||||
val diff = heightWith - heightWithout
|
||||
diff shouldBeGreaterThan 30f // should be substantial
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,205 @@
|
||||
package de.pfadfinder.songbook.layout
|
||||
|
||||
import de.pfadfinder.songbook.model.*
|
||||
import io.kotest.matchers.collections.shouldHaveSize
|
||||
import io.kotest.matchers.shouldBe
|
||||
import io.kotest.matchers.types.shouldBeInstanceOf
|
||||
import kotlin.test.Test
|
||||
|
||||
class PaginationEngineTest {
|
||||
|
||||
private val config = BookConfig(images = ImagesConfig(directory = "/nonexistent/images"))
|
||||
private val engine = PaginationEngine(config)
|
||||
|
||||
private fun song(title: String) = Song(title = title)
|
||||
|
||||
private fun onePage(song: Song) = MeasuredSong(song, 100f, 1)
|
||||
private fun twoPage(song: Song) = MeasuredSong(song, 200f, 2)
|
||||
|
||||
@Test
|
||||
fun `single page songs are placed sequentially`() {
|
||||
val songs = listOf(
|
||||
onePage(song("Song A")),
|
||||
onePage(song("Song B")),
|
||||
onePage(song("Song C"))
|
||||
)
|
||||
|
||||
val pages = engine.paginate(songs, tocPages = 2)
|
||||
|
||||
pages shouldHaveSize 3
|
||||
pages.forEach { it.shouldBeInstanceOf<PageContent.SongPage>() }
|
||||
(pages[0] as PageContent.SongPage).song.title shouldBe "Song A"
|
||||
(pages[1] as PageContent.SongPage).song.title shouldBe "Song B"
|
||||
(pages[2] as PageContent.SongPage).song.title shouldBe "Song C"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `single page songs all have pageIndex 0`() {
|
||||
val songs = listOf(
|
||||
onePage(song("Song A")),
|
||||
onePage(song("Song B"))
|
||||
)
|
||||
|
||||
val pages = engine.paginate(songs, tocPages = 2)
|
||||
|
||||
pages.forEach {
|
||||
(it as PageContent.SongPage).pageIndex shouldBe 0
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `two page song starting on left page has no filler`() {
|
||||
// tocPages = 2, so content starts at page 3 (odd/right page)
|
||||
// First one-page song occupies page 3, next page is 4 (even/left)
|
||||
val songs = listOf(
|
||||
onePage(song("Song A")),
|
||||
twoPage(song("Song B"))
|
||||
)
|
||||
|
||||
val pages = engine.paginate(songs, tocPages = 2)
|
||||
|
||||
// Song A at page 3, Song B starts at page 4 (even = left)
|
||||
pages shouldHaveSize 3
|
||||
(pages[0] as PageContent.SongPage).song.title shouldBe "Song A"
|
||||
(pages[1] as PageContent.SongPage).song.title shouldBe "Song B"
|
||||
(pages[1] as PageContent.SongPage).pageIndex shouldBe 0
|
||||
(pages[2] as PageContent.SongPage).song.title shouldBe "Song B"
|
||||
(pages[2] as PageContent.SongPage).pageIndex shouldBe 1
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `two page song on odd page gets blank filler before it`() {
|
||||
// tocPages = 2, content starts at page 3 (odd/right)
|
||||
// First 2-page song needs to start on even page, so filler at page 3
|
||||
val songs = listOf(
|
||||
twoPage(song("Song A"))
|
||||
)
|
||||
|
||||
val pages = engine.paginate(songs, tocPages = 2)
|
||||
|
||||
// Blank at page 3, Song A at pages 4-5
|
||||
pages shouldHaveSize 3
|
||||
pages[0].shouldBeInstanceOf<PageContent.BlankPage>()
|
||||
(pages[1] as PageContent.SongPage).song.title shouldBe "Song A"
|
||||
(pages[1] as PageContent.SongPage).pageIndex shouldBe 0
|
||||
(pages[2] as PageContent.SongPage).song.title shouldBe "Song A"
|
||||
(pages[2] as PageContent.SongPage).pageIndex shouldBe 1
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `two page song after two single page songs does not need filler`() {
|
||||
// tocPages = 2, content starts at page 3
|
||||
// Song A at page 3, Song B at page 4, Song C (2-page) should start at page 5 (odd)
|
||||
// Page 5 is odd, so it needs filler
|
||||
val songs = listOf(
|
||||
onePage(song("Song A")),
|
||||
onePage(song("Song B")),
|
||||
twoPage(song("Song C"))
|
||||
)
|
||||
|
||||
val pages = engine.paginate(songs, tocPages = 2)
|
||||
|
||||
// Song A at 3, Song B at 4, filler at 5, Song C at 6-7
|
||||
pages shouldHaveSize 5
|
||||
(pages[0] as PageContent.SongPage).song.title shouldBe "Song A"
|
||||
(pages[1] as PageContent.SongPage).song.title shouldBe "Song B"
|
||||
pages[2].shouldBeInstanceOf<PageContent.BlankPage>()
|
||||
(pages[3] as PageContent.SongPage).song.title shouldBe "Song C"
|
||||
(pages[4] as PageContent.SongPage).song.title shouldBe "Song C"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `two consecutive two-page songs are placed correctly`() {
|
||||
// tocPages = 2, content starts at page 3 (odd)
|
||||
// Song A (2-page): needs even start -> filler at 3, Song A at 4-5
|
||||
// Song B (2-page): next page is 6 (even/left) -> no filler, Song B at 6-7
|
||||
val songs = listOf(
|
||||
twoPage(song("Song A")),
|
||||
twoPage(song("Song B"))
|
||||
)
|
||||
|
||||
val pages = engine.paginate(songs, tocPages = 2)
|
||||
|
||||
pages shouldHaveSize 5
|
||||
pages[0].shouldBeInstanceOf<PageContent.BlankPage>()
|
||||
(pages[1] as PageContent.SongPage).song.title shouldBe "Song A"
|
||||
(pages[2] as PageContent.SongPage).song.title shouldBe "Song A"
|
||||
(pages[3] as PageContent.SongPage).song.title shouldBe "Song B"
|
||||
(pages[4] as PageContent.SongPage).song.title shouldBe "Song B"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `empty input produces empty output`() {
|
||||
val pages = engine.paginate(emptyList(), tocPages = 2)
|
||||
pages shouldHaveSize 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `tocPages affects page numbering for alignment`() {
|
||||
// tocPages = 3, content starts at page 4 (even/left)
|
||||
// 2-page song should start directly on page 4 (even) - no filler needed
|
||||
val songs = listOf(
|
||||
twoPage(song("Song A"))
|
||||
)
|
||||
|
||||
val pages = engine.paginate(songs, tocPages = 3)
|
||||
|
||||
// Page 4 is even -> no filler needed
|
||||
pages shouldHaveSize 2
|
||||
(pages[0] as PageContent.SongPage).song.title shouldBe "Song A"
|
||||
(pages[0] as PageContent.SongPage).pageIndex shouldBe 0
|
||||
(pages[1] as PageContent.SongPage).song.title shouldBe "Song A"
|
||||
(pages[1] as PageContent.SongPage).pageIndex shouldBe 1
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `filler uses image when images directory exists`() {
|
||||
// Create a temp directory with an image file
|
||||
val tempDir = kotlin.io.path.createTempDirectory("songbook-test-images").toFile()
|
||||
try {
|
||||
val imageFile = java.io.File(tempDir, "filler.png")
|
||||
imageFile.writeText("fake image")
|
||||
|
||||
val configWithImages = BookConfig(images = ImagesConfig(directory = tempDir.absolutePath))
|
||||
val engineWithImages = PaginationEngine(configWithImages)
|
||||
|
||||
val songs = listOf(twoPage(song("Song A")))
|
||||
val pages = engineWithImages.paginate(songs, tocPages = 2)
|
||||
|
||||
// tocPages=2, start at page 3 (odd), needs filler
|
||||
pages shouldHaveSize 3
|
||||
val filler = pages[0]
|
||||
filler.shouldBeInstanceOf<PageContent.FillerImage>()
|
||||
(filler as PageContent.FillerImage).imagePath shouldBe imageFile.absolutePath
|
||||
} finally {
|
||||
tempDir.deleteRecursively()
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `mixed single and two-page songs layout correctly`() {
|
||||
// tocPages = 4, content starts at page 5 (odd)
|
||||
val songs = listOf(
|
||||
onePage(song("Song A")), // page 5
|
||||
twoPage(song("Song B")), // starts page 6 (even) - no filler
|
||||
onePage(song("Song C")), // page 8
|
||||
onePage(song("Song D")), // page 9
|
||||
twoPage(song("Song E")) // starts page 10 (even) - no filler
|
||||
)
|
||||
|
||||
val pages = engine.paginate(songs, tocPages = 4)
|
||||
|
||||
pages shouldHaveSize 7
|
||||
(pages[0] as PageContent.SongPage).song.title shouldBe "Song A"
|
||||
(pages[1] as PageContent.SongPage).song.title shouldBe "Song B"
|
||||
(pages[1] as PageContent.SongPage).pageIndex shouldBe 0
|
||||
(pages[2] as PageContent.SongPage).song.title shouldBe "Song B"
|
||||
(pages[2] as PageContent.SongPage).pageIndex shouldBe 1
|
||||
(pages[3] as PageContent.SongPage).song.title shouldBe "Song C"
|
||||
(pages[4] as PageContent.SongPage).song.title shouldBe "Song D"
|
||||
(pages[5] as PageContent.SongPage).song.title shouldBe "Song E"
|
||||
(pages[5] as PageContent.SongPage).pageIndex shouldBe 0
|
||||
(pages[6] as PageContent.SongPage).song.title shouldBe "Song E"
|
||||
(pages[6] as PageContent.SongPage).pageIndex shouldBe 1
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,12 @@
|
||||
package de.pfadfinder.songbook.layout
|
||||
|
||||
import de.pfadfinder.songbook.model.FontMetrics
|
||||
import de.pfadfinder.songbook.model.FontSpec
|
||||
|
||||
class StubFontMetrics : FontMetrics {
|
||||
override fun measureTextWidth(text: String, font: FontSpec, size: Float): Float =
|
||||
text.length * size * 0.5f * 0.3528f
|
||||
|
||||
override fun measureLineHeight(font: FontSpec, size: Float): Float =
|
||||
size * 1.2f * 0.3528f
|
||||
}
|
||||
@@ -0,0 +1,211 @@
|
||||
package de.pfadfinder.songbook.layout
|
||||
|
||||
import de.pfadfinder.songbook.model.*
|
||||
import io.kotest.matchers.collections.shouldBeEmpty
|
||||
import io.kotest.matchers.collections.shouldHaveSize
|
||||
import io.kotest.matchers.shouldBe
|
||||
import kotlin.test.Test
|
||||
|
||||
class TocGeneratorTest {
|
||||
|
||||
private val config = BookConfig(
|
||||
referenceBooks = listOf(
|
||||
ReferenceBook(id = "mundorgel", name = "Mundorgel", abbreviation = "MO"),
|
||||
ReferenceBook(id = "kljb", name = "KLJB Liederbuch", abbreviation = "KLJB")
|
||||
)
|
||||
)
|
||||
private val generator = TocGenerator(config)
|
||||
|
||||
@Test
|
||||
fun `generate creates entries for songs sorted alphabetically`() {
|
||||
val pages = listOf(
|
||||
PageContent.SongPage(Song(title = "Zebra Song"), 0),
|
||||
PageContent.SongPage(Song(title = "Alpha Song"), 0),
|
||||
PageContent.SongPage(Song(title = "Middle Song"), 0)
|
||||
)
|
||||
|
||||
val entries = generator.generate(pages, tocStartPage = 0)
|
||||
|
||||
entries shouldHaveSize 3
|
||||
entries[0].title shouldBe "Alpha Song"
|
||||
entries[1].title shouldBe "Middle Song"
|
||||
entries[2].title shouldBe "Zebra Song"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `generate assigns correct page numbers`() {
|
||||
val pages = listOf(
|
||||
PageContent.SongPage(Song(title = "Song A"), 0), // page 1
|
||||
PageContent.SongPage(Song(title = "Song B"), 0), // page 2
|
||||
PageContent.SongPage(Song(title = "Song C"), 0) // page 3
|
||||
)
|
||||
|
||||
val entries = generator.generate(pages, tocStartPage = 0)
|
||||
|
||||
entries.find { it.title == "Song A" }!!.pageNumber shouldBe 1
|
||||
entries.find { it.title == "Song B" }!!.pageNumber shouldBe 2
|
||||
entries.find { it.title == "Song C" }!!.pageNumber shouldBe 3
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `generate with tocStartPage offsets page numbers`() {
|
||||
val pages = listOf(
|
||||
PageContent.SongPage(Song(title = "Song A"), 0)
|
||||
)
|
||||
|
||||
val entries = generator.generate(pages, tocStartPage = 4)
|
||||
|
||||
entries[0].pageNumber shouldBe 5
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `generate creates alias entries`() {
|
||||
val song = Song(title = "Original Title", aliases = listOf("Alias One", "Alias Two"))
|
||||
val pages = listOf(
|
||||
PageContent.SongPage(song, 0)
|
||||
)
|
||||
|
||||
val entries = generator.generate(pages, tocStartPage = 0)
|
||||
|
||||
entries shouldHaveSize 3
|
||||
// Sorted: Alias One, Alias Two, Original Title
|
||||
entries[0].title shouldBe "Alias One"
|
||||
entries[0].isAlias shouldBe true
|
||||
entries[0].pageNumber shouldBe 1
|
||||
entries[1].title shouldBe "Alias Two"
|
||||
entries[1].isAlias shouldBe true
|
||||
entries[1].pageNumber shouldBe 1
|
||||
entries[2].title shouldBe "Original Title"
|
||||
entries[2].isAlias shouldBe false
|
||||
entries[2].pageNumber shouldBe 1
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `generate maps reference book IDs to abbreviations`() {
|
||||
val song = Song(
|
||||
title = "Referenced Song",
|
||||
references = mapOf("mundorgel" to 42, "kljb" to 117)
|
||||
)
|
||||
val pages = listOf(PageContent.SongPage(song, 0))
|
||||
|
||||
val entries = generator.generate(pages, tocStartPage = 0)
|
||||
|
||||
entries shouldHaveSize 1
|
||||
entries[0].references shouldBe mapOf("MO" to 42, "KLJB" to 117)
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `generate keeps unknown reference book IDs as-is`() {
|
||||
val song = Song(
|
||||
title = "Song",
|
||||
references = mapOf("unknown_book" to 5)
|
||||
)
|
||||
val pages = listOf(PageContent.SongPage(song, 0))
|
||||
|
||||
val entries = generator.generate(pages, tocStartPage = 0)
|
||||
|
||||
entries[0].references shouldBe mapOf("unknown_book" to 5)
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `generate skips filler and blank pages for page numbering`() {
|
||||
val pages = listOf(
|
||||
PageContent.BlankPage, // page 1
|
||||
PageContent.SongPage(Song(title = "Song A"), 0), // page 2
|
||||
PageContent.FillerImage("/path/to/image.png"), // page 3
|
||||
PageContent.SongPage(Song(title = "Song B"), 0) // page 4
|
||||
)
|
||||
|
||||
val entries = generator.generate(pages, tocStartPage = 0)
|
||||
|
||||
entries shouldHaveSize 2
|
||||
entries.find { it.title == "Song A" }!!.pageNumber shouldBe 2
|
||||
entries.find { it.title == "Song B" }!!.pageNumber shouldBe 4
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `generate handles two-page songs correctly`() {
|
||||
val song = Song(title = "Long Song")
|
||||
val pages = listOf(
|
||||
PageContent.SongPage(song, 0), // page 1 - first page of song
|
||||
PageContent.SongPage(song, 1) // page 2 - second page of song
|
||||
)
|
||||
|
||||
val entries = generator.generate(pages, tocStartPage = 0)
|
||||
|
||||
// Should only have one entry pointing to the first page
|
||||
entries shouldHaveSize 1
|
||||
entries[0].title shouldBe "Long Song"
|
||||
entries[0].pageNumber shouldBe 1
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `generate aliases share references with original song`() {
|
||||
val song = Song(
|
||||
title = "Main Song",
|
||||
aliases = listOf("Alt Name"),
|
||||
references = mapOf("mundorgel" to 10)
|
||||
)
|
||||
val pages = listOf(PageContent.SongPage(song, 0))
|
||||
|
||||
val entries = generator.generate(pages, tocStartPage = 0)
|
||||
|
||||
entries shouldHaveSize 2
|
||||
val alias = entries.find { it.isAlias }!!
|
||||
alias.references shouldBe mapOf("MO" to 10)
|
||||
val main = entries.find { !it.isAlias }!!
|
||||
main.references shouldBe mapOf("MO" to 10)
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `generate with empty pages produces empty entries`() {
|
||||
val entries = generator.generate(emptyList(), tocStartPage = 0)
|
||||
entries.shouldBeEmpty()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `estimateTocPages returns even number`() {
|
||||
val songs = (1..10).map { Song(title = "Song $it") }
|
||||
val pages = generator.estimateTocPages(songs)
|
||||
(pages % 2) shouldBe 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `estimateTocPages accounts for aliases`() {
|
||||
val songsWithoutAliases = (1..10).map { Song(title = "Song $it") }
|
||||
val songsWithAliases = (1..10).map { Song(title = "Song $it", aliases = listOf("Alias $it")) }
|
||||
|
||||
val pagesWithout = generator.estimateTocPages(songsWithoutAliases)
|
||||
val pagesWith = generator.estimateTocPages(songsWithAliases)
|
||||
|
||||
pagesWith shouldBe pagesWithout // both under 40 entries, same page count
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `estimateTocPages with many songs returns more pages`() {
|
||||
val fewSongs = (1..10).map { Song(title = "Song $it") }
|
||||
val manySongs = (1..200).map { Song(title = "Song $it") }
|
||||
|
||||
val fewPages = generator.estimateTocPages(fewSongs)
|
||||
val manyPages = generator.estimateTocPages(manySongs)
|
||||
|
||||
// 200 songs / 40 per page = 5 + 1 = 6 pages (already even)
|
||||
manyPages shouldBe 6
|
||||
fewPages shouldBe 2 // (10/40)+1 = 1, rounded up to 2 for even
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `generate sorts case-insensitively`() {
|
||||
val pages = listOf(
|
||||
PageContent.SongPage(Song(title = "banana"), 0),
|
||||
PageContent.SongPage(Song(title = "Apple"), 0),
|
||||
PageContent.SongPage(Song(title = "cherry"), 0)
|
||||
)
|
||||
|
||||
val entries = generator.generate(pages, tocStartPage = 0)
|
||||
|
||||
entries[0].title shouldBe "Apple"
|
||||
entries[1].title shouldBe "banana"
|
||||
entries[2].title shouldBe "cherry"
|
||||
}
|
||||
}
|
||||
3
model/build.gradle.kts
Normal file
3
model/build.gradle.kts
Normal file
@@ -0,0 +1,3 @@
|
||||
plugins {
|
||||
id("songbook-conventions")
|
||||
}
|
||||
@@ -0,0 +1,84 @@
|
||||
package de.pfadfinder.songbook.model
|
||||
|
||||
data class BookConfig(
|
||||
val book: BookMeta = BookMeta(),
|
||||
val songs: SongsConfig = SongsConfig(),
|
||||
val fonts: FontsConfig = FontsConfig(),
|
||||
val layout: LayoutConfig = LayoutConfig(),
|
||||
val images: ImagesConfig = ImagesConfig(),
|
||||
val referenceBooks: List<ReferenceBook> = emptyList(),
|
||||
val output: OutputConfig = OutputConfig(),
|
||||
val foreword: ForewordConfig? = null,
|
||||
val toc: TocConfig = TocConfig(),
|
||||
val intro: IntroConfig? = null
|
||||
)
|
||||
|
||||
data class IntroConfig(
|
||||
val enabled: Boolean = true
|
||||
)
|
||||
|
||||
data class TocConfig(
|
||||
val highlightColumn: String? = null // abbreviation of the column to highlight (e.g. "CL")
|
||||
)
|
||||
|
||||
data class ForewordConfig(
|
||||
val file: String = "./foreword.txt"
|
||||
)
|
||||
|
||||
data class BookMeta(
|
||||
val title: String = "Liederbuch",
|
||||
val subtitle: String? = null,
|
||||
val edition: String? = null,
|
||||
val format: String = "A5"
|
||||
)
|
||||
|
||||
data class SongsConfig(
|
||||
val directory: String = "./songs",
|
||||
val order: String = "alphabetical" // "alphabetical" or "manual"
|
||||
)
|
||||
|
||||
data class FontsConfig(
|
||||
val lyrics: FontSpec = FontSpec(family = "Helvetica", size = 10f),
|
||||
val chords: FontSpec = FontSpec(family = "Helvetica", size = 9f, color = "#333333"),
|
||||
val title: FontSpec = FontSpec(family = "Helvetica", size = 14f),
|
||||
val metadata: FontSpec = FontSpec(family = "Helvetica", size = 8f),
|
||||
val toc: FontSpec = FontSpec(family = "Helvetica", size = 9f)
|
||||
)
|
||||
|
||||
data class FontSpec(
|
||||
val family: String = "Helvetica",
|
||||
val file: String? = null,
|
||||
val size: Float = 10f,
|
||||
val color: String = "#000000"
|
||||
)
|
||||
|
||||
data class LayoutConfig(
|
||||
val margins: Margins = Margins(),
|
||||
val chordLineSpacing: Float = 1f, // mm – gap between chord line and lyrics text
|
||||
val verseSpacing: Float = 6f, // mm – gap between consecutive song sections
|
||||
val pageNumberPosition: String = "bottom-outer",
|
||||
val metadataLabels: String = "abbreviated", // "abbreviated" (M:/T:) or "german" (Worte:/Weise:)
|
||||
val metadataPosition: String = "top" // "top" (after title) or "bottom" (bottom of last page)
|
||||
)
|
||||
|
||||
data class Margins(
|
||||
val top: Float = 15f,
|
||||
val bottom: Float = 15f,
|
||||
val inner: Float = 20f,
|
||||
val outer: Float = 12f
|
||||
)
|
||||
|
||||
data class ImagesConfig(
|
||||
val directory: String = "./images"
|
||||
)
|
||||
|
||||
data class ReferenceBook(
|
||||
val id: String,
|
||||
val name: String,
|
||||
val abbreviation: String
|
||||
)
|
||||
|
||||
data class OutputConfig(
|
||||
val directory: String = "./output",
|
||||
val filename: String = "liederbuch.pdf"
|
||||
)
|
||||
@@ -0,0 +1,7 @@
|
||||
package de.pfadfinder.songbook.model
|
||||
|
||||
import java.io.OutputStream
|
||||
|
||||
interface BookRenderer {
|
||||
fun render(layout: LayoutResult, config: BookConfig, output: OutputStream)
|
||||
}
|
||||
@@ -0,0 +1,6 @@
|
||||
package de.pfadfinder.songbook.model
|
||||
|
||||
interface FontMetrics {
|
||||
fun measureTextWidth(text: String, font: FontSpec, size: Float): Float
|
||||
fun measureLineHeight(font: FontSpec, size: Float): Float
|
||||
}
|
||||
@@ -0,0 +1,7 @@
|
||||
package de.pfadfinder.songbook.model
|
||||
|
||||
data class Foreword(
|
||||
val quote: String? = null,
|
||||
val paragraphs: List<String> = emptyList(),
|
||||
val signatures: List<String> = emptyList()
|
||||
)
|
||||
28
model/src/main/kotlin/de/pfadfinder/songbook/model/Layout.kt
Normal file
28
model/src/main/kotlin/de/pfadfinder/songbook/model/Layout.kt
Normal file
@@ -0,0 +1,28 @@
|
||||
package de.pfadfinder.songbook.model
|
||||
|
||||
data class MeasuredSong(
|
||||
val song: Song,
|
||||
val totalHeightMm: Float,
|
||||
val pageCount: Int // 1 or 2
|
||||
)
|
||||
|
||||
sealed class PageContent {
|
||||
data class SongPage(val song: Song, val pageIndex: Int) : PageContent() // pageIndex 0 or 1 for 2-page songs
|
||||
data class FillerImage(val imagePath: String) : PageContent()
|
||||
data object BlankPage : PageContent()
|
||||
data class ForewordPage(val foreword: Foreword, val pageIndex: Int) : PageContent() // pageIndex 0 or 1 for multi-page forewords
|
||||
}
|
||||
|
||||
data class LayoutResult(
|
||||
val introPages: Int = 0,
|
||||
val tocPages: Int,
|
||||
val pages: List<PageContent>,
|
||||
val tocEntries: List<TocEntry>
|
||||
)
|
||||
|
||||
data class TocEntry(
|
||||
val title: String,
|
||||
val pageNumber: Int,
|
||||
val isAlias: Boolean = false,
|
||||
val references: Map<String, Int> = emptyMap() // bookAbbrev → page
|
||||
)
|
||||
34
model/src/main/kotlin/de/pfadfinder/songbook/model/Song.kt
Normal file
34
model/src/main/kotlin/de/pfadfinder/songbook/model/Song.kt
Normal file
@@ -0,0 +1,34 @@
|
||||
package de.pfadfinder.songbook.model
|
||||
|
||||
data class Song(
|
||||
val title: String,
|
||||
val aliases: List<String> = emptyList(),
|
||||
val lyricist: String? = null,
|
||||
val composer: String? = null,
|
||||
val key: String? = null,
|
||||
val tags: List<String> = emptyList(),
|
||||
val notes: List<String> = emptyList(),
|
||||
val references: Map<String, Int> = emptyMap(), // bookId → page number
|
||||
val capo: Int? = null,
|
||||
val sections: List<SongSection> = emptyList()
|
||||
)
|
||||
|
||||
data class SongSection(
|
||||
val type: SectionType,
|
||||
val label: String? = null,
|
||||
val lines: List<SongLine> = emptyList()
|
||||
)
|
||||
|
||||
enum class SectionType {
|
||||
VERSE, CHORUS, BRIDGE, REPEAT
|
||||
}
|
||||
|
||||
data class SongLine(
|
||||
val segments: List<LineSegment> = emptyList(),
|
||||
val imagePath: String? = null // when non-null, this "line" is an inline image (segments ignored)
|
||||
)
|
||||
|
||||
data class LineSegment(
|
||||
val chord: String? = null, // null = no chord above this segment
|
||||
val text: String
|
||||
)
|
||||
13
parser/build.gradle.kts
Normal file
13
parser/build.gradle.kts
Normal file
@@ -0,0 +1,13 @@
|
||||
plugins {
|
||||
id("songbook-conventions")
|
||||
}
|
||||
|
||||
dependencies {
|
||||
implementation(project(":model"))
|
||||
implementation("com.fasterxml.jackson.core:jackson-databind:2.18.3")
|
||||
implementation("com.fasterxml.jackson.module:jackson-module-kotlin:2.18.3")
|
||||
implementation("com.fasterxml.jackson.dataformat:jackson-dataformat-yaml:2.18.3")
|
||||
|
||||
testImplementation(kotlin("test"))
|
||||
testImplementation("io.kotest:kotest-assertions-core:5.9.1")
|
||||
}
|
||||
@@ -0,0 +1,256 @@
|
||||
package de.pfadfinder.songbook.parser
|
||||
|
||||
import de.pfadfinder.songbook.model.*
|
||||
import java.io.File
|
||||
|
||||
object ChordProParser {
|
||||
|
||||
fun parse(input: String): Song {
|
||||
val lines = input.lines()
|
||||
|
||||
var title: String? = null
|
||||
val aliases = mutableListOf<String>()
|
||||
var lyricist: String? = null
|
||||
var composer: String? = null
|
||||
var key: String? = null
|
||||
val tags = mutableListOf<String>()
|
||||
val notes = mutableListOf<String>()
|
||||
val references = mutableMapOf<String, Int>()
|
||||
var capo: Int? = null
|
||||
|
||||
val sections = mutableListOf<SongSection>()
|
||||
|
||||
// Current section being built
|
||||
var currentType: SectionType? = null
|
||||
var currentLabel: String? = null
|
||||
var currentLines = mutableListOf<SongLine>()
|
||||
var explicitSection = false
|
||||
|
||||
// Notes block state
|
||||
var inNotesBlock = false
|
||||
var currentNoteParagraph = StringBuilder()
|
||||
|
||||
fun flushNoteParagraph() {
|
||||
if (currentNoteParagraph.isNotEmpty()) {
|
||||
notes.add(currentNoteParagraph.toString().trim())
|
||||
currentNoteParagraph = StringBuilder()
|
||||
}
|
||||
}
|
||||
|
||||
fun flushSection() {
|
||||
if (currentType != null) {
|
||||
sections.add(SongSection(type = currentType!!, label = currentLabel, lines = currentLines.toList()))
|
||||
currentType = null
|
||||
currentLabel = null
|
||||
currentLines = mutableListOf()
|
||||
explicitSection = false
|
||||
}
|
||||
}
|
||||
|
||||
for (rawLine in lines) {
|
||||
val line = rawLine.trimEnd()
|
||||
|
||||
// Inside a notes block: collect lines as paragraphs
|
||||
if (inNotesBlock) {
|
||||
if (line.trimStart().startsWith("{") && line.trimEnd().endsWith("}")) {
|
||||
val inner = line.trim().removePrefix("{").removeSuffix("}").trim().lowercase()
|
||||
if (inner == "end_of_notes" || inner == "eon") {
|
||||
flushNoteParagraph()
|
||||
inNotesBlock = false
|
||||
continue
|
||||
}
|
||||
}
|
||||
if (line.isBlank()) {
|
||||
flushNoteParagraph()
|
||||
} else {
|
||||
if (currentNoteParagraph.isNotEmpty()) {
|
||||
currentNoteParagraph.append(" ")
|
||||
}
|
||||
currentNoteParagraph.append(line.trim())
|
||||
}
|
||||
continue
|
||||
}
|
||||
|
||||
// Skip comments
|
||||
if (line.trimStart().startsWith("#")) continue
|
||||
|
||||
// Blank line: flush implicit sections, skip otherwise
|
||||
if (line.isBlank()) {
|
||||
if (currentType != null && !explicitSection) {
|
||||
flushSection()
|
||||
}
|
||||
continue
|
||||
}
|
||||
|
||||
// Directive line
|
||||
if (line.trimStart().startsWith("{") && line.trimEnd().endsWith("}")) {
|
||||
val inner = line.trim().removePrefix("{").removeSuffix("}").trim()
|
||||
val colonIndex = inner.indexOf(':')
|
||||
val directive: String
|
||||
val value: String?
|
||||
if (colonIndex >= 0) {
|
||||
directive = inner.substring(0, colonIndex).trim().lowercase()
|
||||
value = inner.substring(colonIndex + 1).trim()
|
||||
} else {
|
||||
directive = inner.trim().lowercase()
|
||||
value = null
|
||||
}
|
||||
|
||||
when (directive) {
|
||||
"title", "t" -> title = value
|
||||
"alias" -> if (value != null) aliases.add(value)
|
||||
"lyricist" -> lyricist = value
|
||||
"composer" -> composer = value
|
||||
"key" -> key = value
|
||||
"tags" -> if (value != null) {
|
||||
tags.addAll(value.split(",").map { it.trim() }.filter { it.isNotEmpty() })
|
||||
}
|
||||
"note" -> if (value != null) notes.add(value)
|
||||
"capo" -> capo = value?.toIntOrNull()
|
||||
"ref" -> if (value != null) {
|
||||
parseReference(value)?.let { (bookId, page) ->
|
||||
references[bookId] = page
|
||||
}
|
||||
}
|
||||
"start_of_verse", "sov" -> {
|
||||
flushSection()
|
||||
currentType = SectionType.VERSE
|
||||
currentLabel = value
|
||||
explicitSection = true
|
||||
}
|
||||
"end_of_verse", "eov" -> {
|
||||
flushSection()
|
||||
}
|
||||
"start_of_chorus", "soc" -> {
|
||||
flushSection()
|
||||
currentType = SectionType.CHORUS
|
||||
currentLabel = value
|
||||
explicitSection = true
|
||||
}
|
||||
"end_of_chorus", "eoc" -> {
|
||||
flushSection()
|
||||
}
|
||||
"start_of_repeat", "sor" -> {
|
||||
flushSection()
|
||||
currentType = SectionType.REPEAT
|
||||
currentLabel = value
|
||||
explicitSection = true
|
||||
}
|
||||
"end_of_repeat", "eor" -> {
|
||||
flushSection()
|
||||
}
|
||||
"image" -> if (value != null) {
|
||||
// Inline image within a song section
|
||||
if (currentType == null) {
|
||||
currentType = SectionType.VERSE
|
||||
}
|
||||
currentLines.add(SongLine(imagePath = value.trim()))
|
||||
}
|
||||
"start_of_notes", "son" -> {
|
||||
inNotesBlock = true
|
||||
}
|
||||
"end_of_notes", "eon" -> {
|
||||
// Should have been handled in the notes block above
|
||||
flushNoteParagraph()
|
||||
inNotesBlock = false
|
||||
}
|
||||
"chorus" -> {
|
||||
flushSection()
|
||||
sections.add(SongSection(type = SectionType.CHORUS))
|
||||
}
|
||||
"repeat" -> {
|
||||
// Store repeat count as label on current section or create a new section
|
||||
if (currentType != null) {
|
||||
currentLabel = value
|
||||
}
|
||||
}
|
||||
}
|
||||
continue
|
||||
}
|
||||
|
||||
// Text/chord line: if we're not inside a section, start an implicit VERSE
|
||||
if (currentType == null) {
|
||||
currentType = SectionType.VERSE
|
||||
}
|
||||
|
||||
val songLine = parseChordLine(line)
|
||||
currentLines.add(songLine)
|
||||
}
|
||||
|
||||
// Flush any remaining section
|
||||
flushSection()
|
||||
|
||||
return Song(
|
||||
title = title ?: "",
|
||||
aliases = aliases.toList(),
|
||||
lyricist = lyricist,
|
||||
composer = composer,
|
||||
key = key,
|
||||
tags = tags.toList(),
|
||||
notes = notes.toList(),
|
||||
references = references.toMap(),
|
||||
capo = capo,
|
||||
sections = sections.toList()
|
||||
)
|
||||
}
|
||||
|
||||
fun parseFile(file: File): Song = parse(file.readText())
|
||||
|
||||
internal fun parseChordLine(line: String): SongLine {
|
||||
val segments = mutableListOf<LineSegment>()
|
||||
var i = 0
|
||||
val len = line.length
|
||||
|
||||
// Check if line starts with text before any chord
|
||||
if (len > 0 && line[0] != '[') {
|
||||
val nextBracket = line.indexOf('[')
|
||||
if (nextBracket < 0) {
|
||||
// No chords at all, entire line is text
|
||||
segments.add(LineSegment(chord = null, text = line))
|
||||
return SongLine(segments)
|
||||
}
|
||||
segments.add(LineSegment(chord = null, text = line.substring(0, nextBracket)))
|
||||
i = nextBracket
|
||||
}
|
||||
|
||||
while (i < len) {
|
||||
if (line[i] == '[') {
|
||||
val closeBracket = line.indexOf(']', i)
|
||||
if (closeBracket < 0) {
|
||||
// Malformed: treat rest as text
|
||||
segments.add(LineSegment(chord = null, text = line.substring(i)))
|
||||
break
|
||||
}
|
||||
val chord = line.substring(i + 1, closeBracket)
|
||||
val textStart = closeBracket + 1
|
||||
val nextBracket = line.indexOf('[', textStart)
|
||||
val text = if (nextBracket < 0) {
|
||||
line.substring(textStart)
|
||||
} else {
|
||||
line.substring(textStart, nextBracket)
|
||||
}
|
||||
segments.add(LineSegment(chord = chord, text = text))
|
||||
i = if (nextBracket < 0) len else nextBracket
|
||||
} else {
|
||||
// Should not happen if logic is correct, but handle gracefully
|
||||
val nextBracket = line.indexOf('[', i)
|
||||
if (nextBracket < 0) {
|
||||
segments.add(LineSegment(chord = null, text = line.substring(i)))
|
||||
break
|
||||
}
|
||||
segments.add(LineSegment(chord = null, text = line.substring(i, nextBracket)))
|
||||
i = nextBracket
|
||||
}
|
||||
}
|
||||
|
||||
return SongLine(segments)
|
||||
}
|
||||
|
||||
internal fun parseReference(value: String): Pair<String, Int>? {
|
||||
val parts = value.trim().split("\\s+".toRegex())
|
||||
if (parts.size < 2) return null
|
||||
val page = parts.last().toIntOrNull() ?: return null
|
||||
val bookId = parts.dropLast(1).joinToString(" ")
|
||||
return bookId to page
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,25 @@
|
||||
package de.pfadfinder.songbook.parser
|
||||
|
||||
import com.fasterxml.jackson.databind.DeserializationFeature
|
||||
import com.fasterxml.jackson.databind.ObjectMapper
|
||||
import com.fasterxml.jackson.databind.PropertyNamingStrategies
|
||||
import com.fasterxml.jackson.dataformat.yaml.YAMLFactory
|
||||
import com.fasterxml.jackson.module.kotlin.registerKotlinModule
|
||||
import de.pfadfinder.songbook.model.BookConfig
|
||||
import java.io.File
|
||||
|
||||
object ConfigParser {
|
||||
|
||||
private val mapper: ObjectMapper = ObjectMapper(YAMLFactory())
|
||||
.registerKotlinModule()
|
||||
.setPropertyNamingStrategy(PropertyNamingStrategies.SNAKE_CASE)
|
||||
.configure(DeserializationFeature.FAIL_ON_UNKNOWN_PROPERTIES, false)
|
||||
|
||||
fun parse(file: File): BookConfig {
|
||||
return mapper.readValue(file, BookConfig::class.java)
|
||||
}
|
||||
|
||||
fun parse(input: String): BookConfig {
|
||||
return mapper.readValue(input, BookConfig::class.java)
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,96 @@
|
||||
package de.pfadfinder.songbook.parser
|
||||
|
||||
import de.pfadfinder.songbook.model.Foreword
|
||||
import java.io.File
|
||||
|
||||
object ForewordParser {
|
||||
|
||||
/**
|
||||
* Parses a foreword text file into a [Foreword] object.
|
||||
*
|
||||
* Format:
|
||||
* - Lines starting with `> ` are collected as the quote (multiple lines joined)
|
||||
* - `---` is a horizontal rule separator (marks end of quote section)
|
||||
* - Lines starting with `-- ` are signatures
|
||||
* - Other non-blank lines are body text; blank lines separate paragraphs
|
||||
*/
|
||||
fun parse(input: String): Foreword {
|
||||
val lines = input.lines()
|
||||
|
||||
val quoteLines = mutableListOf<String>()
|
||||
val signatures = mutableListOf<String>()
|
||||
val paragraphs = mutableListOf<String>()
|
||||
|
||||
var currentParagraph = StringBuilder()
|
||||
var inQuote = true // Start assuming we might be in the quote section
|
||||
var foundSeparator = false
|
||||
|
||||
for (rawLine in lines) {
|
||||
val line = rawLine.trimEnd()
|
||||
|
||||
// Quote lines (before separator)
|
||||
if (!foundSeparator && line.trimStart().startsWith("> ")) {
|
||||
quoteLines.add(line.trimStart().removePrefix("> "))
|
||||
continue
|
||||
}
|
||||
|
||||
// If we had quote lines but now see non-quote content before separator,
|
||||
// the quote section is done
|
||||
if (!foundSeparator && quoteLines.isNotEmpty() && line.trimStart().isNotEmpty() && !line.trimStart().startsWith("> ")) {
|
||||
if (line.trim() == "---") {
|
||||
foundSeparator = true
|
||||
inQuote = false
|
||||
continue
|
||||
}
|
||||
}
|
||||
|
||||
// Separator line
|
||||
if (line.trim() == "---") {
|
||||
foundSeparator = true
|
||||
inQuote = false
|
||||
continue
|
||||
}
|
||||
|
||||
// Signature lines
|
||||
if (line.trimStart().startsWith("-- ")) {
|
||||
signatures.add(line.trimStart().removePrefix("-- "))
|
||||
continue
|
||||
}
|
||||
|
||||
// Skip quote processing after we established there are no quotes
|
||||
if (inQuote && quoteLines.isEmpty() && line.isBlank()) {
|
||||
continue
|
||||
}
|
||||
|
||||
inQuote = false
|
||||
|
||||
// Body paragraphs
|
||||
if (line.isBlank()) {
|
||||
if (currentParagraph.isNotEmpty()) {
|
||||
paragraphs.add(currentParagraph.toString().trim())
|
||||
currentParagraph = StringBuilder()
|
||||
}
|
||||
} else {
|
||||
if (currentParagraph.isNotEmpty()) {
|
||||
currentParagraph.append(" ")
|
||||
}
|
||||
currentParagraph.append(line.trim())
|
||||
}
|
||||
}
|
||||
|
||||
// Flush remaining paragraph
|
||||
if (currentParagraph.isNotEmpty()) {
|
||||
paragraphs.add(currentParagraph.toString().trim())
|
||||
}
|
||||
|
||||
val quote = if (quoteLines.isNotEmpty()) quoteLines.joinToString(" ") else null
|
||||
|
||||
return Foreword(
|
||||
quote = quote,
|
||||
paragraphs = paragraphs,
|
||||
signatures = signatures
|
||||
)
|
||||
}
|
||||
|
||||
fun parseFile(file: File): Foreword = parse(file.readText())
|
||||
}
|
||||
@@ -0,0 +1,78 @@
|
||||
package de.pfadfinder.songbook.parser
|
||||
|
||||
import de.pfadfinder.songbook.model.BookConfig
|
||||
import de.pfadfinder.songbook.model.FontSpec
|
||||
import de.pfadfinder.songbook.model.Song
|
||||
import java.io.File
|
||||
|
||||
data class ValidationError(val file: String?, val line: Int?, val message: String)
|
||||
|
||||
object Validator {
|
||||
|
||||
fun validateSong(song: Song, fileName: String? = null): List<ValidationError> {
|
||||
val errors = mutableListOf<ValidationError>()
|
||||
|
||||
if (song.title.isBlank()) {
|
||||
errors.add(ValidationError(file = fileName, line = null, message = "Song must have a title"))
|
||||
}
|
||||
|
||||
if (song.sections.isEmpty()) {
|
||||
errors.add(ValidationError(file = fileName, line = null, message = "Song must have at least one section"))
|
||||
}
|
||||
|
||||
return errors
|
||||
}
|
||||
|
||||
fun validateSong(song: Song, config: BookConfig, fileName: String? = null): List<ValidationError> {
|
||||
val errors = validateSong(song, fileName).toMutableList()
|
||||
|
||||
val knownBookIds = config.referenceBooks.map { it.id }.toSet()
|
||||
for ((bookId, _) in song.references) {
|
||||
if (bookId !in knownBookIds) {
|
||||
errors.add(
|
||||
ValidationError(
|
||||
file = fileName,
|
||||
line = null,
|
||||
message = "Reference to unknown book '$bookId'. Known books: ${knownBookIds.joinToString(", ")}"
|
||||
)
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
return errors
|
||||
}
|
||||
|
||||
fun validateConfig(config: BookConfig): List<ValidationError> {
|
||||
val errors = mutableListOf<ValidationError>()
|
||||
|
||||
with(config.layout.margins) {
|
||||
if (top <= 0) errors.add(ValidationError(file = null, line = null, message = "Top margin must be greater than 0"))
|
||||
if (bottom <= 0) errors.add(ValidationError(file = null, line = null, message = "Bottom margin must be greater than 0"))
|
||||
if (inner <= 0) errors.add(ValidationError(file = null, line = null, message = "Inner margin must be greater than 0"))
|
||||
if (outer <= 0) errors.add(ValidationError(file = null, line = null, message = "Outer margin must be greater than 0"))
|
||||
}
|
||||
|
||||
// Validate font files exist (paths should already be resolved to absolute by the pipeline)
|
||||
validateFontFile(config.fonts.lyrics, "lyrics", errors)
|
||||
validateFontFile(config.fonts.chords, "chords", errors)
|
||||
validateFontFile(config.fonts.title, "title", errors)
|
||||
validateFontFile(config.fonts.metadata, "metadata", errors)
|
||||
validateFontFile(config.fonts.toc, "toc", errors)
|
||||
|
||||
return errors
|
||||
}
|
||||
|
||||
private fun validateFontFile(font: FontSpec, fontRole: String, errors: MutableList<ValidationError>) {
|
||||
val fontFile = font.file ?: return
|
||||
val file = File(fontFile)
|
||||
if (!file.exists()) {
|
||||
errors.add(
|
||||
ValidationError(
|
||||
file = null,
|
||||
line = null,
|
||||
message = "Font file for '$fontRole' not found: $fontFile"
|
||||
)
|
||||
)
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,772 @@
|
||||
package de.pfadfinder.songbook.parser
|
||||
|
||||
import de.pfadfinder.songbook.model.SectionType
|
||||
import io.kotest.matchers.collections.shouldBeEmpty
|
||||
import io.kotest.matchers.collections.shouldHaveSize
|
||||
import io.kotest.matchers.shouldBe
|
||||
import io.kotest.matchers.nulls.shouldBeNull
|
||||
import io.kotest.matchers.nulls.shouldNotBeNull
|
||||
import kotlin.test.Test
|
||||
|
||||
class ChordProParserTest {
|
||||
|
||||
@Test
|
||||
fun `parse complete song`() {
|
||||
val input = """
|
||||
# This is a comment
|
||||
{title: Wonderwall}
|
||||
{alias: Wonderwall (Oasis)}
|
||||
{lyricist: Noel Gallagher}
|
||||
{composer: Noel Gallagher}
|
||||
{key: F#m}
|
||||
{tags: pop, rock, 90s}
|
||||
{note: Play with capo on 2nd fret}
|
||||
{ref: mundorgel 42}
|
||||
{capo: 2}
|
||||
|
||||
{start_of_verse: Verse 1}
|
||||
[Em7]Today is [G]gonna be the day
|
||||
That they're [Dsus4]gonna throw it back to [A7sus4]you
|
||||
{end_of_verse}
|
||||
|
||||
{start_of_chorus}
|
||||
[C]And all the [D]roads we have to [Em]walk are winding
|
||||
{end_of_chorus}
|
||||
|
||||
{chorus}
|
||||
""".trimIndent()
|
||||
|
||||
val song = ChordProParser.parse(input)
|
||||
|
||||
song.title shouldBe "Wonderwall"
|
||||
song.aliases shouldHaveSize 1
|
||||
song.aliases[0] shouldBe "Wonderwall (Oasis)"
|
||||
song.lyricist shouldBe "Noel Gallagher"
|
||||
song.composer shouldBe "Noel Gallagher"
|
||||
song.key shouldBe "F#m"
|
||||
song.tags shouldBe listOf("pop", "rock", "90s")
|
||||
song.notes shouldHaveSize 1
|
||||
song.notes[0] shouldBe "Play with capo on 2nd fret"
|
||||
song.references shouldBe mapOf("mundorgel" to 42)
|
||||
song.capo shouldBe 2
|
||||
|
||||
song.sections shouldHaveSize 3
|
||||
|
||||
// Verse 1
|
||||
val verse = song.sections[0]
|
||||
verse.type shouldBe SectionType.VERSE
|
||||
verse.label shouldBe "Verse 1"
|
||||
verse.lines shouldHaveSize 2
|
||||
|
||||
// First line of verse
|
||||
val firstLine = verse.lines[0]
|
||||
firstLine.segments shouldHaveSize 2
|
||||
firstLine.segments[0].chord shouldBe "Em7"
|
||||
firstLine.segments[0].text shouldBe "Today is "
|
||||
firstLine.segments[1].chord shouldBe "G"
|
||||
firstLine.segments[1].text shouldBe "gonna be the day"
|
||||
|
||||
// Chorus
|
||||
val chorus = song.sections[1]
|
||||
chorus.type shouldBe SectionType.CHORUS
|
||||
chorus.label.shouldBeNull()
|
||||
chorus.lines shouldHaveSize 1
|
||||
|
||||
// Empty chorus reference
|
||||
val chorusRef = song.sections[2]
|
||||
chorusRef.type shouldBe SectionType.CHORUS
|
||||
chorusRef.lines.shouldBeEmpty()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse title directive`() {
|
||||
val input = "{title: My Song}"
|
||||
val song = ChordProParser.parse(input)
|
||||
song.title shouldBe "My Song"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse short title directive`() {
|
||||
val input = "{t: My Song}"
|
||||
val song = ChordProParser.parse(input)
|
||||
song.title shouldBe "My Song"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse missing title results in empty string`() {
|
||||
val input = """
|
||||
{start_of_verse}
|
||||
Hello world
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.title shouldBe ""
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `comments are skipped`() {
|
||||
val input = """
|
||||
{title: Test}
|
||||
# This is a comment
|
||||
{start_of_verse}
|
||||
Hello world
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.title shouldBe "Test"
|
||||
song.sections shouldHaveSize 1
|
||||
song.sections[0].lines shouldHaveSize 1
|
||||
song.sections[0].lines[0].segments[0].text shouldBe "Hello world"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse chord line with no chords`() {
|
||||
val line = ChordProParser.parseChordLine("Just plain text")
|
||||
line.segments shouldHaveSize 1
|
||||
line.segments[0].chord.shouldBeNull()
|
||||
line.segments[0].text shouldBe "Just plain text"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse chord line starting with chord`() {
|
||||
val line = ChordProParser.parseChordLine("[Am]Hello [C]World")
|
||||
line.segments shouldHaveSize 2
|
||||
line.segments[0].chord shouldBe "Am"
|
||||
line.segments[0].text shouldBe "Hello "
|
||||
line.segments[1].chord shouldBe "C"
|
||||
line.segments[1].text shouldBe "World"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse chord line starting with text`() {
|
||||
val line = ChordProParser.parseChordLine("Hello [Am]World")
|
||||
line.segments shouldHaveSize 2
|
||||
line.segments[0].chord.shouldBeNull()
|
||||
line.segments[0].text shouldBe "Hello "
|
||||
line.segments[1].chord shouldBe "Am"
|
||||
line.segments[1].text shouldBe "World"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse chord line with chord at end`() {
|
||||
val line = ChordProParser.parseChordLine("[Am]Hello [C]")
|
||||
line.segments shouldHaveSize 2
|
||||
line.segments[0].chord shouldBe "Am"
|
||||
line.segments[0].text shouldBe "Hello "
|
||||
line.segments[1].chord shouldBe "C"
|
||||
line.segments[1].text shouldBe ""
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse chord line with only chord`() {
|
||||
val line = ChordProParser.parseChordLine("[Am]")
|
||||
line.segments shouldHaveSize 1
|
||||
line.segments[0].chord shouldBe "Am"
|
||||
line.segments[0].text shouldBe ""
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse multiple aliases`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{alias: Alias One}
|
||||
{alias: Alias Two}
|
||||
{start_of_verse}
|
||||
text
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.aliases shouldBe listOf("Alias One", "Alias Two")
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse reference with multi-word book name`() {
|
||||
val ref = ChordProParser.parseReference("My Big Songbook 123")
|
||||
ref.shouldNotBeNull()
|
||||
ref.first shouldBe "My Big Songbook"
|
||||
ref.second shouldBe 123
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse reference with single word book name`() {
|
||||
val ref = ChordProParser.parseReference("mundorgel 42")
|
||||
ref.shouldNotBeNull()
|
||||
ref.first shouldBe "mundorgel"
|
||||
ref.second shouldBe 42
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse reference with invalid page returns null`() {
|
||||
val ref = ChordProParser.parseReference("mundorgel abc")
|
||||
ref.shouldBeNull()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse reference with only one token returns null`() {
|
||||
val ref = ChordProParser.parseReference("mundorgel")
|
||||
ref.shouldBeNull()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse tags directive`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{tags: folk, german, campfire}
|
||||
{start_of_verse}
|
||||
text
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.tags shouldBe listOf("folk", "german", "campfire")
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse tags with extra whitespace`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{tags: folk , german , campfire }
|
||||
{start_of_verse}
|
||||
text
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.tags shouldBe listOf("folk", "german", "campfire")
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse chorus directive creates empty section`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{start_of_chorus}
|
||||
[C]La la [G]la
|
||||
{end_of_chorus}
|
||||
{chorus}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections shouldHaveSize 2
|
||||
song.sections[0].type shouldBe SectionType.CHORUS
|
||||
song.sections[0].lines shouldHaveSize 1
|
||||
song.sections[1].type shouldBe SectionType.CHORUS
|
||||
song.sections[1].lines.shouldBeEmpty()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse capo directive`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{capo: 3}
|
||||
{start_of_verse}
|
||||
text
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.capo shouldBe 3
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse capo with invalid value results in null`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{capo: abc}
|
||||
{start_of_verse}
|
||||
text
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.capo.shouldBeNull()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse repeat section`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{start_of_repeat: 2x}
|
||||
[Am]La la la
|
||||
{end_of_repeat}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections shouldHaveSize 1
|
||||
song.sections[0].type shouldBe SectionType.REPEAT
|
||||
song.sections[0].label shouldBe "2x"
|
||||
song.sections[0].lines shouldHaveSize 1
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `implicit verse for lines outside sections`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
[Am]Hello [C]World
|
||||
Just text
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections shouldHaveSize 1
|
||||
song.sections[0].type shouldBe SectionType.VERSE
|
||||
song.sections[0].lines shouldHaveSize 2
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `multiple sections parsed correctly`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{start_of_verse: 1}
|
||||
Line one
|
||||
{end_of_verse}
|
||||
{start_of_verse: 2}
|
||||
Line two
|
||||
{end_of_verse}
|
||||
{start_of_chorus}
|
||||
Chorus line
|
||||
{end_of_chorus}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections shouldHaveSize 3
|
||||
song.sections[0].type shouldBe SectionType.VERSE
|
||||
song.sections[0].label shouldBe "1"
|
||||
song.sections[1].type shouldBe SectionType.VERSE
|
||||
song.sections[1].label shouldBe "2"
|
||||
song.sections[2].type shouldBe SectionType.CHORUS
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse multiple notes`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{note: First note}
|
||||
{note: Second note}
|
||||
{start_of_verse}
|
||||
text
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.notes shouldBe listOf("First note", "Second note")
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse multiple references`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{ref: mundorgel 42}
|
||||
{ref: pfadfinderlied 17}
|
||||
{start_of_verse}
|
||||
text
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.references shouldBe mapOf("mundorgel" to 42, "pfadfinderlied" to 17)
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse key directive`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{key: Am}
|
||||
{start_of_verse}
|
||||
text
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.key shouldBe "Am"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `empty input produces song with empty title and no sections`() {
|
||||
val song = ChordProParser.parse("")
|
||||
song.title shouldBe ""
|
||||
song.sections.shouldBeEmpty()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `malformed chord bracket treated as text`() {
|
||||
val line = ChordProParser.parseChordLine("[Am broken text")
|
||||
line.segments shouldHaveSize 1
|
||||
line.segments[0].chord.shouldBeNull()
|
||||
line.segments[0].text shouldBe "[Am broken text"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `repeat directive sets label on current section`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{start_of_verse}
|
||||
Line one
|
||||
{repeat: 3}
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections shouldHaveSize 1
|
||||
song.sections[0].label shouldBe "3"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse short directives sov eov soc eoc`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{sov: V1}
|
||||
Line one
|
||||
{eov}
|
||||
{soc}
|
||||
Chorus
|
||||
{eoc}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections shouldHaveSize 2
|
||||
song.sections[0].type shouldBe SectionType.VERSE
|
||||
song.sections[0].label shouldBe "V1"
|
||||
song.sections[1].type shouldBe SectionType.CHORUS
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse short directives sor eor`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{sor: 2x}
|
||||
Repeat line
|
||||
{eor}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections shouldHaveSize 1
|
||||
song.sections[0].type shouldBe SectionType.REPEAT
|
||||
song.sections[0].label shouldBe "2x"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `section without explicit end is flushed at end of input`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{start_of_verse}
|
||||
Line one
|
||||
Line two
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections shouldHaveSize 1
|
||||
song.sections[0].lines shouldHaveSize 2
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `section flushed when new section starts without end directive`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{start_of_verse: 1}
|
||||
Line one
|
||||
{start_of_verse: 2}
|
||||
Line two
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections shouldHaveSize 2
|
||||
song.sections[0].label shouldBe "1"
|
||||
song.sections[0].lines shouldHaveSize 1
|
||||
song.sections[1].label shouldBe "2"
|
||||
song.sections[1].lines shouldHaveSize 1
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `lyricist and composer directives`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{lyricist: John Doe}
|
||||
{composer: Jane Smith}
|
||||
{start_of_verse}
|
||||
text
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.lyricist shouldBe "John Doe"
|
||||
song.composer shouldBe "Jane Smith"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse consecutive chords with no text between`() {
|
||||
val line = ChordProParser.parseChordLine("[Am][C][G]End")
|
||||
line.segments shouldHaveSize 3
|
||||
line.segments[0].chord shouldBe "Am"
|
||||
line.segments[0].text shouldBe ""
|
||||
line.segments[1].chord shouldBe "C"
|
||||
line.segments[1].text shouldBe ""
|
||||
line.segments[2].chord shouldBe "G"
|
||||
line.segments[2].text shouldBe "End"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse notes block with multiple paragraphs`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{start_of_notes}
|
||||
First paragraph of the notes.
|
||||
It continues on the next line.
|
||||
|
||||
Second paragraph with different content.
|
||||
{end_of_notes}
|
||||
{start_of_verse}
|
||||
text
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.notes shouldHaveSize 2
|
||||
song.notes[0] shouldBe "First paragraph of the notes. It continues on the next line."
|
||||
song.notes[1] shouldBe "Second paragraph with different content."
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse notes block with single paragraph`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{start_of_notes}
|
||||
A single note paragraph.
|
||||
{end_of_notes}
|
||||
{start_of_verse}
|
||||
text
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.notes shouldHaveSize 1
|
||||
song.notes[0] shouldBe "A single note paragraph."
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse notes block with short directives son eon`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{son}
|
||||
Short form notes.
|
||||
{eon}
|
||||
{start_of_verse}
|
||||
text
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.notes shouldHaveSize 1
|
||||
song.notes[0] shouldBe "Short form notes."
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `notes block and single note directives combine`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{note: Single line note}
|
||||
{start_of_notes}
|
||||
Block note paragraph.
|
||||
{end_of_notes}
|
||||
{start_of_verse}
|
||||
text
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.notes shouldHaveSize 2
|
||||
song.notes[0] shouldBe "Single line note"
|
||||
song.notes[1] shouldBe "Block note paragraph."
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse notes block with three paragraphs`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{start_of_notes}
|
||||
Paragraph one.
|
||||
|
||||
Paragraph two.
|
||||
|
||||
Paragraph three.
|
||||
{end_of_notes}
|
||||
{start_of_verse}
|
||||
text
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.notes shouldHaveSize 3
|
||||
song.notes[0] shouldBe "Paragraph one."
|
||||
song.notes[1] shouldBe "Paragraph two."
|
||||
song.notes[2] shouldBe "Paragraph three."
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse image directive within song section`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{start_of_verse}
|
||||
[Am]Hello world
|
||||
{image: images/drawing.png}
|
||||
[C]Goodbye world
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections shouldHaveSize 1
|
||||
song.sections[0].lines shouldHaveSize 3
|
||||
song.sections[0].lines[0].segments[0].chord shouldBe "Am"
|
||||
song.sections[0].lines[1].imagePath shouldBe "images/drawing.png"
|
||||
song.sections[0].lines[1].segments.shouldBeEmpty()
|
||||
song.sections[0].lines[2].segments[0].chord shouldBe "C"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse image directive outside section creates implicit verse`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{image: images/landscape.jpg}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections shouldHaveSize 1
|
||||
song.sections[0].type shouldBe SectionType.VERSE
|
||||
song.sections[0].lines shouldHaveSize 1
|
||||
song.sections[0].lines[0].imagePath shouldBe "images/landscape.jpg"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse multiple image directives`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{start_of_verse}
|
||||
{image: img1.png}
|
||||
Some text
|
||||
{image: img2.png}
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections[0].lines shouldHaveSize 3
|
||||
song.sections[0].lines[0].imagePath shouldBe "img1.png"
|
||||
song.sections[0].lines[0].segments.shouldBeEmpty()
|
||||
song.sections[0].lines[1].imagePath.shouldBeNull()
|
||||
song.sections[0].lines[1].segments[0].text shouldBe "Some text"
|
||||
song.sections[0].lines[2].imagePath shouldBe "img2.png"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `blank line splits implicit verses into separate sections`() {
|
||||
val input = """
|
||||
{title: Am Brunnen vor dem Tore}
|
||||
|
||||
Am [D]Brunnen vor dem Tore
|
||||
Ich [D]träumt in seinem Schatten
|
||||
|
||||
Ich musst auch heute wandern
|
||||
Da hab ich noch im Dunkeln
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections shouldHaveSize 2
|
||||
song.sections[0].type shouldBe SectionType.VERSE
|
||||
song.sections[0].lines shouldHaveSize 2
|
||||
song.sections[0].lines[0].segments shouldHaveSize 2
|
||||
song.sections[0].lines[0].segments[0].chord.shouldBeNull()
|
||||
song.sections[0].lines[0].segments[0].text shouldBe "Am "
|
||||
song.sections[0].lines[0].segments[1].chord shouldBe "D"
|
||||
song.sections[0].lines[0].segments[1].text shouldBe "Brunnen vor dem Tore"
|
||||
song.sections[1].type shouldBe SectionType.VERSE
|
||||
song.sections[1].lines shouldHaveSize 2
|
||||
song.sections[1].lines[0].segments[0].text shouldBe "Ich musst auch heute wandern"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `blank lines within explicit sections are ignored`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{start_of_verse: Verse 1}
|
||||
Line one
|
||||
|
||||
Line two
|
||||
{end_of_verse}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections shouldHaveSize 1
|
||||
song.sections[0].type shouldBe SectionType.VERSE
|
||||
song.sections[0].label shouldBe "Verse 1"
|
||||
song.sections[0].lines shouldHaveSize 2
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `blank lines between metadata do not create empty sections`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
|
||||
{lyricist: Someone}
|
||||
|
||||
{composer: Someone Else}
|
||||
|
||||
[Am]Hello world
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections shouldHaveSize 1
|
||||
song.sections[0].type shouldBe SectionType.VERSE
|
||||
song.sections[0].lines shouldHaveSize 1
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `mixed explicit and implicit sections with blank lines`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{start_of_chorus}
|
||||
[C]Chorus line
|
||||
|
||||
Still in chorus
|
||||
{end_of_chorus}
|
||||
|
||||
Implicit verse one
|
||||
|
||||
Implicit verse two
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections shouldHaveSize 3
|
||||
song.sections[0].type shouldBe SectionType.CHORUS
|
||||
song.sections[0].lines shouldHaveSize 2
|
||||
song.sections[1].type shouldBe SectionType.VERSE
|
||||
song.sections[1].lines shouldHaveSize 1
|
||||
song.sections[1].lines[0].segments[0].text shouldBe "Implicit verse one"
|
||||
song.sections[2].type shouldBe SectionType.VERSE
|
||||
song.sections[2].lines shouldHaveSize 1
|
||||
song.sections[2].lines[0].segments[0].text shouldBe "Implicit verse two"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `multiple blank lines between implicit verses`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
First verse line
|
||||
|
||||
|
||||
Second verse line
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections shouldHaveSize 2
|
||||
song.sections[0].type shouldBe SectionType.VERSE
|
||||
song.sections[0].lines shouldHaveSize 1
|
||||
song.sections[1].type shouldBe SectionType.VERSE
|
||||
song.sections[1].lines shouldHaveSize 1
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `three implicit verses separated by blank lines`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
[Am]Verse one line one
|
||||
Verse one line two
|
||||
|
||||
[C]Verse two line one
|
||||
Verse two line two
|
||||
|
||||
[G]Verse three line one
|
||||
Verse three line two
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections shouldHaveSize 3
|
||||
song.sections.forEach { section ->
|
||||
section.type shouldBe SectionType.VERSE
|
||||
section.lines shouldHaveSize 2
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `blank lines within explicit chorus are ignored`() {
|
||||
val input = """
|
||||
{title: Song}
|
||||
{start_of_chorus}
|
||||
Line one
|
||||
|
||||
Line two
|
||||
|
||||
Line three
|
||||
{end_of_chorus}
|
||||
""".trimIndent()
|
||||
val song = ChordProParser.parse(input)
|
||||
song.sections shouldHaveSize 1
|
||||
song.sections[0].type shouldBe SectionType.CHORUS
|
||||
song.sections[0].lines shouldHaveSize 3
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,271 @@
|
||||
package de.pfadfinder.songbook.parser
|
||||
|
||||
import io.kotest.matchers.collections.shouldHaveSize
|
||||
import io.kotest.matchers.nulls.shouldBeNull
|
||||
import io.kotest.matchers.nulls.shouldNotBeNull
|
||||
import io.kotest.matchers.shouldBe
|
||||
import kotlin.test.Test
|
||||
|
||||
class ConfigParserTest {
|
||||
|
||||
private val sampleYaml = """
|
||||
book:
|
||||
title: "Pfadfinder Liederbuch"
|
||||
subtitle: "Ausgabe 2024"
|
||||
edition: "3. Auflage"
|
||||
format: A5
|
||||
songs:
|
||||
directory: "./songs"
|
||||
order: alphabetical
|
||||
fonts:
|
||||
lyrics: { family: "Garamond", file: "./fonts/Garamond.ttf", size: 10 }
|
||||
chords: { family: "Garamond", file: "./fonts/Garamond-Bold.ttf", size: 9, color: "#333333" }
|
||||
title: { family: "Garamond", file: "./fonts/Garamond-Bold.ttf", size: 14 }
|
||||
metadata: { family: "Garamond", file: "./fonts/Garamond-Italic.ttf", size: 8 }
|
||||
toc: { family: "Garamond", file: "./fonts/Garamond.ttf", size: 9 }
|
||||
layout:
|
||||
margins: { top: 15, bottom: 15, inner: 20, outer: 12 }
|
||||
chord_line_spacing: 3
|
||||
verse_spacing: 4
|
||||
page_number_position: bottom-outer
|
||||
images:
|
||||
directory: "./images"
|
||||
reference_books:
|
||||
- id: mundorgel
|
||||
name: "Mundorgel"
|
||||
abbreviation: "MO"
|
||||
- id: pfadfinderlied
|
||||
name: "Das Pfadfinderlied"
|
||||
abbreviation: "PL"
|
||||
output:
|
||||
directory: "./output"
|
||||
filename: "liederbuch.pdf"
|
||||
""".trimIndent()
|
||||
|
||||
@Test
|
||||
fun `parse full config from yaml string`() {
|
||||
val config = ConfigParser.parse(sampleYaml)
|
||||
|
||||
// Book meta
|
||||
config.book.title shouldBe "Pfadfinder Liederbuch"
|
||||
config.book.subtitle shouldBe "Ausgabe 2024"
|
||||
config.book.edition shouldBe "3. Auflage"
|
||||
config.book.format shouldBe "A5"
|
||||
|
||||
// Songs config
|
||||
config.songs.directory shouldBe "./songs"
|
||||
config.songs.order shouldBe "alphabetical"
|
||||
|
||||
// Fonts
|
||||
config.fonts.lyrics.family shouldBe "Garamond"
|
||||
config.fonts.lyrics.file shouldBe "./fonts/Garamond.ttf"
|
||||
config.fonts.lyrics.size shouldBe 10f
|
||||
config.fonts.lyrics.color shouldBe "#000000" // default
|
||||
|
||||
config.fonts.chords.family shouldBe "Garamond"
|
||||
config.fonts.chords.file shouldBe "./fonts/Garamond-Bold.ttf"
|
||||
config.fonts.chords.size shouldBe 9f
|
||||
config.fonts.chords.color shouldBe "#333333"
|
||||
|
||||
config.fonts.title.family shouldBe "Garamond"
|
||||
config.fonts.title.size shouldBe 14f
|
||||
|
||||
config.fonts.metadata.family shouldBe "Garamond"
|
||||
config.fonts.metadata.size shouldBe 8f
|
||||
|
||||
config.fonts.toc.family shouldBe "Garamond"
|
||||
config.fonts.toc.size shouldBe 9f
|
||||
|
||||
// Layout
|
||||
config.layout.margins.top shouldBe 15f
|
||||
config.layout.margins.bottom shouldBe 15f
|
||||
config.layout.margins.inner shouldBe 20f
|
||||
config.layout.margins.outer shouldBe 12f
|
||||
config.layout.chordLineSpacing shouldBe 3f
|
||||
config.layout.verseSpacing shouldBe 4f
|
||||
config.layout.pageNumberPosition shouldBe "bottom-outer"
|
||||
|
||||
// Images
|
||||
config.images.directory shouldBe "./images"
|
||||
|
||||
// Reference books
|
||||
config.referenceBooks shouldHaveSize 2
|
||||
config.referenceBooks[0].id shouldBe "mundorgel"
|
||||
config.referenceBooks[0].name shouldBe "Mundorgel"
|
||||
config.referenceBooks[0].abbreviation shouldBe "MO"
|
||||
config.referenceBooks[1].id shouldBe "pfadfinderlied"
|
||||
config.referenceBooks[1].name shouldBe "Das Pfadfinderlied"
|
||||
config.referenceBooks[1].abbreviation shouldBe "PL"
|
||||
|
||||
// Output
|
||||
config.output.directory shouldBe "./output"
|
||||
config.output.filename shouldBe "liederbuch.pdf"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse minimal config uses defaults`() {
|
||||
val yaml = """
|
||||
book:
|
||||
title: "Minimal"
|
||||
""".trimIndent()
|
||||
val config = ConfigParser.parse(yaml)
|
||||
|
||||
config.book.title shouldBe "Minimal"
|
||||
config.book.format shouldBe "A5" // default
|
||||
config.songs.directory shouldBe "./songs" // default
|
||||
config.fonts.lyrics.family shouldBe "Helvetica" // default
|
||||
config.layout.margins.top shouldBe 15f // default
|
||||
config.output.filename shouldBe "liederbuch.pdf" // default
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse config with only book section`() {
|
||||
val yaml = """
|
||||
book:
|
||||
title: "Test"
|
||||
subtitle: "Sub"
|
||||
""".trimIndent()
|
||||
val config = ConfigParser.parse(yaml)
|
||||
config.book.title shouldBe "Test"
|
||||
config.book.subtitle shouldBe "Sub"
|
||||
config.book.edition shouldBe null
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse config with reference books`() {
|
||||
val yaml = """
|
||||
book:
|
||||
title: "Test"
|
||||
reference_books:
|
||||
- id: mo
|
||||
name: "Mundorgel"
|
||||
abbreviation: "MO"
|
||||
""".trimIndent()
|
||||
val config = ConfigParser.parse(yaml)
|
||||
config.referenceBooks shouldHaveSize 1
|
||||
config.referenceBooks[0].id shouldBe "mo"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse config with custom layout margins`() {
|
||||
val yaml = """
|
||||
book:
|
||||
title: "Test"
|
||||
layout:
|
||||
margins:
|
||||
top: 25
|
||||
bottom: 20
|
||||
inner: 30
|
||||
outer: 15
|
||||
chord_line_spacing: 5
|
||||
verse_spacing: 6
|
||||
""".trimIndent()
|
||||
val config = ConfigParser.parse(yaml)
|
||||
config.layout.margins.top shouldBe 25f
|
||||
config.layout.margins.bottom shouldBe 20f
|
||||
config.layout.margins.inner shouldBe 30f
|
||||
config.layout.margins.outer shouldBe 15f
|
||||
config.layout.chordLineSpacing shouldBe 5f
|
||||
config.layout.verseSpacing shouldBe 6f
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse config with foreword section`() {
|
||||
val yaml = """
|
||||
book:
|
||||
title: "Test"
|
||||
foreword:
|
||||
file: "./vorwort.txt"
|
||||
""".trimIndent()
|
||||
val config = ConfigParser.parse(yaml)
|
||||
config.foreword.shouldNotBeNull()
|
||||
config.foreword!!.file shouldBe "./vorwort.txt"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse config without foreword section has null foreword`() {
|
||||
val yaml = """
|
||||
book:
|
||||
title: "Test"
|
||||
""".trimIndent()
|
||||
val config = ConfigParser.parse(yaml)
|
||||
config.foreword.shouldBeNull()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse config with toc highlight column`() {
|
||||
val yaml = """
|
||||
book:
|
||||
title: "Test"
|
||||
toc:
|
||||
highlight_column: "CL"
|
||||
""".trimIndent()
|
||||
val config = ConfigParser.parse(yaml)
|
||||
config.toc.highlightColumn shouldBe "CL"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse config without toc section uses defaults`() {
|
||||
val yaml = """
|
||||
book:
|
||||
title: "Test"
|
||||
""".trimIndent()
|
||||
val config = ConfigParser.parse(yaml)
|
||||
config.toc.highlightColumn.shouldBeNull()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse config with german metadata labels`() {
|
||||
val yaml = """
|
||||
book:
|
||||
title: "Test"
|
||||
layout:
|
||||
metadata_labels: german
|
||||
metadata_position: bottom
|
||||
""".trimIndent()
|
||||
val config = ConfigParser.parse(yaml)
|
||||
config.layout.metadataLabels shouldBe "german"
|
||||
config.layout.metadataPosition shouldBe "bottom"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse config with default metadata settings`() {
|
||||
val yaml = """
|
||||
book:
|
||||
title: "Test"
|
||||
""".trimIndent()
|
||||
val config = ConfigParser.parse(yaml)
|
||||
config.layout.metadataLabels shouldBe "abbreviated"
|
||||
config.layout.metadataPosition shouldBe "top"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse config ignores unknown properties`() {
|
||||
val yaml = """
|
||||
book:
|
||||
title: "Test"
|
||||
unknown_field: "value"
|
||||
some_extra_section:
|
||||
key: value
|
||||
""".trimIndent()
|
||||
val config = ConfigParser.parse(yaml)
|
||||
config.book.title shouldBe "Test"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse config with custom title font file only`() {
|
||||
val yaml = """
|
||||
book:
|
||||
title: "Fraktur Test"
|
||||
fonts:
|
||||
title: { file: "./fonts/Fraktur.ttf", size: 16 }
|
||||
""".trimIndent()
|
||||
val config = ConfigParser.parse(yaml)
|
||||
config.fonts.title.file shouldBe "./fonts/Fraktur.ttf"
|
||||
config.fonts.title.size shouldBe 16f
|
||||
config.fonts.title.family shouldBe "Helvetica" // default family as fallback
|
||||
// Other fonts should still use defaults
|
||||
config.fonts.lyrics.file.shouldBeNull()
|
||||
config.fonts.lyrics.family shouldBe "Helvetica"
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,150 @@
|
||||
package de.pfadfinder.songbook.parser
|
||||
|
||||
import io.kotest.matchers.collections.shouldBeEmpty
|
||||
import io.kotest.matchers.collections.shouldHaveSize
|
||||
import io.kotest.matchers.nulls.shouldBeNull
|
||||
import io.kotest.matchers.nulls.shouldNotBeNull
|
||||
import io.kotest.matchers.shouldBe
|
||||
import kotlin.test.Test
|
||||
|
||||
class ForewordParserTest {
|
||||
|
||||
@Test
|
||||
fun `parse foreword with quote, paragraphs and signatures`() {
|
||||
val input = """
|
||||
> This is a quote line one
|
||||
> and quote line two
|
||||
---
|
||||
This is the first paragraph of the foreword body.
|
||||
It continues on the next line.
|
||||
|
||||
This is the second paragraph.
|
||||
|
||||
-- Max Mustermann
|
||||
-- Erika Mustermann
|
||||
""".trimIndent()
|
||||
|
||||
val foreword = ForewordParser.parse(input)
|
||||
|
||||
foreword.quote.shouldNotBeNull()
|
||||
foreword.quote shouldBe "This is a quote line one and quote line two"
|
||||
foreword.paragraphs shouldHaveSize 2
|
||||
foreword.paragraphs[0] shouldBe "This is the first paragraph of the foreword body. It continues on the next line."
|
||||
foreword.paragraphs[1] shouldBe "This is the second paragraph."
|
||||
foreword.signatures shouldHaveSize 2
|
||||
foreword.signatures[0] shouldBe "Max Mustermann"
|
||||
foreword.signatures[1] shouldBe "Erika Mustermann"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse foreword without quote`() {
|
||||
val input = """
|
||||
This is just a paragraph.
|
||||
|
||||
And another one.
|
||||
|
||||
-- Author Name
|
||||
""".trimIndent()
|
||||
|
||||
val foreword = ForewordParser.parse(input)
|
||||
|
||||
foreword.quote.shouldBeNull()
|
||||
foreword.paragraphs shouldHaveSize 2
|
||||
foreword.paragraphs[0] shouldBe "This is just a paragraph."
|
||||
foreword.paragraphs[1] shouldBe "And another one."
|
||||
foreword.signatures shouldHaveSize 1
|
||||
foreword.signatures[0] shouldBe "Author Name"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse foreword without signatures`() {
|
||||
val input = """
|
||||
> A beautiful quote
|
||||
---
|
||||
The foreword body text goes here.
|
||||
""".trimIndent()
|
||||
|
||||
val foreword = ForewordParser.parse(input)
|
||||
|
||||
foreword.quote shouldBe "A beautiful quote"
|
||||
foreword.paragraphs shouldHaveSize 1
|
||||
foreword.paragraphs[0] shouldBe "The foreword body text goes here."
|
||||
foreword.signatures.shouldBeEmpty()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse empty foreword`() {
|
||||
val foreword = ForewordParser.parse("")
|
||||
|
||||
foreword.quote.shouldBeNull()
|
||||
foreword.paragraphs.shouldBeEmpty()
|
||||
foreword.signatures.shouldBeEmpty()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse foreword with only paragraphs`() {
|
||||
val input = """
|
||||
First paragraph.
|
||||
|
||||
Second paragraph.
|
||||
|
||||
Third paragraph.
|
||||
""".trimIndent()
|
||||
|
||||
val foreword = ForewordParser.parse(input)
|
||||
|
||||
foreword.quote.shouldBeNull()
|
||||
foreword.paragraphs shouldHaveSize 3
|
||||
foreword.paragraphs[0] shouldBe "First paragraph."
|
||||
foreword.paragraphs[1] shouldBe "Second paragraph."
|
||||
foreword.paragraphs[2] shouldBe "Third paragraph."
|
||||
foreword.signatures.shouldBeEmpty()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse foreword with multi-line paragraph`() {
|
||||
val input = """
|
||||
This is a long paragraph that
|
||||
spans multiple lines and should
|
||||
be joined into a single paragraph.
|
||||
""".trimIndent()
|
||||
|
||||
val foreword = ForewordParser.parse(input)
|
||||
|
||||
foreword.paragraphs shouldHaveSize 1
|
||||
foreword.paragraphs[0] shouldBe "This is a long paragraph that spans multiple lines and should be joined into a single paragraph."
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse foreword with only a quote`() {
|
||||
val input = """
|
||||
> Just a quote
|
||||
---
|
||||
""".trimIndent()
|
||||
|
||||
val foreword = ForewordParser.parse(input)
|
||||
|
||||
foreword.quote shouldBe "Just a quote"
|
||||
foreword.paragraphs.shouldBeEmpty()
|
||||
foreword.signatures.shouldBeEmpty()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `parse foreword with multiple signatures`() {
|
||||
val input = """
|
||||
Some text here.
|
||||
|
||||
-- Person One
|
||||
-- Person Two
|
||||
-- Person Three
|
||||
""".trimIndent()
|
||||
|
||||
val foreword = ForewordParser.parse(input)
|
||||
|
||||
foreword.paragraphs shouldHaveSize 1
|
||||
foreword.signatures shouldHaveSize 3
|
||||
foreword.signatures[0] shouldBe "Person One"
|
||||
foreword.signatures[1] shouldBe "Person Two"
|
||||
foreword.signatures[2] shouldBe "Person Three"
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,258 @@
|
||||
package de.pfadfinder.songbook.parser
|
||||
|
||||
import de.pfadfinder.songbook.model.*
|
||||
import io.kotest.matchers.collections.shouldBeEmpty
|
||||
import io.kotest.matchers.collections.shouldHaveSize
|
||||
import io.kotest.matchers.string.shouldContain
|
||||
import kotlin.test.Test
|
||||
|
||||
class ValidatorTest {
|
||||
|
||||
@Test
|
||||
fun `valid song produces no errors`() {
|
||||
val song = Song(
|
||||
title = "Test Song",
|
||||
sections = listOf(
|
||||
SongSection(type = SectionType.VERSE, lines = listOf(
|
||||
SongLine(segments = listOf(LineSegment(text = "Hello")))
|
||||
))
|
||||
)
|
||||
)
|
||||
val errors = Validator.validateSong(song)
|
||||
errors.shouldBeEmpty()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `missing title produces error`() {
|
||||
val song = Song(
|
||||
title = "",
|
||||
sections = listOf(
|
||||
SongSection(type = SectionType.VERSE, lines = listOf(
|
||||
SongLine(segments = listOf(LineSegment(text = "Hello")))
|
||||
))
|
||||
)
|
||||
)
|
||||
val errors = Validator.validateSong(song)
|
||||
errors shouldHaveSize 1
|
||||
errors[0].message shouldContain "title"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `blank title produces error`() {
|
||||
val song = Song(
|
||||
title = " ",
|
||||
sections = listOf(
|
||||
SongSection(type = SectionType.VERSE, lines = listOf(
|
||||
SongLine(segments = listOf(LineSegment(text = "Hello")))
|
||||
))
|
||||
)
|
||||
)
|
||||
val errors = Validator.validateSong(song)
|
||||
errors shouldHaveSize 1
|
||||
errors[0].message shouldContain "title"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `empty sections produces error`() {
|
||||
val song = Song(
|
||||
title = "Test",
|
||||
sections = emptyList()
|
||||
)
|
||||
val errors = Validator.validateSong(song)
|
||||
errors shouldHaveSize 1
|
||||
errors[0].message shouldContain "section"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `missing title and empty sections produces two errors`() {
|
||||
val song = Song(title = "", sections = emptyList())
|
||||
val errors = Validator.validateSong(song)
|
||||
errors shouldHaveSize 2
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `fileName is included in error`() {
|
||||
val song = Song(title = "", sections = emptyList())
|
||||
val errors = Validator.validateSong(song, "test.chopro")
|
||||
errors.forEach { it.file shouldContain "test.chopro" }
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `valid song with known references produces no errors`() {
|
||||
val config = BookConfig(
|
||||
referenceBooks = listOf(
|
||||
ReferenceBook(id = "mundorgel", name = "Mundorgel", abbreviation = "MO")
|
||||
)
|
||||
)
|
||||
val song = Song(
|
||||
title = "Test",
|
||||
references = mapOf("mundorgel" to 42),
|
||||
sections = listOf(
|
||||
SongSection(type = SectionType.VERSE, lines = listOf(
|
||||
SongLine(segments = listOf(LineSegment(text = "Hello")))
|
||||
))
|
||||
)
|
||||
)
|
||||
val errors = Validator.validateSong(song, config)
|
||||
errors.shouldBeEmpty()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `unknown reference book produces error`() {
|
||||
val config = BookConfig(
|
||||
referenceBooks = listOf(
|
||||
ReferenceBook(id = "mundorgel", name = "Mundorgel", abbreviation = "MO")
|
||||
)
|
||||
)
|
||||
val song = Song(
|
||||
title = "Test",
|
||||
references = mapOf("unknown_book" to 42),
|
||||
sections = listOf(
|
||||
SongSection(type = SectionType.VERSE, lines = listOf(
|
||||
SongLine(segments = listOf(LineSegment(text = "Hello")))
|
||||
))
|
||||
)
|
||||
)
|
||||
val errors = Validator.validateSong(song, config)
|
||||
errors shouldHaveSize 1
|
||||
errors[0].message shouldContain "unknown_book"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `multiple unknown references produce multiple errors`() {
|
||||
val config = BookConfig(referenceBooks = emptyList())
|
||||
val song = Song(
|
||||
title = "Test",
|
||||
references = mapOf("book1" to 1, "book2" to 2),
|
||||
sections = listOf(
|
||||
SongSection(type = SectionType.VERSE, lines = listOf(
|
||||
SongLine(segments = listOf(LineSegment(text = "Hello")))
|
||||
))
|
||||
)
|
||||
)
|
||||
val errors = Validator.validateSong(song, config)
|
||||
errors shouldHaveSize 2
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `valid config produces no errors`() {
|
||||
val config = BookConfig()
|
||||
val errors = Validator.validateConfig(config)
|
||||
errors.shouldBeEmpty()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `zero top margin produces error`() {
|
||||
val config = BookConfig(
|
||||
layout = LayoutConfig(margins = Margins(top = 0f))
|
||||
)
|
||||
val errors = Validator.validateConfig(config)
|
||||
errors shouldHaveSize 1
|
||||
errors[0].message shouldContain "Top margin"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `negative bottom margin produces error`() {
|
||||
val config = BookConfig(
|
||||
layout = LayoutConfig(margins = Margins(bottom = -5f))
|
||||
)
|
||||
val errors = Validator.validateConfig(config)
|
||||
errors shouldHaveSize 1
|
||||
errors[0].message shouldContain "Bottom margin"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `negative inner margin produces error`() {
|
||||
val config = BookConfig(
|
||||
layout = LayoutConfig(margins = Margins(inner = -1f))
|
||||
)
|
||||
val errors = Validator.validateConfig(config)
|
||||
errors shouldHaveSize 1
|
||||
errors[0].message shouldContain "Inner margin"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `zero outer margin produces error`() {
|
||||
val config = BookConfig(
|
||||
layout = LayoutConfig(margins = Margins(outer = 0f))
|
||||
)
|
||||
val errors = Validator.validateConfig(config)
|
||||
errors shouldHaveSize 1
|
||||
errors[0].message shouldContain "Outer margin"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `all margins zero produces four errors`() {
|
||||
val config = BookConfig(
|
||||
layout = LayoutConfig(margins = Margins(top = 0f, bottom = 0f, inner = 0f, outer = 0f))
|
||||
)
|
||||
val errors = Validator.validateConfig(config)
|
||||
errors shouldHaveSize 4
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `unknown reference with fileName in error`() {
|
||||
val config = BookConfig(referenceBooks = emptyList())
|
||||
val song = Song(
|
||||
title = "Test",
|
||||
references = mapOf("book1" to 1),
|
||||
sections = listOf(
|
||||
SongSection(type = SectionType.VERSE, lines = listOf(
|
||||
SongLine(segments = listOf(LineSegment(text = "Hello")))
|
||||
))
|
||||
)
|
||||
)
|
||||
val errors = Validator.validateSong(song, config, "myfile.chopro")
|
||||
errors shouldHaveSize 1
|
||||
errors[0].file shouldContain "myfile.chopro"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `missing font file produces validation error`() {
|
||||
val config = BookConfig(
|
||||
fonts = FontsConfig(
|
||||
title = FontSpec(file = "/nonexistent/path/FrakturFont.ttf", size = 14f)
|
||||
)
|
||||
)
|
||||
val errors = Validator.validateConfig(config)
|
||||
errors shouldHaveSize 1
|
||||
errors[0].message shouldContain "title"
|
||||
errors[0].message shouldContain "not found"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `multiple missing font files produce multiple errors`() {
|
||||
val config = BookConfig(
|
||||
fonts = FontsConfig(
|
||||
title = FontSpec(file = "/nonexistent/title.ttf", size = 14f),
|
||||
lyrics = FontSpec(file = "/nonexistent/lyrics.ttf", size = 10f)
|
||||
)
|
||||
)
|
||||
val errors = Validator.validateConfig(config)
|
||||
errors shouldHaveSize 2
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `config with no font files produces no font errors`() {
|
||||
val config = BookConfig() // all default built-in fonts
|
||||
val errors = Validator.validateConfig(config)
|
||||
errors.shouldBeEmpty()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `config with existing font file produces no error`() {
|
||||
// Create a temporary file to simulate an existing font file
|
||||
val tempFile = kotlin.io.path.createTempFile(suffix = ".ttf").toFile()
|
||||
try {
|
||||
val config = BookConfig(
|
||||
fonts = FontsConfig(
|
||||
title = FontSpec(file = tempFile.absolutePath, size = 14f)
|
||||
)
|
||||
)
|
||||
val errors = Validator.validateConfig(config)
|
||||
errors.shouldBeEmpty()
|
||||
} finally {
|
||||
tempFile.delete()
|
||||
}
|
||||
}
|
||||
}
|
||||
11
renderer-pdf/build.gradle.kts
Normal file
11
renderer-pdf/build.gradle.kts
Normal file
@@ -0,0 +1,11 @@
|
||||
plugins {
|
||||
id("songbook-conventions")
|
||||
}
|
||||
|
||||
dependencies {
|
||||
implementation(project(":model"))
|
||||
implementation("com.github.librepdf:openpdf:2.0.3")
|
||||
|
||||
testImplementation(kotlin("test"))
|
||||
testImplementation("io.kotest:kotest-assertions-core:5.9.1")
|
||||
}
|
||||
@@ -0,0 +1,70 @@
|
||||
package de.pfadfinder.songbook.renderer.pdf
|
||||
|
||||
import com.lowagie.text.pdf.PdfContentByte
|
||||
import de.pfadfinder.songbook.model.*
|
||||
import java.awt.Color
|
||||
|
||||
class ChordLyricRenderer(
|
||||
private val fontMetrics: PdfFontMetrics,
|
||||
private val config: BookConfig
|
||||
) {
|
||||
// Renders a single SongLine (chord line above + lyric line below)
|
||||
// Returns the total height consumed in PDF points
|
||||
fun renderLine(
|
||||
cb: PdfContentByte,
|
||||
line: SongLine,
|
||||
x: Float, // left x position in points
|
||||
y: Float, // top y position in points (PDF coordinates, y goes up)
|
||||
maxWidth: Float // available width in points
|
||||
): Float {
|
||||
val hasChords = line.segments.any { it.chord != null }
|
||||
val chordFont = fontMetrics.getBaseFontBold(config.fonts.chords)
|
||||
val lyricFont = fontMetrics.getBaseFont(config.fonts.lyrics)
|
||||
val chordSize = config.fonts.chords.size
|
||||
val lyricSize = config.fonts.lyrics.size
|
||||
val chordLineHeight = chordSize * 1.2f
|
||||
val lyricLineHeight = lyricSize * 1.2f
|
||||
val chordLyricGap = config.layout.chordLineSpacing / 0.3528f // mm to points
|
||||
|
||||
var totalHeight = lyricLineHeight
|
||||
if (hasChords) {
|
||||
totalHeight += chordLineHeight + chordLyricGap
|
||||
}
|
||||
|
||||
val chordColor = parseColor(config.fonts.chords.color)
|
||||
|
||||
// Calculate x positions for each segment
|
||||
var currentX = x
|
||||
for (segment in line.segments) {
|
||||
if (hasChords && segment.chord != null) {
|
||||
// Draw chord above
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(chordFont, chordSize)
|
||||
cb.setColorFill(chordColor)
|
||||
cb.setTextMatrix(currentX, y - chordLineHeight)
|
||||
cb.showText(segment.chord)
|
||||
cb.endText()
|
||||
}
|
||||
|
||||
// Draw lyric text
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(lyricFont, lyricSize)
|
||||
cb.setColorFill(Color.BLACK)
|
||||
cb.setTextMatrix(currentX, y - totalHeight)
|
||||
cb.showText(segment.text)
|
||||
cb.endText()
|
||||
|
||||
currentX += lyricFont.getWidthPoint(segment.text, lyricSize)
|
||||
}
|
||||
|
||||
return totalHeight
|
||||
}
|
||||
|
||||
private fun parseColor(hex: String): Color {
|
||||
val clean = hex.removePrefix("#")
|
||||
val r = clean.substring(0, 2).toInt(16)
|
||||
val g = clean.substring(2, 4).toInt(16)
|
||||
val b = clean.substring(4, 6).toInt(16)
|
||||
return Color(r, g, b)
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,37 @@
|
||||
package de.pfadfinder.songbook.renderer.pdf
|
||||
|
||||
import com.lowagie.text.pdf.PdfContentByte
|
||||
import de.pfadfinder.songbook.model.BookConfig
|
||||
import java.awt.Color
|
||||
|
||||
class PageDecorator(
|
||||
private val fontMetrics: PdfFontMetrics,
|
||||
private val config: BookConfig
|
||||
) {
|
||||
fun addPageNumber(cb: PdfContentByte, pageNumber: Int, pageWidth: Float, pageHeight: Float) {
|
||||
val font = fontMetrics.getBaseFont(config.fonts.metadata)
|
||||
val fontSize = config.fonts.metadata.size
|
||||
val text = pageNumber.toString()
|
||||
val textWidth = font.getWidthPoint(text, fontSize)
|
||||
|
||||
val marginBottom = config.layout.margins.bottom / 0.3528f // mm to points
|
||||
val marginOuter = config.layout.margins.outer / 0.3528f
|
||||
|
||||
val y = marginBottom / 2 // center in bottom margin
|
||||
|
||||
// Outer position: even pages -> left, odd pages -> right (for book binding)
|
||||
val isRightPage = pageNumber % 2 == 1
|
||||
val x = if (isRightPage) {
|
||||
pageWidth - marginOuter / 2 - textWidth / 2
|
||||
} else {
|
||||
marginOuter / 2 - textWidth / 2
|
||||
}
|
||||
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(font, fontSize)
|
||||
cb.setColorFill(Color.DARK_GRAY)
|
||||
cb.setTextMatrix(x, y)
|
||||
cb.showText(text)
|
||||
cb.endText()
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,813 @@
|
||||
package de.pfadfinder.songbook.renderer.pdf
|
||||
|
||||
import com.lowagie.text.*
|
||||
import com.lowagie.text.pdf.*
|
||||
import de.pfadfinder.songbook.model.*
|
||||
import java.awt.Color
|
||||
import java.io.OutputStream
|
||||
|
||||
class PdfBookRenderer : BookRenderer {
|
||||
override fun render(layout: LayoutResult, config: BookConfig, output: OutputStream) {
|
||||
val fontMetrics = PdfFontMetrics()
|
||||
val chordLyricRenderer = ChordLyricRenderer(fontMetrics, config)
|
||||
val tocRenderer = TocRenderer(fontMetrics, config)
|
||||
val pageDecorator = PageDecorator(fontMetrics, config)
|
||||
|
||||
// A5 page size in points: 148mm x 210mm -> 419.53 x 595.28 points
|
||||
val pageSize = if (config.book.format == "A5") PageSize.A5 else PageSize.A4
|
||||
|
||||
val marginInner = config.layout.margins.inner / 0.3528f
|
||||
val marginOuter = config.layout.margins.outer / 0.3528f
|
||||
val marginTop = config.layout.margins.top / 0.3528f
|
||||
val marginBottom = config.layout.margins.bottom / 0.3528f
|
||||
|
||||
// Start with right-page margins (page 1 is right/odd page)
|
||||
val document = Document(pageSize, marginInner, marginOuter, marginTop, marginBottom)
|
||||
val writer = PdfWriter.getInstance(document, output)
|
||||
document.open()
|
||||
|
||||
// Render intro page (title page) if configured
|
||||
if (layout.introPages > 0) {
|
||||
val cb = writer.directContent
|
||||
renderIntroPage(cb, fontMetrics, config, pageSize)
|
||||
// Blank back of intro page (for double-sided printing)
|
||||
document.newPage()
|
||||
writer.directContent.let { c -> c.beginText(); c.endText() }
|
||||
document.newPage()
|
||||
}
|
||||
|
||||
// Render TOC
|
||||
if (layout.tocEntries.isNotEmpty()) {
|
||||
tocRenderer.render(document, writer, layout.tocEntries)
|
||||
// Pad with blank pages to fill the allocated TOC page count.
|
||||
// The table auto-paginates, so we only add the difference.
|
||||
val tocPagesUsed = writer.pageNumber - layout.introPages
|
||||
val paddingNeeded = maxOf(0, layout.tocPages - tocPagesUsed)
|
||||
repeat(paddingNeeded) {
|
||||
document.newPage()
|
||||
// Force new page even if empty
|
||||
writer.directContent.let { cb ->
|
||||
cb.beginText()
|
||||
cb.endText()
|
||||
}
|
||||
}
|
||||
document.newPage()
|
||||
}
|
||||
|
||||
// Render content pages
|
||||
var currentPageNum = layout.introPages + layout.tocPages + 1
|
||||
for (pageContent in layout.pages) {
|
||||
// Swap margins for left/right pages
|
||||
val isRightPage = currentPageNum % 2 == 1
|
||||
if (isRightPage) {
|
||||
document.setMargins(marginInner, marginOuter, marginTop, marginBottom)
|
||||
} else {
|
||||
document.setMargins(marginOuter, marginInner, marginTop, marginBottom)
|
||||
}
|
||||
document.newPage()
|
||||
|
||||
val cb = writer.directContent
|
||||
val contentWidth = pageSize.width - marginInner - marginOuter
|
||||
val contentTop = pageSize.height - marginTop
|
||||
|
||||
when (pageContent) {
|
||||
is PageContent.SongPage -> {
|
||||
val leftMargin = if (isRightPage) marginInner else marginOuter
|
||||
renderSongPage(
|
||||
cb, chordLyricRenderer, fontMetrics, config,
|
||||
pageContent.song, pageContent.pageIndex,
|
||||
contentTop, leftMargin, contentWidth, marginBottom
|
||||
)
|
||||
}
|
||||
is PageContent.FillerImage -> {
|
||||
renderFillerImage(document, pageContent.imagePath, pageSize)
|
||||
}
|
||||
is PageContent.BlankPage -> {
|
||||
// Empty page - just add invisible content to force page creation
|
||||
cb.beginText()
|
||||
cb.endText()
|
||||
}
|
||||
is PageContent.ForewordPage -> {
|
||||
val leftMargin = if (isRightPage) marginInner else marginOuter
|
||||
renderForewordPage(
|
||||
cb, fontMetrics, config,
|
||||
pageContent.foreword, pageContent.pageIndex,
|
||||
contentTop, leftMargin, contentWidth
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
pageDecorator.addPageNumber(cb, currentPageNum, pageSize.width, pageSize.height)
|
||||
currentPageNum++
|
||||
}
|
||||
|
||||
document.close()
|
||||
}
|
||||
|
||||
/**
|
||||
* Computes the index of the first section that should be rendered on page 1.
|
||||
* All sections before this index render on page 0; sections from this index
|
||||
* onward render on page 1.
|
||||
*
|
||||
* If all sections fit on page 0, returns song.sections.size (i.e., nothing on page 1).
|
||||
*/
|
||||
private fun computeSplitIndex(
|
||||
song: Song,
|
||||
fontMetrics: PdfFontMetrics,
|
||||
config: BookConfig,
|
||||
contentWidth: Float,
|
||||
availableHeightOnPage0: Float
|
||||
): Int {
|
||||
var consumed = 0f
|
||||
|
||||
// Header: title
|
||||
consumed += config.fonts.title.size * 1.5f
|
||||
|
||||
// Top metadata
|
||||
val renderMetaAtBottom = config.layout.metadataPosition == "bottom"
|
||||
if (!renderMetaAtBottom) {
|
||||
val metaParts = buildMetadataLines(song, config)
|
||||
if (metaParts.isNotEmpty()) {
|
||||
consumed += config.fonts.metadata.size * 1.8f * metaParts.size
|
||||
}
|
||||
}
|
||||
|
||||
// Key/capo
|
||||
if (song.key != null || song.capo != null) {
|
||||
consumed += config.fonts.metadata.size * 1.8f
|
||||
}
|
||||
|
||||
consumed += 4f // gap before sections
|
||||
|
||||
for ((index, section) in song.sections.withIndex()) {
|
||||
val sectionHeight = calculateSectionHeight(section, fontMetrics, config, contentWidth)
|
||||
if (consumed + sectionHeight > availableHeightOnPage0) {
|
||||
// This section doesn't fit on page 0
|
||||
return index
|
||||
}
|
||||
consumed += sectionHeight
|
||||
// Add verse spacing
|
||||
consumed += config.layout.verseSpacing / 0.3528f
|
||||
}
|
||||
|
||||
return song.sections.size
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculates the height in PDF points that a section will consume when rendered.
|
||||
*/
|
||||
private fun calculateSectionHeight(
|
||||
section: SongSection,
|
||||
fontMetrics: PdfFontMetrics,
|
||||
config: BookConfig,
|
||||
contentWidth: Float
|
||||
): Float {
|
||||
var height = 0f
|
||||
val metaSize = config.fonts.metadata.size
|
||||
|
||||
// Section label
|
||||
if (section.label != null || section.type == SectionType.CHORUS) {
|
||||
val labelText = section.label ?: when (section.type) {
|
||||
SectionType.CHORUS -> "Refrain"
|
||||
SectionType.REPEAT -> "Wiederholung"
|
||||
else -> null
|
||||
}
|
||||
if (labelText != null) {
|
||||
height += metaSize * 1.5f
|
||||
}
|
||||
}
|
||||
|
||||
// Empty chorus (reference)
|
||||
if (section.type == SectionType.CHORUS && section.lines.isEmpty()) {
|
||||
height += metaSize * 1.8f
|
||||
return height
|
||||
}
|
||||
|
||||
// Repeat start marker (contributes no extra height - drawn at current y)
|
||||
// Lines
|
||||
val chordSize = config.fonts.chords.size
|
||||
val lyricSize = config.fonts.lyrics.size
|
||||
val chordLineHeight = chordSize * 1.2f
|
||||
val lyricLineHeight = lyricSize * 1.2f
|
||||
val chordLyricGap = config.layout.chordLineSpacing / 0.3528f
|
||||
|
||||
for (line in section.lines) {
|
||||
if (line.imagePath != null) {
|
||||
// Inline image: 40mm max height + gaps
|
||||
val maxImageHeight = 40f / 0.3528f
|
||||
height += maxImageHeight + 6f
|
||||
} else {
|
||||
val hasChords = line.segments.any { it.chord != null }
|
||||
var lineHeight = lyricLineHeight
|
||||
if (hasChords) {
|
||||
lineHeight += chordLineHeight + chordLyricGap
|
||||
}
|
||||
height += lineHeight + 1f // 1pt gap between lines
|
||||
}
|
||||
}
|
||||
|
||||
// Repeat end marker
|
||||
if (section.type == SectionType.REPEAT) {
|
||||
height += metaSize * 1.5f
|
||||
}
|
||||
|
||||
return height
|
||||
}
|
||||
|
||||
/**
|
||||
* Calculates the space (in PDF points) that must be reserved at the bottom of
|
||||
* the last page of a song for notes, bottom-position metadata, and reference footer.
|
||||
*/
|
||||
private fun calculateFooterReservation(
|
||||
song: Song,
|
||||
fontMetrics: PdfFontMetrics,
|
||||
config: BookConfig,
|
||||
contentWidth: Float
|
||||
): Float {
|
||||
var reserved = 0f
|
||||
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
|
||||
val metaSize = config.fonts.metadata.size
|
||||
|
||||
// Notes
|
||||
if (song.notes.isNotEmpty()) {
|
||||
reserved += 4f // gap before notes
|
||||
val noteLineHeight = metaSize * 1.5f
|
||||
for ((idx, note) in song.notes.withIndex()) {
|
||||
val wrappedLines = wrapText(note, metaFont, metaSize, contentWidth)
|
||||
reserved += noteLineHeight * wrappedLines.size
|
||||
if (idx < song.notes.size - 1) {
|
||||
reserved += noteLineHeight * 0.3f
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Bottom metadata
|
||||
if (config.layout.metadataPosition == "bottom") {
|
||||
val metaParts = buildMetadataLines(song, config)
|
||||
if (metaParts.isNotEmpty()) {
|
||||
reserved += 4f
|
||||
for (metaLine in metaParts) {
|
||||
val wrappedLines = wrapText(metaLine, metaFont, metaSize, contentWidth)
|
||||
reserved += metaSize * 1.5f * wrappedLines.size
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Reference footer: gap + separator line + abbreviation row + page number row
|
||||
if (config.referenceBooks.isNotEmpty() && song.references.isNotEmpty()) {
|
||||
val lineHeight = metaSize * 1.4f
|
||||
reserved += 4f // gap before footer
|
||||
reserved += lineHeight * 2 // two rows (headers + numbers)
|
||||
}
|
||||
|
||||
return reserved
|
||||
}
|
||||
|
||||
private fun renderSongPage(
|
||||
cb: PdfContentByte,
|
||||
chordLyricRenderer: ChordLyricRenderer,
|
||||
fontMetrics: PdfFontMetrics,
|
||||
config: BookConfig,
|
||||
song: Song,
|
||||
pageIndex: Int, // 0 for first page, 1 for second page of 2-page songs
|
||||
contentTop: Float,
|
||||
leftMargin: Float,
|
||||
contentWidth: Float,
|
||||
bottomMargin: Float
|
||||
) {
|
||||
var y = contentTop
|
||||
|
||||
val renderMetaAtBottom = config.layout.metadataPosition == "bottom"
|
||||
|
||||
// Calculate the footer reservation for the last page
|
||||
val footerReservation = calculateFooterReservation(song, fontMetrics, config, contentWidth)
|
||||
|
||||
// Compute the split index to determine which sections go on which page.
|
||||
// Page 0 gets sections 0..<splitIndex, page 1 gets sections splitIndex..<size.
|
||||
// Footer space is reserved on the last page only.
|
||||
val availableOnPage0 = contentTop - bottomMargin -
|
||||
(if (song.sections.size > 0) footerReservation else 0f)
|
||||
val splitIndex = computeSplitIndex(song, fontMetrics, config, contentWidth, availableOnPage0)
|
||||
val isTwoPageSong = splitIndex < song.sections.size
|
||||
val isLastPage = if (isTwoPageSong) pageIndex == 1 else pageIndex == 0
|
||||
|
||||
// Bottom boundary for content on this page
|
||||
val yMin = bottomMargin + (if (isLastPage) footerReservation else 0f)
|
||||
|
||||
if (pageIndex == 0) {
|
||||
// Render title
|
||||
val titleFont = fontMetrics.getBaseFont(config.fonts.title)
|
||||
val titleSize = config.fonts.title.size
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(titleFont, titleSize)
|
||||
cb.setColorFill(Color.BLACK)
|
||||
cb.setTextMatrix(leftMargin, y - titleSize)
|
||||
cb.showText(song.title)
|
||||
cb.endText()
|
||||
y -= titleSize * 1.5f
|
||||
|
||||
// Render metadata line (composer/lyricist) - at top position only
|
||||
if (!renderMetaAtBottom) {
|
||||
val metaParts = buildMetadataLines(song, config)
|
||||
if (metaParts.isNotEmpty()) {
|
||||
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
|
||||
val metaSize = config.fonts.metadata.size
|
||||
for (metaLine in metaParts) {
|
||||
if (y - metaSize * 1.8f < yMin) break
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(metaFont, metaSize)
|
||||
cb.setColorFill(Color.GRAY)
|
||||
cb.setTextMatrix(leftMargin, y - metaSize)
|
||||
cb.showText(metaLine)
|
||||
cb.endText()
|
||||
y -= metaSize * 1.8f
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Render key and capo
|
||||
val infoParts = mutableListOf<String>()
|
||||
song.key?.let { infoParts.add("Tonart: $it") }
|
||||
song.capo?.let { infoParts.add("Capo: $it") }
|
||||
if (infoParts.isNotEmpty()) {
|
||||
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
|
||||
val metaSize = config.fonts.metadata.size
|
||||
if (y - metaSize * 1.8f >= yMin) {
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(metaFont, metaSize)
|
||||
cb.setColorFill(Color.GRAY)
|
||||
cb.setTextMatrix(leftMargin, y - metaSize)
|
||||
cb.showText(infoParts.joinToString(" | "))
|
||||
cb.endText()
|
||||
y -= metaSize * 1.8f
|
||||
}
|
||||
}
|
||||
|
||||
y -= 4f // gap before sections
|
||||
}
|
||||
|
||||
// Determine which sections to render on this page
|
||||
val sections = if (pageIndex == 0) {
|
||||
song.sections.subList(0, splitIndex)
|
||||
} else {
|
||||
song.sections.subList(splitIndex, song.sections.size)
|
||||
}
|
||||
|
||||
for (section in sections) {
|
||||
// Safety check: stop rendering if we've gone below the boundary
|
||||
if (y < yMin) break
|
||||
|
||||
// Section label
|
||||
if (section.label != null || section.type == SectionType.CHORUS) {
|
||||
val labelText = section.label ?: when (section.type) {
|
||||
SectionType.CHORUS -> "Refrain"
|
||||
SectionType.REPEAT -> "Wiederholung"
|
||||
else -> null
|
||||
}
|
||||
if (labelText != null) {
|
||||
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
|
||||
val metaSize = config.fonts.metadata.size
|
||||
if (y - metaSize * 1.5f < yMin) break
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(metaFont, metaSize)
|
||||
cb.setColorFill(Color.DARK_GRAY)
|
||||
cb.setTextMatrix(leftMargin, y - metaSize)
|
||||
cb.showText(labelText)
|
||||
cb.endText()
|
||||
y -= metaSize * 1.5f
|
||||
}
|
||||
}
|
||||
|
||||
// Chorus indication for repeat
|
||||
if (section.type == SectionType.CHORUS && section.lines.isEmpty()) {
|
||||
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
|
||||
val metaSize = config.fonts.metadata.size
|
||||
if (y - metaSize * 1.8f < yMin) break
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(metaFont, metaSize)
|
||||
cb.setColorFill(Color.DARK_GRAY)
|
||||
cb.setTextMatrix(leftMargin, y - metaSize)
|
||||
cb.showText("(Refrain)")
|
||||
cb.endText()
|
||||
y -= metaSize * 1.8f
|
||||
continue
|
||||
}
|
||||
|
||||
// Render repeat markers for REPEAT sections
|
||||
if (section.type == SectionType.REPEAT) {
|
||||
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
|
||||
val metaSize = config.fonts.metadata.size
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(metaFont, metaSize)
|
||||
cb.setColorFill(Color.DARK_GRAY)
|
||||
cb.setTextMatrix(leftMargin, y - metaSize)
|
||||
cb.showText("\u2502:")
|
||||
cb.endText()
|
||||
}
|
||||
|
||||
// Render lines
|
||||
for (line in section.lines) {
|
||||
if (y < yMin) break
|
||||
val imgPath = line.imagePath
|
||||
if (imgPath != null) {
|
||||
// Render inline image
|
||||
y -= renderInlineImage(cb, imgPath, leftMargin, y, contentWidth)
|
||||
} else {
|
||||
val height = chordLyricRenderer.renderLine(cb, line, leftMargin, y, contentWidth)
|
||||
y -= height + 1f // 1pt gap between lines
|
||||
}
|
||||
}
|
||||
|
||||
// End repeat marker
|
||||
if (section.type == SectionType.REPEAT) {
|
||||
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
|
||||
val metaSize = config.fonts.metadata.size
|
||||
if (y - metaSize * 1.5f >= yMin) {
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(metaFont, metaSize)
|
||||
cb.setColorFill(Color.DARK_GRAY)
|
||||
cb.setTextMatrix(leftMargin, y - metaSize)
|
||||
cb.showText(":\u2502")
|
||||
cb.endText()
|
||||
y -= metaSize * 1.5f
|
||||
}
|
||||
}
|
||||
|
||||
// Verse spacing
|
||||
y -= config.layout.verseSpacing / 0.3528f
|
||||
}
|
||||
|
||||
// Render footer elements (notes, metadata, references) anchored to the bottom of the page.
|
||||
// Instead of flowing from the current y position after song content, we compute a fixed
|
||||
// starting Y at the top of the footer area (bottomMargin + footerReservation) and render
|
||||
// top-down: notes -> metadata -> references. This ensures footer elements always appear
|
||||
// at the same vertical position regardless of how much song content is on the page.
|
||||
if (isLastPage && footerReservation > 0f) {
|
||||
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
|
||||
val metaSize = config.fonts.metadata.size
|
||||
|
||||
// The footer area spans from bottomMargin to bottomMargin + footerReservation.
|
||||
// Start rendering from the top of this area, flowing downward.
|
||||
var footerY = bottomMargin + footerReservation
|
||||
|
||||
// Render notes (topmost footer element)
|
||||
if (song.notes.isNotEmpty()) {
|
||||
footerY -= 4f // gap before notes
|
||||
val noteLineHeight = metaSize * 1.5f
|
||||
for ((idx, note) in song.notes.withIndex()) {
|
||||
val wrappedLines = wrapText(note, metaFont, metaSize, contentWidth)
|
||||
for (wrappedLine in wrappedLines) {
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(metaFont, metaSize)
|
||||
cb.setColorFill(Color.GRAY)
|
||||
cb.setTextMatrix(leftMargin, footerY - metaSize)
|
||||
cb.showText(wrappedLine)
|
||||
cb.endText()
|
||||
footerY -= noteLineHeight
|
||||
}
|
||||
if (idx < song.notes.size - 1) {
|
||||
footerY -= noteLineHeight * 0.3f
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Render metadata (Worte/Weise) below notes, if configured at bottom
|
||||
if (renderMetaAtBottom) {
|
||||
val metaParts = buildMetadataLines(song, config)
|
||||
if (metaParts.isNotEmpty()) {
|
||||
footerY -= 4f // gap before metadata
|
||||
for (metaLine in metaParts) {
|
||||
val wrappedLines = wrapText(metaLine, metaFont, metaSize, contentWidth)
|
||||
for (wrappedLine in wrappedLines) {
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(metaFont, metaSize)
|
||||
cb.setColorFill(Color.GRAY)
|
||||
cb.setTextMatrix(leftMargin, footerY - metaSize)
|
||||
cb.showText(wrappedLine)
|
||||
cb.endText()
|
||||
footerY -= metaSize * 1.5f
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Render reference book footer (bottommost footer element, just above page number)
|
||||
if (config.referenceBooks.isNotEmpty() && song.references.isNotEmpty()) {
|
||||
footerY -= 4f // gap before reference footer
|
||||
renderReferenceFooter(
|
||||
cb, fontMetrics, config, song,
|
||||
leftMargin, footerY, contentWidth
|
||||
)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Build metadata lines based on configured label style.
|
||||
* Returns a list of lines to render (may be empty).
|
||||
*/
|
||||
private fun buildMetadataLines(song: Song, config: BookConfig): List<String> {
|
||||
val useGerman = config.layout.metadataLabels == "german"
|
||||
val lines = mutableListOf<String>()
|
||||
|
||||
if (useGerman) {
|
||||
// German labels: "Worte und Weise:" when same person, otherwise separate
|
||||
if (song.lyricist != null && song.composer != null && song.lyricist == song.composer) {
|
||||
lines.add("Worte und Weise: ${song.lyricist}")
|
||||
} else {
|
||||
song.lyricist?.let { lines.add("Worte: $it") }
|
||||
song.composer?.let { lines.add("Weise: $it") }
|
||||
}
|
||||
} else {
|
||||
// Abbreviated labels on a single line
|
||||
val parts = mutableListOf<String>()
|
||||
song.composer?.let { parts.add("M: $it") }
|
||||
song.lyricist?.let { parts.add("T: $it") }
|
||||
if (parts.isNotEmpty()) {
|
||||
lines.add(parts.joinToString(" / "))
|
||||
}
|
||||
}
|
||||
|
||||
return lines
|
||||
}
|
||||
|
||||
/**
|
||||
* Renders reference book abbreviations and page numbers as a footer
|
||||
* on the song page, positioned below the current content at [topY].
|
||||
* Layout (top to bottom): separator line, abbreviation row, page number row.
|
||||
*/
|
||||
private fun renderReferenceFooter(
|
||||
cb: PdfContentByte,
|
||||
fontMetrics: PdfFontMetrics,
|
||||
config: BookConfig,
|
||||
song: Song,
|
||||
leftMargin: Float,
|
||||
topY: Float,
|
||||
contentWidth: Float
|
||||
) {
|
||||
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
|
||||
val metaSize = config.fonts.metadata.size
|
||||
val lineHeight = metaSize * 1.4f
|
||||
|
||||
val books = config.referenceBooks
|
||||
|
||||
// Calculate column widths: evenly distribute across content width
|
||||
val colWidth = contentWidth / books.size
|
||||
|
||||
// Draw a thin separator line at the top of the footer
|
||||
val lineY = topY
|
||||
cb.setLineWidth(0.3f)
|
||||
cb.setColorStroke(Color.LIGHT_GRAY)
|
||||
cb.moveTo(leftMargin, lineY)
|
||||
cb.lineTo(leftMargin + contentWidth, lineY)
|
||||
cb.stroke()
|
||||
|
||||
// Row 1: Abbreviation headers (below the separator line)
|
||||
val abbrY = lineY - lineHeight
|
||||
for ((i, book) in books.withIndex()) {
|
||||
val x = leftMargin + i * colWidth
|
||||
val abbr = book.abbreviation
|
||||
val textWidth = metaFont.getWidthPoint(abbr, metaSize)
|
||||
val textX = x + (colWidth - textWidth) / 2
|
||||
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(metaFont, metaSize)
|
||||
cb.setColorFill(Color.DARK_GRAY)
|
||||
cb.setTextMatrix(textX, abbrY)
|
||||
cb.showText(abbr)
|
||||
cb.endText()
|
||||
}
|
||||
|
||||
// Row 2: Page numbers (below abbreviation headers)
|
||||
val numY = abbrY - lineHeight
|
||||
for ((i, book) in books.withIndex()) {
|
||||
val x = leftMargin + i * colWidth
|
||||
val pageNum = song.references[book.id]
|
||||
if (pageNum != null) {
|
||||
val pageText = pageNum.toString()
|
||||
val textWidth = metaFont.getWidthPoint(pageText, metaSize)
|
||||
val textX = x + (colWidth - textWidth) / 2
|
||||
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(metaFont, metaSize)
|
||||
cb.setColorFill(Color.DARK_GRAY)
|
||||
cb.setTextMatrix(textX, numY)
|
||||
cb.showText(pageText)
|
||||
cb.endText()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
private fun renderForewordPage(
|
||||
cb: PdfContentByte,
|
||||
fontMetrics: PdfFontMetrics,
|
||||
config: BookConfig,
|
||||
foreword: Foreword,
|
||||
pageIndex: Int,
|
||||
contentTop: Float,
|
||||
leftMargin: Float,
|
||||
contentWidth: Float
|
||||
) {
|
||||
var y = contentTop
|
||||
val bodyFontSpec = config.fonts.lyrics
|
||||
val bodyFont = fontMetrics.getBaseFont(bodyFontSpec)
|
||||
val bodySize = bodyFontSpec.size
|
||||
val lineHeight = bodySize * 1.5f
|
||||
|
||||
if (pageIndex == 0) {
|
||||
// Page 1: Quote + separator + first paragraphs
|
||||
|
||||
// Render quote in italic (bold)
|
||||
val quoteText = foreword.quote
|
||||
if (quoteText != null) {
|
||||
val quoteFont = fontMetrics.getBaseFontBold(bodyFontSpec)
|
||||
val quoteSize = bodySize * 1.1f
|
||||
|
||||
// Word-wrap the quote text
|
||||
val quoteLines = wrapText(quoteText, quoteFont, quoteSize, contentWidth)
|
||||
for (quoteLine in quoteLines) {
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(quoteFont, quoteSize)
|
||||
cb.setColorFill(Color.DARK_GRAY)
|
||||
cb.setTextMatrix(leftMargin, y - quoteSize)
|
||||
cb.showText(quoteLine)
|
||||
cb.endText()
|
||||
y -= quoteSize * 1.5f
|
||||
}
|
||||
|
||||
y -= 6f // gap before separator
|
||||
|
||||
// Horizontal rule
|
||||
cb.setLineWidth(0.5f)
|
||||
cb.setColorStroke(Color.GRAY)
|
||||
cb.moveTo(leftMargin, y)
|
||||
cb.lineTo(leftMargin + contentWidth, y)
|
||||
cb.stroke()
|
||||
y -= 10f // gap after separator
|
||||
}
|
||||
|
||||
// Render body paragraphs
|
||||
for (paragraph in foreword.paragraphs) {
|
||||
val wrappedLines = wrapText(paragraph, bodyFont, bodySize, contentWidth)
|
||||
for (wrappedLine in wrappedLines) {
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(bodyFont, bodySize)
|
||||
cb.setColorFill(Color.BLACK)
|
||||
cb.setTextMatrix(leftMargin, y - bodySize)
|
||||
cb.showText(wrappedLine)
|
||||
cb.endText()
|
||||
y -= lineHeight
|
||||
}
|
||||
y -= lineHeight * 0.5f // paragraph spacing
|
||||
}
|
||||
|
||||
// Render signatures (right-aligned)
|
||||
if (foreword.signatures.isNotEmpty()) {
|
||||
y -= lineHeight // extra gap before signatures
|
||||
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
|
||||
val metaSize = config.fonts.metadata.size
|
||||
for (signature in foreword.signatures) {
|
||||
val sigWidth = metaFont.getWidthPoint(signature, metaSize)
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(metaFont, metaSize)
|
||||
cb.setColorFill(Color.DARK_GRAY)
|
||||
cb.setTextMatrix(leftMargin + contentWidth - sigWidth, y - metaSize)
|
||||
cb.showText(signature)
|
||||
cb.endText()
|
||||
y -= metaSize * 1.8f
|
||||
}
|
||||
}
|
||||
} else {
|
||||
// Page 2: blank (or overflow content if needed in the future)
|
||||
cb.beginText()
|
||||
cb.endText()
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Simple word-wrap: splits text into lines that fit within maxWidth (in points).
|
||||
*/
|
||||
private fun wrapText(text: String, font: BaseFont, fontSize: Float, maxWidth: Float): List<String> {
|
||||
val words = text.split(" ")
|
||||
val lines = mutableListOf<String>()
|
||||
var currentLine = StringBuilder()
|
||||
|
||||
for (word in words) {
|
||||
val testLine = if (currentLine.isEmpty()) word else "$currentLine $word"
|
||||
val testWidth = font.getWidthPoint(testLine, fontSize)
|
||||
if (testWidth <= maxWidth) {
|
||||
currentLine = StringBuilder(testLine)
|
||||
} else {
|
||||
if (currentLine.isNotEmpty()) {
|
||||
lines.add(currentLine.toString())
|
||||
}
|
||||
currentLine = StringBuilder(word)
|
||||
}
|
||||
}
|
||||
if (currentLine.isNotEmpty()) {
|
||||
lines.add(currentLine.toString())
|
||||
}
|
||||
|
||||
return lines
|
||||
}
|
||||
|
||||
/**
|
||||
* Renders an inline image within a song page at the given position.
|
||||
* Returns the total height consumed in PDF points.
|
||||
*/
|
||||
private fun renderInlineImage(
|
||||
cb: PdfContentByte,
|
||||
imagePath: String,
|
||||
leftMargin: Float,
|
||||
y: Float,
|
||||
contentWidth: Float
|
||||
): Float {
|
||||
try {
|
||||
val img = Image.getInstance(imagePath)
|
||||
// Scale to fit within content width, max height 40mm (~113 points)
|
||||
val maxHeight = 40f / 0.3528f // 40mm in points
|
||||
img.scaleToFit(contentWidth * 0.8f, maxHeight)
|
||||
|
||||
// Center horizontally
|
||||
val imgX = leftMargin + (contentWidth - img.scaledWidth) / 2
|
||||
val imgY = y - img.scaledHeight - 3f // 3pt gap above
|
||||
|
||||
img.setAbsolutePosition(imgX, imgY)
|
||||
cb.addImage(img)
|
||||
|
||||
return img.scaledHeight + 6f // image height + gaps above/below
|
||||
} catch (_: Exception) {
|
||||
// If image can't be loaded, consume minimal space
|
||||
return 5f
|
||||
}
|
||||
}
|
||||
|
||||
private fun renderIntroPage(
|
||||
cb: PdfContentByte,
|
||||
fontMetrics: PdfFontMetrics,
|
||||
config: BookConfig,
|
||||
pageSize: Rectangle
|
||||
) {
|
||||
val pageWidth = pageSize.width
|
||||
val pageHeight = pageSize.height
|
||||
|
||||
// Title centered on the page
|
||||
val titleFont = fontMetrics.getBaseFont(config.fonts.title)
|
||||
val titleSize = config.fonts.title.size * 2.5f
|
||||
val title = config.book.title
|
||||
val titleWidth = titleFont.getWidthPoint(title, titleSize)
|
||||
val titleX = (pageWidth - titleWidth) / 2
|
||||
val titleY = pageHeight * 0.55f
|
||||
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(titleFont, titleSize)
|
||||
cb.setColorFill(Color.BLACK)
|
||||
cb.setTextMatrix(titleX, titleY)
|
||||
cb.showText(title)
|
||||
cb.endText()
|
||||
|
||||
// Subtitle below the title
|
||||
if (config.book.subtitle != null) {
|
||||
val subtitleSize = config.fonts.title.size * 1.2f
|
||||
val subtitle = config.book.subtitle!!
|
||||
val subtitleWidth = titleFont.getWidthPoint(subtitle, subtitleSize)
|
||||
val subtitleX = (pageWidth - subtitleWidth) / 2
|
||||
val subtitleY = titleY - titleSize * 1.8f
|
||||
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(titleFont, subtitleSize)
|
||||
cb.setColorFill(Color.DARK_GRAY)
|
||||
cb.setTextMatrix(subtitleX, subtitleY)
|
||||
cb.showText(subtitle)
|
||||
cb.endText()
|
||||
}
|
||||
|
||||
// Edition at the bottom of the page
|
||||
if (config.book.edition != null) {
|
||||
val metaFont = fontMetrics.getBaseFont(config.fonts.metadata)
|
||||
val metaSize = config.fonts.metadata.size * 1.2f
|
||||
val edition = config.book.edition!!
|
||||
val editionWidth = metaFont.getWidthPoint(edition, metaSize)
|
||||
val editionX = (pageWidth - editionWidth) / 2
|
||||
val editionY = pageHeight * 0.1f
|
||||
|
||||
cb.beginText()
|
||||
cb.setFontAndSize(metaFont, metaSize)
|
||||
cb.setColorFill(Color.GRAY)
|
||||
cb.setTextMatrix(editionX, editionY)
|
||||
cb.showText(edition)
|
||||
cb.endText()
|
||||
}
|
||||
}
|
||||
|
||||
private fun renderFillerImage(document: Document, imagePath: String, pageSize: Rectangle) {
|
||||
try {
|
||||
val img = Image.getInstance(imagePath)
|
||||
img.scaleToFit(pageSize.width * 0.7f, pageSize.height * 0.7f)
|
||||
img.alignment = Image.ALIGN_CENTER or Image.ALIGN_MIDDLE
|
||||
document.add(img)
|
||||
} catch (_: Exception) {
|
||||
// If image can't be loaded, just leave the page blank
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,60 @@
|
||||
package de.pfadfinder.songbook.renderer.pdf
|
||||
|
||||
import com.lowagie.text.pdf.BaseFont
|
||||
import de.pfadfinder.songbook.model.FontMetrics
|
||||
import de.pfadfinder.songbook.model.FontSpec
|
||||
import java.io.File
|
||||
|
||||
class PdfFontMetrics : FontMetrics {
|
||||
private val fontCache = mutableMapOf<String, BaseFont>()
|
||||
|
||||
fun getBaseFont(font: FontSpec): BaseFont {
|
||||
val fontFile = font.file
|
||||
val key = if (fontFile != null) File(fontFile).canonicalPath else font.family
|
||||
return fontCache.getOrPut(key) {
|
||||
if (fontFile != null) {
|
||||
val file = File(fontFile)
|
||||
if (!file.exists()) {
|
||||
throw IllegalArgumentException("Font file not found: ${file.absolutePath}")
|
||||
}
|
||||
BaseFont.createFont(file.absolutePath, BaseFont.IDENTITY_H, BaseFont.EMBEDDED)
|
||||
} else {
|
||||
// Map common family names to built-in PDF fonts
|
||||
val pdfFontName = when (font.family.lowercase()) {
|
||||
"helvetica" -> BaseFont.HELVETICA
|
||||
"courier" -> BaseFont.COURIER
|
||||
"times", "times new roman" -> BaseFont.TIMES_ROMAN
|
||||
else -> BaseFont.HELVETICA
|
||||
}
|
||||
BaseFont.createFont(pdfFontName, BaseFont.CP1252, BaseFont.NOT_EMBEDDED)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Also provide bold variants for chord fonts
|
||||
fun getBaseFontBold(font: FontSpec): BaseFont {
|
||||
if (font.file != null) return getBaseFont(font)
|
||||
val key = "${font.family}_bold"
|
||||
return fontCache.getOrPut(key) {
|
||||
val pdfFontName = when (font.family.lowercase()) {
|
||||
"helvetica" -> BaseFont.HELVETICA_BOLD
|
||||
"courier" -> BaseFont.COURIER_BOLD
|
||||
"times", "times new roman" -> BaseFont.TIMES_BOLD
|
||||
else -> BaseFont.HELVETICA_BOLD
|
||||
}
|
||||
BaseFont.createFont(pdfFontName, BaseFont.CP1252, BaseFont.NOT_EMBEDDED)
|
||||
}
|
||||
}
|
||||
|
||||
override fun measureTextWidth(text: String, font: FontSpec, size: Float): Float {
|
||||
val baseFont = getBaseFont(font)
|
||||
// BaseFont.getWidthPoint returns width in PDF points
|
||||
// Convert to mm: 1 point = 0.3528 mm
|
||||
return baseFont.getWidthPoint(text, size) * 0.3528f
|
||||
}
|
||||
|
||||
override fun measureLineHeight(font: FontSpec, size: Float): Float {
|
||||
// Approximate line height as 1.2 * font size, converted to mm
|
||||
return size * 1.2f * 0.3528f
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,154 @@
|
||||
package de.pfadfinder.songbook.renderer.pdf
|
||||
|
||||
import com.lowagie.text.*
|
||||
import com.lowagie.text.pdf.*
|
||||
import de.pfadfinder.songbook.model.*
|
||||
import java.awt.Color
|
||||
|
||||
class TocRenderer(
|
||||
private val fontMetrics: PdfFontMetrics,
|
||||
private val config: BookConfig
|
||||
) {
|
||||
// Light gray background for the highlighted column
|
||||
private val highlightColor = Color(220, 220, 220)
|
||||
|
||||
/**
|
||||
* Pre-renders the TOC to a temporary document and returns the number of pages needed,
|
||||
* rounded up to an even number for double-sided printing.
|
||||
*/
|
||||
fun measurePages(tocEntries: List<TocEntry>): Int {
|
||||
val pageSize = if (config.book.format == "A5") PageSize.A5 else PageSize.A4
|
||||
val marginInner = config.layout.margins.inner / 0.3528f
|
||||
val marginOuter = config.layout.margins.outer / 0.3528f
|
||||
val marginTop = config.layout.margins.top / 0.3528f
|
||||
val marginBottom = config.layout.margins.bottom / 0.3528f
|
||||
|
||||
val baos = java.io.ByteArrayOutputStream()
|
||||
val doc = Document(pageSize, marginInner, marginOuter, marginTop, marginBottom)
|
||||
val writer = PdfWriter.getInstance(doc, baos)
|
||||
doc.open()
|
||||
render(doc, writer, tocEntries)
|
||||
doc.close()
|
||||
|
||||
val reader = PdfReader(baos.toByteArray())
|
||||
val pageCount = reader.numberOfPages
|
||||
reader.close()
|
||||
|
||||
// Round to even for double-sided printing
|
||||
return if (pageCount % 2 == 0) pageCount else pageCount + 1
|
||||
}
|
||||
|
||||
fun render(document: Document, writer: PdfWriter, tocEntries: List<TocEntry>) {
|
||||
val tocFont = fontMetrics.getBaseFont(config.fonts.toc)
|
||||
val tocBoldFont = fontMetrics.getBaseFontBold(config.fonts.toc)
|
||||
val fontSize = config.fonts.toc.size
|
||||
|
||||
// Title "Inhaltsverzeichnis"
|
||||
val titleFont = Font(fontMetrics.getBaseFont(config.fonts.title), config.fonts.title.size, Font.BOLD)
|
||||
val title = Paragraph("Inhaltsverzeichnis", titleFont)
|
||||
title.alignment = Element.ALIGN_CENTER
|
||||
title.spacingAfter = 12f
|
||||
document.add(title)
|
||||
|
||||
// Determine columns: Title | Page | ref book abbreviations...
|
||||
val refBooks = config.referenceBooks
|
||||
val numCols = 2 + refBooks.size
|
||||
val table = PdfPTable(numCols)
|
||||
table.widthPercentage = 100f
|
||||
|
||||
// Set column widths: title takes most space, ref columns need room for 3-digit numbers
|
||||
val widths = FloatArray(numCols)
|
||||
widths[0] = 12f // title
|
||||
widths[1] = 1.5f // page
|
||||
for (i in refBooks.indices) {
|
||||
widths[2 + i] = 1.5f // enough for 3-digit page numbers; headers are rotated 90°
|
||||
}
|
||||
table.setWidths(widths)
|
||||
|
||||
// Determine which column index should be highlighted
|
||||
val highlightAbbrev = config.toc.highlightColumn
|
||||
val highlightColumnIndex: Int? = if (highlightAbbrev != null) {
|
||||
if (highlightAbbrev == "Seite") {
|
||||
1
|
||||
} else {
|
||||
val refIndex = refBooks.indexOfFirst { it.abbreviation == highlightAbbrev }
|
||||
if (refIndex >= 0) 2 + refIndex else null
|
||||
}
|
||||
} else null
|
||||
|
||||
// Header row — reference book columns are rotated 90°
|
||||
val headerFont = Font(tocBoldFont, fontSize, Font.BOLD)
|
||||
table.addCell(headerCell("Titel", headerFont, isHighlighted = false))
|
||||
table.addCell(headerCell("Seite", headerFont, isHighlighted = highlightColumnIndex == 1))
|
||||
for ((i, book) in refBooks.withIndex()) {
|
||||
val isHighlighted = highlightColumnIndex == 2 + i
|
||||
table.addCell(rotatedHeaderCell(book.abbreviation, headerFont, isHighlighted))
|
||||
}
|
||||
table.headerRows = 1
|
||||
|
||||
// TOC entries
|
||||
val entryFont = Font(tocFont, fontSize)
|
||||
val aliasFont = Font(tocFont, fontSize, Font.ITALIC)
|
||||
for (entry in tocEntries.sortedBy { it.title.lowercase() }) {
|
||||
val font = if (entry.isAlias) aliasFont else entryFont
|
||||
table.addCell(entryCell(entry.title, font, isHighlighted = false))
|
||||
table.addCell(entryCell(entry.pageNumber.toString(), entryFont, Element.ALIGN_RIGHT, isHighlighted = highlightColumnIndex == 1))
|
||||
for ((i, book) in refBooks.withIndex()) {
|
||||
val ref = entry.references[book.abbreviation]
|
||||
val isHighlighted = highlightColumnIndex == 2 + i
|
||||
table.addCell(entryCell(ref?.toString() ?: "", entryFont, Element.ALIGN_CENTER, isHighlighted = isHighlighted))
|
||||
}
|
||||
}
|
||||
|
||||
document.add(table)
|
||||
}
|
||||
|
||||
private fun headerCell(text: String, font: Font, isHighlighted: Boolean): PdfPCell {
|
||||
val cell = PdfPCell(Phrase(text, font))
|
||||
cell.borderWidth = 0f
|
||||
cell.borderWidthBottom = 0.5f
|
||||
cell.paddingBottom = 4f
|
||||
cell.verticalAlignment = Element.ALIGN_BOTTOM
|
||||
if (isHighlighted) {
|
||||
cell.backgroundColor = highlightColor
|
||||
}
|
||||
return cell
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates a header cell with text rotated 90° counterclockwise.
|
||||
* Used for reference book column headers to save horizontal space.
|
||||
*/
|
||||
private fun rotatedHeaderCell(text: String, font: Font, isHighlighted: Boolean): PdfPCell {
|
||||
val cell = PdfPCell(Phrase(text, font))
|
||||
cell.borderWidth = 0f
|
||||
cell.borderWidthBottom = 0.5f
|
||||
cell.rotation = 90
|
||||
cell.horizontalAlignment = Element.ALIGN_CENTER
|
||||
cell.verticalAlignment = Element.ALIGN_MIDDLE
|
||||
// Ensure cell is tall enough for the rotated text
|
||||
val textWidth = font.baseFont.getWidthPoint(text, font.size)
|
||||
cell.minimumHeight = textWidth + 8f
|
||||
if (isHighlighted) {
|
||||
cell.backgroundColor = highlightColor
|
||||
}
|
||||
return cell
|
||||
}
|
||||
|
||||
private fun entryCell(
|
||||
text: String,
|
||||
font: Font,
|
||||
alignment: Int = Element.ALIGN_LEFT,
|
||||
isHighlighted: Boolean = false
|
||||
): PdfPCell {
|
||||
val cell = PdfPCell(Phrase(text, font))
|
||||
cell.borderWidth = 0f
|
||||
cell.horizontalAlignment = alignment
|
||||
cell.paddingTop = 1f
|
||||
cell.paddingBottom = 1f
|
||||
if (isHighlighted) {
|
||||
cell.backgroundColor = highlightColor
|
||||
}
|
||||
return cell
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,103 @@
|
||||
package de.pfadfinder.songbook.renderer.pdf
|
||||
|
||||
import com.lowagie.text.Document
|
||||
import com.lowagie.text.PageSize
|
||||
import com.lowagie.text.pdf.PdfWriter
|
||||
import de.pfadfinder.songbook.model.*
|
||||
import io.kotest.matchers.floats.shouldBeGreaterThan
|
||||
import java.io.ByteArrayOutputStream
|
||||
import kotlin.test.Test
|
||||
|
||||
class ChordLyricRendererTest {
|
||||
|
||||
private val fontMetrics = PdfFontMetrics()
|
||||
private val config = BookConfig()
|
||||
private val renderer = ChordLyricRenderer(fontMetrics, config)
|
||||
|
||||
private fun withPdfContentByte(block: (com.lowagie.text.pdf.PdfContentByte) -> Unit) {
|
||||
val baos = ByteArrayOutputStream()
|
||||
val document = Document(PageSize.A5)
|
||||
val writer = PdfWriter.getInstance(document, baos)
|
||||
document.open()
|
||||
val cb = writer.directContent
|
||||
block(cb)
|
||||
document.close()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `renderLine returns positive height for lyric-only line`() {
|
||||
withPdfContentByte { cb ->
|
||||
val line = SongLine(listOf(LineSegment(text = "Hello world")))
|
||||
val height = renderer.renderLine(cb, line, 50f, 500f, 300f)
|
||||
height shouldBeGreaterThan 0f
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `renderLine returns greater height for chord+lyric line than lyric-only`() {
|
||||
withPdfContentByte { cb ->
|
||||
val lyricOnly = SongLine(listOf(LineSegment(text = "Hello world")))
|
||||
val withChords = SongLine(listOf(LineSegment(chord = "Am", text = "Hello world")))
|
||||
|
||||
val lyricHeight = renderer.renderLine(cb, lyricOnly, 50f, 500f, 300f)
|
||||
val chordHeight = renderer.renderLine(cb, withChords, 50f, 500f, 300f)
|
||||
|
||||
chordHeight shouldBeGreaterThan lyricHeight
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `renderLine handles multiple segments`() {
|
||||
withPdfContentByte { cb ->
|
||||
val line = SongLine(
|
||||
listOf(
|
||||
LineSegment(chord = "C", text = "Amazing "),
|
||||
LineSegment(chord = "G", text = "Grace, how "),
|
||||
LineSegment(chord = "Am", text = "sweet the "),
|
||||
LineSegment(chord = "F", text = "sound")
|
||||
)
|
||||
)
|
||||
val height = renderer.renderLine(cb, line, 50f, 500f, 300f)
|
||||
height shouldBeGreaterThan 0f
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `renderLine handles segments with mixed chords and no-chords`() {
|
||||
withPdfContentByte { cb ->
|
||||
val line = SongLine(
|
||||
listOf(
|
||||
LineSegment(chord = "C", text = "Hello "),
|
||||
LineSegment(text = "world"),
|
||||
LineSegment(chord = "G", text = " today")
|
||||
)
|
||||
)
|
||||
val height = renderer.renderLine(cb, line, 50f, 500f, 300f)
|
||||
height shouldBeGreaterThan 0f
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `renderLine handles empty text segments`() {
|
||||
withPdfContentByte { cb ->
|
||||
val line = SongLine(listOf(LineSegment(chord = "Am", text = "")))
|
||||
val height = renderer.renderLine(cb, line, 50f, 500f, 300f)
|
||||
height shouldBeGreaterThan 0f
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `renderLine handles custom chord color from config`() {
|
||||
val customConfig = BookConfig(
|
||||
fonts = FontsConfig(
|
||||
chords = FontSpec(family = "Helvetica", size = 9f, color = "#FF0000")
|
||||
)
|
||||
)
|
||||
val customRenderer = ChordLyricRenderer(fontMetrics, customConfig)
|
||||
withPdfContentByte { cb ->
|
||||
val line = SongLine(listOf(LineSegment(chord = "Am", text = "Hello")))
|
||||
val height = customRenderer.renderLine(cb, line, 50f, 500f, 300f)
|
||||
height shouldBeGreaterThan 0f
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,55 @@
|
||||
package de.pfadfinder.songbook.renderer.pdf
|
||||
|
||||
import com.lowagie.text.Document
|
||||
import com.lowagie.text.PageSize
|
||||
import com.lowagie.text.pdf.PdfWriter
|
||||
import de.pfadfinder.songbook.model.BookConfig
|
||||
import java.io.ByteArrayOutputStream
|
||||
import kotlin.test.Test
|
||||
|
||||
class PageDecoratorTest {
|
||||
|
||||
private val fontMetrics = PdfFontMetrics()
|
||||
private val config = BookConfig()
|
||||
private val decorator = PageDecorator(fontMetrics, config)
|
||||
|
||||
private fun withPdfContentByte(block: (com.lowagie.text.pdf.PdfContentByte) -> Unit) {
|
||||
val baos = ByteArrayOutputStream()
|
||||
val document = Document(PageSize.A5)
|
||||
val writer = PdfWriter.getInstance(document, baos)
|
||||
document.open()
|
||||
val cb = writer.directContent
|
||||
block(cb)
|
||||
document.close()
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `addPageNumber renders odd page number on right side`() {
|
||||
// Odd page = right side of book spread
|
||||
withPdfContentByte { cb ->
|
||||
decorator.addPageNumber(cb, 1, PageSize.A5.width, PageSize.A5.height)
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `addPageNumber renders even page number on left side`() {
|
||||
// Even page = left side of book spread
|
||||
withPdfContentByte { cb ->
|
||||
decorator.addPageNumber(cb, 2, PageSize.A5.width, PageSize.A5.height)
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `addPageNumber handles large page numbers`() {
|
||||
withPdfContentByte { cb ->
|
||||
decorator.addPageNumber(cb, 999, PageSize.A5.width, PageSize.A5.height)
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `addPageNumber works with A4 page size`() {
|
||||
withPdfContentByte { cb ->
|
||||
decorator.addPageNumber(cb, 5, PageSize.A4.width, PageSize.A4.height)
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,629 @@
|
||||
package de.pfadfinder.songbook.renderer.pdf
|
||||
|
||||
import de.pfadfinder.songbook.model.*
|
||||
import io.kotest.matchers.ints.shouldBeGreaterThan
|
||||
import io.kotest.matchers.shouldBe
|
||||
import java.io.ByteArrayOutputStream
|
||||
import kotlin.test.Test
|
||||
import kotlin.test.assertFails
|
||||
|
||||
class PdfBookRendererTest {
|
||||
|
||||
private val renderer = PdfBookRenderer()
|
||||
|
||||
private fun createSimpleSong(title: String = "Test Song"): Song {
|
||||
return Song(
|
||||
title = title,
|
||||
composer = "Test Composer",
|
||||
lyricist = "Test Lyricist",
|
||||
key = "Am",
|
||||
capo = 2,
|
||||
notes = listOf("Play gently"),
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
label = "Verse 1",
|
||||
lines = listOf(
|
||||
SongLine(
|
||||
listOf(
|
||||
LineSegment(chord = "Am", text = "Hello "),
|
||||
LineSegment(chord = "C", text = "World")
|
||||
)
|
||||
),
|
||||
SongLine(
|
||||
listOf(
|
||||
LineSegment(text = "This is a test line")
|
||||
)
|
||||
)
|
||||
)
|
||||
),
|
||||
SongSection(
|
||||
type = SectionType.CHORUS,
|
||||
lines = listOf(
|
||||
SongLine(
|
||||
listOf(
|
||||
LineSegment(chord = "F", text = "Chorus "),
|
||||
LineSegment(chord = "G", text = "line")
|
||||
)
|
||||
)
|
||||
)
|
||||
)
|
||||
)
|
||||
)
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render produces valid PDF with single song`() {
|
||||
val song = createSimpleSong()
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(PageContent.SongPage(song, 0)),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, BookConfig(), baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
// Check PDF header
|
||||
val bytes = baos.toByteArray()
|
||||
val header = String(bytes.sliceArray(0..4))
|
||||
header shouldBe "%PDF-"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render produces valid PDF with TOC`() {
|
||||
val song = createSimpleSong()
|
||||
val layout = LayoutResult(
|
||||
tocPages = 2,
|
||||
pages = listOf(PageContent.SongPage(song, 0)),
|
||||
tocEntries = listOf(
|
||||
TocEntry(title = "Test Song", pageNumber = 3)
|
||||
)
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, BookConfig(), baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render handles blank pages`() {
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(PageContent.BlankPage),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, BookConfig(), baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render handles mixed page types`() {
|
||||
val song = createSimpleSong()
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(
|
||||
PageContent.SongPage(song, 0),
|
||||
PageContent.BlankPage,
|
||||
PageContent.SongPage(song, 0)
|
||||
),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, BookConfig(), baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render handles A4 format`() {
|
||||
val song = createSimpleSong()
|
||||
val config = BookConfig(book = BookMeta(format = "A4"))
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(PageContent.SongPage(song, 0)),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, config, baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render handles song with all section types`() {
|
||||
val song = Song(
|
||||
title = "Full Song",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
label = "Verse 1",
|
||||
lines = listOf(
|
||||
SongLine(listOf(LineSegment(chord = "C", text = "Verse line")))
|
||||
)
|
||||
),
|
||||
SongSection(
|
||||
type = SectionType.CHORUS,
|
||||
lines = listOf(
|
||||
SongLine(listOf(LineSegment(chord = "G", text = "Chorus line")))
|
||||
)
|
||||
),
|
||||
SongSection(
|
||||
type = SectionType.BRIDGE,
|
||||
label = "Bridge",
|
||||
lines = listOf(
|
||||
SongLine(listOf(LineSegment(text = "Bridge line")))
|
||||
)
|
||||
),
|
||||
SongSection(
|
||||
type = SectionType.REPEAT,
|
||||
lines = listOf(
|
||||
SongLine(listOf(LineSegment(chord = "Am", text = "Repeat line")))
|
||||
)
|
||||
)
|
||||
)
|
||||
)
|
||||
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(PageContent.SongPage(song, 0)),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, BookConfig(), baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render handles empty chorus section (chorus reference)`() {
|
||||
val song = Song(
|
||||
title = "Song with chorus ref",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.CHORUS,
|
||||
lines = emptyList() // empty = just a reference
|
||||
)
|
||||
)
|
||||
)
|
||||
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(PageContent.SongPage(song, 0)),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, BookConfig(), baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render handles song without metadata`() {
|
||||
val song = Song(
|
||||
title = "Minimal Song",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
lines = listOf(
|
||||
SongLine(listOf(LineSegment(text = "Just lyrics")))
|
||||
)
|
||||
)
|
||||
)
|
||||
)
|
||||
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(PageContent.SongPage(song, 0)),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, BookConfig(), baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render handles second page of two-page song`() {
|
||||
val song = createSimpleSong()
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(
|
||||
PageContent.SongPage(song, 0),
|
||||
PageContent.SongPage(song, 1)
|
||||
),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, BookConfig(), baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render handles filler image with nonexistent path gracefully`() {
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(PageContent.FillerImage("/nonexistent/image.png")),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, BookConfig(), baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render handles TOC with reference books`() {
|
||||
val config = BookConfig(
|
||||
referenceBooks = listOf(
|
||||
ReferenceBook(id = "mundorgel", name = "Mundorgel", abbreviation = "MO")
|
||||
)
|
||||
)
|
||||
val song = createSimpleSong()
|
||||
val layout = LayoutResult(
|
||||
tocPages = 2,
|
||||
pages = listOf(PageContent.SongPage(song, 0)),
|
||||
tocEntries = listOf(
|
||||
TocEntry(title = "Test Song", pageNumber = 3, references = mapOf("MO" to 42))
|
||||
)
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, config, baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render handles multiple songs with proper page numbering`() {
|
||||
val song1 = createSimpleSong("Song One")
|
||||
val song2 = createSimpleSong("Song Two")
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(
|
||||
PageContent.SongPage(song1, 0),
|
||||
PageContent.SongPage(song2, 0)
|
||||
),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, BookConfig(), baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render handles song with multiple notes`() {
|
||||
val song = Song(
|
||||
title = "Song with Notes",
|
||||
notes = listOf("Note 1: Play slowly", "Note 2: Repeat chorus twice"),
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
lines = listOf(
|
||||
SongLine(listOf(LineSegment(text = "A simple line")))
|
||||
)
|
||||
)
|
||||
)
|
||||
)
|
||||
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(PageContent.SongPage(song, 0)),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, BookConfig(), baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render with custom margins`() {
|
||||
val config = BookConfig(
|
||||
layout = LayoutConfig(
|
||||
margins = Margins(top = 20f, bottom = 20f, inner = 25f, outer = 15f)
|
||||
)
|
||||
)
|
||||
val song = createSimpleSong()
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(PageContent.SongPage(song, 0)),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, config, baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render throws on empty layout with no content`() {
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = emptyList(),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
// OpenPDF requires at least one page of content
|
||||
assertFails {
|
||||
renderer.render(layout, BookConfig(), baos)
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render handles song with only key no capo`() {
|
||||
val song = Song(
|
||||
title = "Key Only Song",
|
||||
key = "G",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
|
||||
)
|
||||
)
|
||||
)
|
||||
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(PageContent.SongPage(song, 0)),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, BookConfig(), baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render handles song with only capo no key`() {
|
||||
val song = Song(
|
||||
title = "Capo Only Song",
|
||||
capo = 3,
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
lines = listOf(SongLine(listOf(LineSegment(text = "Line"))))
|
||||
)
|
||||
)
|
||||
)
|
||||
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(PageContent.SongPage(song, 0)),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, BookConfig(), baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
// --- Content splitting tests ---
|
||||
|
||||
private fun createLongSong(title: String = "Long Song"): Song {
|
||||
// Create a song with many sections that will exceed one A5 page
|
||||
val sections = (1..20).map { i ->
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
label = "Verse $i",
|
||||
lines = (1..4).map {
|
||||
SongLine(
|
||||
listOf(
|
||||
LineSegment(chord = "Am", text = "Some text with chords "),
|
||||
LineSegment(chord = "G", text = "and more text here")
|
||||
)
|
||||
)
|
||||
}
|
||||
)
|
||||
}
|
||||
return Song(title = title, sections = sections)
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render splits content across pages for two-page song`() {
|
||||
val song = createLongSong()
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(
|
||||
PageContent.SongPage(song, 0),
|
||||
PageContent.SongPage(song, 1)
|
||||
),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, BookConfig(), baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
val bytes = baos.toByteArray()
|
||||
val header = String(bytes.sliceArray(0..4))
|
||||
header shouldBe "%PDF-"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render does not overflow below bottom margin for very long song`() {
|
||||
// Create an extremely long song
|
||||
val sections = (1..40).map { i ->
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
label = "Verse $i",
|
||||
lines = (1..6).map {
|
||||
SongLine(
|
||||
listOf(
|
||||
LineSegment(chord = "C", text = "A long line of text that should be rendered properly "),
|
||||
LineSegment(chord = "G", text = "with chords above each segment")
|
||||
)
|
||||
)
|
||||
}
|
||||
)
|
||||
}
|
||||
val song = Song(title = "Very Long Song", sections = sections)
|
||||
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(
|
||||
PageContent.SongPage(song, 0),
|
||||
PageContent.SongPage(song, 1)
|
||||
),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, BookConfig(), baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render places metadata at bottom of last page for two-page song`() {
|
||||
val config = BookConfig(
|
||||
layout = LayoutConfig(metadataPosition = "bottom")
|
||||
)
|
||||
val song = createLongSong().copy(
|
||||
composer = "Bach",
|
||||
lyricist = "Goethe"
|
||||
)
|
||||
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(
|
||||
PageContent.SongPage(song, 0),
|
||||
PageContent.SongPage(song, 1)
|
||||
),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, config, baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render places notes on last page of two-page song`() {
|
||||
val song = createLongSong().copy(
|
||||
notes = listOf("This is a note that should appear on the last page")
|
||||
)
|
||||
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(
|
||||
PageContent.SongPage(song, 0),
|
||||
PageContent.SongPage(song, 1)
|
||||
),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, BookConfig(), baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render places reference footer on last page of two-page song`() {
|
||||
val config = BookConfig(
|
||||
referenceBooks = listOf(
|
||||
ReferenceBook(id = "mo", name = "Mundorgel", abbreviation = "MO"),
|
||||
ReferenceBook(id = "pl", name = "Pfadfinderlied", abbreviation = "PL")
|
||||
)
|
||||
)
|
||||
val song = createLongSong().copy(
|
||||
references = mapOf("mo" to 42, "pl" to 17)
|
||||
)
|
||||
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(
|
||||
PageContent.SongPage(song, 0),
|
||||
PageContent.SongPage(song, 1)
|
||||
),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, config, baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render handles short song that fits on one page without splitting`() {
|
||||
// A simple short song should still work correctly after split logic is added
|
||||
val song = Song(
|
||||
title = "Short Song",
|
||||
sections = listOf(
|
||||
SongSection(
|
||||
type = SectionType.VERSE,
|
||||
lines = listOf(
|
||||
SongLine(listOf(LineSegment(chord = "Am", text = "One line")))
|
||||
)
|
||||
)
|
||||
)
|
||||
)
|
||||
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(PageContent.SongPage(song, 0)),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, BookConfig(), baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render two-page song with bottom metadata and references`() {
|
||||
val config = BookConfig(
|
||||
layout = LayoutConfig(
|
||||
metadataPosition = "bottom",
|
||||
metadataLabels = "german"
|
||||
),
|
||||
referenceBooks = listOf(
|
||||
ReferenceBook(id = "mo", name = "Mundorgel", abbreviation = "MO")
|
||||
)
|
||||
)
|
||||
val song = createLongSong().copy(
|
||||
composer = "Bach",
|
||||
lyricist = "Goethe",
|
||||
notes = listOf("Play softly", "Repeat last verse"),
|
||||
references = mapOf("mo" to 55)
|
||||
)
|
||||
|
||||
val layout = LayoutResult(
|
||||
tocPages = 0,
|
||||
pages = listOf(
|
||||
PageContent.SongPage(song, 0),
|
||||
PageContent.SongPage(song, 1)
|
||||
),
|
||||
tocEntries = emptyList()
|
||||
)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
renderer.render(layout, config, baos)
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,231 @@
|
||||
package de.pfadfinder.songbook.renderer.pdf
|
||||
|
||||
import de.pfadfinder.songbook.model.FontSpec
|
||||
import io.kotest.matchers.floats.shouldBeGreaterThan
|
||||
import io.kotest.matchers.floats.shouldBeLessThan
|
||||
import io.kotest.matchers.shouldBe
|
||||
import io.kotest.matchers.types.shouldBeSameInstanceAs
|
||||
import kotlin.test.Test
|
||||
import kotlin.test.assertFailsWith
|
||||
|
||||
class PdfFontMetricsTest {
|
||||
|
||||
private val metrics = PdfFontMetrics()
|
||||
|
||||
@Test
|
||||
fun `getBaseFont returns Helvetica for default font spec`() {
|
||||
val font = FontSpec(family = "Helvetica", size = 10f)
|
||||
val baseFont = metrics.getBaseFont(font)
|
||||
// Helvetica built-in returns a non-null BaseFont
|
||||
baseFont.postscriptFontName shouldBe "Helvetica"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `getBaseFont returns Courier for courier family`() {
|
||||
val font = FontSpec(family = "Courier", size = 10f)
|
||||
val baseFont = metrics.getBaseFont(font)
|
||||
baseFont.postscriptFontName shouldBe "Courier"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `getBaseFont returns Times-Roman for times family`() {
|
||||
val font = FontSpec(family = "Times", size = 10f)
|
||||
val baseFont = metrics.getBaseFont(font)
|
||||
baseFont.postscriptFontName shouldBe "Times-Roman"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `getBaseFont returns Times-Roman for times new roman family`() {
|
||||
val font = FontSpec(family = "Times New Roman", size = 10f)
|
||||
val baseFont = metrics.getBaseFont(font)
|
||||
baseFont.postscriptFontName shouldBe "Times-Roman"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `getBaseFont falls back to Helvetica for unknown family`() {
|
||||
val font = FontSpec(family = "UnknownFont", size = 10f)
|
||||
val baseFont = metrics.getBaseFont(font)
|
||||
baseFont.postscriptFontName shouldBe "Helvetica"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `getBaseFont caches fonts by family name`() {
|
||||
val font = FontSpec(family = "Helvetica", size = 10f)
|
||||
val first = metrics.getBaseFont(font)
|
||||
val second = metrics.getBaseFont(font)
|
||||
first shouldBeSameInstanceAs second
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `getBaseFontBold returns Helvetica-Bold for Helvetica`() {
|
||||
val font = FontSpec(family = "Helvetica", size = 10f)
|
||||
val boldFont = metrics.getBaseFontBold(font)
|
||||
boldFont.postscriptFontName shouldBe "Helvetica-Bold"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `getBaseFontBold returns Courier-Bold for Courier`() {
|
||||
val font = FontSpec(family = "Courier", size = 10f)
|
||||
val boldFont = metrics.getBaseFontBold(font)
|
||||
boldFont.postscriptFontName shouldBe "Courier-Bold"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `getBaseFontBold returns Times-Bold for Times`() {
|
||||
val font = FontSpec(family = "Times", size = 10f)
|
||||
val boldFont = metrics.getBaseFontBold(font)
|
||||
boldFont.postscriptFontName shouldBe "Times-Bold"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `getBaseFontBold falls back to Helvetica-Bold for unknown family`() {
|
||||
val font = FontSpec(family = "UnknownFont", size = 10f)
|
||||
val boldFont = metrics.getBaseFontBold(font)
|
||||
boldFont.postscriptFontName shouldBe "Helvetica-Bold"
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `getBaseFontBold returns regular font when file is specified`() {
|
||||
// When a file is specified, bold should return the same as regular
|
||||
// (custom fonts don't have bold variants auto-resolved)
|
||||
// We can't test with a real file here, but verify the logic path:
|
||||
// file != null -> delegates to getBaseFont
|
||||
// Since we don't have a real font file, we test with family-based fonts
|
||||
val font = FontSpec(family = "Helvetica", size = 10f)
|
||||
val bold1 = metrics.getBaseFontBold(font)
|
||||
val bold2 = metrics.getBaseFontBold(font)
|
||||
bold1 shouldBeSameInstanceAs bold2
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `measureTextWidth returns positive value for non-empty text`() {
|
||||
val font = FontSpec(family = "Helvetica", size = 10f)
|
||||
val width = metrics.measureTextWidth("Hello World", font, 10f)
|
||||
width shouldBeGreaterThan 0f
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `measureTextWidth returns zero for empty text`() {
|
||||
val font = FontSpec(family = "Helvetica", size = 10f)
|
||||
val width = metrics.measureTextWidth("", font, 10f)
|
||||
width shouldBe 0f
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `measureTextWidth wider text returns larger width`() {
|
||||
val font = FontSpec(family = "Helvetica", size = 10f)
|
||||
val shortWidth = metrics.measureTextWidth("Hi", font, 10f)
|
||||
val longWidth = metrics.measureTextWidth("Hello World, this is longer", font, 10f)
|
||||
longWidth shouldBeGreaterThan shortWidth
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `measureTextWidth scales with font size`() {
|
||||
val font = FontSpec(family = "Helvetica", size = 10f)
|
||||
val smallWidth = metrics.measureTextWidth("Test", font, 10f)
|
||||
val largeWidth = metrics.measureTextWidth("Test", font, 20f)
|
||||
largeWidth shouldBeGreaterThan smallWidth
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `measureTextWidth returns value in mm`() {
|
||||
val font = FontSpec(family = "Helvetica", size = 10f)
|
||||
val width = metrics.measureTextWidth("M", font, 10f)
|
||||
// A single 'M' at 10pt should be roughly 2-4mm
|
||||
width shouldBeGreaterThan 1f
|
||||
width shouldBeLessThan 10f
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `measureLineHeight returns positive value`() {
|
||||
val font = FontSpec(family = "Helvetica", size = 10f)
|
||||
val height = metrics.measureLineHeight(font, 10f)
|
||||
height shouldBeGreaterThan 0f
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `measureLineHeight scales with font size`() {
|
||||
val font = FontSpec(family = "Helvetica", size = 10f)
|
||||
val smallHeight = metrics.measureLineHeight(font, 10f)
|
||||
val largeHeight = metrics.measureLineHeight(font, 20f)
|
||||
largeHeight shouldBeGreaterThan smallHeight
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `measureLineHeight returns value in mm`() {
|
||||
val font = FontSpec(family = "Helvetica", size = 10f)
|
||||
val height = metrics.measureLineHeight(font, 10f)
|
||||
// 10pt * 1.2 * 0.3528 = ~4.23mm
|
||||
height shouldBeGreaterThan 3f
|
||||
height shouldBeLessThan 6f
|
||||
}
|
||||
|
||||
// --- Custom font file tests ---
|
||||
|
||||
private val testFontPath: String
|
||||
get() = this::class.java.getResource("/TestFont.ttf")!!.file
|
||||
|
||||
@Test
|
||||
fun `getBaseFont loads custom font from file path`() {
|
||||
val font = FontSpec(file = testFontPath, size = 12f)
|
||||
val baseFont = metrics.getBaseFont(font)
|
||||
// Custom font should load successfully and have a non-null PostScript name
|
||||
baseFont.postscriptFontName.isNotEmpty() shouldBe true
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `getBaseFont caches custom font by canonical path`() {
|
||||
val font1 = FontSpec(file = testFontPath, size = 12f)
|
||||
val font2 = FontSpec(file = testFontPath, size = 14f) // different size, same file
|
||||
val first = metrics.getBaseFont(font1)
|
||||
val second = metrics.getBaseFont(font2)
|
||||
first shouldBeSameInstanceAs second
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `getBaseFont throws for missing font file`() {
|
||||
val font = FontSpec(file = "/nonexistent/path/MissingFont.ttf", size = 12f)
|
||||
assertFailsWith<IllegalArgumentException> {
|
||||
metrics.getBaseFont(font)
|
||||
}
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `getBaseFontBold returns same font when file is specified`() {
|
||||
val font = FontSpec(file = testFontPath, size = 12f)
|
||||
val regular = metrics.getBaseFont(font)
|
||||
val bold = metrics.getBaseFontBold(font)
|
||||
// Custom fonts don't have auto-resolved bold variants
|
||||
regular shouldBeSameInstanceAs bold
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `measureTextWidth works with custom font file`() {
|
||||
val font = FontSpec(file = testFontPath, size = 12f)
|
||||
val width = metrics.measureTextWidth("Hello World", font, 12f)
|
||||
width shouldBeGreaterThan 0f
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `measureTextWidth handles German umlauts with custom font`() {
|
||||
val font = FontSpec(file = testFontPath, size = 12f)
|
||||
// These should not throw and should return positive widths
|
||||
val umlautWidth = metrics.measureTextWidth("\u00e4\u00f6\u00fc\u00df", font, 12f)
|
||||
umlautWidth shouldBeGreaterThan 0f
|
||||
|
||||
// Full German words with umlauts
|
||||
val wordWidth = metrics.measureTextWidth("Gr\u00fc\u00dfe aus \u00d6sterreich", font, 12f)
|
||||
wordWidth shouldBeGreaterThan 0f
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `measureTextWidth with custom font returns different width than built-in font`() {
|
||||
val customFont = FontSpec(file = testFontPath, size = 10f)
|
||||
val builtInFont = FontSpec(family = "Courier", size = 10f) // use Courier for contrast
|
||||
val customWidth = metrics.measureTextWidth("Test text", customFont, 10f)
|
||||
val builtInWidth = metrics.measureTextWidth("Test text", builtInFont, 10f)
|
||||
// They should both be positive but likely different
|
||||
customWidth shouldBeGreaterThan 0f
|
||||
builtInWidth shouldBeGreaterThan 0f
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,124 @@
|
||||
package de.pfadfinder.songbook.renderer.pdf
|
||||
|
||||
import com.lowagie.text.Document
|
||||
import com.lowagie.text.PageSize
|
||||
import com.lowagie.text.pdf.PdfWriter
|
||||
import de.pfadfinder.songbook.model.*
|
||||
import io.kotest.matchers.ints.shouldBeGreaterThan
|
||||
import java.io.ByteArrayOutputStream
|
||||
import kotlin.test.Test
|
||||
|
||||
class TocRendererTest {
|
||||
|
||||
private val fontMetrics = PdfFontMetrics()
|
||||
private val config = BookConfig()
|
||||
private val renderer = TocRenderer(fontMetrics, config)
|
||||
|
||||
@Test
|
||||
fun `render creates TOC with entries`() {
|
||||
val baos = ByteArrayOutputStream()
|
||||
val document = Document(PageSize.A5)
|
||||
val writer = PdfWriter.getInstance(document, baos)
|
||||
document.open()
|
||||
|
||||
val entries = listOf(
|
||||
TocEntry(title = "Amazing Grace", pageNumber = 3),
|
||||
TocEntry(title = "Blowin' in the Wind", pageNumber = 5),
|
||||
TocEntry(title = "Country Roads", pageNumber = 7)
|
||||
)
|
||||
|
||||
renderer.render(document, writer, entries)
|
||||
document.close()
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render handles alias entries in italics`() {
|
||||
val baos = ByteArrayOutputStream()
|
||||
val document = Document(PageSize.A5)
|
||||
val writer = PdfWriter.getInstance(document, baos)
|
||||
document.open()
|
||||
|
||||
val entries = listOf(
|
||||
TocEntry(title = "Amazing Grace", pageNumber = 3),
|
||||
TocEntry(title = "Grace (Amazing)", pageNumber = 3, isAlias = true)
|
||||
)
|
||||
|
||||
renderer.render(document, writer, entries)
|
||||
document.close()
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render includes reference book columns`() {
|
||||
val configWithRefs = BookConfig(
|
||||
referenceBooks = listOf(
|
||||
ReferenceBook(id = "mundorgel", name = "Mundorgel", abbreviation = "MO"),
|
||||
ReferenceBook(id = "pfadfinder", name = "Pfadfinderliederbuch", abbreviation = "PL")
|
||||
)
|
||||
)
|
||||
val rendererWithRefs = TocRenderer(fontMetrics, configWithRefs)
|
||||
|
||||
val baos = ByteArrayOutputStream()
|
||||
val document = Document(PageSize.A5)
|
||||
val writer = PdfWriter.getInstance(document, baos)
|
||||
document.open()
|
||||
|
||||
val entries = listOf(
|
||||
TocEntry(
|
||||
title = "Amazing Grace",
|
||||
pageNumber = 3,
|
||||
references = mapOf("MO" to 42, "PL" to 15)
|
||||
),
|
||||
TocEntry(
|
||||
title = "Country Roads",
|
||||
pageNumber = 7,
|
||||
references = mapOf("MO" to 88)
|
||||
)
|
||||
)
|
||||
|
||||
rendererWithRefs.render(document, writer, entries)
|
||||
document.close()
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render sorts entries alphabetically`() {
|
||||
val baos = ByteArrayOutputStream()
|
||||
val document = Document(PageSize.A5)
|
||||
val writer = PdfWriter.getInstance(document, baos)
|
||||
document.open()
|
||||
|
||||
// Entries given out of order
|
||||
val entries = listOf(
|
||||
TocEntry(title = "Zzz Last", pageNumber = 10),
|
||||
TocEntry(title = "Aaa First", pageNumber = 1),
|
||||
TocEntry(title = "Mmm Middle", pageNumber = 5)
|
||||
)
|
||||
|
||||
renderer.render(document, writer, entries)
|
||||
document.close()
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
|
||||
@Test
|
||||
fun `render handles empty reference books list`() {
|
||||
val baos = ByteArrayOutputStream()
|
||||
val document = Document(PageSize.A5)
|
||||
val writer = PdfWriter.getInstance(document, baos)
|
||||
document.open()
|
||||
|
||||
val entries = listOf(
|
||||
TocEntry(title = "Test Song", pageNumber = 1)
|
||||
)
|
||||
|
||||
renderer.render(document, writer, entries)
|
||||
document.close()
|
||||
|
||||
baos.size() shouldBeGreaterThan 0
|
||||
}
|
||||
}
|
||||
BIN
renderer-pdf/src/test/resources/TestFont.ttf
Normal file
BIN
renderer-pdf/src/test/resources/TestFont.ttf
Normal file
Binary file not shown.
25
settings.gradle.kts
Normal file
25
settings.gradle.kts
Normal file
@@ -0,0 +1,25 @@
|
||||
rootProject.name = "songbook"
|
||||
|
||||
pluginManagement {
|
||||
repositories {
|
||||
gradlePluginPortal()
|
||||
maven("https://maven.pkg.jetbrains.space/public/p/compose/dev")
|
||||
google()
|
||||
}
|
||||
}
|
||||
|
||||
dependencyResolutionManagement {
|
||||
repositories {
|
||||
mavenCentral()
|
||||
maven("https://maven.pkg.jetbrains.space/public/p/compose/dev")
|
||||
google()
|
||||
}
|
||||
}
|
||||
|
||||
include("model")
|
||||
include("parser")
|
||||
include("layout")
|
||||
include("renderer-pdf")
|
||||
include("app")
|
||||
include("cli")
|
||||
include("gui")
|
||||
@@ -1,242 +0,0 @@
|
||||
\NeedsTeXFormat{LaTeX2e}
|
||||
\ProvidesPackage{songbook-style}[2026/04/01 Pfadfinder Liederbuch Style]
|
||||
|
||||
% --- Core packages ---
|
||||
\RequirePackage{fontspec}
|
||||
\RequirePackage[ngerman]{babel}
|
||||
\RequirePackage[
|
||||
a5paper,
|
||||
top=15mm,
|
||||
bottom=20mm,
|
||||
inner=20mm,
|
||||
outer=12mm
|
||||
]{geometry}
|
||||
\RequirePackage[hidelinks]{hyperref}
|
||||
\RequirePackage{fancyhdr}
|
||||
\RequirePackage{xcolor}
|
||||
\RequirePackage{longtable}
|
||||
\RequirePackage{array}
|
||||
\RequirePackage{colortbl}
|
||||
\RequirePackage{rotating}
|
||||
\RequirePackage{graphicx}
|
||||
\RequirePackage{csquotes}
|
||||
\RequirePackage[minimal]{leadsheets}
|
||||
\ExplSyntaxOn
|
||||
\cs_new:cpn {leadsheets-library-musicsymbols-loaded} {}
|
||||
\ExplSyntaxOff
|
||||
\useleadsheetslibraries{chordnames,chords,shorthands,properties,templates,translations,songs}
|
||||
|
||||
% --- Font setup ---
|
||||
\setmainfont{TeX Gyre Heros}
|
||||
\newfontfamily\frakfont{UnifrakturMaguntia-Book}[Path=fonts/,Extension=.ttf]
|
||||
|
||||
% --- Colors ---
|
||||
\definecolor{tocrowgray}{gray}{0.92}
|
||||
\definecolor{tocheadgray}{gray}{0.75}
|
||||
|
||||
% --- Page style ---
|
||||
\pagestyle{fancy}
|
||||
\fancyhf{}
|
||||
\fancyfoot[LE]{\large\bfseries\thepage}
|
||||
\fancyfoot[RO]{\large\bfseries\thepage}
|
||||
\renewcommand{\headrulewidth}{0pt}
|
||||
\renewcommand{\footrulewidth}{0pt}
|
||||
|
||||
% --- Custom song properties ---
|
||||
\definesongproperty{alias}
|
||||
\definesongproperty{note}
|
||||
\definesongproperty{mundorgel}
|
||||
\definesongproperty{pfadfinderliederbuch}
|
||||
|
||||
% --- leadsheets settings ---
|
||||
\setleadsheets{
|
||||
title-template = songbook,
|
||||
verse/numbered = false,
|
||||
verse/named = false,
|
||||
chorus/named = false,
|
||||
chorus/numbered = false,
|
||||
after-song = \songendsection,
|
||||
}
|
||||
|
||||
\setchords{
|
||||
format = \small,
|
||||
}
|
||||
|
||||
% ==========================================================================
|
||||
% Song TOC matrix
|
||||
% ==========================================================================
|
||||
|
||||
\newcounter{songnumber}
|
||||
\newcounter{tocrowcount}
|
||||
|
||||
\ExplSyntaxOn
|
||||
\iow_new:N \g__sb_toc_iow
|
||||
\tl_new:N \l__sb_title_tl
|
||||
\tl_new:N \l__sb_mo_tl
|
||||
\tl_new:N \l__sb_pflb_tl
|
||||
\tl_new:N \l__sb_num_tl
|
||||
\tl_new:N \l__sb_songid_tl
|
||||
\bool_new:N \g__sb_toc_opened_bool
|
||||
\seq_new:N \g__sb_written_seq
|
||||
|
||||
% Lazy-open: only truncate the file when first song writes to it
|
||||
% This ensures the TOC reads the PREVIOUS run's data before truncation
|
||||
\cs_new_protected:Npn \__sb_ensure_toc_open:
|
||||
{
|
||||
\bool_if:NF \g__sb_toc_opened_bool
|
||||
{
|
||||
\iow_open:Nn \g__sb_toc_iow { \c_sys_jobname_str .songtoc }
|
||||
\bool_gset_true:N \g__sb_toc_opened_bool
|
||||
}
|
||||
}
|
||||
|
||||
\AtEndDocument{
|
||||
\bool_if:NT \g__sb_toc_opened_bool
|
||||
{ \iow_close:N \g__sb_toc_iow }
|
||||
}
|
||||
|
||||
\cs_new_protected:Npn \writesongtoc
|
||||
{
|
||||
% Use leadsheets song ID to skip duplicate calls (measurement pass)
|
||||
\tl_set:NV \l__sb_songid_tl \l_leadsheets_current_song_id_tl
|
||||
\seq_if_in:NVF \g__sb_written_seq \l__sb_songid_tl
|
||||
{
|
||||
\seq_gput_right:NV \g__sb_written_seq \l__sb_songid_tl
|
||||
\__sb_ensure_toc_open:
|
||||
\stepcounter{songnumber}
|
||||
\tl_set:Nx \l__sb_num_tl { \int_use:N \c@songnumber }
|
||||
\tl_set:Nx \l__sb_title_tl { \songproperty{title} }
|
||||
\tl_set:Nx \l__sb_mo_tl { \songproperty{mundorgel} }
|
||||
\tl_set:Nx \l__sb_pflb_tl { \songproperty{pfadfinderliederbuch} }
|
||||
\iow_now:Nx \g__sb_toc_iow
|
||||
{
|
||||
\exp_not:N \songtocrow
|
||||
{ \l__sb_title_tl }
|
||||
{ \l__sb_mo_tl }
|
||||
{ \l__sb_pflb_tl }
|
||||
{ \exp_not:N \pageref { song: \l__sb_num_tl } }
|
||||
}
|
||||
}
|
||||
% Label MUST be outside guard: measurement pass label is discarded (inside vbox),
|
||||
% but the real pass label survives and gets written to .aux
|
||||
\tl_set:Nx \l__sb_num_tl { \int_use:N \c@songnumber }
|
||||
\label{song:\tl_use:N \l__sb_num_tl}
|
||||
}
|
||||
\ExplSyntaxOff
|
||||
|
||||
% --- Render one TOC row ---
|
||||
\newcommand{\songtocrow}[4]{%
|
||||
#1 & #2 & #3 & \cellcolor{tocheadgray}\textbf{#4} \\
|
||||
\hline
|
||||
}
|
||||
|
||||
% --- Rotated column header ---
|
||||
\newcommand{\rotheader}[1]{%
|
||||
\begin{turn}{70}\footnotesize\textbf{#1}\end{turn}%
|
||||
}
|
||||
|
||||
% --- Print the song TOC table ---
|
||||
\newcommand{\printsongtoc}{%
|
||||
\thispagestyle{fancy}%
|
||||
{\Large\bfseries Inhaltsverzeichnis\par}%
|
||||
\vspace{5mm}%
|
||||
\footnotesize
|
||||
\rowcolors{2}{tocrowgray}{white}%
|
||||
\begin{longtable}{%
|
||||
>{\raggedright\arraybackslash}p{0.52\textwidth}|%
|
||||
>{\centering\arraybackslash}p{0.10\textwidth}|%
|
||||
>{\centering\arraybackslash}p{0.10\textwidth}|%
|
||||
>{\centering\arraybackslash\columncolor{tocheadgray}}p{0.12\textwidth}%
|
||||
}
|
||||
& \rotheader{MO} & \rotheader{PfLB}
|
||||
& \rotheader{\normalsize Lieder-\newline\normalsize buch} \\
|
||||
\hline
|
||||
\endfirsthead
|
||||
& \rotheader{MO} & \rotheader{PfLB}
|
||||
& \rotheader{\normalsize Lieder-\newline\normalsize buch} \\
|
||||
\hline
|
||||
\endhead
|
||||
\InputIfFileExists{\jobname.songtoc}{}{}%
|
||||
\end{longtable}%
|
||||
}
|
||||
|
||||
% ==========================================================================
|
||||
% Song end section
|
||||
% ==========================================================================
|
||||
|
||||
\newcommand{\songendsection}{%
|
||||
\vfill
|
||||
\ifsongproperty{note}{%
|
||||
{\footnotesize\songproperty{note}\par\smallskip}%
|
||||
}{}%
|
||||
\begingroup\footnotesize
|
||||
\ifsongproperty{lyrics}{%
|
||||
\ifsongproperty{composer}{%
|
||||
Worte: \songproperty{lyrics}\par
|
||||
Weise: \songproperty{composer}\par
|
||||
}{%
|
||||
Worte und Weise: \songproperty{lyrics}\par
|
||||
}%
|
||||
}{%
|
||||
\ifsongproperty{composer}{%
|
||||
Weise: \songproperty{composer}\par
|
||||
}{}%
|
||||
}%
|
||||
\endgroup
|
||||
\vspace{3mm}%
|
||||
\begingroup\footnotesize\centering
|
||||
\begin{tabular}{ccc}
|
||||
MO & PfLB & Liederbuch \\
|
||||
\ifsongproperty{mundorgel}{\songproperty{mundorgel}}{} &
|
||||
\ifsongproperty{pfadfinderliederbuch}{\songproperty{pfadfinderliederbuch}}{} &
|
||||
\thepage
|
||||
\end{tabular}\par
|
||||
\endgroup
|
||||
\newpage
|
||||
}
|
||||
|
||||
% ==========================================================================
|
||||
% Song title template
|
||||
% ==========================================================================
|
||||
|
||||
\definesongtitletemplate{songbook}{%
|
||||
{\LARGE\frakfont\songproperty{title}\par}%
|
||||
\writesongtoc
|
||||
\vspace{4mm}%
|
||||
}
|
||||
|
||||
% ==========================================================================
|
||||
% Image placement
|
||||
% ==========================================================================
|
||||
|
||||
% Full-page filler image (centered, scaled to fit, own page)
|
||||
% Usage: \fillerpage{images/drawing.png}
|
||||
\newcommand{\fillerpage}[1]{%
|
||||
\clearpage
|
||||
\thispagestyle{empty}%
|
||||
\vspace*{\fill}%
|
||||
\begin{center}%
|
||||
\includegraphics[width=0.85\textwidth,height=0.85\textheight,keepaspectratio]{#1}%
|
||||
\end{center}%
|
||||
\vspace*{\fill}%
|
||||
\clearpage
|
||||
}
|
||||
|
||||
% Inline image within a page (e.g., at end of a song with remaining space)
|
||||
% Usage: \songimage{images/landscape.png}
|
||||
\newcommand{\songimage}[1]{%
|
||||
\begin{center}%
|
||||
\includegraphics[width=0.8\textwidth,keepaspectratio]{#1}%
|
||||
\end{center}%
|
||||
}
|
||||
|
||||
% Full-page image with no margins (bleeds to edges)
|
||||
% Usage: \fullpageimage{images/cover.png}
|
||||
\newcommand{\fullpageimage}[1]{%
|
||||
\clearpage
|
||||
\thispagestyle{empty}%
|
||||
\newgeometry{margin=0pt}%
|
||||
\noindent\includegraphics[width=\paperwidth,height=\paperheight]{#1}%
|
||||
\restoregeometry
|
||||
\clearpage
|
||||
}
|
||||
61
songbook.tex
61
songbook.tex
@@ -1,61 +0,0 @@
|
||||
% songbook.tex - Pfadfinder Liederbuch
|
||||
\documentclass[a5paper, 10pt, twoside]{article}
|
||||
|
||||
\usepackage{songbook-style}
|
||||
|
||||
\begin{document}
|
||||
|
||||
% --- Title page ---
|
||||
\begin{titlepage}
|
||||
\centering
|
||||
\vspace*{3cm}
|
||||
{\Huge\bfseries Pfadfinder Liederbuch\par}
|
||||
\vspace{1cm}
|
||||
{\Large Beispiel-Ausgabe\par}
|
||||
\vspace{2cm}
|
||||
{\large 1. Auflage, 2026\par}
|
||||
\vfill
|
||||
\end{titlepage}
|
||||
|
||||
% --- Foreword / Introductory page ---
|
||||
\thispagestyle{empty}
|
||||
{\large\bfseries\itshape
|
||||
\enquote{Das Volkslied ist nun einmal da --, daran k\"onnen wir nicht
|
||||
vorbei -- es ergreift uns stark und tief, und die Antwort auf
|
||||
das Warum? bleiben wir schuldig.}
|
||||
\par}
|
||||
\vspace{2mm}
|
||||
\noindent\rule{\textwidth}{0.4pt}
|
||||
\vspace{4mm}
|
||||
|
||||
\small
|
||||
So hei\ss t es im Vorwort des wohl bekanntesten Liederbuchs
|
||||
in der Jugendbewegung, dem \textit{Zupfgeigenhansl}, aus dem Jahr 1913.
|
||||
|
||||
Und auch wir erleben auf Fahrt und Lager immer wieder die Kraft des
|
||||
gemeinsamen Singens. Mit diesem Liederbuch haben wir eine Auswahl
|
||||
an Liedern aus unterschiedlichen Quellen zusammengetragen.
|
||||
|
||||
Singen verbindet uns, macht Freude und ist ein entscheidendes Element
|
||||
unserer Lager und Fahrt.
|
||||
|
||||
\vspace{5mm}
|
||||
Herzlichst Gut Pfad
|
||||
|
||||
\clearpage
|
||||
|
||||
% --- Table of Contents ---
|
||||
\printsongtoc
|
||||
\clearpage
|
||||
|
||||
% --- Filler images can be placed between songs ---
|
||||
% Example: \fillerpage{images/drawing.png}
|
||||
|
||||
% --- Songs (alphabetical) ---
|
||||
\input{songs/abend-wird-es-wieder}
|
||||
\input{songs/auf-auf-zum-froehlichen-jagen}
|
||||
\input{songs/die-gedanken-sind-frei}
|
||||
\input{songs/hejo-spann-den-wagen-an}
|
||||
\input{songs/kein-schoener-land}
|
||||
|
||||
\end{document}
|
||||
45
songbook.yaml
Normal file
45
songbook.yaml
Normal file
@@ -0,0 +1,45 @@
|
||||
book:
|
||||
title: "Pfadfinder Liederbuch"
|
||||
subtitle: "Beispiel-Ausgabe"
|
||||
edition: "1. Auflage, 2026"
|
||||
format: A5
|
||||
|
||||
songs:
|
||||
directory: "./songs"
|
||||
order: alphabetical
|
||||
|
||||
fonts:
|
||||
lyrics: { family: "Helvetica", size: 10 }
|
||||
chords: { family: "Helvetica", size: 9, color: "#333333" }
|
||||
title: { family: "Helvetica", size: 14 }
|
||||
metadata: { family: "Helvetica", size: 8 }
|
||||
toc: { family: "Helvetica", size: 9 }
|
||||
# To use a custom font file (e.g. Fraktur/Blackletter for titles):
|
||||
# title: { file: "./fonts/FrakturFont.ttf", size: 16 }
|
||||
# The file path is relative to the project directory.
|
||||
# Supported formats: .ttf, .otf
|
||||
# Custom fonts are embedded in the PDF and support Unicode (including umlauts).
|
||||
|
||||
layout:
|
||||
margins: { top: 15, bottom: 15, inner: 20, outer: 12 }
|
||||
chord_line_spacing: 1
|
||||
verse_spacing: 6
|
||||
page_number_position: bottom-outer
|
||||
|
||||
images:
|
||||
directory: "./images"
|
||||
|
||||
reference_books:
|
||||
- id: mundorgel
|
||||
name: "Mundorgel"
|
||||
abbreviation: "MO"
|
||||
- id: pfadfinderliederbuch
|
||||
name: "Pfadfinderliederbuch"
|
||||
abbreviation: "PfLB"
|
||||
|
||||
toc:
|
||||
highlight_column: "Seite"
|
||||
|
||||
output:
|
||||
directory: "./output"
|
||||
filename: "liederbuch.pdf"
|
||||
27
songs/abend-wird-es-wieder.chopro
Normal file
27
songs/abend-wird-es-wieder.chopro
Normal file
@@ -0,0 +1,27 @@
|
||||
{title: Abend wird es wieder}
|
||||
{lyricist: Christian Gottlob Barth, 1836}
|
||||
{composer: Volksweise}
|
||||
{key: C}
|
||||
{tags: Abendlied}
|
||||
{ref: pfadfinderliederbuch 12}
|
||||
|
||||
{start_of_verse: Strophe 1}
|
||||
[C]Abend wird es [G]wieder,
|
||||
[G]über Wald und [C]Feld
|
||||
säuselt [F]Frieden [C]nieder,
|
||||
und es [G]ruht die [C]Welt.
|
||||
{end_of_verse}
|
||||
|
||||
{start_of_verse: Strophe 2}
|
||||
[C]Nur der Bach er[G]gießet
|
||||
[G]sich am Felsen [C]dort,
|
||||
und er [F]braust und [C]fließet
|
||||
immer, [G]immer [C]fort.
|
||||
{end_of_verse}
|
||||
|
||||
{start_of_verse: Strophe 3}
|
||||
[C]Und kein Abend [G]bringet
|
||||
[G]Frieden ihm und [C]Ruh,
|
||||
keine [F]Glocke [C]klinget
|
||||
ihm ein [G]Rastlied [C]zu.
|
||||
{end_of_verse}
|
||||
@@ -1,31 +0,0 @@
|
||||
\begin{song}{
|
||||
title = Abend wird es wieder,
|
||||
lyrics = {Christian Gottlob Barth, 1836},
|
||||
composer = Volksweise,
|
||||
key = C,
|
||||
tags = Abendlied,
|
||||
pfadfinderliederbuch = 12,
|
||||
}
|
||||
|
||||
\begin{verse}
|
||||
\chord{C}Abend wird es \chord{G}wieder, \\
|
||||
\chord{G}über Wald und \chord{C}Feld \\
|
||||
säuselt \chord{F}Frieden \chord{C}nieder, \\
|
||||
und es \chord{G}ruht die \chord{C}Welt.
|
||||
\end{verse}
|
||||
|
||||
\begin{verse}
|
||||
\chord{C}Nur der Bach er\chord{G}gießet \\
|
||||
\chord{G}sich am Felsen \chord{C}dort, \\
|
||||
und er \chord{F}braust und \chord{C}fließet \\
|
||||
immer, \chord{G}immer \chord{C}fort.
|
||||
\end{verse}
|
||||
|
||||
\begin{verse}
|
||||
\chord{C}Und kein Abend \chord{G}bringet \\
|
||||
\chord{G}Frieden ihm und \chord{C}Ruh, \\
|
||||
keine \chord{F}Glocke \chord{C}klinget \\
|
||||
ihm ein \chord{G}Rastlied \chord{C}zu.
|
||||
\end{verse}
|
||||
|
||||
\end{song}
|
||||
26
songs/auf-auf-zum-froehlichen-jagen.chopro
Normal file
26
songs/auf-auf-zum-froehlichen-jagen.chopro
Normal file
@@ -0,0 +1,26 @@
|
||||
{title: Auf, auf zum fröhlichen Jagen}
|
||||
{lyricist: Traditionell, 18. Jahrhundert}
|
||||
{composer: Volksweise}
|
||||
{key: F}
|
||||
{tags: Volkslied, Jagd}
|
||||
|
||||
{start_of_verse: Strophe 1}
|
||||
[F]Auf, auf zum fröhlichen [C]Jagen,
|
||||
auf [C]in die grüne [F]Heid'!
|
||||
Es [F]gibt nichts Schönres [Bb]auf Erden,
|
||||
als [C]jetzt zur Herbstes[F]zeit.
|
||||
{end_of_verse}
|
||||
|
||||
{start_of_chorus}
|
||||
Halli, hallo, halli, hallo,
|
||||
auf [C]in die grüne [F]Heid'!
|
||||
{end_of_chorus}
|
||||
|
||||
{start_of_verse: Strophe 2}
|
||||
[F]Der Hirsch, der springt im [C]Walde,
|
||||
das [C]Reh steht auf der [F]Flur,
|
||||
die [F]Vöglein singen [Bb]alle
|
||||
zur [C]schönen Jägerei[F]natur.
|
||||
{end_of_verse}
|
||||
|
||||
{chorus}
|
||||
@@ -1,29 +0,0 @@
|
||||
\begin{song}{
|
||||
title = {Auf, auf zum fröhlichen Jagen},
|
||||
lyrics = {Traditionell, 18. Jahrhundert},
|
||||
composer = Volksweise,
|
||||
key = F,
|
||||
tags = {Volkslied, Jagd},
|
||||
}
|
||||
|
||||
\begin{verse}
|
||||
\chord{F}Auf, auf zum fröhlichen \chord{C}Jagen, \\
|
||||
auf \chord{C}in die grüne \chord{F}Heid'! \\
|
||||
Es \chord{F}gibt nichts Schönres \chord{Bb}auf Erden, \\
|
||||
als \chord{C}jetzt zur Herbstes\chord{F}zeit.
|
||||
\end{verse}
|
||||
|
||||
\begin{verse*}
|
||||
Ref.: \\
|
||||
Halli, hallo, halli, hallo, \\
|
||||
auf \chord{C}in die grüne \chord{F}Heid'!
|
||||
\end{verse*}
|
||||
|
||||
\begin{verse}
|
||||
\chord{F}Der Hirsch, der springt im \chord{C}Walde, \\
|
||||
das \chord{C}Reh steht auf der \chord{F}Flur, \\
|
||||
die \chord{F}Vöglein singen \chord{Bb}alle \\
|
||||
zur \chord{C}schönen Jägerei\chord{F}natur.
|
||||
\end{verse}
|
||||
|
||||
\end{song}
|
||||
42
songs/die-gedanken-sind-frei.chopro
Normal file
42
songs/die-gedanken-sind-frei.chopro
Normal file
@@ -0,0 +1,42 @@
|
||||
{title: Die Gedanken sind frei}
|
||||
{alias: Gedankenfreiheit}
|
||||
{lyricist: Deutsches Volkslied}
|
||||
{composer: Deutsches Volkslied, ca. 1810}
|
||||
{key: G}
|
||||
{tags: Volkslied, Freiheit}
|
||||
{note: Eines der bekanntesten deutschen Volkslieder. Text erstmals 1780.}
|
||||
{ref: mundorgel 42}
|
||||
{ref: pfadfinderliederbuch 118}
|
||||
|
||||
{start_of_verse: Strophe 1}
|
||||
Die Ge[G]danken sind [D]frei,
|
||||
wer [D]kann sie er[G]raten?
|
||||
Sie [G]fliehen vor[C]bei
|
||||
wie [D]nächtliche [G]Schatten.
|
||||
Kein [C]Mensch kann sie [G]wissen,
|
||||
kein [Am]Jäger er[D]schießen.
|
||||
Es [G]bleibet da[C]bei:
|
||||
Die Ge[D]danken sind [G]frei!
|
||||
{end_of_verse}
|
||||
|
||||
{start_of_verse: Strophe 2}
|
||||
Ich [G]denke, was ich [D]will
|
||||
und [D]was mich be[G]glücket,
|
||||
doch [G]alles in der [C]Still',
|
||||
und [D]wie es sich [G]schicket.
|
||||
Mein [C]Wunsch und Be[G]gehren
|
||||
kann [Am]niemand ver[D]wehren,
|
||||
es [G]bleibet da[C]bei:
|
||||
Die Ge[D]danken sind [G]frei!
|
||||
{end_of_verse}
|
||||
|
||||
{start_of_verse: Strophe 3}
|
||||
Und [G]sperrt man mich [D]ein
|
||||
im [D]finsteren [G]Kerker,
|
||||
das [G]alles sind rein [C]
|
||||
ver[D]gebliche [G]Werke.
|
||||
Denn [C]meine Ge[G]danken
|
||||
zer[Am]reißen die [D]Schranken
|
||||
und [G]Mauern ent[C]zwei:
|
||||
Die Ge[D]danken sind [G]frei!
|
||||
{end_of_verse}
|
||||
@@ -1,46 +0,0 @@
|
||||
\begin{song}{
|
||||
title = Die Gedanken sind frei,
|
||||
alias = Gedankenfreiheit,
|
||||
lyrics = Deutsches Volkslied,
|
||||
composer = {Deutsches Volkslied, ca. 1810},
|
||||
key = G,
|
||||
tags = {Volkslied, Freiheit},
|
||||
note = {Eines der bekanntesten deutschen Volkslieder. Text erstmals 1780.},
|
||||
mundorgel = 42,
|
||||
pfadfinderliederbuch = 118,
|
||||
}
|
||||
|
||||
\begin{verse}
|
||||
Die Ge\chord{G}danken sind \chord{D}frei, \\
|
||||
wer \chord{D}kann sie er\chord{G}raten? \\
|
||||
Sie \chord{G}fliehen vor\chord{C}bei \\
|
||||
wie \chord{D}nächtliche \chord{G}Schatten. \\
|
||||
Kein \chord{C}Mensch kann sie \chord{G}wissen, \\
|
||||
kein \chord{Am}Jäger er\chord{D}schießen. \\
|
||||
Es \chord{G}bleibet da\chord{C}bei: \\
|
||||
Die Ge\chord{D}danken sind \chord{G}frei!
|
||||
\end{verse}
|
||||
|
||||
\begin{verse}
|
||||
Ich \chord{G}denke, was ich \chord{D}will \\
|
||||
und \chord{D}was mich be\chord{G}glücket, \\
|
||||
doch \chord{G}alles in der \chord{C}Still', \\
|
||||
und \chord{D}wie es sich \chord{G}schicket. \\
|
||||
Mein \chord{C}Wunsch und Be\chord{G}gehren \\
|
||||
kann \chord{Am}niemand ver\chord{D}wehren, \\
|
||||
es \chord{G}bleibet da\chord{C}bei: \\
|
||||
Die Ge\chord{D}danken sind \chord{G}frei!
|
||||
\end{verse}
|
||||
|
||||
\begin{verse}
|
||||
Und \chord{G}sperrt man mich \chord{D}ein \\
|
||||
im \chord{D}finsteren \chord{G}Kerker, \\
|
||||
das \chord{G}alles sind rein \\
|
||||
\chord{C}ver- \chord{D}gebliche \chord{G}Werke. \\
|
||||
Denn \chord{C}meine Ge\chord{G}danken \\
|
||||
zer\chord{Am}reißen die \chord{D}Schranken \\
|
||||
und \chord{G}Mauern ent\chord{C}zwei: \\
|
||||
Die Ge\chord{D}danken sind \chord{G}frei!
|
||||
\end{verse}
|
||||
|
||||
\end{song}
|
||||
18
songs/hejo-spann-den-wagen-an.chopro
Normal file
18
songs/hejo-spann-den-wagen-an.chopro
Normal file
@@ -0,0 +1,18 @@
|
||||
{title: Hejo, spann den Wagen an}
|
||||
{lyricist: Traditionell}
|
||||
{composer: Traditionell}
|
||||
{key: Am}
|
||||
{tags: Kanon, Fahrt}
|
||||
{ref: mundorgel 15}
|
||||
|
||||
{start_of_verse: Kanon}
|
||||
[Am]Hejo, spann den Wagen an,
|
||||
denn der [G]Wind treibt [Am]Regen übers Land.
|
||||
[Am]Hol die goldnen Garben rein,
|
||||
denn der [G]Wind treibt [Am]Regen übers Land.
|
||||
{end_of_verse}
|
||||
|
||||
{start_of_verse: 2. Stimme}
|
||||
[Am]Hejo, spann den Wagen an,
|
||||
denn der [G]Wind treibt [Am]Regen übers Land.
|
||||
{end_of_verse}
|
||||
@@ -1,24 +0,0 @@
|
||||
\begin{song}{
|
||||
title = {Hejo, spann den Wagen an},
|
||||
lyrics = Traditionell,
|
||||
composer = Traditionell,
|
||||
key = Am,
|
||||
tags = {Kanon, Fahrt},
|
||||
mundorgel = 15,
|
||||
}
|
||||
|
||||
\begin{verse*}
|
||||
Kanon: \\
|
||||
\chord{Am}Hejo, spann den Wagen an, \\
|
||||
denn der \chord{G}Wind treibt \chord{Am}Regen übers Land. \\
|
||||
\chord{Am}Hol die goldnen Garben rein, \\
|
||||
denn der \chord{G}Wind treibt \chord{Am}Regen übers Land.
|
||||
\end{verse*}
|
||||
|
||||
\begin{verse*}
|
||||
2. Stimme: \\
|
||||
\chord{Am}Hejo, spann den Wagen an, \\
|
||||
denn der \chord{G}Wind treibt \chord{Am}Regen übers Land.
|
||||
\end{verse*}
|
||||
|
||||
\end{song}
|
||||
33
songs/kein-schoener-land.chopro
Normal file
33
songs/kein-schoener-land.chopro
Normal file
@@ -0,0 +1,33 @@
|
||||
{title: Kein schöner Land}
|
||||
{alias: Kein schöner Land in dieser Zeit}
|
||||
{lyricist: Anton Wilhelm von Zuccalmaglio}
|
||||
{composer: Volksweise, 1840}
|
||||
{key: D}
|
||||
{tags: Volkslied, Abendlied}
|
||||
{note: Veröffentlicht 1840 in "Deutsche Volkslieder mit ihren Original-Weisen".}
|
||||
{ref: mundorgel 88}
|
||||
{ref: pfadfinderliederbuch 65}
|
||||
|
||||
{start_of_verse: Strophe 1}
|
||||
Kein [D]schöner Land in [A]dieser Zeit,
|
||||
als [A]hier das unsre [D]weit und breit,
|
||||
wo [D]wir uns [G]finden
|
||||
wohl [D]unter [A]Linden
|
||||
zur [D]Abend[A]zeit.
|
||||
{end_of_verse}
|
||||
|
||||
{start_of_verse: Strophe 2}
|
||||
Da [D]haben wir so [A]manche Stund'
|
||||
ge[A]sessen da in [D]froher Rund'
|
||||
und [D]taten [G]singen,
|
||||
die [D]Lieder [A]klingen
|
||||
im [D]Eichen[A]grund.
|
||||
{end_of_verse}
|
||||
|
||||
{start_of_verse: Strophe 3}
|
||||
Dass [D]wir uns hier in [A]diesem Tal
|
||||
noch [A]treffen so viel [D]hundertmal,
|
||||
Gott [D]mag es [G]schenken,
|
||||
Gott [D]mag es [A]lenken,
|
||||
er [D]hat die [A]Gnad'.
|
||||
{end_of_verse}
|
||||
@@ -1,37 +0,0 @@
|
||||
\begin{song}{
|
||||
title = Kein schöner Land,
|
||||
alias = {Kein schöner Land in dieser Zeit},
|
||||
lyrics = {Anton Wilhelm von Zuccalmaglio},
|
||||
composer = {Volksweise, 1840},
|
||||
key = D,
|
||||
tags = {Volkslied, Abendlied},
|
||||
note = {Veröffentlicht 1840 in ``Deutsche Volkslieder mit ihren Original-Weisen''.},
|
||||
mundorgel = 88,
|
||||
pfadfinderliederbuch = 65,
|
||||
}
|
||||
|
||||
\begin{verse}
|
||||
Kein \chord{D}schöner Land in \chord{A}dieser Zeit, \\
|
||||
als \chord{A}hier das unsre \chord{D}weit und breit, \\
|
||||
wo \chord{D}wir uns \chord{G}finden \\
|
||||
wohl \chord{D}unter \chord{A}Linden \\
|
||||
zur \chord{D}Abend- \chord{A}zeit.
|
||||
\end{verse}
|
||||
|
||||
\begin{verse}
|
||||
Da \chord{D}haben wir so \chord{A}manche Stund' \\
|
||||
ge\chord{A}sessen da in \chord{D}froher Rund' \\
|
||||
und \chord{D}taten \chord{G}singen, \\
|
||||
die \chord{D}Lieder \chord{A}klingen \\
|
||||
im \chord{D}Eichen- \chord{A}grund.
|
||||
\end{verse}
|
||||
|
||||
\begin{verse}
|
||||
Dass \chord{D}wir uns hier in \chord{A}diesem Tal \\
|
||||
noch \chord{A}treffen so viel \chord{D}hundertmal, \\
|
||||
Gott \chord{D}mag es \chord{G}schenken, \\
|
||||
Gott \chord{D}mag es \chord{A}lenken, \\
|
||||
er \chord{D}hat die \chord{A}Gnad'.
|
||||
\end{verse}
|
||||
|
||||
\end{song}
|
||||
Reference in New Issue
Block a user